/* ==== bootstrap.css ==== */
@charset "UTF-8";/*!
 * Bootstrap  v5.2.3 (https://getbootstrap.com/)
 * Copyright 2011-2022 The Bootstrap Authors
 * Copyright 2011-2022 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */:root{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-body-color-rgb:33,37,41;--bs-body-bg-rgb:255,255,255;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-bg:#fff;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-2xl:2rem;--bs-border-radius-pill:50rem;--bs-link-color:#0d6efd;--bs-link-hover-color:#0a58ca;--bs-code-color:#d63384;--bs-highlight-bg:#fff3cd}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:#6c757d;text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:textfield}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid var(--bs-border-color);border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:#6c757d}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:30px;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1200px}}.row{--bs-gutter-x:30px;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.6666666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color:var(--bs-body-color);--bs-table-bg:transparent;--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-body-color);--bs-table-striped-bg:rgba(0, 0, 0, 0.05);--bs-table-active-color:var(--bs-body-color);--bs-table-active-bg:rgba(0, 0, 0, 0.1);--bs-table-hover-color:var(--bs-body-color);--bs-table-hover-bg:rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;color:var(--bs-table-color);vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg)}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:2px solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-active{--bs-table-accent-bg:var(--bs-table-active-bg);color:var(--bs-table-active-color)}.table-hover>tbody>tr:hover>*{--bs-table-accent-bg:var(--bs-table-hover-bg);color:var(--bs-table-hover-color)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#bacbe6;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#cbccce;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#bcd0c7;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#badce3;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#e6dbb9;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#dfc2c4;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#dfe0e1;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#373b3e;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:#6c757d}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;-webkit-appearance:none;-moz-appearance:none;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled{background-color:#e9ecef;opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:#dde0e3}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + 2px)}textarea.form-control-sm{min-height:calc(1.5em + .5rem + 2px)}textarea.form-control-lg{min-height:calc(1.5em + 1rem + 2px)}.form-control-color{width:3rem;height:calc(1.5em + .75rem + 2px);padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:.375rem}.form-control-color::-webkit-color-swatch{border-radius:.375rem}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + 2px)}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + 2px)}.form-select{display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;-moz-padding-start:calc(0.75rem - 3px);font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #ced4da;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(0,0,0,.25);-webkit-appearance:none;-moz-appearance:none;appearance:none;-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{width:2em;margin-left:-2.5em;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}.form-range{width:100%;height:1.5rem;padding:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.form-range:disabled::-moz-range-thumb{background-color:#adb5bd}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + 2px);line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;width:100%;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:1px solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:-webkit-autofill~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.375rem}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:-1px;border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(25,135,84,.9);border-radius:.375rem}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:#198754;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:#198754}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:#198754}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:#198754}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.375rem}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:#dc3545}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:#dc3545}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:#dc3545}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:#212529;--bs-btn-bg:transparent;--bs-btn-border-width:1px;--bs-btn-border-color:transparent;--bs-btn-border-radius:0.375rem;--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:none;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:0.5rem}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:0.25rem}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:#212529;--bs-dropdown-bg:#fff;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:0.375rem;--bs-dropdown-border-width:1px;--bs-dropdown-inner-border-radius:calc(0.375rem - 1px);--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color:#212529;--bs-dropdown-link-hover-color:#1e2125;--bs-dropdown-link-hover-bg:#e9ecef;--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:#6c757d;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link.disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:1px;--bs-nav-tabs-border-color:#dee2e6;--bs-nav-tabs-border-radius:0.375rem;--bs-nav-tabs-link-hover-border-color:#e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color:#495057;--bs-nav-tabs-link-active-bg:#fff;--bs-nav-tabs-link-active-border-color:#dee2e6 #dee2e6 #fff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));background:0 0;border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.disabled,.nav-tabs .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:0.375rem;--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{background:0 0;border:0;border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(0, 0, 0, 0.55);--bs-navbar-hover-color:rgba(0, 0, 0, 0.7);--bs-navbar-disabled-color:rgba(0, 0, 0, 0.3);--bs-navbar-active-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-hover-color:rgba(0, 0, 0, 0.9);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(0, 0, 0, 0.1);--bs-navbar-toggler-border-radius:0.375rem;--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .show>.nav-link{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-border-width:1px;--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(0.375rem - 1px);--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(0, 0, 0, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:#fff;--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:#212529;--bs-accordion-bg:#fff;--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:1px;--bs-accordion-border-radius:0.375rem;--bs-accordion-inner-border-radius:calc(0.375rem - 1px);--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:#212529;--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230c63e4'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:#0c63e4;--bs-accordion-active-bg:#e7f1ff}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:#6c757d;--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:#6c757d;display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:#fff;--bs-pagination-border-width:1px;--bs-pagination-border-color:#dee2e6;--bs-pagination-border-radius:0.375rem;--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:#e9ecef;--bs-pagination-hover-border-color:#dee2e6;--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:#e9ecef;--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:#6c757d;--bs-pagination-disabled-bg:#fff;--bs-pagination-disabled-border-color:#dee2e6;display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:-1px}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:0.5rem}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:0.25rem}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:1px solid var(--bs-alert-border-color);--bs-alert-border-radius:0.375rem;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:#084298;--bs-alert-bg:#cfe2ff;--bs-alert-border-color:#b6d4fe}.alert-primary .alert-link{color:#06357a}.alert-secondary{--bs-alert-color:#41464b;--bs-alert-bg:#e2e3e5;--bs-alert-border-color:#d3d6d8}.alert-secondary .alert-link{color:#34383c}.alert-success{--bs-alert-color:#0f5132;--bs-alert-bg:#d1e7dd;--bs-alert-border-color:#badbcc}.alert-success .alert-link{color:#0c4128}.alert-info{--bs-alert-color:#055160;--bs-alert-bg:#cff4fc;--bs-alert-border-color:#b6effb}.alert-info .alert-link{color:#04414d}.alert-warning{--bs-alert-color:#664d03;--bs-alert-bg:#fff3cd;--bs-alert-border-color:#ffecb5}.alert-warning .alert-link{color:#523e02}.alert-danger{--bs-alert-color:#842029;--bs-alert-bg:#f8d7da;--bs-alert-border-color:#f5c2c7}.alert-danger .alert-link{color:#6a1a21}.alert-light{--bs-alert-color:#636464;--bs-alert-bg:#fefefe;--bs-alert-border-color:#fdfdfe}.alert-light .alert-link{color:#4f5050}.alert-dark{--bs-alert-color:#141619;--bs-alert-bg:#d3d3d4;--bs-alert-border-color:#bcbebf}.alert-dark .alert-link{color:#101214}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:#e9ecef;--bs-progress-border-radius:0.375rem;--bs-progress-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:#212529;--bs-list-group-bg:#fff;--bs-list-group-border-color:rgba(0, 0, 0, 0.125);--bs-list-group-border-width:1px;--bs-list-group-border-radius:0.375rem;--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:#495057;--bs-list-group-action-hover-color:#495057;--bs-list-group-action-hover-bg:#f8f9fa;--bs-list-group-action-active-color:#212529;--bs-list-group-action-active-bg:#e9ecef;--bs-list-group-disabled-color:#6c757d;--bs-list-group-disabled-bg:#fff;--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#084298;background-color:#cfe2ff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#084298;background-color:#bacbe6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#084298;border-color:#084298}.list-group-item-secondary{color:#41464b;background-color:#e2e3e5}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#41464b;background-color:#cbccce}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#41464b;border-color:#41464b}.list-group-item-success{color:#0f5132;background-color:#d1e7dd}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#0f5132;background-color:#bcd0c7}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#0f5132;border-color:#0f5132}.list-group-item-info{color:#055160;background-color:#cff4fc}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#055160;background-color:#badce3}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#055160;border-color:#055160}.list-group-item-warning{color:#664d03;background-color:#fff3cd}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#664d03;background-color:#e6dbb9}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#664d03;border-color:#664d03}.list-group-item-danger{color:#842029;background-color:#f8d7da}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#842029;background-color:#dfc2c4}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#842029;border-color:#842029}.list-group-item-light{color:#636464;background-color:#fefefe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#636464;background-color:#e5e5e5}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#636464;border-color:#636464}.list-group-item-dark{color:#141619;background-color:#d3d3d4}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#141619;background-color:#bebebf}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#141619;border-color:#141619}.btn-close{box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:#000;background:transparent url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:.5}.btn-close:hover{color:#000;text-decoration:none;opacity:.75}.btn-close:focus{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25);opacity:1}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:.25}.btn-close-white{filter:invert(1) grayscale(100%) brightness(200%)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(255, 255, 255, 0.85);--bs-toast-border-width:1px;--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:0.375rem;--bs-toast-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color:#6c757d;--bs-toast-header-bg:rgba(255, 255, 255, 0.85);--bs-toast-header-border-color:rgba(0, 0, 0, 0.05);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:#fff;--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:1px;--bs-modal-border-radius:0.5rem;--bs-modal-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius:calc(0.5rem - 1px);--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:1px;--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:#fff;--bs-tooltip-bg:#000;--bs-tooltip-border-radius:0.375rem;--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;padding:var(--bs-tooltip-arrow-height);margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:0}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:0}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:#fff;--bs-popover-border-width:1px;--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:0.5rem;--bs-popover-inner-border-radius:calc(0.5rem - 1px);--bs-popover-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color: ;--bs-popover-header-bg:#f0f0f0;--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:#212529;--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%;list-style:none}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color: ;--bs-offcanvas-bg:#fff;--bs-offcanvas-border-width:1px;--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075)}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:575.98px){.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}}@media (max-width:575.98px){.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:767.98px){.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}}@media (max-width:767.98px){.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:991.98px){.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}}@media (max-width:991.98px){.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1199.98px){.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}}@media (max-width:1199.98px){.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}}@media (max-width:1399.98px){.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:1.5}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(13,110,253,var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(108,117,125,var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(25,135,84,var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(13,202,240,var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(255,193,7,var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(220,53,69,var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(248,249,250,var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(33,37,41,var(--bs-bg-opacity,1))!important}.link-primary{color:#0d6efd!important}.link-primary:focus,.link-primary:hover{color:#0a58ca!important}.link-secondary{color:#6c757d!important}.link-secondary:focus,.link-secondary:hover{color:#565e64!important}.link-success{color:#198754!important}.link-success:focus,.link-success:hover{color:#146c43!important}.link-info{color:#0dcaf0!important}.link-info:focus,.link-info:hover{color:#3dd5f3!important}.link-warning{color:#ffc107!important}.link-warning:focus,.link-warning:hover{color:#ffcd39!important}.link-danger{color:#dc3545!important}.link-danger:focus,.link-danger:hover{color:#b02a37!important}.link-light{color:#f8f9fa!important}.link-light:focus,.link-light:hover{color:#f9fafb!important}.link-dark{color:#212529!important}.link-dark:focus,.link-dark:hover{color:#1a1e21!important}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){position:absolute!important;width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-1{--bs-border-width:1px}.border-2{--bs-border-width:2px}.border-3{--bs-border-width:3px}.border-4{--bs-border-width:4px}.border-5{--bs-border-width:5px}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-light{font-weight:300!important}.fw-lighter{font-weight:lighter!important}.fw-normal{font-weight:400!important}.fw-bold{font-weight:700!important}.fw-semibold{font-weight:600!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:#6c757d!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-2xl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}}

/* ==== swiper-bundle.css ==== */
/**
 * Swiper 8.4.5
 * Most modern mobile touch slider and framework with hardware accelerated transitions
 * https://swiperjs.com
 *
 * Copyright 2014-2022 Vladimir Kharlampidi
 *
 * Released under the MIT License
 *
 * Released on: November 21, 2022
 */

 @font-face{font-family:swiper-icons;src:url('data:application/font-woff;charset=utf-8;base64, d09GRgABAAAAAAZgABAAAAAADAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABGRlRNAAAGRAAAABoAAAAci6qHkUdERUYAAAWgAAAAIwAAACQAYABXR1BPUwAABhQAAAAuAAAANuAY7+xHU1VCAAAFxAAAAFAAAABm2fPczU9TLzIAAAHcAAAASgAAAGBP9V5RY21hcAAAAkQAAACIAAABYt6F0cBjdnQgAAACzAAAAAQAAAAEABEBRGdhc3AAAAWYAAAACAAAAAj//wADZ2x5ZgAAAywAAADMAAAD2MHtryVoZWFkAAABbAAAADAAAAA2E2+eoWhoZWEAAAGcAAAAHwAAACQC9gDzaG10eAAAAigAAAAZAAAArgJkABFsb2NhAAAC0AAAAFoAAABaFQAUGG1heHAAAAG8AAAAHwAAACAAcABAbmFtZQAAA/gAAAE5AAACXvFdBwlwb3N0AAAFNAAAAGIAAACE5s74hXjaY2BkYGAAYpf5Hu/j+W2+MnAzMYDAzaX6QjD6/4//Bxj5GA8AuRwMYGkAPywL13jaY2BkYGA88P8Agx4j+/8fQDYfA1AEBWgDAIB2BOoAeNpjYGRgYNBh4GdgYgABEMnIABJzYNADCQAACWgAsQB42mNgYfzCOIGBlYGB0YcxjYGBwR1Kf2WQZGhhYGBiYGVmgAFGBiQQkOaawtDAoMBQxXjg/wEGPcYDDA4wNUA2CCgwsAAAO4EL6gAAeNpj2M0gyAACqxgGNWBkZ2D4/wMA+xkDdgAAAHjaY2BgYGaAYBkGRgYQiAHyGMF8FgYHIM3DwMHABGQrMOgyWDLEM1T9/w8UBfEMgLzE////P/5//f/V/xv+r4eaAAeMbAxwIUYmIMHEgKYAYjUcsDAwsLKxc3BycfPw8jEQA/gZBASFhEVExcQlJKWkZWTl5BUUlZRVVNXUNTQZBgMAAMR+E+gAEQFEAAAAKgAqACoANAA+AEgAUgBcAGYAcAB6AIQAjgCYAKIArAC2AMAAygDUAN4A6ADyAPwBBgEQARoBJAEuATgBQgFMAVYBYAFqAXQBfgGIAZIBnAGmAbIBzgHsAAB42u2NMQ6CUAyGW568x9AneYYgm4MJbhKFaExIOAVX8ApewSt4Bic4AfeAid3VOBixDxfPYEza5O+Xfi04YADggiUIULCuEJK8VhO4bSvpdnktHI5QCYtdi2sl8ZnXaHlqUrNKzdKcT8cjlq+rwZSvIVczNiezsfnP/uznmfPFBNODM2K7MTQ45YEAZqGP81AmGGcF3iPqOop0r1SPTaTbVkfUe4HXj97wYE+yNwWYxwWu4v1ugWHgo3S1XdZEVqWM7ET0cfnLGxWfkgR42o2PvWrDMBSFj/IHLaF0zKjRgdiVMwScNRAoWUoH78Y2icB/yIY09An6AH2Bdu/UB+yxopYshQiEvnvu0dURgDt8QeC8PDw7Fpji3fEA4z/PEJ6YOB5hKh4dj3EvXhxPqH/SKUY3rJ7srZ4FZnh1PMAtPhwP6fl2PMJMPDgeQ4rY8YT6Gzao0eAEA409DuggmTnFnOcSCiEiLMgxCiTI6Cq5DZUd3Qmp10vO0LaLTd2cjN4fOumlc7lUYbSQcZFkutRG7g6JKZKy0RmdLY680CDnEJ+UMkpFFe1RN7nxdVpXrC4aTtnaurOnYercZg2YVmLN/d/gczfEimrE/fs/bOuq29Zmn8tloORaXgZgGa78yO9/cnXm2BpaGvq25Dv9S4E9+5SIc9PqupJKhYFSSl47+Qcr1mYNAAAAeNptw0cKwkAAAMDZJA8Q7OUJvkLsPfZ6zFVERPy8qHh2YER+3i/BP83vIBLLySsoKimrqKqpa2hp6+jq6RsYGhmbmJqZSy0sraxtbO3sHRydnEMU4uR6yx7JJXveP7WrDycAAAAAAAH//wACeNpjYGRgYOABYhkgZgJCZgZNBkYGLQZtIJsFLMYAAAw3ALgAeNolizEKgDAQBCchRbC2sFER0YD6qVQiBCv/H9ezGI6Z5XBAw8CBK/m5iQQVauVbXLnOrMZv2oLdKFa8Pjuru2hJzGabmOSLzNMzvutpB3N42mNgZGBg4GKQYzBhYMxJLMlj4GBgAYow/P/PAJJhLM6sSoWKfWCAAwDAjgbRAAB42mNgYGBkAIIbCZo5IPrmUn0hGA0AO8EFTQAA');font-weight:400;font-style:normal}:root{--swiper-theme-color:#007aff}.swiper{margin-left:auto;margin-right:auto;position:relative;overflow:hidden;list-style:none;padding:0;z-index:1}.swiper-vertical>.swiper-wrapper{flex-direction:column}.swiper-wrapper{position:relative;width:100%;height:100%;z-index:1;display:flex;transition-property:transform;box-sizing:content-box}.swiper-android .swiper-slide,.swiper-wrapper{transform:translate3d(0px,0,0)}.swiper-pointer-events{touch-action:pan-y}.swiper-pointer-events.swiper-vertical{touch-action:pan-x}.swiper-slide{flex-shrink:0;width:100%;height:100%;position:relative;transition-property:transform}.swiper-slide-invisible-blank{visibility:hidden}.swiper-autoheight,.swiper-autoheight .swiper-slide{height:auto}.swiper-autoheight .swiper-wrapper{align-items:flex-start;transition-property:transform,height}.swiper-backface-hidden .swiper-slide{transform:translateZ(0);-webkit-backface-visibility:hidden;backface-visibility:hidden}.swiper-3d,.swiper-3d.swiper-css-mode .swiper-wrapper{perspective:1200px}.swiper-3d .swiper-cube-shadow,.swiper-3d .swiper-slide,.swiper-3d .swiper-slide-shadow,.swiper-3d .swiper-slide-shadow-bottom,.swiper-3d .swiper-slide-shadow-left,.swiper-3d .swiper-slide-shadow-right,.swiper-3d .swiper-slide-shadow-top,.swiper-3d .swiper-wrapper{transform-style:preserve-3d}.swiper-3d .swiper-slide-shadow,.swiper-3d .swiper-slide-shadow-bottom,.swiper-3d .swiper-slide-shadow-left,.swiper-3d .swiper-slide-shadow-right,.swiper-3d .swiper-slide-shadow-top{position:absolute;left:0;top:0;width:100%;height:100%;pointer-events:none;z-index:10}.swiper-3d .swiper-slide-shadow{background:rgba(0,0,0,.15)}.swiper-3d .swiper-slide-shadow-left{background-image:linear-gradient(to left,rgba(0,0,0,.5),rgba(0,0,0,0))}.swiper-3d .swiper-slide-shadow-right{background-image:linear-gradient(to right,rgba(0,0,0,.5),rgba(0,0,0,0))}.swiper-3d .swiper-slide-shadow-top{background-image:linear-gradient(to top,rgba(0,0,0,.5),rgba(0,0,0,0))}.swiper-3d .swiper-slide-shadow-bottom{background-image:linear-gradient(to bottom,rgba(0,0,0,.5),rgba(0,0,0,0))}.swiper-css-mode>.swiper-wrapper{overflow:auto;scrollbar-width:none;-ms-overflow-style:none}.swiper-css-mode>.swiper-wrapper::-webkit-scrollbar{display:none}.swiper-css-mode>.swiper-wrapper>.swiper-slide{scroll-snap-align:start start}.swiper-horizontal.swiper-css-mode>.swiper-wrapper{scroll-snap-type:x mandatory}.swiper-vertical.swiper-css-mode>.swiper-wrapper{scroll-snap-type:y mandatory}.swiper-centered>.swiper-wrapper::before{content:'';flex-shrink:0;order:9999}.swiper-centered.swiper-horizontal>.swiper-wrapper>.swiper-slide:first-child{margin-inline-start:var(--swiper-centered-offset-before)}.swiper-centered.swiper-horizontal>.swiper-wrapper::before{height:100%;min-height:1px;width:var(--swiper-centered-offset-after)}.swiper-centered.swiper-vertical>.swiper-wrapper>.swiper-slide:first-child{margin-block-start:var(--swiper-centered-offset-before)}.swiper-centered.swiper-vertical>.swiper-wrapper::before{width:100%;min-width:1px;height:var(--swiper-centered-offset-after)}.swiper-centered>.swiper-wrapper>.swiper-slide{scroll-snap-align:center center}.swiper-virtual .swiper-slide{-webkit-backface-visibility:hidden;transform:translateZ(0)}.swiper-virtual.swiper-css-mode .swiper-wrapper::after{content:'';position:absolute;left:0;top:0;pointer-events:none}.swiper-virtual.swiper-css-mode.swiper-horizontal .swiper-wrapper::after{height:1px;width:var(--swiper-virtual-size)}.swiper-virtual.swiper-css-mode.swiper-vertical .swiper-wrapper::after{width:1px;height:var(--swiper-virtual-size)}:root{--swiper-navigation-size:44px}.swiper-button-next,.swiper-button-prev{position:absolute;top:50%;width:calc(var(--swiper-navigation-size)/ 44 * 27);height:var(--swiper-navigation-size);margin-top:calc(0px - (var(--swiper-navigation-size)/ 2));z-index:10;cursor:pointer;display:flex;align-items:center;justify-content:center;color:var(--swiper-navigation-color,var(--swiper-theme-color))}.swiper-button-next.swiper-button-disabled,.swiper-button-prev.swiper-button-disabled{opacity:.35;cursor:auto;pointer-events:none}.swiper-button-next.swiper-button-hidden,.swiper-button-prev.swiper-button-hidden{opacity:0;cursor:auto;pointer-events:none}.swiper-navigation-disabled .swiper-button-next,.swiper-navigation-disabled .swiper-button-prev{display:none!important}.swiper-button-next:after,.swiper-button-prev:after{font-family:swiper-icons;font-size:var(--swiper-navigation-size);text-transform:none!important;letter-spacing:0;font-variant:initial;line-height:1}.swiper-button-prev,.swiper-rtl .swiper-button-next{left:10px;right:auto}.swiper-button-prev:after,.swiper-rtl .swiper-button-next:after{content:'prev'}.swiper-button-next,.swiper-rtl .swiper-button-prev{right:10px;left:auto}.swiper-button-next:after,.swiper-rtl .swiper-button-prev:after{content:'next'}.swiper-button-lock{display:none}.swiper-pagination{position:absolute;text-align:center;transition:.3s opacity;transform:translate3d(0,0,0);z-index:10}.swiper-pagination.swiper-pagination-hidden{opacity:0}.swiper-pagination-disabled>.swiper-pagination,.swiper-pagination.swiper-pagination-disabled{display:none!important}.swiper-horizontal>.swiper-pagination-bullets,.swiper-pagination-bullets.swiper-pagination-horizontal,.swiper-pagination-custom,.swiper-pagination-fraction{bottom:10px;left:0;width:100%}.swiper-pagination-bullets-dynamic{overflow:hidden;font-size:0}.swiper-pagination-bullets-dynamic .swiper-pagination-bullet{transform:scale(.33);position:relative}.swiper-pagination-bullets-dynamic .swiper-pagination-bullet-active{transform:scale(1)}.swiper-pagination-bullets-dynamic .swiper-pagination-bullet-active-main{transform:scale(1)}.swiper-pagination-bullets-dynamic .swiper-pagination-bullet-active-prev{transform:scale(.66)}.swiper-pagination-bullets-dynamic .swiper-pagination-bullet-active-prev-prev{transform:scale(.33)}.swiper-pagination-bullets-dynamic .swiper-pagination-bullet-active-next{transform:scale(.66)}.swiper-pagination-bullets-dynamic .swiper-pagination-bullet-active-next-next{transform:scale(.33)}.swiper-pagination-bullet{width:var(--swiper-pagination-bullet-width,var(--swiper-pagination-bullet-size,8px));height:var(--swiper-pagination-bullet-height,var(--swiper-pagination-bullet-size,8px));display:inline-block;border-radius:50%;background:var(--swiper-pagination-bullet-inactive-color,#000);opacity:var(--swiper-pagination-bullet-inactive-opacity, .2)}button.swiper-pagination-bullet{border:none;margin:0;padding:0;box-shadow:none;-webkit-appearance:none;appearance:none}.swiper-pagination-clickable .swiper-pagination-bullet{cursor:pointer}.swiper-pagination-bullet:only-child{display:none!important}.swiper-pagination-bullet-active{opacity:var(--swiper-pagination-bullet-opacity, 1);background:var(--swiper-pagination-color,var(--swiper-theme-color))}.swiper-pagination-vertical.swiper-pagination-bullets,.swiper-vertical>.swiper-pagination-bullets{right:10px;top:50%;transform:translate3d(0px,-50%,0)}.swiper-pagination-vertical.swiper-pagination-bullets .swiper-pagination-bullet,.swiper-vertical>.swiper-pagination-bullets .swiper-pagination-bullet{margin:var(--swiper-pagination-bullet-vertical-gap,6px) 0;display:block}.swiper-pagination-vertical.swiper-pagination-bullets.swiper-pagination-bullets-dynamic,.swiper-vertical>.swiper-pagination-bullets.swiper-pagination-bullets-dynamic{top:50%;transform:translateY(-50%);width:8px}.swiper-pagination-vertical.swiper-pagination-bullets.swiper-pagination-bullets-dynamic .swiper-pagination-bullet,.swiper-vertical>.swiper-pagination-bullets.swiper-pagination-bullets-dynamic .swiper-pagination-bullet{display:inline-block;transition:.2s transform,.2s top}.swiper-horizontal>.swiper-pagination-bullets .swiper-pagination-bullet,.swiper-pagination-horizontal.swiper-pagination-bullets .swiper-pagination-bullet{margin:0 var(--swiper-pagination-bullet-horizontal-gap,4px)}.swiper-horizontal>.swiper-pagination-bullets.swiper-pagination-bullets-dynamic,.swiper-pagination-horizontal.swiper-pagination-bullets.swiper-pagination-bullets-dynamic{left:50%;transform:translateX(-50%);white-space:nowrap}.swiper-horizontal>.swiper-pagination-bullets.swiper-pagination-bullets-dynamic .swiper-pagination-bullet,.swiper-pagination-horizontal.swiper-pagination-bullets.swiper-pagination-bullets-dynamic .swiper-pagination-bullet{transition:.2s transform,.2s left}.swiper-horizontal.swiper-rtl>.swiper-pagination-bullets-dynamic .swiper-pagination-bullet{transition:.2s transform,.2s right}.swiper-pagination-progressbar{background:rgba(0,0,0,.25);position:absolute}.swiper-pagination-progressbar .swiper-pagination-progressbar-fill{background:var(--swiper-pagination-color,var(--swiper-theme-color));position:absolute;left:0;top:0;width:100%;height:100%;transform:scale(0);transform-origin:left top}.swiper-rtl .swiper-pagination-progressbar .swiper-pagination-progressbar-fill{transform-origin:right top}.swiper-horizontal>.swiper-pagination-progressbar,.swiper-pagination-progressbar.swiper-pagination-horizontal,.swiper-pagination-progressbar.swiper-pagination-vertical.swiper-pagination-progressbar-opposite,.swiper-vertical>.swiper-pagination-progressbar.swiper-pagination-progressbar-opposite{width:100%;height:4px;left:0;top:0}.swiper-horizontal>.swiper-pagination-progressbar.swiper-pagination-progressbar-opposite,.swiper-pagination-progressbar.swiper-pagination-horizontal.swiper-pagination-progressbar-opposite,.swiper-pagination-progressbar.swiper-pagination-vertical,.swiper-vertical>.swiper-pagination-progressbar{width:4px;height:100%;left:0;top:0}.swiper-pagination-lock{display:none}.swiper-scrollbar{border-radius:10px;position:relative;-ms-touch-action:none;background:rgba(0,0,0,.1)}.swiper-scrollbar-disabled>.swiper-scrollbar,.swiper-scrollbar.swiper-scrollbar-disabled{display:none!important}.swiper-horizontal>.swiper-scrollbar,.swiper-scrollbar.swiper-scrollbar-horizontal{position:absolute;left:1%;bottom:3px;z-index:50;height:5px;width:98%}.swiper-scrollbar.swiper-scrollbar-vertical,.swiper-vertical>.swiper-scrollbar{position:absolute;right:3px;top:1%;z-index:50;width:5px;height:98%}.swiper-scrollbar-drag{height:100%;width:100%;position:relative;background:rgba(0,0,0,.5);border-radius:10px;left:0;top:0}.swiper-scrollbar-cursor-drag{cursor:move}.swiper-scrollbar-lock{display:none}.swiper-zoom-container{width:100%;height:100%;display:flex;justify-content:center;align-items:center;text-align:center}.swiper-zoom-container>canvas,.swiper-zoom-container>img,.swiper-zoom-container>svg{max-width:100%;max-height:100%;object-fit:contain}.swiper-slide-zoomed{cursor:move}.swiper-lazy-preloader{width:42px;height:42px;position:absolute;left:50%;top:50%;margin-left:-21px;margin-top:-21px;z-index:10;transform-origin:50%;box-sizing:border-box;border:4px solid var(--swiper-preloader-color,var(--swiper-theme-color));border-radius:50%;border-top-color:transparent}.swiper-watch-progress .swiper-slide-visible .swiper-lazy-preloader,.swiper:not(.swiper-watch-progress) .swiper-lazy-preloader{animation:swiper-preloader-spin 1s infinite linear}.swiper-lazy-preloader-white{--swiper-preloader-color:#fff}.swiper-lazy-preloader-black{--swiper-preloader-color:#000}@keyframes swiper-preloader-spin{0%{transform:rotate(0deg)}100%{transform:rotate(360deg)}}.swiper .swiper-notification{position:absolute;left:0;top:0;pointer-events:none;opacity:0;z-index:-1000}.swiper-free-mode>.swiper-wrapper{transition-timing-function:ease-out;margin:0 auto}.swiper-grid>.swiper-wrapper{flex-wrap:wrap}.swiper-grid-column>.swiper-wrapper{flex-wrap:wrap;flex-direction:column}.swiper-fade.swiper-free-mode .swiper-slide{transition-timing-function:ease-out}.swiper-fade .swiper-slide{pointer-events:none;transition-property:opacity}.swiper-fade .swiper-slide .swiper-slide{pointer-events:none}.swiper-fade .swiper-slide-active,.swiper-fade .swiper-slide-active .swiper-slide-active{pointer-events:auto}.swiper-cube{overflow:visible}.swiper-cube .swiper-slide{pointer-events:none;-webkit-backface-visibility:hidden;backface-visibility:hidden;z-index:1;visibility:hidden;transform-origin:0 0;width:100%;height:100%}.swiper-cube .swiper-slide .swiper-slide{pointer-events:none}.swiper-cube.swiper-rtl .swiper-slide{transform-origin:100% 0}.swiper-cube .swiper-slide-active,.swiper-cube .swiper-slide-active .swiper-slide-active{pointer-events:auto}.swiper-cube .swiper-slide-active,.swiper-cube .swiper-slide-next,.swiper-cube .swiper-slide-next+.swiper-slide,.swiper-cube .swiper-slide-prev{pointer-events:auto;visibility:visible}.swiper-cube .swiper-slide-shadow-bottom,.swiper-cube .swiper-slide-shadow-left,.swiper-cube .swiper-slide-shadow-right,.swiper-cube .swiper-slide-shadow-top{z-index:0;-webkit-backface-visibility:hidden;backface-visibility:hidden}.swiper-cube .swiper-cube-shadow{position:absolute;left:0;bottom:0px;width:100%;height:100%;opacity:.6;z-index:0}.swiper-cube .swiper-cube-shadow:before{content:'';background:#000;position:absolute;left:0;top:0;bottom:0;right:0;filter:blur(50px)}.swiper-flip{overflow:visible}.swiper-flip .swiper-slide{pointer-events:none;-webkit-backface-visibility:hidden;backface-visibility:hidden;z-index:1}.swiper-flip .swiper-slide .swiper-slide{pointer-events:none}.swiper-flip .swiper-slide-active,.swiper-flip .swiper-slide-active .swiper-slide-active{pointer-events:auto}.swiper-flip .swiper-slide-shadow-bottom,.swiper-flip .swiper-slide-shadow-left,.swiper-flip .swiper-slide-shadow-right,.swiper-flip .swiper-slide-shadow-top{z-index:0;-webkit-backface-visibility:hidden;backface-visibility:hidden}.swiper-creative .swiper-slide{-webkit-backface-visibility:hidden;backface-visibility:hidden;overflow:hidden;transition-property:transform,opacity,height}.swiper-cards{overflow:visible}.swiper-cards .swiper-slide{transform-origin:center bottom;-webkit-backface-visibility:hidden;backface-visibility:hidden;overflow:hidden}

/* ==== magnific-popup.css ==== */
/* Magnific Popup CSS */
.mfp-bg {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  z-index: 1042;
  overflow: hidden;
  position: fixed;
  background: #0b0b0b;
  opacity: 0.8; }

.mfp-wrap {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  z-index: 99999;
  position: fixed;
  outline: none !important;
  -webkit-backface-visibility: hidden; }

.mfp-container {
  text-align: center;
  position: absolute;
  width: 100%;
  height: 100%;
  left: 0;
  top: 0;
  padding: 0 8px;
  box-sizing: border-box; }

.mfp-container:before {
  content: '';
  display: inline-block;
  height: 100%;
  vertical-align: middle; }

.mfp-align-top .mfp-container:before {
  display: none; }

.mfp-content {
  position: relative;
  display: inline-block;
  vertical-align: middle;
  margin: 0 auto;
  text-align: left;
  z-index: 1045; }

.mfp-inline-holder .mfp-content,
.mfp-ajax-holder .mfp-content {
  width: 100%;
  cursor: auto; }

.mfp-ajax-cur {
  cursor: progress; }

.mfp-zoom-out-cur, .mfp-zoom-out-cur .mfp-image-holder .mfp-close {
  cursor: -moz-zoom-out;
  cursor: -webkit-zoom-out;
  cursor: zoom-out; }

.mfp-zoom {
  cursor: pointer;
  cursor: -webkit-zoom-in;
  cursor: -moz-zoom-in;
  cursor: zoom-in; }

.mfp-auto-cursor .mfp-content {
  cursor: auto; }

.mfp-close,
.mfp-arrow,
.mfp-preloader,
.mfp-counter {
  -webkit-user-select: none;
  -moz-user-select: none;
  user-select: none; }

.mfp-loading.mfp-figure {
  display: none; }

.mfp-hide {
  display: none !important; }

.mfp-preloader {
  color: #CCC;
  position: absolute;
  top: 50%;
  width: auto;
  text-align: center;
  margin-top: -0.8em;
  left: 8px;
  right: 8px;
  z-index: 1044; }
  .mfp-preloader a {
    color: #CCC; }
    .mfp-preloader a:hover {
      color: #FFF; }

.mfp-s-ready .mfp-preloader {
  display: none; }

.mfp-s-error .mfp-content {
  display: none; }

button.mfp-close,
button.mfp-arrow {
  overflow: visible;
  cursor: pointer;
  background: transparent;
  border: 0;
  -webkit-appearance: none;
  display: block;
  outline: none;
  padding: 0;
  z-index: 1046;
  box-shadow: none;
  touch-action: manipulation; }

button::-moz-focus-inner {
  padding: 0;
  border: 0; }

.mfp-close {
  width: 44px;
  height: 44px;
  line-height: 44px;
  position: absolute;
  right: 0;
  top: 0;
  text-decoration: none;
  text-align: center;
  opacity: 0.65;
  padding: 0 0 18px 10px;
  color: #FFF;
  font-style: normal;
  font-size: 28px;
  font-family: Arial, Baskerville, monospace; }
  .mfp-close:hover,
  .mfp-close:focus {
    opacity: 1; }
  .mfp-close:active {
    top: 1px; }

.mfp-close-btn-in .mfp-close {
  color: #333; }

.mfp-image-holder .mfp-close,
.mfp-iframe-holder .mfp-close {
  color: #FFF;
  right: -6px;
  text-align: right;
  padding-right: 6px;
  width: 100%; }

.mfp-counter {
  position: absolute;
  top: 0;
  right: 0;
  color: #CCC;
  font-size: 12px;
  line-height: 18px;
  white-space: nowrap; }

.mfp-arrow {
  position: absolute;
  opacity: 0.65;
  margin: 0;
  top: 50%;
  margin-top: -55px;
  padding: 0;
  width: 90px;
  height: 110px;
  -webkit-tap-highlight-color: transparent; }
  .mfp-arrow:active {
    margin-top: -54px; }
  .mfp-arrow:hover,
  .mfp-arrow:focus {
    opacity: 1; }
  .mfp-arrow:before,
  .mfp-arrow:after {
    content: '';
    display: block;
    width: 0;
    height: 0;
    position: absolute;
    left: 0;
    top: 0;
    margin-top: 35px;
    margin-left: 35px;
    border: medium inset transparent; }
  .mfp-arrow:after {
    border-top-width: 13px;
    border-bottom-width: 13px;
    top: 8px; }
  .mfp-arrow:before {
    border-top-width: 21px;
    border-bottom-width: 21px;
    opacity: 0.7; }

.mfp-arrow-left {
  left: 0; }
  .mfp-arrow-left:after {
    border-right: 17px solid #FFF;
    margin-left: 31px; }
  .mfp-arrow-left:before {
    margin-left: 25px;
    border-right: 27px solid #3F3F3F; }

.mfp-arrow-right {
  right: 0; }
  .mfp-arrow-right:after {
    border-left: 17px solid #FFF;
    margin-left: 39px; }
  .mfp-arrow-right:before {
    border-left: 27px solid #3F3F3F; }

.mfp-iframe-holder {
  padding-top: 40px;
  padding-bottom: 40px; }
  .mfp-iframe-holder .mfp-content {
    line-height: 0;
    width: 100%;
    max-width: 900px; }
  .mfp-iframe-holder .mfp-close {
    top: -40px; }

.mfp-iframe-scaler {
  width: 100%;
  height: 0;
  overflow: hidden;
  padding-top: 56.25%; }
  .mfp-iframe-scaler iframe {
    position: absolute;
    display: block;
    top: 0;
    left: 0;
    width: 100%;
    height: 100%;
    box-shadow: 0 0 8px rgba(0, 0, 0, 0.6);
    background: #000; }

/* Main image in popup */
img.mfp-img {
  width: auto;
  max-width: 100%;
  height: auto;
  display: block;
  line-height: 0;
  box-sizing: border-box;
  padding: 40px 0 40px;
  margin: 0 auto; }

/* The shadow behind the image */
.mfp-figure {
  line-height: 0; }
  .mfp-figure:after {
    content: '';
    position: absolute;
    left: 0;
    top: 40px;
    bottom: 40px;
    display: block;
    right: 0;
    width: auto;
    height: auto;
    z-index: -1;
    box-shadow: 0 0 8px rgba(0, 0, 0, 0.6);
    background: #444; }
  .mfp-figure small {
    color: #BDBDBD;
    display: block;
    font-size: 12px;
    line-height: 14px; }
  .mfp-figure figure {
    margin: 0; }

.mfp-bottom-bar {
  margin-top: -36px;
  position: absolute;
  top: 100%;
  left: 0;
  width: 100%;
  cursor: auto; }

.mfp-title {
  text-align: left;
  line-height: 18px;
  color: #F3F3F3;
  word-wrap: break-word;
  padding-right: 36px; }

.mfp-image-holder .mfp-content {
  max-width: 100%; }

.mfp-gallery .mfp-image-holder .mfp-figure {
  cursor: pointer; }

@media screen and (max-width: 800px) and (orientation: landscape), screen and (max-height: 300px) {
  /**
       * Remove all paddings around the image on small screen
       */
  .mfp-img-mobile .mfp-image-holder {
    padding-left: 0;
    padding-right: 0; }
  .mfp-img-mobile img.mfp-img {
    padding: 0; }
  .mfp-img-mobile .mfp-figure:after {
    top: 0;
    bottom: 0; }
  .mfp-img-mobile .mfp-figure small {
    display: inline;
    margin-left: 5px; }
  .mfp-img-mobile .mfp-bottom-bar {
    background: rgba(0, 0, 0, 0.6);
    bottom: 0;
    margin: 0;
    top: auto;
    padding: 3px 5px;
    position: fixed;
    box-sizing: border-box; }
    .mfp-img-mobile .mfp-bottom-bar:empty {
      padding: 0; }
  .mfp-img-mobile .mfp-counter {
    right: 5px;
    top: 3px; }
  .mfp-img-mobile .mfp-close {
    top: 0;
    right: 0;
    width: 35px;
    height: 35px;
    line-height: 35px;
    background: rgba(0, 0, 0, 0.6);
    position: fixed;
    text-align: center;
    padding: 0; } }

@media all and (max-width: 900px) {
  .mfp-arrow {
    -webkit-transform: scale(0.75);
    transform: scale(0.75); }
  .mfp-arrow-left {
    -webkit-transform-origin: 0;
    transform-origin: 0; }
  .mfp-arrow-right {
    -webkit-transform-origin: 100%;
    transform-origin: 100%; }
  .mfp-container {
    padding-left: 6px;
    padding-right: 6px; } }


/* ==== spacing.css ==== */
.mt-5{margin-top:5px !important}.mt-10{margin-top:10px}.mt-15{margin-top:15px}.mt-20{margin-top:20px}.mt-25{margin-top:25px}.mt-30{margin-top:30px}.mt-35{margin-top:35px}.mt-40{margin-top:40px}.mt-45{margin-top:45px}.mt-50{margin-top:50px}.mt-55{margin-top:55px}.mt-60{margin-top:60px}.mt-65{margin-top:65px}.mt-70{margin-top:70px}.mt-75{margin-top:75px}.mt-80{margin-top:80px}.mt-85{margin-top:85px}.mt-90{margin-top:90px}.mt-95{margin-top:95px}.mt-100{margin-top:100px}.mt-105{margin-top:105px}.mt-110{margin-top:110px}.mt-115{margin-top:115px}.mt-120{margin-top:120px}.mt-125{margin-top:125px}.mt-130{margin-top:130px}.mt-135{margin-top:135px}.mt-140{margin-top:140px}.mt-145{margin-top:145px}.mt-150{margin-top:150px}.mt-155{margin-top:155px}.mt-160{margin-top:160px}.mt-165{margin-top:165px}.mt-170{margin-top:170px}.mt-175{margin-top:175px}.mt-180{margin-top:180px}.mt-185{margin-top:185px}.mt-190{margin-top:190px}.mt-195{margin-top:195px}.mt-200{margin-top:200px}.mb-5{margin-bottom:5px !important}.mb-10{margin-bottom:10px}.mb-15{margin-bottom:15px}.mb-20{margin-bottom:20px}.mb-25{margin-bottom:25px}.mb-30{margin-bottom:30px}.mb-35{margin-bottom:35px}.mb-40{margin-bottom:40px}.mb-45{margin-bottom:45px}.mb-50{margin-bottom:50px}.mb-55{margin-bottom:55px}.mb-60{margin-bottom:60px}.mb-65{margin-bottom:65px}.mb-70{margin-bottom:70px}.mb-75{margin-bottom:75px}.mb-80{margin-bottom:80px}.mb-85{margin-bottom:85px}.mb-90{margin-bottom:90px}.mb-95{margin-bottom:95px}.mb-100{margin-bottom:100px}.mb-105{margin-bottom:105px}.mb-110{margin-bottom:110px}.mb-115{margin-bottom:115px}.mb-120{margin-bottom:120px}.mb-125{margin-bottom:125px}.mb-130{margin-bottom:130px}.mb-135{margin-bottom:135px}.mb-140{margin-bottom:140px}.mb-145{margin-bottom:145px}.mb-150{margin-bottom:150px}.mb-155{margin-bottom:155px}.mb-160{margin-bottom:160px}.mb-165{margin-bottom:165px}.mb-170{margin-bottom:170px}.mb-175{margin-bottom:175px}.mb-180{margin-bottom:180px}.mb-185{margin-bottom:185px}.mb-190{margin-bottom:190px}.mb-195{margin-bottom:195px}.mb-200{margin-bottom:200px}.ml-5{margin-left:5px}.ml-10{margin-left:10px}.ml-15{margin-left:15px}.ml-20{margin-left:20px}.ml-25{margin-left:25px}.ml-30{margin-left:30px}.ml-35{margin-left:35px}.ml-40{margin-left:40px}.ml-45{margin-left:45px}.ml-50{margin-left:50px}.ml-55{margin-left:55px}.ml-60{margin-left:60px}.ml-65{margin-left:65px}.ml-70{margin-left:70px}.ml-75{margin-left:75px}.ml-80{margin-left:80px}.ml-85{margin-left:85px}.ml-90{margin-left:90px}.ml-95{margin-left:95px}.ml-100{margin-left:100px}.ml-105{margin-left:105px}.ml-110{margin-left:110px}.ml-115{margin-left:115px}.ml-120{margin-left:120px}.ml-125{margin-left:125px}.ml-130{margin-left:130px}.ml-135{margin-left:135px}.ml-140{margin-left:140px}.ml-145{margin-left:145px}.ml-150{margin-left:150px}.ml-155{margin-left:155px}.ml-160{margin-left:160px}.ml-165{margin-left:165px}.ml-170{margin-left:170px}.ml-175{margin-left:175px}.ml-180{margin-left:180px}.ml-185{margin-left:185px}.ml-190{margin-left:190px}.ml-195{margin-left:195px}.ml-200{margin-left:200px}.mr-5{margin-right:5px}.mr-10{margin-right:10px}.mr-15{margin-right:15px}.mr-20{margin-right:20px}.mr-25{margin-right:25px}.mr-30{margin-right:30px}.mr-35{margin-right:35px}.mr-40{margin-right:40px}.mr-45{margin-right:45px}.mr-50{margin-right:50px}.mr-55{margin-right:55px}.mr-60{margin-right:60px}.mr-65{margin-right:65px}.mr-70{margin-right:70px}.mr-75{margin-right:75px}.mr-80{margin-right:80px}.mr-85{margin-right:85px}.mr-90{margin-right:90px}.mr-95{margin-right:95px}.mr-100{margin-right:100px}.mr-105{margin-right:105px}.mr-110{margin-right:110px}.mr-115{margin-right:115px}.mr-120{margin-right:120px}.mr-125{margin-right:125px}.mr-130{margin-right:130px}.mr-135{margin-right:135px}.mr-140{margin-right:140px}.mr-145{margin-right:145px}.mr-150{margin-right:150px}.mr-155{margin-right:155px}.mr-160{margin-right:160px}.mr-165{margin-right:165px}.mr-170{margin-right:170px}.mr-175{margin-right:175px}.mr-180{margin-right:180px}.mr-185{margin-right:185px}.mr-190{margin-right:190px}.mr-195{margin-right:195px}.mr-200{margin-right:200px}.pt-5{padding-top:5px !important}.pt-10{padding-top:10px}.pt-15{padding-top:15px}.pt-20{padding-top:20px}.pt-25{padding-top:25px}.pt-30{padding-top:30px}.pt-35{padding-top:35px}.pt-40{padding-top:40px}.pt-45{padding-top:45px}.pt-50{padding-top:50px}.pt-55{padding-top:55px}.pt-60{padding-top:60px}.pt-65{padding-top:65px}.pt-70{padding-top:70px}.pt-75{padding-top:75px}.pt-80{padding-top:80px}.pt-85{padding-top:85px}.pt-90{padding-top:90px}.pt-95{padding-top:95px}.pt-100{padding-top:100px}.pt-105{padding-top:105px}.pt-110{padding-top:110px}.pt-115{padding-top:115px}.pt-120{padding-top:120px}.pt-125{padding-top:125px}.pt-130{padding-top:130px}.pt-135{padding-top:135px}.pt-140{padding-top:140px}.pt-145{padding-top:145px}.pt-150{padding-top:150px}.pt-155{padding-top:155px}.pt-160{padding-top:160px}.pt-165{padding-top:165px}.pt-170{padding-top:170px}.pt-175{padding-top:175px}.pt-180{padding-top:180px}.pt-185{padding-top:185px}.pt-190{padding-top:190px}.pt-195{padding-top:195px}.pt-200{padding-top:200px}.pt-270{padding-top:270px}.pb-5{padding-bottom:5px !important}.pb-10{padding-bottom:10px}.pb-15{padding-bottom:15px}.pb-20{padding-bottom:20px}.pb-25{padding-bottom:25px}.pb-30{padding-bottom:30px}.pb-35{padding-bottom:35px}.pb-40{padding-bottom:40px}.pb-45{padding-bottom:45px}.pb-50{padding-bottom:50px}.pb-55{padding-bottom:55px}.pb-60{padding-bottom:60px}.pb-65{padding-bottom:65px}.pb-70{padding-bottom:70px}.pb-75{padding-bottom:75px}.pb-80{padding-bottom:80px}.pb-85{padding-bottom:85px}.pb-90{padding-bottom:90px}.pb-95{padding-bottom:95px}.pb-100{padding-bottom:100px}.pb-105{padding-bottom:105px}.pb-110{padding-bottom:110px}.pb-115{padding-bottom:115px}.pb-120{padding-bottom:120px}.pb-125{padding-bottom:125px}.pb-130{padding-bottom:130px}.pb-135{padding-bottom:135px}.pb-140{padding-bottom:140px}.pb-145{padding-bottom:145px}.pb-150{padding-bottom:150px}.pb-155{padding-bottom:155px}.pb-160{padding-bottom:160px}.pb-165{padding-bottom:165px}.pb-170{padding-bottom:170px}.pb-175{padding-bottom:175px}.pb-180{padding-bottom:180px}.pb-185{padding-bottom:185px}.pb-190{padding-bottom:190px}.pb-195{padding-bottom:195px}.pb-200{padding-bottom:200px}.pl-5{padding-left:5px}.pl-10{padding-left:10px}.pl-15{padding-left:15px}.pl-20{padding-left:20px}.pl-25{padding-left:25px}.pl-30{padding-left:30px}.pl-35{padding-left:35px}.pl-40{padding-left:40px}.pl-45{padding-left:45px}.pl-50{padding-left:50px}.pl-55{padding-left:55px}.pl-60{padding-left:60px}.pl-65{padding-left:65px}.pl-70{padding-left:70px}.pl-75{padding-left:75px}.pl-80{padding-left:80px}.pl-85{padding-left:85px}.pl-90{padding-left:90px}.pl-95{padding-left:95px}.pl-100{padding-left:100px}.pl-105{padding-left:105px}.pl-110{padding-left:110px}.pl-115{padding-left:115px}.pl-120{padding-left:120px}.pl-125{padding-left:125px}.pl-130{padding-left:130px}.pl-135{padding-left:135px}.pl-140{padding-left:140px}.pl-145{padding-left:145px}.pl-150{padding-left:150px}.pl-155{padding-left:155px}.pl-160{padding-left:160px}.pl-165{padding-left:165px}.pl-170{padding-left:170px}.pl-175{padding-left:175px}.pl-180{padding-left:180px}.pl-185{padding-left:185px}.pl-190{padding-left:190px}.pl-195{padding-left:195px}.pl-200{padding-left:200px}.pr-5{padding-right:5px}.pr-10{padding-right:10px}.pr-15{padding-right:15px}.pr-20{padding-right:20px}.pr-25{padding-right:25px}.pr-30{padding-right:30px}.pr-35{padding-right:35px}.pr-40{padding-right:40px}.pr-45{padding-right:45px}.pr-50{padding-right:50px}.pr-55{padding-right:55px}.pr-60{padding-right:60px}.pr-65{padding-right:65px}.pr-70{padding-right:70px}.pr-75{padding-right:75px}.pr-80{padding-right:80px}.pr-85{padding-right:85px}.pr-90{padding-right:90px}.pr-95{padding-right:95px}.pr-100{padding-right:100px}.pr-105{padding-right:105px}.pr-110{padding-right:110px}.pr-115{padding-right:115px}.pr-120{padding-right:120px}.pr-125{padding-right:125px}.pr-130{padding-right:130px}.pr-135{padding-right:135px}.pr-140{padding-right:140px}.pr-145{padding-right:145px}.pr-150{padding-right:150px}.pr-155{padding-right:155px}.pr-160{padding-right:160px}.pr-165{padding-right:165px}.pr-170{padding-right:170px}.pr-175{padding-right:175px}.pr-180{padding-right:180px}.pr-185{padding-right:185px}.pr-190{padding-right:190px}.pr-195{padding-right:195px}.pr-200{padding-right:200px}

/* ==== main.css ==== */
/*-----------------------------------------------------------------------------------

    Template Name: Agntix - Digital Agency & Creative Portfolio HTML Template
    Author: Theme_Pure
    Support: https://help.themepure.net/support/
    Description: Template
    Version: 1.0.3

-----------------------------------------------------------------------------------

/************ TABLE OF CONTENTS ***************

	-----------------
    01. THEME CSS
	-----------------
		1.1 Theme Default
		1.2 Common Classes

	-----------------
    02. COMPONENTS CSS
	-----------------
		2.1 Back to top
		2.2 Buttons
		2.3 Animations
		2.4 Preloader
		2.5 Background
		2.6 Nice Select
		2.7 Breadcrumb
		2.8 Accordion
		2.9 Section Title
		2.10 Accordion
		2.11 Search
		2.12 Magic Cursor

	-----------------
    03. HEADER CSS
	-----------------
		3.1 Header Style

    ---------------------------------
	04. MENU CSS
	---------------------------------
		4.1 Main Menu
		4.2 Mobile Menu
		4.3 offcanvas Menu

	---------------------------------
	05. BLOG CSS
	---------------------------------
		5.1 Postbox css
		5.2 Recent Post css
		5.3 Sidebar css
		5.4 Blog css

	---------------------------------
	06. FOOTER CSS
	---------------------------------
		6.1 Footer Style 1
		6.2 Footer Style 2
		6.3 Footer Style 3
		6.5 Footer Style 5
		6.7 Footer Style 7
		6.8 Footer Style 8
		6.9 Footer Style 9
		6.10 Footer Style 10
		6.11 Footer Style 11
		6.12 Footer Style 12
		6.13 Footer Style 13
		6.14 Footer Style 14
		6.15 Footer Style 15

	---------------------------------
	07. PAGES CSS
	---------------------------------
		7.1 Hero css
		7.2 About Css
		7.3 Banner Css
		7.4 Text-slide Css
		7.5 Service Css
		7.6 Project Css
		7.7 Funfact Css
		7.8 Work Css
		7.9 Testimonail Css
		8.0 Award Css
		8.1 Video Css
		8.2 Brand Css
		8.3 Team Css
		8.4 Step Css
		8.5 Choose Css
		8.6 Price Css
		8.7 Faq Css
		8.8 Success Css
		8.9 Instagram Css
		9.0 Feature Css
		9.1 Review Css
		9.2 Stack Css
		9.3 Benefits Css
		9.4 Cta Css
		9.5 Intaractive Css
		9.6 Project Slider Css
		9.7 Career Css
		9.8 Contact Css
		9.9 Portfolio css
		10.0 Shop Css
		10.1 Shop Details Css
		10.2 Login Css
		10.3 Checkout css
		10.4 Cart css
		10.5 Account css
		10.6 Error Css
		10.7 Dark Css Start
		10.8 Light Css Start


**********************************************/
/*----------------------------------------*/
/*  1.1 Theme Default
/*----------------------------------------*/
@import url("https://fonts.googleapis.com/css2?family=Inter:ital,opsz,wght@0,14..32,100..900;1,14..32,100..900&family=Besley:ital,wght@0,400..900;1,400..900&family=Space+Grotesk:wght@300..700&family=Playfair+Display:ital,wght@0,400..900;1,400..900&family=Satisfy&family=Teko:wght@300..700&family=Phudu:wght@300..900&family=Poppins:ital,wght@0,100;0,200;0,300;0,400;0,500;0,600;0,700;0,800;0,900;1,100;1,200;1,300;1,400;1,500;1,600;1,700;1,800;1,900&family=Onest:wght@100..900&display=swap");
@keyframes bannerAnimationTwo {
  0% {
    transform: translate(0px, 0px);
  }
  20% {
    transform: translate(20px, -5px);
  }
  40% {
    transform: translate(50px, 20px);
  }
  60% {
    transform: translate(20px, 50px);
  }
  80% {
    transform: translate(-20px, 30px);
  }
  100% {
    transform: translate(0px, 0px);
  }
}
.back-to-top-wrapper, a,
button,
p,
input,
select,
textarea,
li,
.transition-3 {
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}

.cst-btn span svg, .tp-product-details-views > span svg, .tp-btn-white-border span {
  -webkit-transform: translateY(-1px);
  -moz-transform: translateY(-1px);
  -ms-transform: translateY(-1px);
  -o-transform: translateY(-1px);
  transform: translateY(-1px);
}

.tp-product-details-action-sm-btn svg, .tp-product-details-wishlist-btn svg, .tp-perspective-social-info span svg, .tp-team-details-info-contact a svg, .app-testimonial-review-content span svg, .pp-service-2-banner-text p span, .pp-service-2-banner-text a span, .tp-service-4-solution-item-btn a span, .pp-service-details-process-bottom span a svg, .st-hero-btn-icon, .pp-footer-btn span, .postbox__comment-reply a span, .tp-header-10-announcement-content a span, .breadcrumb__list span:not(:last-child)::after, .tp-btn-border-2.st span, .tp-portfolio-details-btn span {
  -webkit-transform: translateY(-2px);
  -moz-transform: translateY(-2px);
  -ms-transform: translateY(-2px);
  -o-transform: translateY(-2px);
  transform: translateY(-2px);
}

.tp-career-title .shape-1 {
  -webkit-transform: translateY(-3px);
  -moz-transform: translateY(-3px);
  -ms-transform: translateY(-3px);
  -o-transform: translateY(-3px);
  transform: translateY(-3px);
}

/* transform */
@font-face {
  font-family: "Platform";
  src: url("../fonts/Platform-Light.eot");
  src: local("Platform Light"), local("Platform-Light"), url("../fonts/Platform-Light.eot?#iefix") format("embedded-opentype"), url("../fonts/Platform-Light.woff2") format("woff2"), url("../fonts/Platform-Light.woff") format("woff"), url("../fonts/Platform-Light.ttf") format("truetype");
  font-weight: 300;
  font-style: normal;
}
@font-face {
  font-family: "Platform";
  src: url("../fonts/Platform-Regular.eot");
  src: local("Platform Regular"), local("Platform-Regular"), url("../fonts/Platform-Regular.eot?#iefix") format("embedded-opentype"), url("../fonts/Platform-Regular.woff2") format("woff2"), url("../fonts/Platform-Regular.woff") format("woff"), url("../fonts/Platform-Regular.ttf") format("truetype");
  font-weight: normal;
  font-style: normal;
}
@font-face {
  font-family: "Platform";
  src: url("../fonts/Platform-Medium.eot");
  src: local("Platform Medium"), local("Platform-Medium"), url("../fonts/Platform-Medium.eot?#iefix") format("embedded-opentype"), url("../fonts/Platform-Medium.woff2") format("woff2"), url("../fonts/Platform-Medium.woff") format("woff"), url("../fonts/Platform-Medium.ttf") format("truetype");
  font-weight: 500;
  font-style: normal;
}
@font-face {
  font-family: "MangoGrotesque";
  src: url("../fonts/MangoGrotesque-Bold.eot");
  src: url("../fonts/MangoGrotesque-Bold.eot?#iefix") format("embedded-opentype"), url("../fonts/MangoGrotesque-Bold.woff") format("woff"), url("../fonts/MangoGrotesque-Bold.woff2") format("woff2"), url("../fonts/MangoGrotesque-Bold.ttf") format("truetype");
  font-style: normal;
  font-weight: bold;
  text-rendering: optimizeLegibility;
}
@font-face {
  font-family: "MangoGrotesqueLight";
  src: url("../fonts/MangoGrotesque-Light.eot");
  src: url("../fonts/MangoGrotesque-Light.eot?#iefix") format("embedded-opentype"), url("../fonts/MangoGrotesque-Light.woff") format("woff"), url("../fonts/MangoGrotesque-Light.woff2") format("woff2"), url("../fonts/MangoGrotesque-Light.ttf") format("truetype");
  font-style: normal;
  font-weight: normal;
  text-rendering: optimizeLegibility;
}
@font-face {
  font-family: "MangoGrotesqueMed";
  src: url("../fonts/MangoGrotesque-Medium.eot");
  src: url("../fonts/MangoGrotesque-Medium.eot?#iefix") format("embedded-opentype"), url("../fonts/MangoGrotesque-Medium.woff") format("woff"), url("../fonts/MangoGrotesque-Medium.woff2") format("woff2"), url("../fonts/MangoGrotesque-Medium.ttf") format("truetype");
  font-style: normal;
  font-weight: normal;
  text-rendering: optimizeLegibility;
}
@font-face {
  font-family: "MangoGrotesqueSemBd";
  src: url("../fonts/MangoGrotesque-SemiBold.eot");
  src: url("../fonts/MangoGrotesque-SemiBold.eot?#iefix") format("embedded-opentype"), url("../fonts/MangoGrotesque-SemiBold.woff") format("woff"), url("../fonts/MangoGrotesque-SemiBold.woff2") format("woff2"), url("../fonts/MangoGrotesque-SemiBold.ttf") format("truetype");
  font-style: normal;
  font-weight: normal;
  text-rendering: optimizeLegibility;
}
@font-face {
  font-family: "MangoGrotesque";
  src: url("../fonts/MangoGrotesque-Regular.eot");
  src: url("../fonts/MangoGrotesque-Regular.eot?#iefix") format("embedded-opentype"), url("../fonts/MangoGrotesque-Regular.woff") format("woff"), url("../fonts/MangoGrotesque-Regular.woff2") format("woff2"), url("../fonts/MangoGrotesque-Regular.ttf") format("truetype");
  font-style: normal;
  font-weight: normal;
  text-rendering: optimizeLegibility;
}
@font-face {
  font-family: "MangoGrotesqueThin";
  src: url("../fonts/MangoGrotesque-Thin.eot");
  src: url("../fonts/MangoGrotesque-Thin.eot?#iefix") format("embedded-opentype"), url("../fonts/MangoGrotesque-Thin.woff") format("woff"), url("../fonts/MangoGrotesque-Thin.woff2") format("woff2"), url("../fonts/MangoGrotesque-Thin.ttf") format("truetype");
  font-style: normal;
  font-weight: normal;
  text-rendering: optimizeLegibility;
}
@font-face {
  font-family: "dirtyline-36daysoftype-2022";
  src: url("../fonts/dirtyline-36daysoftype-2022.otf");
  font-style: normal;
  font-weight: normal;
  text-rendering: optimizeLegibility;
}
@font-face {
  font-family: "ClashDisplay-Light";
  src: url("../fonts/ClashDisplay-Light.woff2") format("woff2"), url("../fonts/ClashDisplay-Light.woff") format("woff"), url("../fonts/ClashDisplay-Light.ttf") format("truetype");
  font-weight: 300;
  font-display: swap;
  font-style: normal;
}
@font-face {
  font-family: "ClashDisplay-Regular";
  src: url("../fonts/ClashDisplay-Regular.woff2") format("woff2"), url("../fonts/ClashDisplay-Regular.woff") format("woff"), url("../fonts/ClashDisplay-Regular.ttf") format("truetype");
  font-weight: 400;
  font-display: swap;
  font-style: normal;
}
@font-face {
  font-family: "ClashDisplay-Medium";
  src: url("../fonts/ClashDisplay-Medium.woff2") format("woff2"), url("../fonts/ClashDisplay-Medium.woff") format("woff"), url("../fonts/ClashDisplay-Medium.ttf") format("truetype");
  font-weight: 500;
  font-display: swap;
  font-style: normal;
}
@font-face {
  font-family: "ClashDisplay-Semibold";
  src: url("../fonts/ClashDisplay-Semibold.woff2") format("woff2"), url("../fonts/ClashDisplay-Semibold.woff") format("woff"), url("../fonts/ClashDisplay-Semibold.ttf") format("truetype");
  font-weight: 600;
  font-display: swap;
  font-style: normal;
}
@font-face {
  font-family: "ClashDisplay-Bold";
  src: url("../fonts/ClashDisplay-Bold.woff2") format("woff2"), url("../fonts/ClashDisplay-Bold.woff") format("woff"), url("../fonts/ClashDisplay-Bold.ttf") format("truetype");
  font-weight: 700;
  font-display: swap;
  font-style: normal;
}
:root {
  /**
  @font family declaration
  */
  --tp-ff-teko: 'Teko', serif;
  --tp-ff-body: 'Inter', sans-serif;
  --tp-ff-heading: 'Inter', sans-serif;
  --tp-ff-inter: 'Inter', sans-serif;
  --tp-ff-p: 'Inter', sans-serif;
  --tp-ff-besley: 'Besley', serif;
  --tp-ff-mango-thin: 'MangoGrotesqueThin', serif;
  --tp-ff-mango-light: 'MangoGrotesqueLight', serif;
  --tp-ff-mango: 'MangoGrotesque', serif;
  --tp-ff-mango-medium: 'MangoGrotesqueMed', serif;
  --tp-ff-mango-semibold: 'MangoGrotesqueSemBd', serif;
  --tp-ff-mango-bold: 'MangoGrotesque', serif;
  --tp-ff-clash-light: 'ClashDisplay-Light', serif;
  --tp-ff-clash-regular: 'ClashDisplay-Regular', serif;
  --tp-ff-clash-medium: 'ClashDisplay-Medium', serif;
  --tp-ff-clash-semibold: 'ClashDisplay-Semibold', serif;
  --tp-ff-clash-bold: 'ClashDisplay-Bold', serif;
  --tp-ff-grotesk: 'Space Grotesk', serif;
  --tp-ff-platform: 'Platform', serif;
  --tp-ff-playfair: 'Playfair Display', serif;
  --tp-ff-satisfy: 'Satisfy', cursive;
  --tp-ff-dirtyline: 'dirtyline-36daysoftype-2022', serif;
  --tp-ff-phudu: 'Phudu', serif;
  --tp-ff-poppins: 'Poppins', serif;
  --tp-ff-onest: 'Onest', serif;
  --tp-ff-fontawesome: "Font Awesome 6 Pro";
  /**
  @color declaration
  */
  --tp-common-white: #ffffff;
  --tp-common-black: #141414;
  --tp-common-black-2: #232323;
  --tp-common-black-3: #000;
  --tp-common-black-4: #0a0a0a;
  --tp-common-black-5: #121212;
  --tp-common-black-6: #212121;
  --tp-common-black-7: #0E0F11;
  --tp-common-black-8: #1a1b1e;
  --tp-common-black-9: #16302f;
  --tp-common-black-10: #21212D;
  --tp-common-cream: #f9f4e8;
  --tp-common-cream-2: #FFF6BF;
  --tp-common-cream-3: #ffffe6;
  --tp-common-yellow: #ffc446;
  --tp-common-yellow-1: #FFF669;
  --tp-common-yellow-green: #E9FF48;
  --tp-common-green-light: #D0FF71;
  --tp-common-green-regular: #C1ED00;
  --tp-common-green-1: #B4E717;
  --tp-common-green-solid: #17312F;
  --tp-common-pink-light: #FDE1DA;
  --tp-common-paste: #43D4A0;
  --tp-common-paste-2: #0C5752;
  --tp-common-sky: #C5FCFC;
  --tp-common-red: #FF4851;
  --tp-common-red-2: #FF481F;
  --tp-common-red-3: #FF5722;
  --tp-common-blue: #7463FF;
  --tp-common-brown: #453030;
  --tp-grey-1: #f8f8f8;
  --tp-grey-2: #f1f1f1;
  --tp-grey-3: #F8F8FB;
  --tp-grey-4: #F6F8EF;
  --tp-coffe-1: #653624;
  --tp-coffe-2: #552411;
  --tp-cream-1: #B7AB98;
  --tp-cream-2: #CFC292;
  --tp-text-body: #2e2d2d;
  --tp-theme-green: #A0FF27;
  --tp-theme-pink: #EC6FD5;
  --tp-theme-yellow: #FFB701;
  --tp-border-1: #EAEBED;
  --tp-border-2: #e7e7e7;
}

* {
  margin: 0;
  padding: 0;
  box-sizing: border-box;
}

html {
  scroll-behavior: smooth;
}

@media (min-width: 1400px) {
  .container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
    max-width: 1510px;
  }
  .container-1830 {
    max-width: 1830px;
  }
  .container-1800 {
    max-width: 1800px;
  }
  .container-1750 {
    max-width: 1750px;
  }
  .container-1730 {
    max-width: 1730px;
  }
  .container-1680 {
    max-width: 1680px;
  }
  .container-1630 {
    max-width: 1630px;
  }
  .container-1610 {
    max-width: 1610px;
  }
  .container-1580 {
    max-width: 1580px;
  }
  .container-1550 {
    max-width: 1550px;
  }
  .container-1530 {
    max-width: 1530px;
  }
  .container-1460 {
    max-width: 1460px;
  }
  .container-1430 {
    max-width: 1430px;
  }
  .container-1350 {
    max-width: 1350px;
  }
  .container-1330 {
    max-width: 1330px;
  }
  .container-1320 {
    max-width: 1320px;
  }
  .container-1300 {
    max-width: 1300px;
  }
  .container-1230 {
    max-width: 1230px;
  }
  .container-1200 {
    max-width: 1200px;
  }
  .container-1030 {
    max-width: 1030px;
  }
}
/*---------------------------------
	typography css start 
---------------------------------*/
body {
  font-size: 14px;
  line-height: 26px;
  font-weight: normal;
  color: var(--tp-text-body);
  font-family: var(--tp-ff-body);
}

img {
  max-width: 100%;
}

a {
  text-decoration: none;
}

h1,
h2,
h3,
h4,
h5,
h6 {
  margin-top: 0px;
  font-weight: 500;
  line-height: 1.2;
  -webkit-transition: color 0.3s ease-in-out;
  -moz-transition: color 0.3s ease-in-out;
  -ms-transition: color 0.3s ease-in-out;
  -o-transition: color 0.3s ease-in-out;
  transition: color 0.3s ease-in-out;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-heading);
}

h1 {
  font-size: 40px;
}

h2 {
  font-size: 36px;
}

h3 {
  font-size: 28px;
}

h4 {
  font-size: 24px;
}

h5 {
  font-size: 20px;
}

h6 {
  font-size: 16px;
}

ul {
  margin: 0px;
  padding: 0px;
}

p {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.56;
  margin-bottom: 15px;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-p);
  color: var(--tp-text-body);
}

a:not([href]):not([class]),
a:not([href]):not([class]):hover {
  color: inherit;
  text-decoration: none;
}

a:focus,
.button:focus {
  text-decoration: none;
  outline: none;
}

a:focus,
a:hover {
  color: inherit;
  text-decoration: none;
}

a,
button {
  color: inherit;
  outline: none;
  border: none;
  background: transparent;
}

button:hover {
  cursor: pointer;
}

button:focus {
  outline: 0;
}

.uppercase {
  text-transform: uppercase;
}

.capitalize {
  text-transform: capitalize;
}

input[type=text],
input[type=email],
input[type=tel],
input[type=number],
input[type=password],
input[type=url],
textarea {
  outline: none;
  height: 60px;
  width: 100%;
  line-height: 60px;
  font-size: 16px;
  padding-left: 26px;
  padding-right: 26px;
  border-radius: 8px;
  background: rgb(246, 246, 249);
  color: var(--tp-common-black);
  border: 1px solid rgb(246, 246, 249);
}
input[type=text]::-webkit-input-placeholder,
input[type=email]::-webkit-input-placeholder,
input[type=tel]::-webkit-input-placeholder,
input[type=number]::-webkit-input-placeholder,
input[type=password]::-webkit-input-placeholder,
input[type=url]::-webkit-input-placeholder,
textarea::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  color: var(--tp-common-black);
}
input[type=text]::-moz-placeholder,
input[type=email]::-moz-placeholder,
input[type=tel]::-moz-placeholder,
input[type=number]::-moz-placeholder,
input[type=password]::-moz-placeholder,
input[type=url]::-moz-placeholder,
textarea::-moz-placeholder { /* Firefox 19+ */
  color: var(--tp-common-black);
}
input[type=text]:-moz-placeholder,
input[type=email]:-moz-placeholder,
input[type=tel]:-moz-placeholder,
input[type=number]:-moz-placeholder,
input[type=password]:-moz-placeholder,
input[type=url]:-moz-placeholder,
textarea:-moz-placeholder { /* Firefox 4-18 */
  color: var(--tp-common-black);
}
input[type=text]:-ms-input-placeholder,
input[type=email]:-ms-input-placeholder,
input[type=tel]:-ms-input-placeholder,
input[type=number]:-ms-input-placeholder,
input[type=password]:-ms-input-placeholder,
input[type=url]:-ms-input-placeholder,
textarea:-ms-input-placeholder { /* IE 10+  Edge*/
  color: var(--tp-common-black);
}
input[type=text]::placeholder,
input[type=email]::placeholder,
input[type=tel]::placeholder,
input[type=number]::placeholder,
input[type=password]::placeholder,
input[type=url]::placeholder,
textarea::placeholder { /* MODERN BROWSER */
  color: var(--tp-common-black);
}
input[type=text]:focus,
input[type=email]:focus,
input[type=tel]:focus,
input[type=number]:focus,
input[type=password]:focus,
input[type=url]:focus,
textarea:focus {
  border-color: var(--tp-common-black);
}
input[type=text]:focus::placeholder,
input[type=email]:focus::placeholder,
input[type=tel]:focus::placeholder,
input[type=number]:focus::placeholder,
input[type=password]:focus::placeholder,
input[type=url]:focus::placeholder,
textarea:focus::placeholder {
  opacity: 0;
}

textarea {
  line-height: 1.4;
  padding-top: 17px;
  padding-bottom: 17px;
}

input[type=color] {
  appearance: none;
  -moz-appearance: none;
  -webkit-appearance: none;
  background: none;
  border: 0;
  cursor: pointer;
  height: 100%;
  width: 100%;
  padding: 0;
  border-radius: 50%;
}

*::-moz-selection {
  background: var(--tp-common-black);
  color: var(--tp-common-white);
  text-shadow: none;
}

::-moz-selection {
  background: var(--tp-common-black);
  color: var(--tp-common-white);
  text-shadow: none;
}

::selection {
  background: var(--tp-common-black);
  color: var(--tp-common-white);
  text-shadow: none;
}

*::-moz-placeholder {
  color: var(--tp-common-black);
  font-size: 14px;
  opacity: 1;
}

*::placeholder {
  color: var(--tp-common-black);
  font-size: 14px;
  opacity: 1;
}

.tp-line-black {
  display: inline;
  transition: all 0.3s linear;
  background-repeat: no-repeat;
  background-size: 0% 1px, 0 1px;
  background-position: 100% 100%, 0 100%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.tp-line-black:hover {
  background-size: 0% 1px, 100% 1px;
}

.tp-line-white {
  display: inline;
  transition: all 0.3s linear;
  background-repeat: no-repeat;
  background-size: 0% 1px, 0 1px;
  background-position: 100% 100%, 0 100%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.tp-line-white.green {
  background-position: 100% 100%, 0 75%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.tp-line-white.cream {
  background-position: 100% 100%, 0 75%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.tp-line-white.cream-2 {
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.tp-line-white:hover {
  background-size: 0% 1px, 100% 1px;
}

.body-padding {
  padding: 0 20px;
}
@media (max-width: 767px) {
  .body-padding {
    padding: 0;
  }
}

.tp_img_reveal {
  visibility: hidden;
  overflow: hidden;
}

/*---------------------------------
    1.2 Common Classes
---------------------------------*/
.w-img img {
  width: 100%;
}

.m-img img {
  max-width: 100%;
}

.fix {
  overflow: hidden;
}

.clear {
  clear: both;
}

.z-index-1 {
  position: relative;
  z-index: 1;
}

.z-index-2 {
  position: relative;
  z-index: 2;
}

.z-index-3 {
  position: relative;
  z-index: 3;
}

.z-index-4 {
  position: relative;
  z-index: 4;
}

.z-index-5 {
  position: relative;
  z-index: 5;
}

.z-index-6 {
  position: relative;
  z-index: 6;
}

.z-index-7 {
  position: relative;
  z-index: 7;
}

.z-index-8 {
  position: relative;
  z-index: 8;
}

.z-index-9 {
  position: relative;
  z-index: 9;
}

.z-index-10 {
  position: relative;
  z-index: 10;
}

.gx-7 {
  --bs-gutter-x: 7px;
}

.gx-10 {
  --bs-gutter-x: 10px;
}

.gx-12 {
  --bs-gutter-x: 12px;
}

.gx-15 {
  --bs-gutter-x: 15px;
}

.gx-20 {
  --bs-gutter-x: 20px;
}

.gx-24 {
  --bs-gutter-x: 24px;
}

.gx-30 {
  --bs-gutter-x: 30px;
}

.gx-40 {
  --bs-gutter-x: 40px;
}

.gx-45 {
  --bs-gutter-x: 45px;
}

.gx-50 {
  --bs-gutter-x: 50px;
}

.gx-55 {
  --bs-gutter-x: 55px;
}

.gx-60 {
  --bs-gutter-x: 60px;
}

.gx-70 {
  --bs-gutter-x: 70px;
}

.gx-80 {
  --bs-gutter-x: 80px;
}

.gx-90 {
  --bs-gutter-x: 90px;
}

.gx-100 {
  --bs-gutter-x: 100px;
}

.gx-135 {
  --bs-gutter-x: 135px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .gx-135 {
    --bs-gutter-x: 30px;
  }
}

.overflow-y-visible {
  overflow-x: hidden;
  overflow-y: visible;
}

.text-capitalize {
  text-transform: capitalize;
}

.text-uppercase {
  text-transform: uppercase;
}

.p-relative {
  position: relative;
}

.p-absolute {
  position: absolute;
}

.include-bg {
  background-position: center;
  background-size: cover;
  background-repeat: no-repeat;
}

/* dropcap */
.tp-dropcap::first-letter {
  float: left;
  width: 65px;
  height: 85px;
  font-size: 90px;
  line-height: 0.8;
  font-weight: 500;
  margin-right: 5px;
  text-align: center;
  line-height: inherit;
  text-transform: capitalize;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-body);
}

.coffe-bg {
  background-color: var(--tp-coffe-1);
}

.counter-row {
  counter-reset: count;
}

/*----------------------------------------*/
/*  2.1 Back to top
/*----------------------------------------*/
.back-to-top-wrapper {
  position: fixed;
  right: 50px;
  bottom: 0;
  height: 44px;
  width: 44px;
  cursor: pointer;
  display: block;
  border-radius: 50%;
  z-index: 99;
  opacity: 0;
  visibility: hidden;
}
@media (max-width: 767px) {
  .back-to-top-wrapper {
    right: 20px;
    bottom: 20px;
  }
}
.back-to-top-wrapper.back-to-top-btn-show {
  visibility: visible;
  opacity: 1;
  bottom: 50px;
}

.back-to-top-btn {
  display: inline-block;
  width: 44px;
  height: 44px;
  line-height: 44px;
  text-align: center;
  border-radius: 50%;
  color: var(--tp-common-black);
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  background: var(--tp-common-white);
  box-shadow: 0px 8px 16px rgba(3, 4, 28, 0.3);
}
.back-to-top-btn svg {
  -webkit-transform: translateY(-2px);
  -moz-transform: translateY(-2px);
  -ms-transform: translateY(-2px);
  -o-transform: translateY(-2px);
  transform: translateY(-2px);
}
.back-to-top-btn:hover {
  -webkit-transform: translateY(-4px);
  -moz-transform: translateY(-4px);
  -ms-transform: translateY(-4px);
  -o-transform: translateY(-4px);
  transform: translateY(-4px);
}

/*----------------------------------------*/
/*  2.2 Buttons
/*----------------------------------------*/
.tp-btn-black {
  position: relative;
  display: inline-block;
}
.tp-btn-black-text {
  font-size: 16px;
  font-weight: 500;
  padding: 7px 22px;
  border-radius: 9999px;
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-btn-black-text {
    font-size: 14px;
    padding: 7px 17px;
  }
}
@media (max-width: 767px) {
  .tp-btn-black-text {
    font-size: 15px;
    padding: 7px 13px;
  }
}
.tp-btn-black-filter-blur {
  position: absolute;
  top: 0;
  left: 0;
}
.tp-btn-black-circle {
  width: 36px;
  height: 36px;
  line-height: 32px;
  margin-left: -4px;
  text-align: center;
  border-radius: 9999px;
  transition-duration: 0.9s;
  background: var(--tp-common-black);
  transition-timing-function: cubic-bezier(0.135, 0.9, 0.15, 1);
}
.tp-btn-black-circle > svg {
  width: 14px;
  margin-left: 3px;
  color: var(--tp-common-white);
  transform: translateX(-2px);
}
.tp-btn-black:hover .tp-btn-black-circle {
  transform: translateX(12px) rotate(45deg);
}
.tp-btn-black.btn-green-bg .tp-btn-black-text {
  color: var(--tp-common-black);
  background-color: var(--tp-theme-green);
}
.tp-btn-black.btn-green-bg .tp-btn-black-circle {
  background: var(--tp-theme-green);
}
.tp-btn-black.btn-green-bg .tp-btn-black-circle svg {
  color: var(--tp-common-black);
}
.tp-btn-black.btn-green-bg:hover .tp-btn-black-circle {
  transform: translateX(12px) rotate(45deg);
}
.tp-btn-black.btn-red-bg .tp-btn-black-text {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.tp-btn-black.btn-red-bg .tp-btn-black-circle {
  background: var(--tp-common-red-3);
}
.tp-btn-black.btn-red-bg .tp-btn-black-circle svg {
  color: var(--tp-common-white);
}
.tp-btn-black.btn-red-bg:hover .tp-btn-black-circle {
  transform: translateX(12px) rotate(45deg);
}
.tp-btn-black.btn-white-bg .tp-btn-black-text {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.tp-btn-black.btn-white-bg .tp-btn-black-circle {
  background: var(--tp-common-white);
}
.tp-btn-black.btn-white-bg .tp-btn-black-circle svg {
  color: var(--tp-common-black);
}
.tp-btn-black.btn-white-bg:hover .tp-btn-black-circle {
  transform: translateX(12px) rotate(45deg);
}
.tp-btn-black.btn-green-light-bg .tp-btn-black-text {
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-light);
}
.tp-btn-black.btn-green-light-bg .tp-btn-black-circle {
  background-color: var(--tp-common-green-light);
}
.tp-btn-black.btn-green-light-bg .tp-btn-black-circle svg {
  color: var(--tp-common-black);
}
.tp-btn-black.btn-transparent-bg .tp-btn-black-text {
  color: var(--tp-common-white);
  background-color: #26282C;
}
.tp-btn-black.btn-transparent-bg .tp-btn-black-circle {
  background-color: #26282C;
}
.tp-btn-black.btn-transparent-bg .tp-btn-black-circle svg {
  color: var(--tp-common-white);
}
.tp-btn-black-square {
  padding: 20px 34px;
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  border-radius: 10px;
  display: inline-block;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.tp-btn-black-square span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-btn-black-square span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.tp-btn-black-square span span.text-2 {
  position: absolute;
  top: 100%;
  display: block;
  transition: 0.3s;
}
.tp-btn-black-square i {
  position: relative;
  overflow: hidden;
  width: 14px;
  height: 14px;
  display: inline-flex;
  margin-left: 7px;
}
.tp-btn-black-square i svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.2s ease-out;
}
.tp-btn-black-square i svg:last-child {
  left: -12px;
  bottom: -12px;
  transform: translate(0, 0);
  opacity: 0;
}
.tp-btn-black-square:hover {
  color: var(--tp-common-white);
}
.tp-btn-black-square:hover span span.text-1 {
  -webkit-transform: translateY(-150%);
  transform: translateY(-150%);
}
.tp-btn-black-square:hover span span.text-2 {
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-btn-black-square:hover i svg:first-child {
  transform: translate(16px, -16px);
}
.tp-btn-black-square:hover i svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(13px, -13px);
}
.tp-btn-black-square:focus {
  color: var(--tp-common-white);
}
.tp-btn-black-square.yellow-bg {
  color: var(--tp-common-black);
  background-color: var(--tp-common-yellow);
}
.tp-btn-black-solid {
  display: inline-block;
  border-radius: 40px;
  padding: 18px 70px;
  font-size: 16px;
  line-height: 1;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
@media (max-width: 767px) {
  .tp-btn-black-solid {
    font-size: 15px;
    padding: 18px 30px;
  }
}
.tp-btn-black-solid:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-red-2);
  background-color: var(--tp-common-red-2);
}
.tp-btn-black-solid:focus {
  color: var(--tp-common-white);
}
.tp-btn-black-radius {
  font-size: 16px;
  font-weight: 600;
  padding: 4px 22px;
  padding-right: 4px;
  border-radius: 38px;
  display: inline-block;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
  background-color: #21212d;
  gap: 10px;
}
.tp-btn-black-radius span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-btn-black-radius span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
  transform: translateY(-1px);
}
.tp-btn-black-radius span span.text-2 {
  position: absolute;
  top: 100%;
  display: block;
  transition: 0.3s;
  transform: translateY(-1px);
}
.tp-btn-black-radius i {
  height: 38px;
  width: 38px;
  line-height: 38px;
  border-radius: 50%;
  margin-left: 2px;
  text-align: center;
  display: inline-block;
  background-color: var(--tp-common-white);
}
.tp-btn-black-radius i span {
  position: relative;
  overflow: hidden;
  width: 14px;
  height: 14px;
  display: inline-flex;
}
.tp-btn-black-radius i svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.2s ease-out;
}
.tp-btn-black-radius i svg:last-child {
  left: -12px;
  bottom: -12px;
  transform: translate(0, 0);
  opacity: 0;
}
.tp-btn-black-radius:hover {
  color: var(--tp-common-white);
}
.tp-btn-black-radius:hover span span.text-1 {
  -webkit-transform: translateY(-150%);
  transform: translateY(-150%);
}
.tp-btn-black-radius:hover span span.text-2 {
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-btn-black-radius:hover i svg:first-child {
  transform: translate(16px, -16px);
}
.tp-btn-black-radius:hover i svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(13px, -13px);
}
.tp-btn-black-radius:focus {
  color: var(--tp-common-white);
}
.tp-btn-black-radius.btn-blue-bg {
  padding: 5px 22px;
  padding-right: 5px;
  background-color: var(--tp-common-blue);
  border: 1px solid rgba(238, 241, 234, 0.04);
}
.tp-btn-black-radius.btn-blue-bg i {
  height: 48px;
  width: 48px;
  line-height: 50px;
}
.tp-btn-black-radius.btn-blue-bg.btn-border {
  background-color: transparent;
  color: var(--tp-common-black-10);
  border: 1px solid rgba(33, 33, 45, 0.1);
}
.tp-btn-black-radius.btn-blue-bg.btn-border i {
  line-height: 52px;
  color: var(--tp-common-white);
  background-color: var(--tp-common-black-10);
}
.tp-btn-black-radius.btn-blue-bg.btn-border i span {
  width: 19px;
  height: 15px;
  margin-left: 2px;
  display: inline-block;
}
.tp-btn-black-radius.btn-blur {
  backdrop-filter: blur(20px);
  background: rgba(255, 255, 255, 0.1);
  border: 1.5px solid rgba(255, 255, 255, 0.3);
}
.tp-btn-border {
  font-weight: 400;
  font-size: 40px;
  transition: 0.3s;
  border-radius: 6px;
  padding: 8px 20px;
  line-height: 1;
  display: inline-block;
  letter-spacing: 1px;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-mango);
  border: 1px solid rgba(249, 244, 232, 0.1);
}
.tp-btn-border:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-cream);
  background-color: var(--tp-common-cream);
}
.tp-btn-border-2 {
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  transition: 0.3s;
  padding: 15px 25px;
  border-radius: 24px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
  border: 1px solid rgba(25, 25, 25, 0.1);
}
.tp-btn-border-2:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-red-2);
  background-color: var(--tp-common-red-2);
}
.tp-btn-border-2 span svg {
  margin-left: 6px;
  transform: translateY(-2px);
}
.tp-btn-border-2.st {
  font-size: 18px;
  font-weight: 600;
  padding: 14px 28px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
  border-color: rgba(69, 48, 48, 0.15);
}
.tp-btn-border-2.st:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-brown);
  background-color: var(--tp-common-brown);
}
.tp-btn-sky-border {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.02em;
  color: var(--tp-common-sky);
  border: 1.5px solid #c5fcfc;
  border-radius: 50px;
  padding: 22px 36px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-btn-sky-border {
    padding: 17px 25px;
  }
}
@media (max-width: 767px) {
  .tp-btn-sky-border {
    padding: 16px 25px;
  }
}
.tp-btn-sky-border:hover {
  background-color: #c5fcfc;
  color: var(--tp-common-black);
}
.tp-btn-sky-border.height-50 {
  padding: 16px 36px;
}
.tp-btn-sky-border.solid-bg {
  color: var(--tp-common-black);
  background-color: #c5fcfc;
}
.tp-btn-sky-border.solid-bg:hover {
  color: var(--tp-common-sky);
  background-color: transparent;
}
.tp-btn-sky {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.02em;
  border-radius: 50px;
  padding: 20px 36px;
  background-color: #c5fcfc;
  color: var(--tp-common-black);
}
.tp-btn-yellow {
  font-weight: 600;
  font-size: 14px;
  line-height: 1;
  padding: 12px 24px;
  display: inline-block;
  letter-spacing: -0.01em;
  color: var(--tp-common-black);
  background-color: var(--tp-common-yellow);
  border: 1px solid rgba(255, 255, 255, 0.3);
}
@media (max-width: 767px) {
  .tp-btn-yellow {
    padding: 12px 13px;
  }
}
.tp-btn-yellow span {
  margin-right: 8px;
}
.tp-btn-yellow span svg {
  transform: translateY(-1px);
}
.tp-btn-green-border {
  font-weight: 600;
  font-size: 14px;
  line-height: 1;
  padding: 16px 28px 14px;
  border-radius: 30px;
  display: inline-block;
  text-transform: uppercase;
  color: #2A4C3A;
  border: 1px solid #2A4C3A;
}
.tp-btn-green-border span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-btn-green-border span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.tp-btn-green-border span span.text-2 {
  position: absolute;
  bottom: 100%;
  display: block;
  transition: 0.3s;
}
.tp-btn-green-border i {
  position: relative;
  overflow: hidden;
  width: 12px;
  height: 12px;
  display: inline-flex;
  margin-left: 8px;
}
.tp-btn-green-border i svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.2s ease-out;
}
.tp-btn-green-border i svg:last-child {
  left: -12px;
  bottom: -12px;
  transform: translate(0, 0);
  opacity: 0;
}
.tp-btn-green-border:hover {
  color: #2A4C3A;
}
.tp-btn-green-border:hover span span.text-1 {
  -webkit-transform: translateY(150%);
  transform: translateY(150%);
}
.tp-btn-green-border:hover span span.text-2 {
  bottom: 50%;
  -webkit-transform: translateY(50%);
  transform: translateY(50%);
}
.tp-btn-green-border:hover i {
  display: inline-block;
  transform: translateY(-1px);
}
.tp-btn-green-border:hover i svg:first-child {
  transform: translate(16px, -16px);
}
.tp-btn-green-border:hover i svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(13px, -13px);
}
.tp-btn-green-border:focus {
  color: #2A4C3A;
}
.tp-btn-yellow-green {
  border-radius: 10px;
  padding: 16px 24px;
  font-weight: 600;
  font-size: 14px;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.01em;
  text-transform: uppercase;
  color: var(--tp-common-black-9);
  background-color: var(--tp-common-yellow-green);
}
.tp-btn-yellow-green span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-btn-yellow-green span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-green span span.text-2 {
  position: absolute;
  top: 100%;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-green.lg {
  font-size: 16px;
  padding: 22px 28px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-btn-yellow-green.lg {
    font-size: 14px;
    padding: 17px 20px;
  }
}
.tp-btn-yellow-green.green-solid {
  gap: 8px;
  line-height: 1;
  font-size: 16px;
  font-weight: 600;
  padding: 18px 24px;
  letter-spacing: -0.01em;
  text-transform: capitalize;
  color: var(--tp-common-black);
  display: inline-flex;
  align-items: center;
  justify-content: center;
  background-color: var(--tp-common-green-regular);
}
.tp-btn-yellow-green.green-solid span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-btn-yellow-green.green-solid span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-green.green-solid span span.text-2 {
  position: absolute;
  top: 100%;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-green.green-solid.btn-60 {
  padding: 23px 24px;
}
.tp-btn-yellow-green.green-solid.btn-60 span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-btn-yellow-green.green-solid.btn-60 span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-green.green-solid.btn-60 span span.text-2 {
  position: absolute;
  top: 100%;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-green.green-solid.btn-60 i {
  position: relative;
  overflow: hidden;
  width: 14px;
  height: 14px;
  display: inline-flex;
  margin-left: 4px;
}
.tp-btn-yellow-green.green-solid.btn-60 i svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.2s ease-out;
}
.tp-btn-yellow-green.green-solid.btn-60 i svg:last-child {
  left: -12px;
  bottom: -12px;
  transform: translate(0, 0);
  opacity: 0;
}
.tp-btn-yellow-green.green-solid.btn-60:hover {
  color: var(--tp-common-black);
}
.tp-btn-yellow-green.green-solid.btn-60:hover span span.text-1 {
  -webkit-transform: translateY(-150%);
  transform: translateY(-150%);
}
.tp-btn-yellow-green.green-solid.btn-60:hover span span.text-2 {
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-btn-yellow-green.green-solid.btn-60:hover i svg:first-child {
  transform: translate(16px, -16px);
}
.tp-btn-yellow-green.green-solid.btn-60:hover i svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(13px, -13px);
}
.tp-btn-yellow-green.green-solid:hover {
  color: var(--tp-common-black);
}
.tp-btn-yellow-green.green-solid:hover span span.text-1 {
  -webkit-transform: translateY(-150%);
  transform: translateY(-150%);
}
.tp-btn-yellow-green.green-solid:hover span span.text-2 {
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-btn-yellow-green.green-solid:focus {
  color: var(--tp-common-black);
}
.tp-btn-yellow-green:hover {
  color: var(--tp-common-black);
}
.tp-btn-yellow-green:hover span span.text-1 {
  -webkit-transform: translateY(-150%);
  transform: translateY(-150%);
}
.tp-btn-yellow-green:hover span span.text-2 {
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-btn-yellow-green:focus {
  color: var(--tp-common-black);
}
.tp-btn-yellow-green.sidebar-btn {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  color: #16302f;
  padding: 18px 24px;
  letter-spacing: -0.01em;
  background-color: #D0FF71;
}
.tp-btn-yellow-green.sidebar-btn.sidebar-btn-style {
  padding: 20px 54px;
  padding-bottom: 16px;
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  color: #16302f;
  letter-spacing: -0.01em;
}
.tp-btn-yellow-border {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  padding: 21px 28px;
  border-radius: 10px;
  display: inline-block;
  letter-spacing: -0.01em;
  text-transform: uppercase;
  color: var(--tp-common-yellow-green);
  border: 1px solid var(--tp-common-yellow-green);
}
.tp-btn-yellow-border span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-btn-yellow-border span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-border span span.text-2 {
  position: absolute;
  bottom: 100%;
  display: block;
  transition: 0.3s;
}
.tp-btn-yellow-border i {
  position: relative;
  overflow: hidden;
  width: 12px;
  height: 12px;
  display: inline-flex;
  margin-left: 7px;
}
.tp-btn-yellow-border i svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.2s ease-out;
}
.tp-btn-yellow-border i svg:last-child {
  left: -12px;
  bottom: -12px;
  transform: translate(0, 0);
  opacity: 0;
}
@media (max-width: 767px) {
  .tp-btn-yellow-border {
    font-size: 14px;
    padding: 15px 20px;
  }
}
.tp-btn-yellow-border.sm {
  font-size: 14px;
  padding: 15px 28px;
}
.tp-btn-yellow-border:hover {
  color: var(--tp-common-yellow-green);
}
.tp-btn-yellow-border:hover span span.text-1 {
  -webkit-transform: translateY(150%);
  transform: translateY(150%);
}
.tp-btn-yellow-border:hover span span.text-2 {
  bottom: 50%;
  -webkit-transform: translateY(50%);
  transform: translateY(50%);
}
.tp-btn-yellow-border:hover i svg:first-child {
  transform: translate(16px, -16px);
}
.tp-btn-yellow-border:hover i svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(13px, -13px);
}
.tp-btn-yellow-border:focus {
  color: var(--tp-common-yellow-green);
}
.tp-btn-yellow-border.postbox-btn {
  font-weight: 600;
  font-size: 15px;
  line-height: 1;
  color: #d0ff71;
  padding: 15.5px 28px;
  background: #1a1b1e;
  border: 1px solid #1a1b1e;
}
.tp-btn-yellow-border.postbox-btn i {
  width: 15px;
  height: 15px;
  border-radius: 14px;
}
.tp-btn-red-border {
  border-radius: 20px;
  padding: 11px 20px;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-semibold);
  border: 1.5px solid var(--tp-common-red);
}
.tp-btn-red-border:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red);
}
.tp-btn-red-border.about-us-2 {
  color: var(--tp-common-black-10);
}
.tp-btn-red-border.about-us-2:hover {
  color: var(--tp-common-white);
}
.tp-btn-gradient {
  display: flex;
  position: relative;
  align-items: center;
  overflow: hidden;
  font-weight: 600;
  font-size: 17px;
  line-height: 1;
  z-index: 1;
  margin: 1px;
  transition: 0.4s;
  border-radius: 14px;
  padding: 22px 30px;
  padding-top: 25px;
  display: inline-block;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
  background: linear-gradient(230deg, #FF994B 6.7%, #D34BE9 48.83%, #3188FF 90.96%);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-btn-gradient {
    font-size: 16px;
    padding: 15px 25px;
    padding-top: 18px;
  }
}
.tp-btn-gradient:hover {
  color: var(--tp-common-white);
}
.tp-btn-gradient:focus {
  color: var(--tp-common-white);
}
.tp-btn-gradient span {
  margin-right: 10px;
  display: inline-block;
}
.tp-btn-gradient span svg {
  transform: translateY(-2px);
}
.tp-btn-gradient.sm {
  padding-top: 0;
  padding: 13px 24px;
  position: relative;
}
.tp-btn-black-border {
  margin: 1px;
  display: flex;
  align-items: center;
  font-weight: 600;
  font-size: 17px;
  line-height: 1;
  border-radius: 14px;
  padding: 12px 24px;
  display: inline-block;
  letter-spacing: -0.01em;
  backdrop-filter: blur(10px);
  color: var(--tp-common-white);
  background: rgb(41, 38, 54);
  border: 1px solid rgba(255, 246, 191, 0.1);
}
.tp-btn-black-border:hover {
  color: var(--tp-common-white);
}
.tp-btn-black-border:focus {
  color: var(--tp-common-white);
}
.tp-btn-black-border span {
  margin-right: 10px;
  display: inline-block;
}
.tp-btn-black-border span svg {
  transform: translateY(-2px);
}
.tp-btn-red-circle-box {
  display: inline-flex;
  width: -moz-fit-content;
  width: fit-content;
}
.tp-btn-red-circle-box > *:nth-child(1) {
  transform: scale3d(0.5, 0.5, 1);
  margin-inline-end: -55px;
}
.tp-btn-red-circle-box > *:nth-child(2) {
  transform: scale3d(1, 1, 1);
}
.tp-btn-red-circle-box > *:nth-child(3) {
  transform: scale3d(1, 1, 1);
  margin-inline-start: 0;
}
.tp-btn-red-circle-box:hover > *:nth-child(1) {
  transform: scale3d(1, 1, 1);
  margin-inline-end: 0;
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-2);
}
.tp-btn-red-circle-box:hover > *:nth-child(2) {
  position: relative;
  z-index: 1;
  transform: scale3d(1, 1, 1);
}
.tp-btn-red-circle-box:hover > *:nth-child(3) {
  transform: scale3d(0.5, 0.5, 1);
  margin-inline-start: -55px;
}
.tp-btn-red-circle-box:hover .tp-btn-red-circle-text {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-2);
}
.tp-btn-red-circle-box.tp-pp-btn-style .tp-btn-red-circle-text {
  font-size: 16px;
  font-weight: 600;
  color: #FFF669;
  letter-spacing: -0.32px;
  text-transform: capitalize;
  background-color: transparent;
  border: 1px solid #FFF669;
  font-family: var(--tp-ff-inter);
}
.tp-btn-red-circle-box.tp-pp-btn-style .tp-btn-red-circle-icon {
  background: #FFF669;
  color: var(--tp-common-black);
  border: 1px solid #FFF669;
}
.tp-btn-red-circle-box.tp-pp-btn-style > :nth-child(1) {
  opacity: 0;
}
.tp-btn-red-circle-box.tp-pp-btn-style:hover .tp-btn-red-circle-text {
  color: var(--tp-common-black);
  background-color: #FFF669;
}
.tp-btn-red-circle-box.tp-pp-btn-style:hover > *:nth-child(1) {
  opacity: 1;
}
.tp-btn-red-circle-box.tp-pp-btn-style:hover > *:nth-child(3) {
  opacity: 0;
}
.tp-btn-red-circle-icon {
  height: 54px;
  width: 54px;
  line-height: 50px;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  color: var(--tp-common-red-2);
  border: 1px solid var(--tp-common-red-2);
}
.tp-btn-red-circle-text {
  font-size: 15px;
  line-height: 1;
  border-radius: 30px;
  padding: 18.5px 36px;
  letter-spacing: 1px;
  display: inline-block;
  text-transform: uppercase;
  background-color: #F2F1EE;
  color: var(--tp-common-red-2);
  font-family: var(--tp-ff-clash-medium);
  border: 1px solid var(--tp-common-red-2);
}
.tp-btn-white-border {
  font-size: 15px;
  font-weight: 500;
  color: #0E0F11;
  display: inline-block;
  border-radius: 40px;
  padding: 6px 20px 6px;
  backdrop-filter: blur(10px);
  letter-spacing: -0.15px;
  background-color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-btn-white-border.coffee-bg {
  padding: 7px 30px;
  background-color: #4d3d30;
  text-transform: capitalize;
  color: var(--tp-common-white);
}
.tp-btn-white-border.coffee-bg:hover {
  color: #4d3d30;
  border-color: #4d3d30;
  background-color: transparent;
}
.tp-btn-white-border.coffee-bg.border-none {
  color: #4d3d30;
  border-color: #4d3d30;
  background-color: transparent;
}
.tp-btn-white-border.coffee-bg.border-none:hover {
  border-color: #4d3d30;
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.tp-btn-white-border:hover {
  color: var(--tp-common-white);
  background-color: transparent;
  border-color: var(--tp-common-white);
}
.tp-btn-white-border span {
  margin-left: 4px;
  display: inline-block;
}
.tp-btn-white-border.tp-btn-transparent {
  color: var(--tp-common-white);
  background-color: transparent;
  border-color: rgba(255, 255, 255, 0.2);
}
.tp-btn-white-border.tp-btn-transparent:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.tp-btn-animation {
  height: 50px;
  line-height: 1;
  padding: 17px 15px;
  border-radius: 30px;
  display: inline-block;
  white-space: nowrap;
  animation: scrollText 20s infinite linear;
  background: rgba(255, 255, 255, 0.08);
}
.tp-btn-animation:hover {
  animation-play-state: paused;
}
.tp-btn-animation span {
  font-weight: 600;
  font-size: 18px;
  z-index: 9;
  overflow: hidden;
  display: inline-block;
  text-transform: uppercase;
  position: relative;
  transition: all 0.3s;
  color: var(--tp-common-white);
}
.tp-btn-animation span svg {
  margin-right: 8px;
  margin-left: 8px;
}

.tp-btn-cream-bdr {
  height: 50px;
  line-height: 50px;
  padding: 0 25px;
  font-size: 14px;
  font-weight: 500;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-poppins);
  border: 1px solid var(--tp-cream-2);
  transition: 0.3s;
}
.tp-btn-cream-bdr:hover {
  background-color: var(--tp-cream-2);
  color: var(--tp-coffe-1);
}

/* Glow Border Animation */
.animated-border-box {
  position: relative;
  overflow: hidden;
  z-index: 0;
  line-height: 0;
  border-radius: 14px;
  display: inline-block;
  transition: 0.4s;
}
.animated-border-box:hover {
  transform: scale(1.1);
}
.animated-border-box:before {
  content: "";
  z-index: -2;
  text-align: center;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%) rotate(0deg);
  position: absolute;
  width: 99999px;
  height: 99999px;
  background-repeat: no-repeat;
  background-position: 0 0;
  background-image: conic-gradient(rgba(0, 0, 0, 0), #FFF, rgba(0, 0, 0, 0) 25%);
  animation: rotate 4s linear infinite;
}
.animated-border-box.radius-style-2 {
  border-radius: 100px;
}
.animated-border-box.radius-style-2 .tp-btn-gradient.sm {
  border-radius: 100px;
}
.animated-border-box.radius-style-2::before {
  background-image: conic-gradient(rgba(0, 0, 0, 0), #21212D, rgba(0, 0, 0, 0) 25%);
}
.animated-border-box.border-icon .tp-btn-gradient span {
  padding-right: 10px;
  border-right: 1px solid rgba(255, 255, 255, 0.3);
}
.animated-border-box.border-icon::before {
  background-image: conic-gradient(rgba(0, 0, 0, 0), #21212D, rgba(0, 0, 0, 0) 25%);
}

.tp-action-btn {
  font-size: 15px;
  font-weight: 600;
  color: #4D3D30;
  width: 100%;
  padding: 11px 50px;
  background: #F4F0EA;
  display: inline-block;
  text-transform: uppercase;
  backdrop-filter: blur(10px);
  border: 1px solid rgba(77, 61, 48, 0.1);
  transform: translateY(100%);
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.tp-action-btn:hover {
  color: var(--tp-common-white);
  background-color: #4D3D30;
}

.tp-quick-view-btn {
  height: 40px;
  width: 40px;
  display: grid;
  color: #4d3d30;
  text-align: center;
  place-content: center;
  background-color: #F4F0EA;
  transform: translateX(100%);
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.tp-quick-view-btn:hover {
  color: var(--tp-common-white);
  background-color: #4D3D30;
}

.tp-portfolio-details-btn {
  font-size: 16px;
  font-weight: 600;
  padding: 9px 25px;
  border-radius: 24px;
  letter-spacing: -0.16px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-portfolio-details-btn:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.tp-portfolio-details-btn span {
  display: inline-block;
  margin-left: 15px;
}

/*----------------------------------------*/
/*  2.3 Animations
/*----------------------------------------*/
@keyframes rotate2 {
  from {
    transform: rotate(0deg);
  }
  to {
    transform: rotate(360deg);
  }
}
@keyframes animationglob {
  0% {
    -webkit-transform: rotate(0deg);
    transform: rotate(0deg);
  }
  100% {
    -webkit-transform: rotate(-360deg);
    transform: rotate(-360deg);
  }
}
@keyframes lqdItiImgOut {
  0% {
    transform: translateY(0) scale(1);
  }
  to {
    transform: translateY(100%) scale(1.15);
  }
}
@keyframes hero-circle-2 {
  0% {
    -webkit-transform: translateX(1000px);
    -moz-transform: translateX(1000px);
    -ms-transform: translateX(1000px);
    -o-transform: translateX(1000px);
    transform: translateX(1000px);
  }
  100% {
    -webkit-transform: translateX(0px);
    -moz-transform: translateX(0px);
    -ms-transform: translateX(0px);
    -o-transform: translateX(0px);
    transform: translateX(0px);
  }
}
@keyframes hero-circle-3 {
  0% {
    -webkit-transform: translateX(500px);
    -moz-transform: translateX(500px);
    -ms-transform: translateX(500px);
    -o-transform: translateX(500px);
    transform: translateX(500px);
  }
  100% {
    -webkit-transform: translateX(0px);
    -moz-transform: translateX(0px);
    -ms-transform: translateX(0px);
    -o-transform: translateX(0px);
    transform: translateX(0px);
  }
}
@keyframes move1 {
  0% {
    bottom: -300px;
    left: -300px;
  }
  30% {
    bottom: 100px;
    left: 300px;
  }
  60% {
    bottom: 200px;
    left: 600px;
  }
  100% {
    bottom: -300px;
    left: 1200px;
  }
}
@keyframes move1-reverse {
  0% {
    bottom: -150px;
    left: 1400px;
  }
  40% {
    bottom: 50px;
    left: 600px;
  }
  70% {
    bottom: 200px;
    left: 300px;
  }
  100% {
    bottom: -150px;
    left: -150px;
  }
}
@keyframes animate-pulse {
  0% {
    box-shadow: 0 0 0 0 rgba(255, 255, 255, 0.2), 0 0 0 0 rgba(255, 255, 255, 0.2);
  }
  40% {
    box-shadow: 0 0 0 50px rgba(255, 109, 74, 0), 0 0 0 0 rgba(255, 255, 255, 0.2);
  }
  80% {
    box-shadow: 0 0 0 50px rgba(255, 109, 74, 0), 0 0 0 30px rgba(255, 109, 74, 0);
  }
  100% {
    box-shadow: 0 0 0 0 rgba(255, 109, 74, 0), 0 0 0 30px rgba(255, 109, 74, 0);
  }
}
@keyframes animate-pulse-2 {
  0% {
    box-shadow: 0 0 0 0 rgba(255, 246, 105, 0.1), 0 0 0 0 rgba(255, 246, 105, 0.1);
  }
  40% {
    box-shadow: 0 0 0 50px rgba(255, 109, 74, 0), 0 0 0 0 rgba(255, 246, 105, 0.1);
  }
  80% {
    box-shadow: 0 0 0 50px rgba(255, 109, 74, 0), 0 0 0 30px rgba(255, 109, 74, 0);
  }
  100% {
    box-shadow: 0 0 0 0 rgba(255, 109, 74, 0), 0 0 0 30px rgba(255, 109, 74, 0);
  }
}
@keyframes rotate {
  100% {
    transform: translate(-50%, -50%) rotate(1turn);
  }
}
@keyframes marquee-horizontal {
  from {
    transform: translateX(0);
  }
  to {
    transform: translateX(-100%);
  }
}
@-webkit-keyframes video-border {
  0% {
    transform: translate(-50%, -50%) scale(1);
  }
  60% {
    opacity: 1;
  }
  100% {
    transform: translate(-50%, -50%) scale(2);
    opacity: 0;
  }
}
@-moz-keyframes video-border {
  0% {
    transform: translate(-50%, -50%) scale(1);
  }
  60% {
    opacity: 1;
  }
  100% {
    transform: translate(-50%, -50%) scale(2);
    opacity: 0;
  }
}
@-ms-keyframes video-border {
  0% {
    transform: translate(-50%, -50%) scale(1);
  }
  60% {
    opacity: 1;
  }
  100% {
    transform: translate(-50%, -50%) scale(2);
    opacity: 0;
  }
}
@keyframes video-border {
  0% {
    transform: translate(-50%, -50%) scale(1);
  }
  60% {
    opacity: 1;
  }
  100% {
    transform: translate(-50%, -50%) scale(2);
    opacity: 0;
  }
}
@keyframes scroll-up-down {
  0% {
    -webkit-transform: translateZ(0);
    transform: translateZ(0);
  }
}
@keyframes scroll1 {
  0% {
    top: 0px;
  }
  100% {
    top: 100%;
  }
}
@keyframes scroll2 {
  0% {
    top: 0px;
  }
  100% {
    top: 100%;
  }
}
@keyframes transform {
  0% {
    transform: scale(0.5);
    opacity: 0.8;
  }
  50% {
    transform: scale(1);
    opacity: 1;
  }
  100% {
    transform: scale(0.5);
    opacity: 0.8;
  }
}
@keyframes dash {
  0% {
    stroke-dashoffset: 1000;
  }
  100% {
    stroke-dashoffset: 0;
  }
}
.tp-zoom-in-out {
  -webkit-animation: tp_zoom_in_out 7s infinite linear;
  -moz-animation: tp_zoom_in_out 7s infinite linear;
  -ms-animation: tp_zoom_in_out 7s infinite linear;
  -o-animation: tp_zoom_in_out 7s infinite linear;
  animation: tp_zoom_in_out 7s infinite linear;
}

@-webkit-keyframes tp_zoom_in_out {
  0% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
  50% {
    -webkit-transform: scale(1);
    -moz-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
  }
  100% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
}
@-moz-keyframes tp_zoom_in_out {
  0% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
  50% {
    -webkit-transform: scale(1);
    -moz-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
  }
  100% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
}
@-ms-keyframes tp_zoom_in_out {
  0% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
  50% {
    -webkit-transform: scale(1);
    -moz-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
  }
  100% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
}
@keyframes tp_zoom_in_out {
  0% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
  50% {
    -webkit-transform: scale(1);
    -moz-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
  }
  100% {
    -webkit-transform: scale(0.8);
    -moz-transform: scale(0.8);
    -ms-transform: scale(0.8);
    -o-transform: scale(0.8);
    transform: scale(0.8);
  }
}
@keyframes scroll_anim {
  0% {
    transform: translateY(0);
  }
  50% {
    transform: translateY(10px);
  }
  100% {
    transform: translateY(0);
  }
}
@keyframes loadingAnimation {
  to {
    transform: rotate(-360deg);
  }
}
@keyframes roteted {
  0% {
    transform: rotate(0);
  }
  100% {
    transform: rotate(360deg);
  }
}
@keyframes headerSlideDown {
  0% {
    margin-top: -150px;
  }
  100% {
    margin-top: 0;
  }
}
@keyframes bar_anim {
  0%, 100% {
    -webkit-clip-path: inset(-2px 0);
    clip-path: inset(-2px 0);
  }
  42% {
    -webkit-clip-path: inset(-2px 0 -2px 100%);
    clip-path: inset(-2px 0 -2px 100%);
  }
  43% {
    -webkit-clip-path: inset(-2px 100% -2px 0);
    clip-path: inset(-2px 100% -2px 0);
  }
}
@keyframes scrollText {
  from {
    transform: translateX(0%);
  }
  to {
    transform: translateX(-50%);
  }
}
@keyframes fadeInUp {
  0% {
    opacity: 0;
    -webkit-transform: translateY(20px);
    -ms-transform: translateY(20px);
    transform: translateY(20px);
  }
  100% {
    opacity: 1;
    -webkit-transform: translateY(0);
    -ms-transform: translateY(0);
    transform: translateY(0);
  }
}
.fadeInUp {
  -webkit-animation-name: fadeInUp;
  animation-name: fadeInUp;
}

@-webkit-keyframes tpshake {
  10% {
    transform: translateY(-10px);
  }
  50% {
    transform: skew(15deg);
  }
  80% {
    transform: rotate(10deg);
  }
  100% {
    transform: translate(0);
  }
}
@-moz-keyframes tpshake {
  10% {
    transform: translateY(-10px);
  }
  50% {
    transform: skew(15deg);
  }
  80% {
    transform: rotate(10deg);
  }
  100% {
    transform: translate(0);
  }
}
@-ms-keyframes tpshake {
  10% {
    transform: translateY(-10px);
  }
  50% {
    transform: skew(15deg);
  }
  80% {
    transform: rotate(10deg);
  }
  100% {
    transform: translate(0);
  }
}
@keyframes tpshake {
  10% {
    transform: translateY(-10px);
  }
  50% {
    transform: skew(15deg);
  }
  80% {
    transform: rotate(10deg);
  }
  100% {
    transform: translate(0);
  }
}
/*----------------------------------------*/
/*  2.4 Preloader
/*----------------------------------------*/
#preloader {
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  z-index: 1000;
  background-color: var(--tp-theme-green);
}

.preloader {
  width: 50px;
  height: 50px;
  display: inline-block;
  padding: 0px;
  text-align: left;
  box-sizing: border-box;
  position: absolute;
  top: 50%;
  left: 50%;
  margin-left: -25px;
  margin-top: -25px;
}

.preloader span {
  position: absolute;
  display: inline-block;
  width: 50px;
  height: 50px;
  border-radius: 100%;
  background: var(--tp-common-black);
  animation: preloader 1.3s linear infinite;
  -webkit-animation: preloader 1.3s linear infinite;
}

.preloader span:last-child {
  animation-delay: -0.9s;
  -webkit-animation-delay: -0.9s;
}

@keyframes preloader {
  0% {
    transform: scale(0, 0);
    opacity: 0.5;
  }
  100% {
    transform: scale(1, 1);
    opacity: 0;
  }
}
@-webkit-keyframes preloader {
  0% {
    -webkit-transform: scale(0, 0);
    opacity: 0.5;
  }
  100% {
    -webkit-transform: scale(1, 1);
    opacity: 0;
  }
}
/*--- end of preloader ---*/
/*----------------------------------------*/
/*  2.5 Background
/*----------------------------------------*/
.grey-bg {
  background-color: var(--tp-grey-1);
}

.grey-bg-2 {
  background-color: var(--tp-grey-4);
}

.green-bg {
  background-color: var(--tp-theme-green);
}

.white-bg {
  background-color: var(--tp-common-white);
}

.black-bg {
  background-color: var(--tp-common-black);
}

.black-bg-3 {
  background-color: var(--tp-common-black-3);
}

.black-bg-4 {
  background-color: var(--tp-common-black-4);
}

.black-bg-5 {
  background-color: var(--tp-common-black-5);
}

.black-bg-6 {
  background-color: var(--tp-common-black-6);
}

.black-bg-7 {
  background-color: var(--tp-common-black-7);
}

.black-bg-8 {
  background-color: var(--tp-common-black-8);
}

.pink-light-bg {
  background-color: var(--tp-common-pink-light);
}

.yellow-bg {
  background-color: var(--tp-common-yellow);
}

.red-bg {
  background-color: var(--tp-common-red-2);
}

.red-bg-2 {
  background-color: var(--tp-common-red-3);
}

.yellow-green-bg {
  background-color: var(--tp-common-yellow-green);
}

.green-regular-bg {
  background-color: var(--tp-common-green-regular);
}

.paste-bg-2 {
  background-color: var(--tp-common-paste-2);
}

[data-bg-color=footer-bg-grey] {
  background-color: var(--tp-footer-grey-1);
}

[data-bg-color=footer-bg-white] {
  background-color: var(--tp-common-white);
}

/*----------------------------------------*/
/*  2.6 Nice Select
/*----------------------------------------*/
.custom-select {
  position: relative;
  width: 200px;
  border: 1px solid #ccc;
  cursor: pointer;
}
.custom-select .selected {
  display: flex;
  justify-content: space-between;
  align-items: center;
  padding: 10px;
  background: #fff;
}
.custom-select .selected.open .arrow {
  transform: rotate(-135deg);
}
.custom-select .selected.open + .options {
  max-height: 500px;
  opacity: 1;
}
.custom-select .selected .arrow {
  display: inline-block;
  width: 8px;
  height: 8px;
  border: solid #333;
  border-width: 0 1px 1px 0;
  transform: rotate(45deg);
  transition: transform 0.3s ease;
}
.custom-select .options {
  position: absolute;
  top: 100%;
  left: 0;
  width: 100%;
  background: #fff;
  border: 1px solid #ccc;
  max-height: 0;
  overflow: hidden;
  opacity: 0;
  z-index: 100;
  transition: max-height 0.3s ease, opacity 0.3s ease;
}
.custom-select .options li {
  padding: 10px;
  cursor: pointer;
  list-style: none;
  transition: background 0.2s ease;
}
.custom-select .options li:hover {
  background: #f0f0f0;
}

/*----------------------------------------*/
/*  2.7 Breadcrumb
/*----------------------------------------*/
.tp-breadcrumb-ptb {
  padding-top: 180px;
}
.tp-breadcrumb-title {
  font-weight: 700;
  font-size: 80px;
  line-height: 1.5;
  margin-bottom: 0;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-breadcrumb-title {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .tp-breadcrumb-title {
    font-size: 40px;
  }
}
.tp-breadcrumb-list {
  display: inline-block;
  padding: 0px 10px;
}
.tp-breadcrumb-list span:last-child {
  color: var(--tp-common-white);
}
.tp-breadcrumb-list span {
  font-weight: 400;
  font-size: 18px;
  line-height: 1;
  text-transform: capitalize;
  color: rgba(255, 255, 255, 0.4);
}
@media (max-width: 767px) {
  .tp-breadcrumb-list span {
    font-size: 15px;
  }
}
.tp-breadcrumb-list span.dvdr i {
  padding: 0px 14px;
  font-style: normal;
}

.breadcrumb__list span {
  font-size: 14px;
  font-weight: 500;
  position: relative;
  color: rgba(77, 61, 48, 0.6);
}
.breadcrumb__list span:not(:last-child) {
  padding-right: 12px;
  margin-right: 5px;
}
.breadcrumb__list span:not(:last-child)::after {
  position: absolute;
  content: "";
  right: 0;
  top: 50%;
  width: 4px;
  height: 4px;
  background-color: #A8ACB0;
  border-radius: 50%;
}
.breadcrumb__list span:hover {
  color: #4D3D30;
}
.breadcrumb__list span a:hover {
  color: var(--tp-coffe-2);
}
.breadcrumb__style-2 .breadcrumb__list span:last-child {
  color: #4D3D30;
}
.breadcrumb__style-2 .breadcrumb__list span.breadcrumb-icon {
  padding-right: 0;
  margin-right: 0;
}
.breadcrumb__style-2 .breadcrumb__list span.breadcrumb-icon svg {
  transform: translateY(-3px);
}
.breadcrumb__style-2 .breadcrumb__list.has-icon span:nth-child(1)::after {
  display: none;
}

/*----------------------------------------*/
/*  2.8 Accordion
/*----------------------------------------*/
.design-service-accordion .accordion-header {
  font-size: inherit;
}
.design-service-accordion .accordion-buttons {
  text-align: left;
  width: 100%;
  height: 100%;
  position: relative;
}
.design-service-accordion .accordion-buttons img {
  transition: 0.3s;
}
.design-service-accordion .accordion-buttons span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  color: #999da6;
  padding-bottom: 25px;
  display: block;
}
.design-service-accordion .accordion-buttons i {
  font-weight: 400;
  font-size: 80px;
  line-height: 0.87;
  color: #E0EEEE;
  margin-bottom: 0;
  transition: 0.3s;
  font-style: normal;
  padding-bottom: 5px;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-dirtyline);
}
@media (max-width: 767px) {
  .design-service-accordion .accordion-buttons i {
    font-size: 50px;
  }
}
.design-service-accordion .accordion-buttons:not(.collapsed) img {
  transform: scale(1.4) rotate(-20deg) translate(-45px, 25px);
}
.design-service-accordion .accordion-buttons:not(.collapsed) i {
  color: #C5FCFC;
}
.design-service-accordion .accordion-body {
  padding: 0;
  padding-right: 280px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-service-accordion .accordion-body {
    padding-right: 250px;
  }
}
@media (max-width: 767px) {
  .design-service-accordion .accordion-body {
    padding-right: 0;
  }
}
.design-service-accordion .accordion-body p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.62;
  color: #999da6;
  margin-bottom: 0;
  padding-bottom: 30px;
  letter-spacing: -0.02em;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-service-accordion .accordion-body p br {
    display: none;
  }
}
.design-service-accordion .accordion-items {
  padding-bottom: 40px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.design-service-accordion .accordion-items:not(:last-child) {
  margin-bottom: 30px;
}
.design-service-category a {
  font-weight: 500;
  font-size: 13px;
  line-height: 1;
  padding: 7px 16px;
  border-radius: 20px;
  display: inline-block;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: #E0EEEE;
  margin-bottom: 5px;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.design-service-category a:hover {
  background-color: #272729;
}
@media (max-width: 767px) {
  .design-service-category a {
    margin-bottom: 10px;
  }
}
.design-service-category a:not(:last-child) {
  margin-right: 5px;
}
.design-service-img {
  position: absolute;
  top: 0;
  right: 0;
  border-radius: 10px;
  height: 110px;
  width: 160px;
}

.ai-faq-accordion-wrap .accordion-items {
  padding-left: 40px;
  padding-bottom: 15px;
  position: relative;
}
.ai-faq-accordion-wrap .accordion-items:not(:last-child) {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.ai-faq-accordion-wrap .accordion-header {
  margin-bottom: 0;
  font-size: 0;
}
.ai-faq-accordion-wrap .accordion-header .accordion-buttons {
  padding-top: 25px;
  padding-bottom: 13px;
  font-weight: 600;
  font-size: 20px;
  line-height: 1;
  width: 100%;
  text-align: left;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .ai-faq-accordion-wrap .accordion-header .accordion-buttons {
    font-size: 15px;
  }
}
.ai-faq-accordion-wrap .accordion-header .accordion-buttons:not(.collapsed) .accordion-icon::before {
  transform: translate(-50%, -50%) rotate(90deg);
}
.ai-faq-accordion-wrap .accordion-header .accordion-buttons .accordion-icon {
  position: absolute;
  top: 35px;
  left: 7px;
}
.ai-faq-accordion-wrap .accordion-header .accordion-buttons .accordion-icon::before {
  position: absolute;
  content: "";
  width: 2px;
  height: 14px;
  left: 50%;
  top: 50%;
  transform: translate(-50%, -50%);
  background-color: var(--tp-common-white);
  border-radius: 2px;
  transition: 0.4s;
}
.ai-faq-accordion-wrap .accordion-header .accordion-buttons .accordion-icon::after {
  position: absolute;
  content: "";
  width: 14px;
  height: 2px;
  left: 50%;
  top: 50%;
  transform: translate(-50%, -50%);
  background-color: var(--tp-common-white);
  border-radius: 2px;
}
.ai-faq-accordion-wrap .accordion-header span {
  margin-right: 20px;
}
.ai-faq-accordion-wrap .accordion-body {
  padding: 0;
  padding-right: 85px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-faq-accordion-wrap .accordion-body {
    padding-right: 0;
  }
}
.ai-faq-accordion-wrap .accordion-body p {
  font-weight: 500;
  font-size: 15px;
  line-height: 1.6;
  margin-bottom: 15px;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.6);
  margin-bottom: 0;
  padding-bottom: 15px;
}
@media (max-width: 767px) {
  .ai-faq-accordion-wrap .accordion-body p {
    font-size: 14px;
  }
}

.it-faq-wrap {
  margin-left: 85px;
  position: relative;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .it-faq-wrap {
    margin-left: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .it-faq-wrap {
    margin-left: 0;
  }
}
@media (max-width: 767px) {
  .it-faq-wrap {
    margin-left: 0;
  }
}
.it-faq-wrap::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 8px;
  height: 100%;
  border-radius: 20px;
  background-color: rgba(255, 255, 255, 0.1);
}
.it-faq-wrap .accordion-items {
  padding-left: 115px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .it-faq-wrap .accordion-items {
    padding-left: 60px;
  }
}
@media (max-width: 767px) {
  .it-faq-wrap .accordion-items {
    padding-left: 50px;
  }
}
.it-faq-wrap .accordion-items:not(:last-child) {
  margin-bottom: 70px;
}
@media (max-width: 767px) {
  .it-faq-wrap .accordion-items:not(:last-child) {
    margin-bottom: 45px;
  }
}
.it-faq-wrap .accordion-buttons {
  text-align: left;
}
.it-faq-wrap .accordion-buttons i {
  font-weight: 400;
  font-size: 22px;
  line-height: 1.18;
  font-style: normal;
  margin-bottom: 20px;
  display: inline-block;
  letter-spacing: 0.04em;
  color: rgba(255, 255, 255, 0.6);
  font-family: var(--tp-ff-platform);
}
.it-faq-wrap .accordion-buttons span {
  font-weight: 500;
  font-size: 36px;
  line-height: 0.7;
  display: block;
  letter-spacing: 0.04em;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-platform);
}
@media (max-width: 767px) {
  .it-faq-wrap .accordion-buttons span {
    font-size: 32px;
  }
}
.it-faq-wrap .accordion-body {
  padding: 0;
  padding: 25px 85px 0 0;
}
@media (max-width: 767px) {
  .it-faq-wrap .accordion-body {
    padding: 25px 15px 0 0;
  }
}
.it-faq-wrap .accordion-body p {
  font-weight: 500;
  font-size: 18px;
  line-height: 1.5;
  margin-bottom: 0;
  color: rgba(255, 255, 255, 0.6);
}

/*----------------------------------------*/
/*  2.9 Section Title
/*----------------------------------------*/
.tp-hero-title {
  font-weight: 700;
  font-size: 220px;
  line-height: 0.9;
  margin-bottom: 0;
  letter-spacing: -0.08em;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-hero-title {
    font-size: 180px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-hero-title {
    font-size: 160px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-title {
    font-size: 120px;
    letter-spacing: -0.02em;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-title {
    font-size: 140px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-title {
    font-size: 115px;
  }
}
@media (max-width: 767px) {
  .tp-hero-title {
    font-size: 50px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-hero-title {
    font-size: 65px;
  }
}

.ar-title-mlr {
  margin-left: 100px;
  margin-right: 100px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-title-mlr {
    margin-left: 0;
    margin-right: 0;
  }
}

.tp-section-subtitle {
  font-weight: 400;
  font-size: 18px;
  line-height: 1;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-black);
}
.tp-section-subtitle.pre::before {
  content: "";
  height: 8px;
  width: 8px;
  margin-right: 12px;
  border-radius: 4px;
  display: inline-block;
  transform: translateY(-2px);
  background-color: var(--tp-common-red-3);
}
.tp-section-subtitle.subtitle-black {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.2;
  text-transform: capitalize;
  color: var(--tp-common-black);
}
.tp-section-subtitle.fs-17 {
  font-weight: 400;
  font-size: 17px;
  line-height: 1;
  text-transform: capitalize;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-subtitle.fs-17 {
    display: inline-block;
    margin-bottom: 15px;
  }
}
.tp-section-subtitle.fs-17.pre-circle::before {
  content: "";
  height: 8px;
  width: 8px;
  margin-right: 12px;
  border-radius: 50%;
  display: inline-block;
  transform: translateY(-2px);
  background-color: var(--tp-common-white);
}
.tp-section-subtitle-clash {
  font-size: 14px;
  line-height: 1.1;
  color: #f9f4e8;
  text-transform: uppercase;
  font-family: var(--tp-ff-clash-semibold);
}
.tp-section-subtitle-clash i {
  margin-left: 10px;
}
.tp-section-subtitle-clash.clash-subtitle-pos {
  display: inline-block;
  transform: translateY(60px);
}
@media (max-width: 767px) {
  .tp-section-subtitle-clash.clash-subtitle-pos {
    transform: translateY(0px);
    margin-bottom: 20px;
  }
}
.tp-section-subtitle-clash.clash-subtitle-pos.body-ff {
  font-size: 18px;
  font-weight: 600;
  text-transform: capitalize;
  transform: translateY(5px);
  font-family: var(--tp-ff-inter);
}
.tp-section-subtitle-clash.clash-subtitle-pos.about-us-2 {
  color: var(--tp-common-black-10);
}
.tp-section-subtitle-clash.color-red {
  color: var(--tp-common-red);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-subtitle-clash.color-red {
    padding-bottom: 20px;
  }
}
.tp-section-subtitle-gradient {
  font-weight: 600;
  font-size: 14px;
  line-height: 1;
  display: inline-block;
  text-transform: uppercase;
  background: linear-gradient(139deg, #9968ff 0%, #ff6cb2 49%, #ffaf56 100%);
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
}
.tp-section-subtitle-gradient div img {
  margin-bottom: 13px;
  display: inline-block;
}
.tp-section-subtitle-gradient.icon-left div {
  display: inline-block;
}
.tp-section-subtitle-gradient.icon-left div img {
  margin-bottom: 0;
  margin-right: 10px;
  transform: translateY(-3px);
}
.tp-section-subtitle-gradient.ct {
  font-size: 16px;
  font-weight: 500;
  padding: 7px 20px;
  border-radius: 20px;
  margin-bottom: 15px;
  text-transform: capitalize;
  font-family: var(--tp-ff-onest);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media (max-width: 767px) {
  .tp-section-subtitle-gradient.ct {
    font-size: 14px;
  }
}
.tp-section-subtitle-satisfy {
  font-weight: 400;
  font-size: 26px;
  line-height: 1;
  display: inline-block;
  color: var(--tp-common-red-2);
  font-family: var(--tp-ff-satisfy);
}
.tp-section-subtitle-teko {
  font-weight: 500;
  font-size: 30px;
  line-height: 1;
  display: inline-block;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media (max-width: 767px) {
  .tp-section-subtitle-teko {
    font-size: 25px;
  }
}
.tp-section-subtitle-teko i {
  font-style: normal;
  color: var(--tp-common-yellow-green);
}
.tp-section-subtitle.border-bg {
  font-size: 14px;
  font-weight: 500;
  padding: 7px 12px;
  border-radius: 40px;
  margin-bottom: 10px;
  text-transform: capitalize;
  color: var(--tp-common-black-10);
  border: 1px solid rgba(33, 33, 45, 0.06);
  box-shadow: 0px 0px 2px 0px rgba(39, 39, 46, 0.04);
  backdrop-filter: blur(10px);
}
.tp-section-subtitle.border-bg.bg-color {
  font-size: 15px;
  font-weight: 600;
  background: var(--tp-common-white);
  border: 1px solid rgba(33, 33, 45, 0.06);
  box-shadow: 0px 0px 2px 0px rgba(39, 39, 46, 0.04);
}
.tp-section-subtitle-platform {
  font-size: 24px;
  font-weight: 400;
  font-style: italic;
  display: inline-block;
  letter-spacing: 0.04em;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-platform);
}
@media (max-width: 767px) {
  .tp-section-subtitle-platform {
    font-size: 20px;
  }
}
.tp-section-subtitle-platform.platform-text-black {
  color: var(--tp-common-black-10);
}
.tp-section-subtitle.st {
  font-weight: 500;
  color: #494949;
  margin-bottom: 20px;
}
.tp-section-subtitle.orange-color {
  color: var(--tp-common-red-3);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-subtitle.orange-color {
    margin-right: 50px;
  }
}

.tp-section-title {
  font-size: 80px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -0.08em;
  text-transform: uppercase;
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .tp-section-title {
    font-size: 70px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-section-title {
    font-size: 60px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .tp-section-title {
    font-size: 42px;
  }
}
.tp-section-title.fs-140 {
  line-height: 0.89;
  font-size: 140px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title.fs-140 {
    font-size: 115px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title.fs-140 {
    font-size: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title.fs-140 {
    font-size: 75px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-section-title.fs-140 {
    letter-spacing: 0;
    font-size: 65px;
  }
}
.tp-section-title.fs-64 {
  font-weight: 600;
  font-size: 64px;
  line-height: 1.1;
  letter-spacing: -0.02em;
  text-transform: capitalize;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title.fs-64 {
    font-size: 55px;
  }
}
@media (max-width: 767px) {
  .tp-section-title.fs-64 {
    font-size: 42px;
  }
}
.tp-section-title.fs-44 {
  font-weight: 600;
  font-size: 44px;
  line-height: 1.18;
  margin-bottom: 0;
  letter-spacing: -0.03em;
  text-transform: capitalize;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title.fs-44 {
    font-size: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-title.fs-44 {
    font-size: 38px;
  }
  .tp-section-title.fs-44 br {
    display: none;
  }
}
.tp-section-title.fs-54 {
  font-weight: 700;
  font-size: 54px;
  line-height: 1.15;
  letter-spacing: -0.04em;
  text-transform: capitalize;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title.fs-54 {
    font-size: 45px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title.fs-54 {
    font-size: 40px;
  }
}
@media (max-width: 767px) {
  .tp-section-title.fs-54 {
    font-size: 35px;
  }
}
.tp-section-title.fs-54 span {
  height: 55px;
  width: 50px;
  display: inline-block;
}
.tp-section-title.fs-54.fs-60 {
  font-size: 60px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title.fs-54.fs-60 {
    font-size: 55px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title.fs-54.fs-60 {
    font-size: 45px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title.fs-54.fs-60 {
    font-size: 55px;
  }
}
@media (max-width: 767px) {
  .tp-section-title.fs-54.fs-60 {
    font-size: 40px;
  }
}
.tp-section-title.lts {
  letter-spacing: -2.4px;
  text-transform: capitalize;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-section-title.lts {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .tp-section-title.lts {
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-section-title.lts br {
    display: none;
  }
}
.tp-section-title-mango {
  font-weight: 300;
  font-size: 56px;
  line-height: 1;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-mango-light);
}
.tp-section-title-mango.fs-100 {
  font-size: 100px;
  font-family: var(--tp-ff-mango-semibold);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-mango.fs-100 {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-mango.fs-100 {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-mango {
    font-size: 50px;
  }
}
.tp-section-title-grotesk {
  font-size: 60px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -0.03em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-grotesk {
    font-size: 55px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-grotesk {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-grotesk br {
    display: none;
  }
}
.tp-section-title-grotesk > span {
  display: inline-block;
}
.tp-section-title-shape {
  position: absolute;
  bottom: -12px;
  left: 0;
  z-index: -1;
}
.tp-section-title-dirtyline {
  font-weight: 400;
  font-size: 200px;
  line-height: 0.8;
  color: #e0eeee;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-dirtyline);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-dirtyline {
    font-size: 160px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-dirtyline {
    font-size: 130px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-dirtyline {
    font-size: 130px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-dirtyline {
    font-size: 80px;
  }
}
.tp-section-title-dirtyline.fs-140 {
  font-size: 140px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-dirtyline.fs-140 {
    font-size: 110px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-dirtyline.fs-140 {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-dirtyline.fs-140 {
    font-size: 70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-title-dirtyline.fs-140 br {
    display: none;
  }
}
.tp-section-title-clash {
  font-size: 130px;
  line-height: 0.79;
  letter-spacing: -0.03em;
  text-transform: uppercase;
  color: var(--tp-common-red);
  font-family: var(--tp-ff-clash-bold);
}
@media only screen and (min-width: 1801px) and (max-width: 1850px), only screen and (min-width: 1701px) and (max-width: 1800px) {
  .tp-section-title-clash {
    font-size: 120px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-section-title-clash {
    font-size: 115px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-clash {
    font-size: 110px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-clash {
    font-size: 100px;
  }
  .tp-section-title-clash br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-clash {
    font-size: 85px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-clash {
    font-size: 40px;
    letter-spacing: 0;
  }
  .tp-section-title-clash br {
    display: none;
  }
}
.tp-section-title-clash span {
  display: inline-block;
}
@media (max-width: 767px) {
  .tp-section-title-clash span br {
    display: none;
  }
}
.tp-section-title-clash span.clash-subtitle-space-1 {
  padding-left: 230px;
}
@media (max-width: 767px) {
  .tp-section-title-clash span.clash-subtitle-space-1 {
    padding-left: 0;
  }
  .tp-section-title-clash span.clash-subtitle-space-1 br {
    display: none;
  }
}
.tp-section-title-clash.fs-200 {
  font-size: 200px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-section-title-clash.fs-200 {
    font-size: 170px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-clash.fs-200 {
    font-size: 135px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-clash.fs-200 {
    font-size: 125px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-clash.fs-200 {
    font-size: 125px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-clash.fs-200 {
    font-size: 60px;
  }
}
.tp-section-title-clash-600 {
  font-weight: 600;
  font-size: 80px;
  line-height: 1;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-clash-600 {
    font-size: 60px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-clash-600 {
    font-size: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-clash-600 {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-clash-600 {
    font-size: 45px;
  }
}
.tp-section-title-clash-600.fs-60 {
  font-size: 60px;
  line-height: 1.1;
  letter-spacing: 0;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-section-title-clash-600.fs-60 {
    font-size: 55px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-clash-600.fs-60 {
    font-size: 45px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-clash-600.fs-60 {
    font-size: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-clash-600.fs-60 {
    font-size: 45px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-clash-600.fs-60 {
    font-size: 30px;
  }
}
.tp-section-title-clash-600.fw-400 {
  font-family: var(--tp-ff-clash-light);
}
.tp-section-title-teko {
  font-weight: 600;
  font-size: 72px;
  line-height: 0.9;
  letter-spacing: -0.01em;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-teko {
    font-size: 60px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-teko {
    font-size: 55px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-teko {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-teko {
    font-size: 44px;
  }
}
.tp-section-title-teko span {
  color: var(--tp-common-yellow-green);
}
.tp-section-title-teko.fs-150 {
  line-height: 0.73;
  font-size: 150px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-teko.fs-150 {
    font-size: 130px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-teko.fs-150 {
    font-size: 115px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-teko.fs-150 {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-teko.fs-150 {
    font-size: 80px;
  }
}
.tp-section-title-teko.fs-80 {
  font-size: 80px;
  font-weight: 500;
  letter-spacing: -0.8px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-section-title-teko.fs-80 {
    font-size: 70px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-teko.fs-80 {
    font-size: 60px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-title-teko.fs-80 {
    font-size: 50px;
  }
}
.tp-section-title-teko.fs-80 span {
  color: rgba(255, 255, 255, 0.3);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-title-teko.fs-80 br {
    display: none;
  }
}
.tp-section-title-teko.fs-120 {
  font-size: 120px;
  letter-spacing: -1.2px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-section-title-teko.fs-120 {
    font-size: 100px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-teko.fs-120 {
    font-size: 85px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-teko.fs-120 {
    font-size: 75px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-teko.fs-120 {
    font-size: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-section-title-teko.fs-120 {
    font-size: 75px;
  }
}
.tp-section-title-teko.fs-120 span {
  color: rgba(255, 255, 255, 0.3);
}
.tp-section-title-phudu {
  font-size: 94px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -2px;
  text-transform: uppercase;
  font-family: var(--tp-ff-phudu);
  color: var(--tp-common-black-10);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-phudu {
    font-size: 75px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-phudu {
    font-size: 65px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-phudu {
    font-size: 50px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-section-title-phudu {
    font-size: 60px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-section-title-phudu br {
    display: none;
  }
}
.tp-section-title-phudu.fs-70 {
  font-size: 70px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-phudu.fs-70 {
    font-size: 62px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-phudu.fs-70 {
    font-size: 50px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-section-title-phudu.fs-70 {
    font-size: 60px;
    letter-spacing: 0;
  }
}
.tp-section-title-phudu.ff-inter {
  font-size: 70px;
  letter-spacing: -2px;
  text-transform: inherit;
  font-family: var(--tp-ff-inter);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-phudu.ff-inter {
    font-size: 62px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-phudu.ff-inter {
    font-size: 50px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-section-title-phudu.ff-inter {
    font-size: 60px;
    letter-spacing: 0;
  }
}
.tp-section-title-platform {
  font-weight: 500;
  font-size: 60px;
  line-height: 1;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-platform);
}
@media (max-width: 767px) {
  .tp-section-title-platform {
    font-size: 45px;
  }
}
.tp-section-title-platform.platform-text-black {
  color: var(--tp-common-black-10);
}
.tp-section-title-platform.fs-200 {
  font-size: 200px;
  font-style: italic;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-platform.fs-200 {
    font-size: 115px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-platform.fs-200 {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-platform.fs-200 {
    font-size: 60px;
  }
}
.tp-section-title-platform.fs-84 {
  font-size: 80px;
  line-height: 0.88;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-platform.fs-84 {
    font-size: 70px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-platform.fs-84 {
    font-size: 60px;
  }
}
.tp-section-title-playfair {
  font-size: 80px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -1.6px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-section-title-playfair {
    font-size: 70px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-playfair {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-playfair {
    font-size: 45px;
  }
  .tp-section-title-playfair br {
    display: none;
  }
}
.tp-section-title-playfair span {
  font-style: italic;
  color: rgba(69, 48, 48, 0.6);
  font-family: var(--tp-ff-playfair);
}
.tp-section-title-onest {
  font-size: 54px;
  font-weight: 600;
  line-height: 1.1;
  margin-bottom: 25px;
  letter-spacing: -2.16px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-title-onest {
    font-size: 42px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-onest br {
    display: none;
  }
}
.tp-section-title-onest.fs-72 {
  font-size: 72px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-onest.fs-72 {
    font-size: 55px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-onest.fs-72 {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-onest.fs-72 {
    font-size: 45px;
  }
}
.tp-section-title-onest.fs-44 {
  font-size: 44px;
}
.tp-section-title-5 {
  font-size: 120px;
  font-weight: 500;
  line-height: 0.9;
  letter-spacing: -4.8px;
  color: var(--tp-cream-1);
  text-transform: uppercase;
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-5 {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-5 {
    font-size: 70px;
  }
}
.tp-section-title-5.fs-140 {
  font-size: 140px;
  font-weight: 400;
  line-height: 1;
  letter-spacing: -8.4px;
  text-transform: uppercase;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-section-title-5.fs-140 {
    font-size: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-section-title-5.fs-140 {
    font-size: 85px;
  }
}
@media (max-width: 767px) {
  .tp-section-title-5.fs-140 {
    font-size: 50px;
    letter-spacing: -1.4px;
    line-height: 1.2;
  }
}
.tp-section-title-5.fs-140 span {
  transform: translateY(-15px);
  display: inline-block;
  margin: 0px 30px;
  white-space: nowrap;
}
@media (max-width: 767px) {
  .tp-section-title-5.fs-140 span {
    white-space: inherit;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-title-5.fs-140 span {
    margin: 0;
  }
}
.tp-section-title-5.fs-140 span img {
  border-radius: 100px;
}
.tp-section-title-5.fs-140 em {
  font-style: normal;
  padding-left: 160px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-section-title-5.fs-140 em {
    padding-left: 0;
  }
}

.tp-revel-line {
  overflow: hidden;
}

/*----------------------------------------*/
/*  2.11 Search
/*----------------------------------------*/
.tp-search-area {
  position: fixed;
  left: 0;
  top: 0;
  width: 100%;
  opacity: 0;
  height: 300px;
  visibility: hidden;
  background: var(--tp-common-white);
  -webkit-transform: translateY(calc(-100% - 80px));
  -moz-transform: translateY(calc(-100% - 80px));
  -ms-transform: translateY(calc(-100% - 80px));
  -o-transform: translateY(calc(-100% - 80px));
  transform: translateY(calc(-100% - 80px));
  transition: all 0.5s ease-in-out 0s, visibility 0.5s ease-in-out;
  animation: 0.95s ease 0s normal forwards 1 running headerSlideDown;
  z-index: 99999;
  overflow-y: scroll;
  overscroll-behavior-y: contain;
  scrollbar-width: none;
}
.tp-search-area::-webkit-scrollbar {
  display: none; /* for Chrome, Safari, and Opera */
}
.tp-search-area.opened {
  -webkit-transform: translateY(0);
  -moz-transform: translateY(0);
  -ms-transform: translateY(0);
  -o-transform: translateY(0);
  transform: translateY(0);
  visibility: visible;
  opacity: 1;
}
.tp-search-area.search-black {
  background: rgb(38, 37, 40);
}
.tp-search-area.search-black .tp-search-content .search::before {
  background-color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-content input {
  border-color: #4F4F4F;
  background-color: transparent;
  color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-content input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-content input::-moz-placeholder { /* Firefox 19+ */
  color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-content input:-moz-placeholder { /* Firefox 4-18 */
  color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-content input:-ms-input-placeholder { /* IE 10+  Edge*/
  color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-content input::placeholder { /* MODERN BROWSER */
  color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-content .tp-search-icon {
  color: var(--tp-common-white);
}
.tp-search-area.search-black .tp-search-close-btn {
  border-color: #4F4F4F;
  color: var(--tp-common-white);
}
.tp-search-wrapper {
  position: relative;
  display: flex;
  padding-top: 80px;
  justify-content: center;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-search-wrapper {
    padding-top: 115px;
  }
}
.tp-search-close {
  position: absolute;
  top: 35px;
  right: 35px;
}
@media (max-width: 767px) {
  .tp-search-close {
    right: 20px;
    top: 20px;
  }
}
.tp-search-close-btn {
  position: relative;
  height: 50px;
  width: 50px;
  z-index: 2;
  line-height: 1;
  border-radius: 50%;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  background-color: transparent;
  color: var(--tp-common-black);
  border: 1px solid rgba(22, 22, 19, 0.1);
}
.tp-search-close-btn svg {
  height: 12px;
  width: 12px;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  -webkit-transform: translateY(-1px);
  -moz-transform: translateY(-1px);
  -ms-transform: translateY(-1px);
  -o-transform: translateY(-1px);
  transform: translateY(-1px);
}
.tp-search-close-btn:hover svg {
  -webkit-transform: rotate(90deg);
  -moz-transform: rotate(90deg);
  -ms-transform: rotate(90deg);
  -o-transform: rotate(90deg);
  transform: rotate(90deg);
}
.tp-search-content .search {
  margin-bottom: 40px;
  position: relative;
}
.tp-search-content .search:has(input:focus)::before {
  width: 100%;
}
.tp-search-content .search::before {
  position: absolute;
  content: "";
  left: 0;
  bottom: 0;
  height: 1px;
  width: 0;
  transition: 0.4s;
  background-color: var(--tp-common-black);
}
.tp-search-content input {
  height: 80px;
  border: none;
  font-size: 30px;
  font-weight: 400;
  border-radius: 0;
  padding: 0 60px 0 10px;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  border-bottom: 1px solid #E6E8F0;
  color: var(--tp-common-black);
  background: var(--tp-common-white);
}
.tp-search-content input:focus:hover {
  background: transparent;
}
.tp-search-content input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-size: 30px;
  font-weight: 400;
  color: var(--tp-common-black);
}
.tp-search-content input::-moz-placeholder { /* Firefox 19+ */
  font-size: 30px;
  font-weight: 400;
  color: var(--tp-common-black);
}
.tp-search-content input:-moz-placeholder { /* Firefox 4-18 */
  font-size: 30px;
  font-weight: 400;
  color: var(--tp-common-black);
}
.tp-search-content input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-size: 30px;
  font-weight: 400;
  color: var(--tp-common-black);
}
.tp-search-content input::placeholder { /* MODERN BROWSER */
  font-size: 30px;
  font-weight: 400;
  color: var(--tp-common-black);
}
.tp-search-icon {
  position: absolute;
  right: 20px;
  top: 50%;
  line-height: 1;
  transform: translateY(-50%);
}

/*----------------------------------------*/
/*  2.12 Magic Cursor
/*----------------------------------------*/
body.tp-magic-cursor #magic-cursor {
  display: block;
}

#magic-cursor {
  position: absolute;
  display: none;
  width: 10px;
  height: 10px;
  pointer-events: none;
  z-index: 99999;
  opacity: 0;
  top: 0;
  left: 0;
}

#ball {
  position: fixed;
  display: flex;
  align-items: center;
  pointer-events: none;
  border-radius: 50%;
  color: transparent;
  justify-content: center;
  mix-blend-mode: difference;
  background-color: var(--tp-common-black);
}

.cursor-bg-red #ball {
  background-color: #FF535B !important;
}
.cursor-bg-red #ball .ball-view {
  color: var(--tp-common-white);
}

.cursor-bg-red-2 #ball {
  background-color: #FF481F !important;
}
.cursor-bg-red-2 #ball .ball-view {
  color: var(--tp-common-white);
}

.cursor-bg-yellow #ball {
  background-color: #FFF669 !important;
}
.cursor-bg-yellow #ball .ball-view {
  color: var(--tp-common-black);
}

.cursor-white-bg #ball .ball-view {
  color: var(--tp-common-black);
}

/* Ball view 
============= */
#ball .ball-view {
  position: absolute;
  opacity: 0;
  visibility: hidden;
  padding: 0 5px;
  font-size: 15px;
  font-weight: 500;
  line-height: 1.3;
  text-align: center;
  transform: scale(0);
  color: var(--tp-common-black);
}

/* Ball drag 
============= */
#ball .ball-drag {
  position: absolute;
  display: block;
  width: 100%;
  padding: 0 5px;
  font-size: 15px;
  font-weight: 600;
  line-height: 1.2;
  text-align: center;
  transition: all 0.3s;
  color: var(--tp-common-black);
}

#ball .ball-drag::before,
#ball .ball-drag::after {
  position: absolute;
  top: 50%;
  margin-top: -5px;
  font-size: 19px;
  height: 10px;
  line-height: 10px;
  font-weight: 900;
  display: inline-block;
  font-style: normal;
  font-variant: normal;
  text-rendering: auto;
  color: var(--tp-common-white);
  font-family: "Font Awesome 6 Pro";
  -webkit-font-smoothing: antialiased;
}

#ball .ball-drag::before {
  content: "\f104"; /* Font Awesome */
  left: 0;
  transform: translate3d(-30px, 0, 0);
  transition: all 0.25s;
}

#ball .ball-drag::after {
  content: "\f105"; /* Font Awesome */
  right: 0;
  transform: translate3d(30px, 0, 0);
  transition: all 0.25s;
}

#ball.with-blur {
  -webkit-backdrop-filter: blur(5px);
  backdrop-filter: blur(5px);
  -webkit-transform: translate3d(0, 0, 0);
  transform: translate3d(0, 0, 0);
}

/* Ball close 
============== */
#ball.ball-close-enabled {
  opacity: 1 !important;
}

#ball .ball-close {
  position: absolute;
  padding: 0 5px;
  font-size: 14px;
  font-weight: 600;
  line-height: 1;
  text-align: center;
  color: var(--tp-common-black);
}

.tp-magnetic-wrap {
  display: flex;
  align-items: center;
  justify-content: center;
}

/* HEADER CSS */
/*----------------------------------------*/
/*   3.1 Header Style
/*----------------------------------------*/
.header-transparent {
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  z-index: 9;
  width: 100%;
}

.header-fixed {
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  z-index: 55;
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-ptb {
    padding: 10px 0;
  }
}
.tp-header-border {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-header-menu > nav > ul > li {
  margin: 0 20px;
  list-style-type: none;
  display: inline-block;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-header-menu > nav > ul > li {
    margin: 0 15px;
  }
}
.tp-header-menu > nav > ul > li > a {
  padding: 35px 0;
  font-weight: 500;
  font-size: 17px;
  display: inline-block;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
}
.tp-header-lang a {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  color: rgba(255, 255, 255, 0.6);
}
.tp-header-lang a.active {
  color: var(--tp-common-white);
}
.tp-header-lang a:not(:first-child) {
  margin-left: 10px;
}
.tp-header-lang a:hover {
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-header-box {
    padding-right: 30px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-header-box {
    padding-right: 0px;
  }
}
.tp-header-logo img {
  max-width: inherit;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-header-logo {
    padding-left: 30px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-header-logo {
    padding-right: 25px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-logo {
    padding: 10px 0;
  }
}
.tp-header-bar button {
  width: 30px;
  color: var(--tp-common-white);
}
.tp-header-bar button i:nth-child(2) {
  width: 24px;
}
.tp-header-bar button i {
  height: 2px;
  width: 14px;
  display: block;
  margin-left: 0;
  background-color: var(--tp-common-white);
}
.tp-header-bar button i:not(:last-of-type) {
  margin: 6px auto;
}
.tp-header-bar button:hover i {
  animation: bar_anim 0.8s cubic-bezier(0.44, 1.1, 0.53, 0.99) 1 forwards;
}

@media (max-width: 767px) {
  .tp-header-2-area {
    margin-top: 20px;
  }
}
.tp-header-2-area.header-black-style .tp-header-2-bar span {
  color: var(--tp-common-black-7);
}
.tp-header-2-area.header-black-style .tp-header-2-bar span i {
  background-color: var(--tp-common-black-7);
}
.tp-header-2-bar span {
  font-weight: 500;
  font-size: 17px;
  line-height: 1;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
}
.tp-header-2-bar span i {
  height: 2px;
  width: 40px;
  display: block;
  margin: 6px 0;
  margin-left: 20px;
  background-color: var(--tp-common-white);
}
.tp-header-2-bar span:hover i {
  animation: bar_anim 0.8s cubic-bezier(0.44, 1.1, 0.53, 0.99) 1 forwards;
}

.tp-header-3-style {
  padding-top: 15px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-3-style {
    padding-top: 30px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-header-3-style {
    padding-left: 30px;
  }
}
.tp-header-3-style .tp-header-menu > nav > ul {
  margin-left: 5px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-header-3-style .tp-header-menu > nav > ul {
    margin-left: 35px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-header-3-style .tp-header-menu > nav > ul {
    margin-left: 70px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-header-3-style .tp-header-menu > nav > ul > li {
    margin: 0 12px;
  }
}
.tp-header-3-style .tp-header-menu > nav > ul > li > a {
  font-size: 16px;
  color: var(--tp-common-black);
}
.tp-header-3-style .tp-header-dropdown nav ul li.has-dropdown::after {
  color: var(--tp-common-black);
}
.tp-header-3-style .tp-header-bar button {
  height: 50px;
  width: 50px;
  line-height: 50px;
  border-radius: 10px;
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-regular);
}
.tp-header-3-style .tp-header-bar button i {
  width: 24px;
  margin: 4px auto;
  background-color: var(--tp-common-black);
}

.tp-header-4-style .tp-header-menu nav ul li a {
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-header-4-style .tp-header-btn-box {
    display: none;
  }
}
.tp-header-4-style.header-4-light-style .tp-header-bar button {
  color: var(--tp-common-black);
}
.tp-header-4-style.header-4-light-style .tp-header-bar button i {
  background-color: var(--tp-common-black);
}

.tp-header-5-area.header-style-light .tp-header-5-bar span {
  background-color: var(--tp-common-black-7);
}
.tp-header-5-area.header-style-light .tp-header-5-button .tp-btn-red-border {
  color: var(--tp-common-black);
}
.tp-header-5-area.header-style-light .tp-header-5-button .tp-btn-red-border:hover {
  color: var(--tp-common-white);
}
.tp-header-5-bar span {
  height: 2px;
  width: 60px;
  display: block;
  margin: 8px 0;
  background-color: var(--tp-common-cream);
}

.tp-header-7-wrapper {
  padding: 0px 25px;
  padding-right: 10px;
  border-radius: 16px;
  background: rgba(8, 4, 29, 0.2);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-7-wrapper {
    padding: 10px 25px;
    padding-right: 10px;
  }
}
.tp-header-7-wrapper::after {
  content: "";
  height: 100%;
  width: 100%;
  display: block;
  backdrop-filter: blur(10px);
}
.tp-header-7-menu > nav > ul {
  margin-left: 0;
}
.tp-header-7-menu > nav > ul > li > a {
  padding: 22px 0;
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
}
.tp-header-7-btn-box {
  line-height: 1;
}
.tp-header-7-serach {
  color: var(--tp-common-white);
}

.tp-header-8-area.header-8-style-dark .tp-header-8-bar {
  border: 1px solid rgba(255, 255, 255, 0.12);
}
.tp-header-8-area.header-8-style-dark .tp-header-8-bar span {
  color: var(--tp-common-white);
}
.tp-header-8-area.header-8-style-dark .tp-btn-border-2 {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.12);
}
.tp-header-8-wrapper {
  padding: 18px 0;
}
.tp-header-8-border {
  border-bottom: 1px solid rgba(25, 25, 25, 0.08);
}
.tp-header-8-bar {
  transition: 0.3s;
  padding: 8px 22px;
  margin-right: 18px;
  border-radius: 24px;
  display: inline-block;
  border: 1px solid rgba(25, 25, 25, 0.1);
}
.tp-header-8-bar:hover {
  border-color: var(--tp-common-red-2);
  background-color: var(--tp-common-red-2);
}
.tp-header-8-bar:hover span {
  color: var(--tp-common-white);
}
.tp-header-8-bar span {
  line-height: 1;
  transition: 0.3s;
  font-size: 15px;
  letter-spacing: -0.01em;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
.tp-header-8-bar span svg {
  margin-left: 7px;
}
.tp-header-8-lang a {
  font-size: 15px;
  line-height: 1;
  letter-spacing: -0.01em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
.tp-header-8-lang a:not(:last-child) {
  margin-right: 8px;
}
.tp-header-8-lang a:hover {
  color: var(--tp-common-red-2);
}
.tp-header-8-btn {
  margin-left: 20px;
}

.tp-header-9-mt {
  margin-top: 40px;
}
.tp-header-9-box {
  margin-left: 90px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-9-box {
    margin-left: 0;
  }
}
.tp-header-9-menu.tp-header-dropdown nav ul li.has-dropdown::after {
  display: none;
}
.tp-header-9-menu > nav > ul {
  display: inline-block;
  padding: 0 10px;
  border-radius: 14px;
  background: rgba(238, 241, 234, 0.04);
  border: 1px solid rgba(238, 241, 234, 0.04);
}
.tp-header-9-menu > nav > ul > li {
  display: inline-block;
  list-style-type: none;
  padding: 8px 0;
}
.tp-header-9-menu > nav > ul > li > a {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  border-radius: 8px;
  padding: 7px 23px;
  display: inline-block;
  letter-spacing: -0.01em;
  color: var(--tp-common-cream-3);
  background-color: transparent;
}
.tp-header-9-menu > nav > ul > li > a:hover {
  color: var(--tp-common-yellow-green);
  background-color: rgba(238, 241, 234, 0.06);
}
.tp-header-9-logo .logo-2 {
  display: none;
}
.tp-header-9-search span {
  color: var(--tp-common-cream);
}

.tp-header-10-area.header-10-dark-style .tp-header-10-wrapper {
  background: #1A1B1E;
  border: 1px solid rgba(0, 0, 0, 0.6);
}
.tp-header-10-area.header-10-dark-style .tp-header-10-menu > nav > ul > li > a {
  color: var(--tp-common-white);
}
.tp-header-10-area.header-10-dark-style .tp-header-10-offcanvas .tp-header-bar button {
  color: var(--tp-common-white);
}
.tp-header-10-area.header-10-dark-style .tp-header-10-offcanvas .tp-header-bar button i {
  background-color: var(--tp-common-white);
}
.tp-header-10-announcement-wrapper {
  padding: 10px 0;
}
.tp-header-10-announcement-content p {
  font-size: 14px;
  font-weight: 600;
  margin: 0;
  margin-right: 8px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-header-10-announcement-content p {
    font-size: 12px;
    margin-right: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-header-10-announcement-content p {
    font-size: 14px;
    margin-right: 8px;
  }
}
.tp-header-10-announcement-content p span {
  display: inline-block;
  font-size: 11px;
  font-weight: 700;
  padding: 4px 16px;
  margin-right: 10px;
  text-transform: uppercase;
  background: #21212D;
  border-radius: 18px;
}
@media (max-width: 767px) {
  .tp-header-10-announcement-content p span {
    font-size: 10px;
    font-weight: 500;
    padding: 4px 10px;
    margin-right: 5px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-header-10-announcement-content p span {
    padding: 4px 16px;
  }
}
.tp-header-10-announcement-content a {
  position: relative;
  display: inline-block;
  font-size: 14px;
  font-weight: 700;
  color: var(--tp-common-white);
}
.tp-header-10-announcement-content a::after {
  position: absolute;
  content: "";
  height: 1px;
  width: 100%;
  bottom: 0;
  left: 0;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  background-color: rgba(255, 255, 255, 0.5);
}
.tp-header-10-announcement-content a:hover::after {
  opacity: 0;
  visibility: hidden;
}
.tp-header-10-announcement-content a:hover span {
  transform: rotate(45deg);
}
.tp-header-10-announcement-content a span {
  display: inline-block;
  margin-left: 5px;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.tp-header-10-announcement-close {
  position: absolute;
  top: 7px;
  right: 60px;
}
.tp-header-10-announcement-close button {
  display: inline-block;
  height: 26px;
  width: 26px;
  line-height: 7px;
  border-radius: 50%;
  color: var(--tp-common-black);
  background: var(--tp-common-white);
}
.tp-header-10-announcement-close button:hover {
  transform: scale(1.1);
}
@media (max-width: 767px) {
  .tp-header-10-announcement-close button {
    display: none;
  }
}
.tp-header-10-menu {
  margin-left: -70px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-header-10-menu {
    margin-left: -15px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1701px) and (max-width: 1800px), only screen and (min-width: 1801px) and (max-width: 1850px) {
  .tp-header-10-menu {
    margin-left: -60px;
  }
}
.tp-header-10-menu::before {
  position: absolute;
  content: "";
  height: 30px;
  width: 1px;
  top: 15px;
  left: -10px;
  background: rgba(33, 33, 45, 0.06);
}
.tp-header-10-menu > nav > ul {
  margin-left: 0;
}
.tp-header-10-menu > nav > ul > li {
  margin: 0 20px;
}
.tp-header-10-menu > nav > ul > li > a {
  padding: 22px 0;
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.16px;
  color: var(--tp-common-black-10);
}
.tp-header-10-menu.tp-header-dropdown nav ul li.has-dropdown::after {
  display: none;
}
.tp-header-10-wrapper {
  padding: 1px 30px;
  border-radius: 60px;
  border: 1px solid rgba(255, 255, 255, 0.6);
  background: rgba(247, 247, 253, 0.2);
  box-shadow: 0px 20px 30px 0px rgba(33, 33, 45, 0.03);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-10-wrapper {
    padding: 10px 20px;
  }
}
.tp-header-10-btn-box {
  line-height: 1;
}
.tp-header-10-offcanvas .tp-header-bar button {
  color: var(--tp-common-black);
}
.tp-header-10-offcanvas .tp-header-bar button i {
  background-color: var(--tp-common-black);
}

.tp-header-11-style .tp-header-10-wrapper {
  background: rgba(255, 255, 255, 0.8);
  border: 1px solid rgba(255, 255, 255, 0.6);
  box-shadow: 0 20px 30px 0 rgba(33, 33, 45, 0.03);
}
.tp-header-11-style .tp-header-10-wrapper::after {
  content: "";
  height: 100%;
  width: 100%;
  backdrop-filter: blur(10px);
}
.tp-header-11-style .tp-header-10-menu {
  margin-left: -100px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-11-style .tp-header-10-menu {
    margin-left: 0;
  }
}
.tp-header-11-style.header-11-dark-style .tp-header-10-wrapper {
  background: #1A1B1E;
  border: 1px solid rgba(0, 0, 0, 0.6);
}
.tp-header-11-style.header-11-dark-style .tp-header-10-menu > nav > ul > li > a {
  color: var(--tp-common-white);
}
.tp-header-11-style.header-11-dark-style .tp-header-10-offcanvas .tp-header-bar button {
  color: var(--tp-common-white);
}
.tp-header-11-style.header-11-dark-style .tp-header-10-offcanvas .tp-header-bar button i {
  background-color: var(--tp-common-white);
}
.tp-header-11-style.header-11-dark-style .tp-btn-black-radius {
  background-color: #fff;
  color: var(--tp-common-black);
}
.tp-header-11-style.header-11-dark-style .tp-btn-black-radius i {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-12-ptb {
    padding: 10px 0;
  }
}
.tp-header-12-ptb.sticky-black-bg .tp-header-12-menu > nav > ul > li > a {
  color: var(--tp-common-white);
}
.tp-header-12-ptb.sticky-black-bg .tp-header-12-menu > nav > ul > li.has-dropdown::after {
  color: var(--tp-common-white);
}
.tp-header-12-menu > nav > ul {
  margin-left: 0;
}
.tp-header-12-menu > nav > ul > li {
  margin: 0 20px;
}
.tp-header-12-menu > nav > ul > li > a {
  position: relative;
  padding: 41px 0;
  font-size: 17px;
  font-weight: 500;
  line-height: 1;
  color: #616161;
  display: inline-block;
  letter-spacing: -0.17px;
}
.tp-header-12-menu.about-us-4 nav ul li a {
  color: #111013;
}
.tp-header-12-menu.tp-header-dropdown nav ul li.has-dropdown::after {
  color: #616161;
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-13-ptb {
    padding: 10px 0;
  }
}
.tp-header-13-menu > nav > ul {
  margin-left: 270px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-header-13-menu > nav > ul {
    margin-left: 100px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-13-menu > nav > ul {
    margin-left: 0;
  }
}
.tp-header-13-menu > nav > ul > li {
  margin: 0 20px;
}

.tp-header-14-main {
  position: relative;
  z-index: 999;
}
.tp-header-14-wrapper {
  padding: 18px 0;
}
.tp-header-14-info a {
  font-size: 15px;
  font-weight: 600;
  color: var(--tp-common-white);
}
.tp-header-14-bar-wrap .tp-header-8-bar {
  margin-right: 0;
  padding: 8px 18px;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-header-14-bar-wrap .tp-header-8-bar:hover {
  background-color: var(--tp-common-white);
}
.tp-header-14-bar-wrap .tp-header-8-bar:hover span {
  color: var(--tp-common-black);
}
.tp-header-14-bar-wrap .tp-header-8-bar span {
  font-size: 14px;
  font-weight: 700;
  letter-spacing: -0.14px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-inter);
}

.tp-header-15-style .tp-header-14-info a {
  color: #653624;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-15-style .tp-header-14-info a {
    color: var(--tp-cream-2);
  }
}
.tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar {
  border-color: #653624;
}
.tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar span {
  color: #653624;
}
.tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar:hover {
  background-color: #653624;
}
.tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar:hover span {
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar {
    border-color: var(--tp-cream-2);
  }
  .tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar span {
    color: var(--tp-cream-2);
  }
  .tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar:hover {
    background-color: var(--tp-cream-2);
  }
  .tp-header-15-style .tp-header-14-bar-wrap .tp-header-8-bar:hover span {
    color: var(--tp-common-black);
  }
}

.tp-header-inner-style .tp-header-menu > nav > ul {
  padding: 0 10px;
  border-radius: 30px;
  display: inline-block;
  background-color: rgb(246, 246, 249);
}
.tp-header-inner-style .tp-header-menu > nav > ul > li > a {
  padding: 10px 0;
  color: var(--tp-common-black);
}
.tp-header-inner-style .tp-header-dropdown nav ul li.has-dropdown::after {
  color: var(--tp-common-black);
}
.tp-header-inner-style .tp-header-dropdown nav ul li .tp-submenu {
  top: 110%;
}
.tp-header-inner-style .tp-header-14-bar-wrap .tp-header-8-bar {
  border: 0;
  background-color: rgb(246, 246, 249);
}
.tp-header-inner-style .tp-header-14-bar-wrap .tp-header-8-bar span {
  color: var(--tp-common-black);
}
.tp-header-inner-style .tp-header-14-bar-wrap .tp-header-8-bar:hover {
  background-color: var(--tp-common-black);
}
.tp-header-inner-style .tp-header-14-bar-wrap .tp-header-8-bar:hover span {
  color: var(--tp-common-white);
}
.tp-header-inner-style.header-inner-white .tp-header-menu > nav > ul {
  background-color: #1D1D1F;
}
.tp-header-inner-style.header-inner-white .tp-header-menu > nav > ul > li > a {
  color: #BFBFC0;
}
.tp-header-inner-style.header-inner-white .tp-header-menu > nav > ul > li:hover > a {
  color: var(--tp-common-white);
}
.tp-header-inner-style.header-inner-white .tp-header-dropdown > nav > ul > li.has-dropdown::after {
  color: #BFBFC0;
}
.tp-header-inner-style.header-inner-white .tp-header-dropdown > nav > ul > li:hover.has-dropdown::after {
  color: var(--tp-common-white);
}
.tp-header-inner-style.header-inner-white .tp-header-14-bar-wrap .tp-header-8-bar {
  background-color: #1D1D1F;
}
.tp-header-inner-style.header-inner-white .tp-header-14-bar-wrap .tp-header-8-bar span {
  color: var(--tp-common-white);
}
.tp-header-inner-style.header-inner-white .tp-header-14-bar-wrap .tp-header-8-bar:hover {
  background-color: var(--tp-common-white);
}
.tp-header-inner-style.header-inner-white .tp-header-14-bar-wrap .tp-header-8-bar:hover span {
  color: var(--tp-common-black);
}
.tp-header-inner-style .tp-megamenu-wrapper {
  top: 110%;
}

.tp-header-shop-wrap {
  position: relative;
  border: 1px solid rgba(77, 61, 48, 0.2);
}
.tp-header-shop-wrap.shop-white-header {
  border: 1px solid rgba(255, 255, 255, 0.2);
}
.tp-header-shop-wrap.shop-white-header .tp-header-shop-menu > nav > ul > li > a {
  color: var(--tp-common-white);
  border-color: rgba(255, 255, 255, 0.2);
}
.tp-header-shop-wrap.shop-white-header .tp-header-shop-action ul li {
  border-color: rgba(255, 255, 255, 0.2);
}
.tp-header-shop-wrap.shop-white-header .tp-header-shop-cart button {
  color: var(--tp-common-white);
}
.tp-header-shop-wrap.shop-white-header .tp-header-shop-cart button span {
  color: #4D3D30;
  background-color: var(--tp-common-white);
}
.tp-header-shop-wrap.shop-white-header .tp-header-shop-lang button, .tp-header-shop-wrap.shop-white-header .tp-header-shop-lang span {
  color: var(--tp-common-white);
}
.tp-header-shop-wrap.shop-white-header .tp-header-shop-search button {
  color: var(--tp-common-white);
}
.tp-header-shop-wrap.shop-white-header .logo-2 {
  display: none;
}
.tp-header-shop-wrap.shop-white-header .tp-header-10-offcanvas .tp-header-bar button i {
  background-color: var(--tp-common-white);
}
.tp-header-shop-wrap .tp-header-dropdown nav ul li.has-dropdown::after {
  display: none;
}
.tp-header-shop-wrap .tp-megamenu-wrapper {
  max-width: 100%;
  border-radius: 0 0 14px 14px;
}
.tp-header-shop-wrap .tp-megamenu-wrapper.megamenu-white-bg {
  background: rgba(244, 240, 234, 0.8);
  border: 1px solid rgba(77, 61, 48, 0.12);
}
.tp-header-shop-wrap.header-sticky {
  top: 10px;
  width: calc(100% - 30px);
  margin: 0 auto;
}
.tp-header-shop-wrap.header-sticky.sticky-white-bg {
  background: rgba(244, 240, 234, 0.9);
}
.tp-header-shop-wrap.header-sticky.shop-white-header {
  border: 1px solid rgba(77, 61, 48, 0.2);
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-menu > nav > ul > li > a {
  color: #4d3d30;
  border-color: rgba(77, 61, 48, 0.2);
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-action ul li {
  border-color: rgba(77, 61, 48, 0.2);
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-search button {
  color: #4d3d30;
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-cart button {
  color: #4d3d30;
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-cart button span {
  background-color: #4D3D30;
  color: var(--tp-common-white);
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-lang span {
  color: #4d3d30;
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-logo .logo-1 {
  display: none;
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-shop-logo .logo-2 {
  display: inline-block !important;
}
.tp-header-shop-wrap.header-sticky.shop-white-header .tp-header-10-offcanvas .tp-header-bar button i {
  background-color: #4d3d30;
}
.tp-header-shop-wrap .dropdown-white-bg nav ul li .tp-submenu {
  border-radius: 0 0 14px 14px;
  background: rgba(244, 240, 234, 0.8);
  border: 1px solid rgba(77, 61, 48, 0.12);
}
.tp-header-shop-menu > nav > ul {
  display: flex;
}
.tp-header-shop-menu > nav > ul > li {
  list-style: none;
  display: inline-block;
}
.tp-header-shop-menu > nav > ul > li > a {
  height: 100%;
  padding: 18px 30px;
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  color: #4d3d30;
  letter-spacing: -0.01em;
  display: inline-block;
  text-transform: uppercase;
  border-right: 1px solid rgba(77, 61, 48, 0.2);
}
.tp-header-shop-action > ul {
  display: flex;
}
.tp-header-shop-action > ul > li {
  position: relative;
  padding: 12px 30px;
  list-style-type: none;
  display: inline-flex;
  justify-content: center;
  align-items: center;
  border-left: 1px solid rgba(77, 61, 48, 0.2);
}
.tp-header-shop-cart a, .tp-header-shop-cart button, .tp-header-shop-cart span, .tp-header-shop-lang a, .tp-header-shop-lang button, .tp-header-shop-lang span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  color: #4d3d30;
  letter-spacing: -0.01em;
  text-transform: uppercase;
}
.tp-header-shop-cart button span {
  position: absolute;
  top: 0;
  right: 0;
  padding: 3px 6px 4px;
  font-weight: 600;
  font-size: 14px;
  line-height: 1;
  text-align: center;
  display: inline-block;
  letter-spacing: -0.01em;
  text-transform: uppercase;
  color: var(--tp-common-white);
  background-color: #4d3d30;
  border: 1px solid rgba(77, 61, 48, 0.2);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-shop-logo {
    margin-left: 20px;
  }
}

.header-lang-submenu {
  position: absolute;
  top: 110%;
  right: 0px;
  width: 120px;
  z-index: 9;
  opacity: 0;
  padding: 15px 20px;
  visibility: hidden;
  background: #4D3D30;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  box-shadow: 0 30px 70px 6px rgba(11, 6, 70, 0.08);
}
.header-lang-submenu li {
  list-style: none;
}
.header-lang-submenu li a {
  font-size: 13px;
  text-transform: capitalize;
  color: var(--tp-common-white);
}
.header-lang-submenu.open {
  top: 100%;
  opacity: 1;
  visibility: visible;
}

.tp-header-14-yellow-bg .tp-header-8-bar:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}

/*----------------------------------------*/
/*  4.1 Main Menu
/*----------------------------------------*/
.header-sticky {
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  opacity: 1;
  width: 100%;
  z-index: 10;
  visibility: visible;
  background: rgba(38, 37, 40, 0.9);
  box-shadow: 0 2px 6px 0 rgba(19, 19, 22, 0.08);
  animation: 0.95s ease 0s normal forwards 1 running headerSlideDown;
  -webkit-animation: 0.95s ease 0s normal forwards 1 running headerSlideDown;
}
.header-sticky .tp-header-menu > nav > ul > li > a {
  padding: 22px 0;
}
.header-sticky.sticky-white-bg {
  background: rgba(255, 255, 255, 0.9);
}
.header-sticky.sticky-white-bg .tp-header-menu > nav > ul > li > a {
  color: var(--tp-common-black);
}
.header-sticky.sticky-white-bg .tp-header-dropdown nav ul li.has-dropdown::after {
  color: var(--tp-common-black);
}
.header-sticky.sticky-white-bg .logo-white {
  display: none;
}
.header-sticky.sticky-white-bg .logo-black {
  display: block !important;
}
.header-sticky.sticky-white-bg .tp-header-lang a {
  color: rgba(0, 0, 0, 0.6);
}
.header-sticky.sticky-white-bg .tp-header-lang a.active {
  color: var(--tp-common-black);
}
.header-sticky.sticky-white-bg .tp-header-bar button i {
  background-color: var(--tp-common-black);
}
.header-sticky.sticky-white-bg .tp-header-7-serach {
  color: var(--tp-common-black);
}
.header-sticky.sticky-white-bg .cr-header-login a {
  background: rgb(0, 0, 0);
  border-color: rgba(0, 0, 0, 0.6);
}
.header-sticky.sticky-white-bg .cr-header-login a:hover {
  color: var(--tp-common-black);
  background-color: transparent;
}
.header-sticky.sticky-white-bg .tp-header-btn-box .tp-btn-white-border:hover {
  color: var(--tp-common-black);
  border-color: rgba(0, 0, 0, 0.6);
}
.header-sticky.sticky-white-bg .animated-border-box::before {
  background-image: conic-gradient(rgb(255, 255, 255), #000, rgb(255, 255, 255) 25%);
}
.header-sticky.sticky-white-bg .tp-btn-white-border.tp-btn-light-bg {
  color: #0E0F11;
  background-color: transparent;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.header-sticky.sticky-white-bg .tp-btn-white-border.tp-btn-light-bg:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
.header-sticky.tp-header-blur::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  backdrop-filter: blur(40px);
  z-index: -1;
}
.header-sticky.tp-header-3-style {
  padding-top: 0;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .header-sticky.tp-header-3-style {
    padding: 10px 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .header-sticky.tp-header-9-sticky {
    padding: 10px 0;
  }
}
.header-sticky.tp-header-border {
  border-bottom: 0;
}
.header-sticky .tp-header-logo {
  padding: 0;
}
.header-sticky .tp-header-7-wrapper {
  padding: 0;
  padding-right: 0;
  border-radius: 0;
  background: initial;
  border: none;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .header-sticky .tp-header-7-wrapper {
    padding: 10px 0;
  }
}
.header-sticky.tp-header-9-sticky .tp-header-9-logo .logo-1 {
  display: none;
}
.header-sticky.tp-header-9-sticky .tp-header-9-logo .logo-2 {
  display: block !important;
}
.header-sticky.tp-header-9-sticky .tp-header-9-menu > nav > ul > li > a {
  padding: 25px 0;
  margin: 0 15px;
  color: var(--tp-common-black);
}
.header-sticky.tp-header-9-sticky .tp-header-9-menu > nav > ul > li {
  padding: 0;
}
.header-sticky.tp-header-9-sticky .tp-header-9-menu > nav > ul {
  padding: 0;
}
.header-sticky.tp-header-9-sticky .tp-header-9-box {
  margin-left: 0;
}
.header-sticky.tp-header-9-sticky .tp-header-9-search span {
  color: var(--tp-common-black);
}
.header-sticky.tp-header-9-sticky .tp-header-9-btn .tp-btn-yellow-green {
  color: #fff;
  background-color: #2A4C3A;
}
.header-sticky.tp-header-10-sticky .tp-header-10-wrapper {
  margin-top: 0;
  border-radius: 0;
  border: 0;
  box-shadow: none;
  background: transparent;
}
.header-sticky.tp-header-11-style .tp-header-10-wrapper {
  border: 0;
  background: 0;
  margin-top: 0;
  box-shadow: none;
  backdrop-filter: initial;
}
.header-sticky.tp-header-inner-style .tp-header-menu > nav > ul {
  padding: 0;
  border-radius: 0;
  display: inline-block;
  margin-bottom: 0;
  background-color: transparent;
}
.header-sticky.tp-header-inner-style .tp-header-dropdown nav > ul > li .tp-submenu {
  top: 104%;
}
.header-sticky.tp-header-inner-style .tp-header-dropdown nav > ul > li .tp-submenu li .tp-submenu {
  top: 0;
}
.header-sticky.tp-header-inner-style .tp-megamenu-wrapper {
  top: 104%;
}

.sticky-white-bg .tp-megamenu-list ul li a span {
  font-weight: 700;
}
.sticky-white-bg .tp-megamenu-list ul li a span.new {
  color: rgb(182, 74, 222);
  background: rgba(182, 74, 222, 0.08);
}
.sticky-white-bg .tp-megamenu-list ul li a span.pop {
  color: #0db50e;
  background-color: rgba(13, 181, 14, 0.08);
}

.tp-header-dropdown nav ul li {
  position: relative;
  list-style: none;
}
.tp-header-dropdown nav ul li.p-static {
  position: static;
}
.tp-header-dropdown nav ul li.has-dropdown::after {
  content: "\f107";
  font-size: 16px;
  font-weight: 400;
  margin-left: 2px;
  display: inline-block;
  color: var(--tp-common-white);
  transition: all 0.3s 0s ease-out;
  font-family: var(--tp-ff-fontawesome);
}
.tp-header-dropdown nav ul li.has-dropdown:hover::after {
  transform: rotate(-180deg);
}
.tp-header-dropdown nav ul li .tp-submenu {
  position: absolute;
  top: 100%;
  left: 0;
  width: 260px;
  z-index: 99;
  opacity: 0;
  padding: 12px 0;
  transition: 0.5s;
  text-align: start;
  visibility: hidden;
  border-radius: 14px;
  transform-origin: 0 0;
  transform: scale(1, 0);
  backdrop-filter: blur(40px);
  background: rgba(38, 37, 40, 0.9);
  box-shadow: 0 20px 30px -8px rgba(19, 19, 22, 0.1);
}
.tp-header-dropdown nav ul li .tp-submenu li {
  width: 100%;
  padding: 0 12px;
  border-radius: 8px;
}
.tp-header-dropdown nav ul li .tp-submenu li a {
  position: relative;
  border-radius: 8px;
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  color: #bfbfc0;
  padding: 12px 18px;
  display: inline-block;
  letter-spacing: -0.01em;
  text-align: start;
  width: 100%;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-header-dropdown nav ul li .tp-submenu li a {
    font-size: 14px;
  }
}
.tp-header-dropdown nav ul li .tp-submenu li .tp-submenu {
  top: 0;
  left: 100%;
}
.tp-header-dropdown nav ul li .tp-submenu li:hover > a {
  background-color: #2c2b2e;
  color: var(--tp-common-white);
}
.tp-header-dropdown nav ul li .tp-submenu li.menu-item-has-children > a {
  display: flex;
  align-items: center;
  justify-content: space-between;
}
.tp-header-dropdown nav ul li .tp-submenu li.menu-item-has-children > a::after {
  content: "\f107";
  font-size: 16px;
  font-weight: 400;
  margin-left: 2px;
  color: #bfbfc0;
  display: inline-block;
  transform: rotate(-90deg);
  transition: all 0.3s 0s ease-out;
  font-family: var(--tp-ff-fontawesome);
}
.tp-header-dropdown nav ul li .tp-submenu li.menu-item-has-children:hover a::after {
  transform: rotate(0deg);
  color: var(--tp-common-white);
}
.tp-header-dropdown nav ul li:hover > .tp-submenu {
  visibility: visible;
  opacity: 1;
  transform: scale(1);
}
.tp-header-dropdown nav ul li:hover > .tp-megamenu-wrapper {
  visibility: visible;
  opacity: 1;
  transition-duration: 0.2s;
  -webkit-transform: perspective(300px) rotateX(0deg);
  -moz-transform: perspective(300px) rotateX(0deg);
  -ms-transform: perspective(300px) rotateX(0deg);
  -o-transform: perspective(300px) rotateX(0deg);
  transform: perspective(300px) rotateX(0deg);
}

.tp-megamenu-wrapper {
  position: absolute;
  transition: 0.3s;
  opacity: 0;
  visibility: hidden;
  padding-top: 45px;
  top: 100%;
  left: 0;
  right: 0;
  max-width: 1760px;
  margin: 0 auto;
  overflow: hidden;
  border-radius: 14px;
  transform-origin: top;
  transition-duration: 0.1s;
  -webkit-transform: perspective(300px) rotateX(-18deg);
  -moz-transform: perspective(300px) rotateX(-18deg);
  -ms-transform: perspective(300px) rotateX(-18deg);
  -o-transform: perspective(300px) rotateX(-18deg);
  transform: perspective(300px) rotateX(-18deg);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-megamenu-wrapper {
    max-width: calc(100% - 40px);
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-megamenu-wrapper {
    padding-top: 25px;
  }
}
.tp-megamenu-wrapper.megamenu-black-bg {
  backdrop-filter: blur(40px);
  background: rgba(38, 37, 40, 0.9);
  box-shadow: 0 20px 30px -8px rgba(19, 19, 22, 0.1);
}
.tp-megamenu-wrapper.megamenu-white-bg {
  backdrop-filter: blur(40px);
  background: rgba(255, 255, 255, 0.9);
  box-shadow: 0 2px 6px 0 rgba(19, 19, 22, 0.1);
}
.tp-megamenu-wrapper.megamenu-white-bg .tp-megamenu-title {
  color: #111013;
  border-bottom: 1px solid #F3F3F6;
}
.tp-megamenu-wrapper.megamenu-white-bg .tp-megamenu-list ul::after {
  background-color: #F3F3F6;
}
.tp-megamenu-wrapper.megamenu-white-bg .tp-megamenu-list ul li a {
  color: #636368;
}
.tp-megamenu-wrapper.megamenu-white-bg .tp-megamenu-list ul li a:hover {
  background-color: #f8f8fb;
  color: var(--tp-common-black);
}
.tp-megamenu-title {
  font-weight: 600;
  font-size: 13px;
  line-height: 1;
  margin-bottom: 0;
  padding-left: 40px;
  padding-bottom: 25px;
  text-align: start;
  text-transform: uppercase;
  color: var(--tp-common-white);
  border-bottom: 1px solid rgba(255, 255, 255, 0.06);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-megamenu-title {
    padding-left: 23px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-megamenu-title {
    padding-left: 20px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-megamenu-title {
    padding-left: 20px;
  }
}
.tp-megamenu-list {
  height: 100%;
}
.tp-megamenu-list ul {
  position: relative;
  height: 100%;
  padding-top: 18px;
  padding-bottom: 50px;
}
.tp-megamenu-list ul::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 1px;
  height: 100%;
  background-color: rgba(255, 255, 255, 0.06);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-megamenu-list ul::after {
    display: none;
  }
}
.tp-megamenu-list ul li {
  padding: 0px 20px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-megamenu-list ul li {
    padding: 0px 10px;
  }
}
.tp-megamenu-list ul li:not(:last-child) {
  margin-bottom: 10px;
}
.tp-megamenu-list ul li a {
  position: relative;
  width: 100%;
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  color: #bfbfc0;
  padding: 12px 18px;
  border-radius: 8px;
  display: inline-block;
  letter-spacing: -0.01em;
  text-align: start;
}
@media only screen and (min-width: 1701px) and (max-width: 1800px), only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-megamenu-list ul li a {
    font-size: 14px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-megamenu-list ul li a {
    font-size: 14px;
    padding: 12px 12px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-megamenu-list ul li a {
    font-size: 14px;
    padding: 12px 8px;
  }
}
.tp-megamenu-list ul li a span {
  font-size: 13px;
  line-height: 1;
  font-weight: 800;
  padding: 6px 8px;
  border-radius: 20px;
  display: inline-block;
  margin-left: 3px;
  text-transform: capitalize;
  letter-spacing: 0.7px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-megamenu-list ul li a span {
    font-size: 8px;
    padding: 5px 6px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-megamenu-list ul li a span {
    display: none;
  }
}
.tp-megamenu-list ul li a span.hot {
  color: #FF535B;
  background-color: rgba(255, 83, 91, 0.08);
}
.tp-megamenu-list ul li a span.new {
  color: #fff669;
  background-color: rgba(255, 246, 105, 0.08);
}
.tp-megamenu-list ul li a span.pop {
  color: #19e41a;
  background-color: rgba(25, 228, 26, 0.08);
}
.tp-megamenu-list ul li a:hover {
  background-color: #2c2b2e;
  color: var(--tp-common-white);
}
.tp-megamenu-thumb {
  height: 100%;
  position: absolute;
  top: 0;
  right: 0;
  width: 17%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-megamenu-thumb {
    display: none;
  }
}
.tp-megamenu-thumb img {
  height: 100%;
  object-fit: cover;
  width: 100%;
  overflow: hidden;
}

.dropdown-white-bg nav ul li .tp-submenu {
  background: rgba(255, 255, 255, 0.9);
}
.dropdown-white-bg nav ul li .tp-submenu li a {
  color: #636368;
}
.dropdown-white-bg nav ul li .tp-submenu li:hover > a {
  background-color: #F8F8FB;
  color: var(--tp-common-black);
}
.dropdown-white-bg nav ul li .tp-submenu li.menu-item-has-children > a::after {
  color: #636368;
}
.dropdown-white-bg nav ul li .tp-submenu li.menu-item-has-children:hover > a::after {
  color: var(--tp-common-black);
}

/*----------------------------------------*/
/*  4.2 Mobile Menu
/*----------------------------------------*/
.tp-offcanvas-menu {
  margin-bottom: 80px;
}
.tp-offcanvas-menu ul {
  list-style: none;
}
.tp-offcanvas-menu ul li {
  position: relative;
}
.tp-offcanvas-menu ul li > a {
  padding: 10px 0;
  display: block;
  font-size: 20px;
  font-weight: 500;
}
.tp-offcanvas-menu ul li.active > a {
  color: var(--tp-common-red-3);
}
.tp-offcanvas-menu ul li.active > .tp-menu-close i {
  top: 10px;
  -webkit-transform: rotate(135deg);
  -moz-transform: rotate(135deg);
  -ms-transform: rotate(135deg);
  -o-transform: rotate(135deg);
  transform: rotate(135deg);
}
.tp-offcanvas-menu ul li .submenu {
  display: none;
}
.tp-offcanvas-menu ul li .submenu .submenu {
  margin-left: 30px;
}
.tp-offcanvas-menu .tp-megamenu-wrapper.megamenu-white-bg {
  backdrop-filter: none;
  background: transparent;
  box-shadow: none;
}
.tp-offcanvas-menu .mega-menu {
  width: auto;
  opacity: 1;
  visibility: visible;
  transition: none;
  position: static;
  display: none;
  -webkit-transform: perspective(0) rotateX(0);
  -moz-transform: perspective(0) rotateX(0);
  -ms-transform: perspective(0) rotateX(0);
  -o-transform: perspective(0) rotateX(0);
  transform: perspective(0) rotateX(0);
}
.tp-offcanvas-menu .tp-megamenu-list ul li {
  padding: 0;
}
.tp-offcanvas-menu .tp-megamenu-list ul li a {
  padding: 8px 20px;
  font-size: 17px;
}
.tp-offcanvas-menu .tp-submenu li a {
  padding: 8px 20px;
  border-radius: 10px;
  font-size: 17px;
}
.tp-offcanvas-menu .tp-submenu li a:hover {
  background-color: #f8f8fb;
  color: var(--tp-common-black);
}

.tp-menu-close {
  position: absolute;
  right: 7px;
  top: 12px;
}
.tp-menu-close i {
  transition: all 0.3s;
  font-size: 18px;
  font-weight: 500;
}

.menu-item-has-children .tp-menu-close {
  right: 14px;
  top: 9px;
}

/*----------------------------------------*/
/*  4.3 offcanvas Menu
/*----------------------------------------*/
.body-overlay {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 99;
  width: 100%;
  height: 100%;
  visibility: hidden;
  opacity: 0;
  transition: 0.45s ease-in-out;
  background: rgba(24, 24, 24, 0.4);
}
.body-overlay.opened {
  opacity: 1;
  visibility: visible;
}

.tp-offcanvas-wrapper {
  position: fixed;
  top: 0;
  right: 0;
  width: 450px;
  height: 100vh;
  z-index: 999;
  padding: 50px 50px;
  overflow-y: scroll;
  transition: all 0.3s;
  background: #FFF;
  overscroll-behavior-y: contain;
  -webkit-transform: translateX(calc(100% + 80px));
  -moz-transform: translateX(calc(100% + 80px));
  -ms-transform: translateX(calc(100% + 80px));
  -o-transform: translateX(calc(100% + 80px));
  transform: translateX(calc(100% + 80px));
}
@media (max-width: 767px) {
  .tp-offcanvas-wrapper {
    width: 100%;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-offcanvas-wrapper {
    width: 450px;
  }
}
.tp-offcanvas-wrapper .logo-2 {
  display: none;
}
.tp-offcanvas-wrapper.offcanvas-black-bg {
  background: #1C1D20;
}
.tp-offcanvas-wrapper.offcanvas-black-bg .logo-1 {
  display: none;
}
.tp-offcanvas-wrapper.offcanvas-black-bg .logo-2 {
  display: block !important;
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-close-btn {
  color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-menu ul li > a {
  color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-menu ul li.active > a {
  color: var(--tp-common-red-3);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-menu .tp-submenu li a:hover {
  background-color: #2c2b2e;
  color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-menu-close i {
  color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-megamenu-wrapper.megamenu-black-bg {
  backdrop-filter: initial;
  background: transparent;
  box-shadow: none;
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-title.sm {
  color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-contact ul li a {
  color: rgba(255, 255, 255, 0.8);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-contact ul li a:hover {
  color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-contact ul li a::after {
  background-color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-social ul li a {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-social ul li a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-title {
  color: var(--tp-common-white);
}
.tp-offcanvas-wrapper.offcanvas-black-bg .tp-offcanvas-content p {
  color: rgba(255, 255, 255, 0.8);
}
.tp-offcanvas-area.opened .tp-offcanvas-wrapper {
  -webkit-transform: translateX(0);
  -moz-transform: translateX(0);
  -ms-transform: translateX(0);
  -o-transform: translateX(0);
  transform: translateX(0);
}
.tp-offcanvas-top {
  margin-bottom: 90px;
}
.tp-offcanvas-close-btn {
  color: black;
}
.tp-offcanvas-close-btn:hover {
  opacity: 1;
  -webkit-transform: rotate(90deg);
  -moz-transform: rotate(90deg);
  -ms-transform: rotate(90deg);
  -o-transform: rotate(90deg);
  transform: rotate(90deg);
}
.tp-offcanvas-content {
  margin-bottom: 45px;
}
.tp-offcanvas-content p {
  font-size: 16px;
  font-weight: 400;
  line-height: 24px;
  color: #414144;
}
.tp-offcanvas-title {
  font-size: 40px;
  line-height: 1;
  letter-spacing: -0.8px;
  font-weight: 700;
  margin-bottom: 15px;
  color: var(--tp-common-black);
}
.tp-offcanvas-title.sm {
  font-size: 20px;
  font-weight: 700;
  margin-bottom: 15px;
  text-transform: uppercase;
  color: var(--tp-common-black);
}
.tp-offcanvas-gallery {
  margin-bottom: 65px;
}
.tp-offcanvas-gallery-img img {
  transition: 0.9s;
}
.tp-offcanvas-gallery-img:hover img {
  transform: scale(1.2) rotate(-2deg);
}
.tp-offcanvas-contact {
  margin-bottom: 55px;
}
.tp-offcanvas-contact ul li {
  list-style: none;
}
.tp-offcanvas-contact ul li:not(:last-child) {
  margin-bottom: 2px;
}
.tp-offcanvas-contact ul li a {
  display: inline-block;
  color: #414144;
  font-size: 16px;
  position: relative;
}
.tp-offcanvas-contact ul li a::after {
  position: absolute;
  bottom: 2px;
  right: 0;
  width: 0;
  height: 1px;
  content: "";
  transition: 0.4s;
  background-color: #1e1e1e;
}
.tp-offcanvas-contact ul li a:hover {
  color: var(--tp-common-black);
}
.tp-offcanvas-contact ul li a:hover::after {
  width: 100%;
  right: auto;
  left: 0;
}
.tp-offcanvas-social ul {
  display: -webkit-box;
  display: -moz-box;
  display: -ms-flexbox;
  display: -webkit-flex;
  display: flex;
  align-items: center;
}
.tp-offcanvas-social ul li {
  list-style: none;
}
.tp-offcanvas-social ul li:not(:last-child) {
  margin-right: 8px;
}
.tp-offcanvas-social ul li a {
  display: inline-block;
  text-align: center;
  width: 40px;
  height: 40px;
  line-height: 38px;
  border-radius: 40px;
  transition: all 0.3s;
  color: var(--tp-common-black);
  border: 1px solid rgba(2, 11, 24, 0.1);
}
.tp-offcanvas-social ul li a:hover {
  background-color: var(--tp-common-black);
  border-color: var(--tp-common-black);
  color: var(--tp-common-white);
}
.tp-offcanvas-social ul li a svg {
  -webkit-transform: translateY(-1px);
  -moz-transform: translateY(-1px);
  -ms-transform: translateY(-1px);
  -o-transform: translateY(-1px);
  transform: translateY(-1px);
}

.tp-offcanvas-2-area {
  position: relative;
}
.tp-offcanvas-2-area.opened .animated-text > nav > ul > li a::after {
  visibility: visible;
  opacity: 1;
  bottom: 35px;
}
.tp-offcanvas-2-area.opened .animated-text > nav > ul > li a::before {
  width: 100%;
}
.tp-offcanvas-2-area.opened .animated-text > nav > ul > li a .tp-text-hover-effect-word .single-char span {
  -webkit-transform: translateZ(0.1px);
  -moz-transform: translateZ(0.1px);
  -ms-transform: translateZ(0.1px);
  -o-transform: translateZ(0.1px);
  transform: translateZ(0.1px);
}
.tp-offcanvas-2-area.opened .tp-offcanvas-2-left, .tp-offcanvas-2-area.opened .tp-offcanvas-2-right {
  visibility: visible;
  opacity: 1;
}
.tp-offcanvas-2-area.opened .tp-offcanvas-2-wrapper {
  visibility: visible;
  opacity: 1;
}
.tp-offcanvas-2-area.opened .tp-offcanvas-2-bg.is-left, .tp-offcanvas-2-area.opened .tp-offcanvas-2-bg.is-right {
  -webkit-transform: scale(1, 1);
  -moz-transform: scale(1, 1);
  -ms-transform: scale(1, 1);
  -o-transform: scale(1, 1);
  transform: scale(1, 1);
  transition-delay: 0s;
}
.tp-offcanvas-2-area.opened .tp-offcanvas-2-menu {
  transition-delay: 0s;
}
.tp-offcanvas-2-area.opened .tp-offcanvas-2-close {
  visibility: visible;
  opacity: 1;
  -webkit-transform: translateY(0);
  -moz-transform: translateY(0);
  -ms-transform: translateY(0);
  -o-transform: translateY(0);
  transform: translateY(0);
  transition-delay: 0.9s;
}
.tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li > a {
  font-weight: 700;
  font-size: 50px;
  line-height: 1;
  color: #717172;
  letter-spacing: -0.02em;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li > a {
    font-size: 35px;
  }
}
@media (max-width: 767px) {
  .tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li > a {
    font-size: 30px;
  }
}
.tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li > a::after {
  position: absolute;
  left: 0;
  top: 3px;
  font-weight: 500;
  font-size: 13px;
  content: "0" counter(count);
  counter-increment: count;
  color: rgba(113, 113, 114, 0.8);
}
.tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li.is-active > a {
  color: var(--tp-common-white);
}
.tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li.is-active .tp-menu-close i {
  color: var(--tp-common-white);
}
.tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li > ul > li > a {
  font-weight: 600;
  font-size: 30px;
  line-height: 1;
  transition: 0.3s;
  color: #717172;
  letter-spacing: -0.02em;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li > ul > li > a {
    font-size: 20px;
  }
}
.tp-offcanvas-2-area .tp-offcanvas-menu > nav > ul > li > ul > li > a:hover {
  transform: translateX(15px);
  color: var(--tp-common-white);
}
.tp-offcanvas-2-area .tp-offcanvas-menu .tp-submenu li a:hover {
  background-color: initial;
  color: var(--tp-common-white);
}
.tp-offcanvas-2-area .tp-offcanvas-menu ul li:not(:last-child) > a {
  border-bottom: 0;
}
.tp-offcanvas-2-area .tp-offcanvas-menu ul li > a {
  padding: 0;
  padding-left: 30px;
}
.tp-offcanvas-2-area .tp-offcanvas-menu ul > li:not(:last-child) {
  margin-bottom: 45px;
}
.tp-offcanvas-2-area .tp-offcanvas-menu ul li .submenu {
  padding-left: 20px;
  margin-top: 40px;
  margin-bottom: 56px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-offcanvas-2-area .tp-offcanvas-menu ul li .submenu {
    padding-left: 0;
  }
}
.tp-offcanvas-2-area .tp-offcanvas-menu ul li .submenu li:not(:last-child) {
  margin-bottom: 30px;
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-bg.is-left {
  background: var(--tp-common-white);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-logo .logo-1 {
  display: none;
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-menu > nav > ul > li.is-active > a {
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-menu > nav > ul > li.is-active .tp-menu-close i {
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-menu > nav > ul > li > a {
  color: #D5D5D5;
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-menu > nav > ul > li > ul > li > a {
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-menu .tp-submenu li a:hover {
  background-color: initial;
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-bg.is-right {
  background-color: #F6F6F9;
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-right-info-title {
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-right-info-item > a {
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-right-social a {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-right-social a:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-close-btn .text {
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-white-bg .tp-offcanvas-2-close-btn {
  color: var(--tp-common-black);
}
.tp-offcanvas-2-area.offcanvas-2-black-bg .tp-offcanvas-2-logo .logo-2 {
  display: none !important;
}
.tp-offcanvas-2-bg.left-box {
  position: fixed;
  top: 0;
  height: 100%;
  width: 60%;
  -webkit-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  -moz-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  -ms-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  -o-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  z-index: 1111;
}
@media (max-width: 767px) {
  .tp-offcanvas-2-bg.left-box {
    width: 100%;
  }
}
.tp-offcanvas-2-bg.right-box {
  position: fixed;
  top: 0;
  height: 100%;
  width: 40%;
  -webkit-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  -moz-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  -ms-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  -o-transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  transition: all 1s cubic-bezier(0.77, 0, 0.175, 1);
  z-index: 1111;
}
@media (max-width: 767px) {
  .tp-offcanvas-2-bg.right-box {
    width: 100%;
  }
}
.tp-offcanvas-2-bg.is-left {
  left: 0;
  -webkit-transform: scale(1, 0);
  -moz-transform: scale(1, 0);
  -ms-transform: scale(1, 0);
  -o-transform: scale(1, 0);
  transform: scale(1, 0);
  transform-origin: top center;
  background: var(--tp-common-black);
  transition-delay: 1s;
}
.tp-offcanvas-2-bg.is-right {
  right: 0;
  transform-origin: bottom center;
  -webkit-transform: scale(1, 0);
  -moz-transform: scale(1, 0);
  -ms-transform: scale(1, 0);
  -o-transform: scale(1, 0);
  transform: scale(1, 0);
  background-color: #1C1D20;
  transition-delay: 1s;
}
.tp-offcanvas-2-wrapper .left-box {
  position: fixed;
  top: 0;
  width: 60%;
  height: 100vh;
  z-index: 9999;
  overflow-y: scroll;
  pointer-events: auto;
  scrollbar-width: none;
  padding: 40px 80px 50px 80px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-offcanvas-2-wrapper .left-box {
    padding: 40px 40px;
  }
}
@media (max-width: 767px) {
  .tp-offcanvas-2-wrapper .left-box {
    width: 100%;
    padding: 40px 40px;
  }
}
.tp-offcanvas-2-wrapper .left-box .tp-offcanvas-menu {
  padding: 0px 125px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-offcanvas-2-wrapper .left-box .tp-offcanvas-menu {
    padding: 0 70px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-offcanvas-2-wrapper .left-box .tp-offcanvas-menu {
    padding: 0 20px;
  }
}
@media (max-width: 767px) {
  .tp-offcanvas-2-wrapper .left-box .tp-offcanvas-menu {
    padding: 0;
  }
}
.tp-offcanvas-2-wrapper .right-box {
  position: fixed;
  top: 0;
  width: 40%;
  height: 100vh;
  z-index: 9999;
  padding: 50px 100px 50px 0;
  scrollbar-width: none;
  overscroll-behavior-y: contain;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-offcanvas-2-wrapper .right-box {
    padding-right: 40px;
  }
}
.tp-offcanvas-2-wrapper .right-box::-webkit-scrollbar {
  display: none;
}
@media (max-width: 767px) {
  .tp-offcanvas-2-wrapper .right-box {
    width: 100%;
  }
}
.tp-offcanvas-2-wrapper .tp-menu-close {
  top: 10px;
  height: 0;
  width: 0;
}
@media (max-width: 767px) {
  .tp-offcanvas-2-wrapper .tp-menu-close {
    top: 0;
    right: 20px;
  }
}
.tp-offcanvas-2-wrapper .tp-menu-close i {
  font-size: 20px;
  color: #717172;
}
.tp-offcanvas-2-left {
  visibility: hidden;
  opacity: 0;
  left: 0;
  transition: 0.3s;
  transition-delay: 0.8s;
}
@media (max-width: 767px) {
  .tp-offcanvas-2-left-wrap {
    margin-bottom: 80px;
  }
}
.tp-offcanvas-2-right {
  visibility: hidden;
  opacity: 0;
  right: 0;
  transition: 0.3s;
  transition-delay: 0.8s;
}
.tp-offcanvas-2-right-inner {
  height: 100%;
  padding: 100px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-offcanvas-2-right-inner {
    padding-left: 50px;
    padding-right: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-offcanvas-2-right-inner {
    padding: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-offcanvas-2-right-inner {
    padding: 30px;
  }
}
.tp-offcanvas-2-right-info-box {
  padding: 0 200px;
}
@media only screen and (min-width: 1801px) and (max-width: 1850px), only screen and (min-width: 1701px) and (max-width: 1800px) {
  .tp-offcanvas-2-right-info-box {
    padding-right: 100px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-offcanvas-2-right-info-box {
    padding: 0 100px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-offcanvas-2-right-info-box {
    padding: 0 100px;
    padding-right: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-offcanvas-2-right-info-box {
    padding: 0 70px;
    padding-right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-offcanvas-2-right-info-box {
    padding: 0 60px;
    padding-right: 0;
    margin-top: 130px;
  }
}
.tp-offcanvas-2-right-info-title {
  font-weight: 700;
  font-size: 30px;
  line-height: 1;
  margin-bottom: 35px;
  color: var(--tp-common-white);
}
.tp-offcanvas-2-right-info-item {
  margin-bottom: 30px;
}
.tp-offcanvas-2-right-info-item label {
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  display: block;
  color: #717172;
}
.tp-offcanvas-2-right-info-item > a {
  font-weight: 600;
  font-size: 18px;
  line-height: 1;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-offcanvas-2-right-info-item > a br {
    display: none;
  }
}
.tp-offcanvas-2-right-social a {
  height: 40px;
  width: 40px;
  transition: 0.3s;
  line-height: 35px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-offcanvas-2-right-social a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.tp-offcanvas-2-close {
  visibility: hidden;
  opacity: 0;
  transition: 0.3s;
  transition-delay: 0.5s;
  -webkit-transform: translateY(20px);
  -moz-transform: translateY(20px);
  -ms-transform: translateY(20px);
  -o-transform: translateY(20px);
  transform: translateY(20px);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-offcanvas-2-close {
    padding-right: 30px;
  }
}
.tp-offcanvas-2-close-btn {
  font-size: 14px;
  font-weight: 500;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-offcanvas-2-close-btn .text {
  width: 60px;
  height: 20px;
  transition: 0.3s;
  overflow: hidden;
  display: inline-block;
  transform: translateY(4px);
  color: var(--tp-common-white);
}
.tp-offcanvas-2-close-btn .text span {
  transition: 0.3s;
  display: inline-block;
  -webkit-transform: translateX(120%);
  -moz-transform: translateX(120%);
  -ms-transform: translateX(120%);
  -o-transform: translateX(120%);
  transform: translateX(120%);
}
.tp-offcanvas-2-close-btn:hover .text span {
  transform: translateX(0%);
}
.tp-offcanvas-2-close-btn:hover span svg {
  -webkit-transform: rotate(90deg);
  -moz-transform: rotate(90deg);
  -ms-transform: rotate(90deg);
  -o-transform: rotate(90deg);
  transform: rotate(90deg);
}
.tp-offcanvas-2-text {
  right: 0;
  bottom: 0;
  position: absolute;
  transform: rotate(-90deg) translateY(100%);
}
.tp-offcanvas-2-text span {
  font-size: 320px;
  font-weight: 700;
  color: rgba(33, 35, 41, 0.3);
}
.tp-offcanvas-2-logo {
  margin-bottom: 105px;
}
@media (max-width: 767px) {
  .tp-offcanvas-2-logo {
    margin-bottom: 0;
  }
}
.tp-offcanvas-2-logo .logo-2 {
  display: block !important;
}

/*----------------------------------------*/
/*  5.1 Postbox css
/*----------------------------------------*/
.postbox-wrapper {
  margin-right: 20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .postbox-wrapper {
    margin-right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .postbox-wrapper {
    margin-right: 0;
    margin-bottom: 0;
  }
}
.postbox-author-img {
  flex: 0 0 auto;
  margin-right: 15px;
}
.postbox-author-img img {
  height: 42px;
  width: 42px;
  border-radius: 50%;
}
.postbox-author-name {
  font-weight: 700;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 5px;
  letter-spacing: -0.01em;
  color: rgba(255, 255, 255, 0.9);
}
.postbox-author-info {
  line-height: 1;
}
.postbox-author-info span {
  font-weight: 600;
  font-size: 13px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.6);
}
.postbox-author-wrap {
  padding: 0px 20px;
}
@media (max-width: 767px) {
  .postbox-author-wrap {
    flex-wrap: wrap;
    padding: 0;
  }
}
@media (max-width: 767px) {
  .postbox-author-box {
    margin-bottom: 15px;
    margin-right: 15px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .postbox-author-box {
    margin-bottom: 0;
  }
}
.postbox-meta i {
  color: rgba(255, 255, 255, 0.6);
}
.postbox-meta i svg {
  margin-right: 4px;
  display: inline-block;
  transform: translateY(-2px);
}
.postbox-meta span {
  font-weight: 600;
  font-size: 15px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.6);
}
.postbox-item {
  padding: 35px 15px;
  padding-bottom: 40px;
  border-radius: 20px;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.postbox-item:hover .postbox-thumb img {
  transform: scale(1.1);
}
.postbox-tag {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 15px;
  display: inline-block;
  color: rgba(255, 255, 255, 0.6);
}
.postbox-tag i svg {
  margin-right: 4px;
  transform: translateY(-1px);
}
.postbox-title {
  font-size: 40px;
  line-height: 1.1;
  font-weight: 600;
  margin-bottom: 23px;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
}
.postbox-title.fs-80 {
  font-size: 80px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -2.4px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .postbox-title.fs-80 {
    font-size: 75px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox-title.fs-80 {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .postbox-title.fs-80 {
    font-size: 45px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .postbox-title.fs-80 br {
    display: none;
  }
}
.postbox-title.fs-54 {
  font-size: 54px;
  font-weight: 700;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .postbox-title.fs-54 {
    font-size: 45px;
  }
}
@media (max-width: 767px) {
  .postbox-title.fs-54 {
    font-size: 40px;
  }
}
.postbox-title.fs-34 {
  font-size: 34px;
  margin-bottom: 18px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox-title {
    font-size: 35px;
  }
}
@media (max-width: 767px) {
  .postbox-title {
    font-size: 25px;
  }
}
.postbox-title a:hover {
  color: var(--tp-common-green-light);
}
.postbox-content {
  padding: 0px 20px;
}
@media (max-width: 767px) {
  .postbox-content {
    padding: 0;
  }
}
.postbox-content p {
  font-weight: 400;
  font-size: 17px;
  line-height: 1.6;
  margin-bottom: 30px;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .postbox-content p {
    font-size: 16px;
  }
  .postbox-content p br {
    display: none;
  }
}
.postbox-play-btn {
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
}
.postbox-play-btn a {
  height: 80px;
  width: 80px;
  line-height: 77px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  background-color: var(--tp-common-white);
  animation: animate-pulse 3s linear infinite;
}
.postbox-play-btn a svg {
  margin-left: 3px;
  display: inline-block;
}
.postbox-slider-item {
  position: relative;
  border-radius: 14px;
}
.postbox-slider-item::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  border-radius: 14px;
  background-color: rgba(0, 0, 0, 0.3);
}
.postbox-slider-item img {
  border-radius: 14px;
}
.postbox-arrow button {
  height: 50px;
  width: 50px;
  line-height: 50px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  background-color: var(--tp-common-white);
}
.postbox-arrow button:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.postbox-arrow-prev {
  position: absolute;
  top: 50%;
  left: 30px;
  z-index: 2;
  transform: translateY(-50%);
}
.postbox-arrow-next {
  position: absolute;
  top: 50%;
  right: 30px;
  z-index: 2;
  transform: translateY(-50%);
}
.postbox-blockquote {
  padding: 50px 55px;
  padding-bottom: 30px;
  border-radius: 14px;
  background: #1a1b1e;
}
@media (max-width: 767px) {
  .postbox-blockquote {
    padding: 30px 20px;
    padding-bottom: 30px;
  }
}
.postbox-blockquote-paragraph p {
  font-weight: 600;
  font-size: 24px;
  line-height: 1.5;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox-blockquote-paragraph p br {
    display: none;
  }
}
@media (max-width: 767px) {
  .postbox-blockquote-paragraph p {
    font-size: 20px;
  }
  .postbox-blockquote-paragraph p br {
    display: none;
  }
}
.postbox-blockquote-icon {
  margin-bottom: 20px;
  display: inline-block;
}
.postbox-thumb {
  border-radius: 14px;
  overflow: hidden;
}
.postbox-thumb-overlay::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  background: rgba(0, 0, 0, 0.3);
}
.postbox-thumb img {
  transition: 0.9s;
  border-radius: 14px;
}
@media (max-width: 767px) {
  .postbox__comment {
    padding-top: 50px;
  }
}
.postbox__comment ul {
  margin-right: 75px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .postbox__comment ul {
    margin-right: 0;
  }
}
.postbox__comment ul li {
  margin-bottom: 30px;
  list-style: none;
}
.postbox__comment ul li.children {
  margin-left: 100px;
}
@media (max-width: 767px) {
  .postbox__comment ul li.children {
    margin-left: 15px;
  }
}
.postbox__comment-title {
  font-weight: 600;
  font-size: 30px;
  line-height: 1.1;
  margin-bottom: 15px;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
}
.postbox__comment-box {
  padding-top: 20px;
}
@media (max-width: 767px) {
  .postbox__comment-box {
    flex-wrap: wrap;
  }
}
.postbox__comment-info {
  flex: 0 0 auto;
}
.postbox__comment-avater {
  flex: 0 0 auto;
}
@media (max-width: 767px) {
  .postbox__comment-avater {
    margin-right: 0;
  }
}
.postbox__comment-avater img {
  width: 70px;
  height: 70px;
  border-radius: 50%;
}
@media (max-width: 767px) {
  .postbox__comment-avater img {
    margin-bottom: 30px;
  }
}
.postbox__comment-name {
  margin-bottom: 17px;
}
.postbox__comment-name h5 {
  font-weight: 700;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
}
.postbox__comment-name span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.7);
}
.postbox__comment-text p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.6;
  margin-bottom: 20px;
  color: rgba(255, 255, 255, 0.7);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox__comment-text p {
    font-size: 15px;
  }
}
.postbox__comment-reply a {
  font-weight: 600;
  font-size: 13px;
  line-height: 1;
  padding: 11px 20px;
  border-radius: 40px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.postbox__comment-reply a span {
  margin-left: 6px;
  display: inline-block;
}
.postbox__comment-reply a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-green-light);
  background-color: var(--tp-common-green-light);
}
.postbox__comment-agree {
  padding-left: 5px;
}
.postbox__comment-agree input {
  margin: 0;
  appearance: none;
  -moz-appearance: none;
  display: block;
  width: 16px;
  height: 16px;
  background: var(--tp-common-white);
  border: 1px solid #949392;
  outline: none;
  flex: 0 0 auto;
  transform: translateY(-1px);
}
.postbox__comment-agree input:checked {
  position: relative;
  background-color: var(--tp-theme-1);
  border-color: transparent;
}
.postbox__comment-agree input:checked::after {
  box-sizing: border-box;
  content: "\f00c";
  position: absolute;
  font-family: var(--tp-ff-fontawesome);
  font-size: 10px;
  color: var(--tp-common-white);
  top: 47%;
  left: 50%;
  transform: translate(-50%, -50%);
}
.postbox__comment-agree input:hover {
  cursor: pointer;
}
.postbox__comment-agree label {
  padding-left: 8px;
  color: #838383;
  line-height: 1;
}
.postbox__comment-agree label a {
  color: var(--tp-common-black);
  font-weight: 600;
  padding-left: 4px;
}
.postbox__comment-agree label a:hover {
  color: var(--tp-theme-1);
}
.postbox__comment-agree label:hover {
  cursor: pointer;
}

.basic-pagination {
  margin-bottom: 40px;
}
.basic-pagination ul li {
  list-style: none;
  display: inline-block;
  margin-right: 5px;
}
@media (max-width: 767px) {
  .basic-pagination ul li {
    margin-right: 5px;
  }
}
.basic-pagination ul li:hover a {
  border-color: #D0FF71;
  background-color: #D0FF71;
  color: var(--tp-common-black);
}
.basic-pagination ul li > a {
  height: 50px;
  width: 50px;
  line-height: 49px;
  text-align: center;
  font-weight: 600;
  font-size: 16px;
  border-radius: 50%;
  display: inline-block;
  color: var(--tp-common-white);
  transition: all 0.3s ease-in-out;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.basic-pagination ul li .current {
  height: 50px;
  width: 50px;
  font-weight: 600;
  line-height: 49px;
  text-align: center;
  font-size: 16px;
  border-radius: 50%;
  display: inline-block;
  border-color: #D0FF71;
  background-color: #D0FF71;
  color: var(--tp-common-black);
  transition: all 0.3s ease-in-out;
}
.basic-pagination-label span {
  font-weight: 500;
  font-size: 15px;
  line-height: 1.33;
  color: #525356;
  display: inline-block;
}
@media (max-width: 767px) {
  .basic-pagination-label span {
    margin-bottom: 15px;
  }
}
.basic-pagination.product-pagination ul li > a {
  color: #4d3d30;
  border: 1px solid rgb(77, 61, 48);
}
.basic-pagination.product-pagination ul li:hover a {
  background-color: #4d3d30;
  color: var(--tp-common-white);
}
.basic-pagination.product-pagination ul li .current {
  background-color: #4d3d30;
  color: var(--tp-common-white);
}

.postbox-details-item {
  padding: 43px 45px;
  border-radius: 14px;
}
@media (max-width: 767px) {
  .postbox-details-item {
    padding: 30px;
  }
}
.postbox-details-item.item-border {
  border-radius: 20px;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.postbox-details-tag {
  margin-bottom: 8px;
}
@media (max-width: 767px) {
  .postbox-details-tag {
    flex-wrap: wrap;
  }
}
.postbox-details-tag span:last-child {
  position: relative;
  padding-left: 9px;
  margin-left: 9px;
  display: inline-block;
}
.postbox-details-tag span:last-child::after {
  position: absolute;
  content: "";
  top: 8px;
  left: -3px;
  height: 4px;
  width: 4px;
  border-radius: 50%;
  background-color: rgba(255, 255, 255, 0.6);
}
@media (max-width: 767px) {
  .postbox-details-tag-wrap {
    flex-wrap: wrap;
  }
}
@media (max-width: 767px) {
  .postbox-details-meta {
    flex-wrap: wrap;
  }
}
.postbox-details-meta .postbox-author-name {
  font-weight: 700;
  margin-bottom: 0;
  color: rgba(255, 255, 255, 0.6);
}
.postbox-details-meta > div:not(:first-child) {
  padding-left: 16px;
  margin-left: 16px;
  position: relative;
}
@media (max-width: 767px) {
  .postbox-details-meta > div:not(:first-child) {
    padding-left: 0;
    margin-left: 0;
    margin-right: 10px;
  }
}
.postbox-details-meta > div:not(:first-child)::after {
  position: absolute;
  content: "";
  top: 2px;
  left: 0;
  width: 1px;
  height: 24px;
  background: rgba(255, 255, 255, 0.1);
}
@media (max-width: 767px) {
  .postbox-details-meta > div:not(:first-child)::after {
    display: none;
  }
}
@media (max-width: 767px) {
  .postbox-details-meta .postbox-meta {
    margin-bottom: 15px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .postbox-details-meta .postbox-meta {
    margin-bottom: 0;
  }
}
.postbox-details-thumb {
  gap: 11px;
}
.postbox-details-thumb img {
  border-radius: 14px;
}
.postbox-details-text p {
  font-weight: 500;
  font-size: 17px;
  line-height: 1.6;
  color: rgba(255, 255, 255, 0.7);
}
.postbox-details-text p span {
  color: var(--tp-common-green-light);
}
.postbox-details-quote p {
  font-weight: 600;
  font-size: 30px;
  line-height: 1.3;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .postbox-details-quote p {
    font-size: 25px;
  }
  .postbox-details-quote p br {
    display: none;
  }
}
.postbox-details-quote span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.6);
}
.postbox-details-quote span::before {
  content: "";
  height: 1px;
  width: 40px;
  margin-right: 10px;
  display: inline-block;
  transform: translateY(-5px);
  background-color: rgba(255, 255, 255, 0.6);
}
@media (max-width: 767px) {
  .postbox-details-quote-box {
    flex-wrap: wrap;
  }
}
.postbox-details-quote-box i {
  flex: 0 0 auto;
  margin-right: 35px;
  display: inline-block;
}
@media (max-width: 767px) {
  .postbox-details-quote-box i {
    margin-right: 0;
    margin-bottom: 20px;
  }
}
.postbox-details-list ul {
  padding-left: 30px;
}
@media (max-width: 767px) {
  .postbox-details-list ul {
    padding-left: 0;
  }
}
.postbox-details-list ul li {
  list-style-type: none;
  font-weight: 500;
  font-size: 17px;
  line-height: 1.1;
  color: rgba(255, 255, 255, 0.7);
  position: relative;
  padding-left: 20px;
}
.postbox-details-list ul li:not(:last-child) {
  margin-bottom: 15px;
}
.postbox-details-list ul li::before {
  position: absolute;
  top: 7px;
  left: 0;
  content: "";
  height: 5px;
  width: 5px;
  margin-right: 10px;
  border-radius: 50%;
  display: inline-block;
  background-color: rgba(255, 255, 255, 0.7);
}
.postbox-details-list ul li span {
  color: rgba(255, 255, 255, 0.3);
}
.postbox-details-list ul li i {
  font-style: normal;
  color: var(--tp-common-green-light);
}
.postbox-details-code {
  padding: 25px 30px;
  border-radius: 14px;
  background: #1a1b1e;
}
.postbox-details-code pre {
  font-size: 15px;
  font-weight: 500;
  line-height: 1.8;
  margin: 0;
  color: rgba(255, 255, 255, 0.7);
}
.postbox-details-tag span {
  margin-bottom: 10px;
  display: inline-block;
  font-weight: 600;
  font-size: 17px;
  line-height: 1;
  margin-right: 15px;
  color: var(--tp-common-white);
}
.postbox-details-author .sidebar-widget-author-img {
  flex: 0 0 auto;
  margin-bottom: 0;
  margin-right: 30px;
}
@media (max-width: 767px) {
  .postbox-details-author .sidebar-widget-author-img {
    margin-right: 0;
    margin-bottom: 20px;
  }
}
.postbox-details-author .sidebar-widget-author-img img {
  height: 100px;
  width: 100px;
}
.postbox-details-author .sidebar-widget-author {
  padding: 0;
  padding-bottom: 0;
  padding: 30px;
  border: none;
  border-radius: 14px;
  background: #1a1b1e;
}
@media (max-width: 767px) {
  .postbox-details-author .sidebar-widget-author {
    flex-wrap: wrap;
  }
}
.postbox-details-author .sidebar-widget-author-content span {
  margin-bottom: 8px;
}
.postbox-details-author .sidebar-widget-author-name {
  margin-bottom: 18px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .postbox-details-author .sidebar-widget-author-content p br {
    display: none;
  }
}
.postbox-details-nevigation-wrap {
  height: 560px;
  overflow: hidden;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .postbox-details-nevigation-wrap {
    height: 460px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .postbox-details-nevigation-wrap {
    height: 320px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox-details-nevigation-wrap {
    height: 350px;
    margin-top: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox-details-nevigation-wrap {
    height: 350px;
    margin-top: 50px;
  }
}
@media (max-width: 767px) {
  .postbox-details-nevigation-wrap {
    height: 140px;
    margin-top: 50px;
  }
}
.postbox-details-nevigation-wrap:hover .postbox-details-nevigation-thumb-bg {
  transform: scale(0.95);
}
.postbox-details-nevigation-thumb {
  position: relative;
}
.postbox-details-nevigation-thumb::after {
  position: absolute;
  content: "";
  top: -50px;
  left: 0;
  width: 100%;
  height: 120%;
  background: rgba(0, 0, 0, 0.4);
}
.postbox-details-nevigation-thumb img {
  width: 100%;
  margin-top: -290px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .postbox-details-nevigation-thumb img {
    margin-top: -50px;
  }
}
.postbox-details-nevigation-thumb-bg {
  width: 100%;
  height: 100%;
  background-color: #1a1b1e;
  transition: all 0.3s ease-in-out;
}
.postbox-details-nevigation-content {
  position: absolute;
  top: 50%;
  left: 0;
  right: 0;
  z-index: 5;
  text-align: center;
  transform: translateY(-50%);
}
.postbox-details-nevigation-content span {
  font-weight: 500;
  font-size: 24px;
  line-height: 1;
  margin-bottom: 15px;
  display: inline-block;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .postbox-details-nevigation-content span {
    font-size: 16px;
  }
}
.postbox-details-nevigation-title {
  font-weight: 700;
  font-size: 60px;
  margin-bottom: 0;
  line-height: 1.17;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox-details-nevigation-title {
    font-size: 45px;
  }
}
@media (max-width: 767px) {
  .postbox-details-nevigation-title {
    font-size: 20px;
  }
}
.postbox-details-form {
  padding: 60px;
  border-radius: 20px;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .postbox-details-form {
    padding: 30px;
  }
}
@media (max-width: 767px) {
  .postbox-details-form {
    padding: 20px;
  }
}
.postbox-details-form p {
  font-weight: 500;
  font-size: 15px;
  line-height: 1.7;
  margin-bottom: 23px;
  color: rgba(255, 255, 255, 0.7);
}
@media (max-width: 767px) {
  .postbox-details-form p {
    font-size: 16px;
  }
}
.postbox-details-form-title {
  font-weight: 600;
  font-size: 30px;
  line-height: 1.6;
  margin-bottom: 0;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
}
.postbox-details-input label {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 12px;
  color: var(--tp-common-white);
}
.postbox-details-input input, .postbox-details-input textarea {
  font-size: 17px;
  font-weight: 400;
  margin-bottom: 25px;
  border-radius: 14px;
  background: #1a1b1e;
  color: var(--tp-common-white);
  border: 1px solid #1a1b1e;
}
.postbox-details-input input::-webkit-input-placeholder, .postbox-details-input textarea::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-size: 17px;
  font-weight: 400;
  color: #707072;
}
.postbox-details-input input::-moz-placeholder, .postbox-details-input textarea::-moz-placeholder { /* Firefox 19+ */
  font-size: 17px;
  font-weight: 400;
  color: #707072;
}
.postbox-details-input input:-moz-placeholder, .postbox-details-input textarea:-moz-placeholder { /* Firefox 4-18 */
  font-size: 17px;
  font-weight: 400;
  color: #707072;
}
.postbox-details-input input:-ms-input-placeholder, .postbox-details-input textarea:-ms-input-placeholder { /* IE 10+  Edge*/
  font-size: 17px;
  font-weight: 400;
  color: #707072;
}
.postbox-details-input input::placeholder, .postbox-details-input textarea::placeholder { /* MODERN BROWSER */
  font-size: 17px;
  font-weight: 400;
  color: #707072;
}
.postbox-details-input input:focus, .postbox-details-input textarea:focus {
  border-color: var(--tp-common-green-light);
}
.postbox-details-input textarea {
  height: 160px;
  resize: none;
  margin-bottom: 20px;
}
.postbox-details-remeber input {
  display: none;
}
.postbox-details-remeber input:checked ~ label::before {
  visibility: visible;
  opacity: 1;
}
.postbox-details-remeber label {
  position: relative;
  padding-left: 30px;
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.7);
}
.postbox-details-remeber label::after {
  position: absolute;
  content: "";
  top: -3px;
  left: 0;
  width: 20px;
  height: 20px;
  z-index: -1;
  transition: 0.3s;
  line-height: 16px;
  border-radius: 4px;
  text-align: center;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.postbox-details-remeber label::before {
  position: absolute;
  content: url("../img/svg/check.svg");
  top: -2px;
  left: 2px;
  width: 16px;
  height: 16px;
  line-height: 16px;
  text-align: center;
  visibility: hidden;
  opacity: 0;
  transition: 0.3s;
  color: var(--tp-common-white);
}
.postbox-details-remeber label:hover {
  cursor: pointer;
}
.postbox-details-social a {
  height: 36px;
  width: 36px;
  line-height: 33px;
  text-align: center;
  margin-bottom: 10px;
  border-radius: 14px;
  display: inline-block;
  background-color: #1a1b1e;
  color: rgba(255, 255, 255, 0.8);
}
.postbox-details-social a svg {
  height: 15px;
  width: 15px;
}
.postbox-details-social a:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-light);
}

/*----------------------------------------*/
/*  5.2 Recent Post css
/*----------------------------------------*/
.rc-post-thumb {
  flex: 0 0 auto;
  overflow: hidden;
  margin-right: 30px;
  border-radius: 14px;
}
.rc-post-thumb img {
  transition: 0.9s;
  border-radius: 14px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .rc-post-thumb img {
    height: 100px;
    width: 100px;
  }
}
.rc-post:hover .rc-post-thumb img {
  transform: scale(1.1);
}
.rc-post-category {
  margin-bottom: 10px;
}
.rc-post-category a {
  font-weight: 600;
  font-size: 13px;
  line-height: 1;
  color: #f9e4b4;
  padding: 7px 12px;
  border-radius: 15px;
  display: inline-block;
  background: rgba(249, 228, 180, 0.08);
}
.rc-post-title {
  font-weight: 600;
  font-size: 20px;
  line-height: 1.4;
  margin-bottom: 8px;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .rc-post-title {
    font-size: 18px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .rc-post-title {
    font-size: 16px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .rc-post-title {
    font-size: 18px;
  }
}
.rc-post-title a:hover {
  color: var(--tp-common-green-light);
}
.rc-post-meta span {
  font-weight: 600;
  font-size: 13px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.6);
}
.rc-post-wrap .rc-post:not(:last-child) {
  padding-bottom: 25px;
  margin-bottom: 25px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.08);
}

/*----------------------------------------*/
/*  5.3 Sidebar css
/*----------------------------------------*/
.sidebar-search {
  position: relative;
}
.sidebar-search input {
  width: 100%;
  height: 60px;
  padding: 0 25px;
  font-weight: 500;
  font-size: 18px;
  line-height: 60px;
  border-radius: 14px;
  padding-right: 50px;
  background: #1a1b1e;
  border: 1px solid transparent;
  color: var(--tp-common-white);
}
.sidebar-search input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.3);
}
.sidebar-search input::-moz-placeholder { /* Firefox 19+ */
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.3);
}
.sidebar-search input:-moz-placeholder { /* Firefox 4-18 */
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.3);
}
.sidebar-search input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.3);
}
.sidebar-search input::placeholder { /* MODERN BROWSER */
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.3);
}
.sidebar-search input:focus {
  background-color: #0E0F11;
  border: 1px solid #D0FF71;
}
.sidebar-search button {
  position: absolute;
  top: 0;
  right: 25px;
  height: 100%;
  line-height: 60px;
  color: var(--tp-common-white);
}
.sidebar-search button:hover {
  color: #D0FF71;
}
.sidebar-widget-author {
  padding: 40px;
  border-radius: 14px;
  border: 1px solid rgba(255, 255, 255, 0.06);
}
.sidebar-widget-author-img {
  margin-bottom: 35px;
}
.sidebar-widget-author-img img {
  height: 120px;
  width: 120px;
  border-radius: 50%;
}
.sidebar-widget-author-name {
  font-weight: 600;
  font-size: 22px;
  line-height: 1;
  margin-bottom: 5px;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.sidebar-widget-author-content span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  margin-bottom: 20px;
  display: inline-block;
  color: rgba(255, 255, 255, 0.4);
}
.sidebar-widget-author-content p {
  font-weight: 500;
  font-size: 17px;
  line-height: 1.5;
  margin-bottom: 20px;
  color: rgba(255, 255, 255, 0.7);
}
.sidebar-widget-author-social a {
  margin: 0 5px;
}
.sidebar-widget-author-social a span {
  transition: all 0.4s ease-in-out;
  color: var(--tp-common-white);
}
.sidebar-widget-author-social a:hover span {
  color: #D0FF71;
}
.sidebar-widget-title {
  font-weight: 600;
  font-size: 24px;
  line-height: 1;
  margin-bottom: 30px;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.sidebar-widget-category ul li {
  list-style-type: none;
}
.sidebar-widget-category ul li a {
  border-radius: 14px;
  padding: 12px 20px;
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  background: #1a1b1e;
  letter-spacing: -0.01em;
  color: rgba(255, 255, 255, 0.8);
}
.sidebar-widget-category ul li a span {
  transition: 0.3s;
}
.sidebar-widget-category ul li a span:last-child {
  color: rgba(255, 255, 255, 0.4);
}
.sidebar-widget-category ul li a:hover {
  color: #D0FF71;
}
.sidebar-widget-category ul li a:hover span:last-child {
  color: #D0FF71;
}
.sidebar-widget-category ul li:not(:last-child) {
  margin-bottom: 6px;
}
.sidebar-wrapper {
  padding-left: 35px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .sidebar-wrapper {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .sidebar-wrapper {
    padding-left: 0;
    margin-top: 70px;
  }
}
.sidebar-blog-grid-wrap .sidebar-wrapper {
  padding-left: 2px;
}

.tagcloud a {
  border-radius: 14px;
  padding: 10px 18px;
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  text-align: center;
  margin-bottom: 10px;
  background: #1a1b1e;
  display: inline-block;
  text-transform: capitalize;
  color: rgba(255, 255, 255, 0.8);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tagcloud a {
    padding: 10px 14px;
    font-size: 13px;
  }
}
@media (max-width: 767px) {
  .tagcloud a {
    padding: 10px 14px;
  }
}
.tagcloud a:not(:last-child) {
  margin-right: 5px;
}
.tagcloud a:hover {
  color: var(--tp-common-black);
  background-color: #D0FF71;
}

/*----------------------------------------*/
/*  5.4 Blog css
/*----------------------------------------*/
.dgm-blog-content {
  min-width: 310px;
  height: 100%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-blog-content {
    min-width: 220px;
  }
}
@media (max-width: 767px) {
  .dgm-blog-content {
    min-width: 100%;
    height: auto;
    margin-bottom: 30px;
  }
}
.dgm-blog-content-wrap {
  height: 100%;
}
@media (max-width: 767px) {
  .dgm-blog-content-wrap {
    height: auto;
    flex-wrap: wrap;
  }
}
.dgm-blog-meta h4 {
  font-weight: 700;
  font-size: 20px;
  line-height: 1;
  margin-bottom: 2px;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-blog-meta span {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  color: #4d5051;
  letter-spacing: -0.04em;
}
.dgm-blog-category span {
  font-weight: 400;
  font-size: 14px;
  line-height: 1;
  padding: 7px 10px;
  border-radius: 6px;
  display: inline-block;
  background-color: #EFFAC0;
  color: var(--tp-common-black);
}
.dgm-blog-title-sm {
  font-weight: 500;
  font-size: 34px;
  line-height: 1;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-blog-title-sm {
    font-size: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-blog-title-sm {
    font-size: 25px;
  }
}
@media (max-width: 767px) {
  .dgm-blog-title-box {
    margin-bottom: 20px;
  }
}
.dgm-blog-item {
  padding-top: 35px;
  padding-bottom: 35px;
  border-top: 1px solid rgba(20, 20, 20, 0.1);
}
.dgm-blog-item:hover .dgm-blog-thumb img {
  transform: scale(1.1) rotate(-2deg);
}
.dgm-blog-main {
  border-bottom: 1px solid rgba(20, 20, 20, 0.1);
}
.dgm-blog-thumb {
  display: inline-block;
  overflow: hidden;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-blog-thumb {
    margin-top: 20px;
  }
}
@media (max-width: 767px) {
  .dgm-blog-thumb {
    width: 100%;
  }
}
.dgm-blog-thumb img {
  width: 100%;
  height: 160px;
  transition: 0.9s;
  object-fit: cover;
}
@media (max-width: 767px) {
  .dgm-blog-thumb img {
    width: 100%;
  }
}

.creative-blog-item:hover .creative-blog-thumb img {
  transform: perspective(600px) rotateX(0.09deg) rotateY(0) scaleX(1.1) scaleY(1.1);
}
.creative-blog-thumb {
  overflow: hidden;
  margin-bottom: 30px;
  border-radius: 20px;
}
.creative-blog-thumb img {
  width: 100%;
  height: 300px;
  object-fit: cover;
  border-radius: 20px;
  transition: transform 500ms;
  transform-origin: center center;
  transform: perspective(0) rotateX(0) rotateY(0) scaleX(1) scaleY(1);
}
.creative-blog-meta span {
  font-weight: 600;
  font-size: 14px;
  line-height: 1;
  margin-bottom: 20px;
  display: inline-block;
  color: rgba(255, 255, 255, 0.5);
}
.creative-blog-meta span:not(:last-child) {
  padding-right: 10px;
  margin-right: 10px;
  position: relative;
}
.creative-blog-meta span:not(:last-child)::after {
  position: absolute;
  top: -1px;
  right: -2px;
  content: "";
  height: 17px;
  width: 1.5px;
  display: inline-block;
  background-color: rgba(255, 255, 255, 0.5);
}
.creative-blog-title-sm {
  font-weight: 600;
  font-size: 26px;
  line-height: 1.3;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-blog-title-sm br {
    display: none;
  }
}
.creative-blog-title-box {
  padding-left: 80px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-blog-title-box {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-blog-title-box {
    margin-bottom: 10px;
  }
}
.creative-blog-top-content {
  padding-left: 45px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-blog-top-content {
    padding-left: 0;
  }
}
.creative-blog-top-content p {
  font-weight: 400;
  font-size: 17px;
  line-height: 1.53;
  margin-bottom: 25px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .creative-blog-top-content p br {
    display: none;
  }
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-blog-area {
    padding-bottom: 70px;
  }
}
.ai-blog-item {
  border-radius: 20px;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.ai-blog-item:hover .ai-blog-thumb img {
  transform: scale(1.1) rotate(-2deg);
}
.ai-blog-thumb {
  overflow: hidden;
  border-radius: 20px;
}
.ai-blog-thumb img {
  width: 100%;
  height: 250px;
  transition: 0.9s;
  object-fit: cover;
  border-radius: 20px;
}
.ai-blog-content span {
  color: #FFF6BF;
  font-size: 14px;
  font-weight: 600;
  line-height: 1;
  margin-bottom: 12px;
  display: inline-block;
  letter-spacing: -0.28px;
  text-transform: uppercase;
}
.ai-blog-content-wrap {
  padding: 28px 30px 32px 30px;
}
.ai-blog-meta span {
  position: relative;
  font-size: 14px;
  font-weight: 600;
  color: rgba(255, 255, 255, 0.4);
}
.ai-blog-meta span:not(:last-child) {
  margin-right: 11px;
  padding-right: 11px;
}
.ai-blog-meta span:not(:last-child)::after {
  position: absolute;
  content: "";
  top: 7px;
  right: -3px;
  height: 4px;
  width: 4px;
  border-radius: 50%;
  background-color: rgba(255, 255, 255, 0.4);
}
.ai-blog-title {
  font-size: 24px;
  font-weight: 700;
  line-height: 1.4;
  margin-bottom: 25px;
  letter-spacing: -0.48px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-blog-title {
    font-size: 20px;
  }
}
.ai-blog-shape-1 {
  position: absolute;
  bottom: 48%;
  right: -2%;
  z-index: -1;
}

.ar-blog-category {
  position: absolute;
  top: 0;
  left: 0;
  margin: 20px;
  font-weight: 600;
  border-radius: 30px;
  padding: 8px 14px;
  font-size: 13px;
  line-height: 1;
  letter-spacing: 1px;
  color: #1d2132;
  display: inline-block;
  text-transform: uppercase;
  background-color: var(--tp-common-white);
}
.ar-blog-title-sm {
  font-size: 24px;
  line-height: 1.3;
  letter-spacing: 1px;
  margin-bottom: 8px;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-blog-title-sm {
    font-size: 20px;
  }
}
@media (max-width: 767px) {
  .ar-blog-title-box {
    margin-bottom: 20px;
  }
}
.ar-blog-meta {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  color: rgba(25, 25, 25, 0.6);
}
.ar-blog-thumb {
  margin-bottom: 20px;
  overflow: hidden;
}
.ar-blog-thumb img {
  height: 413px;
  transition: 0.9s;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-blog-area .gx-40 {
    --bs-gutter-x: 30px;
  }
}
.ar-blog-item:hover .ar-blog-thumb img {
  transform: scale(1.1);
}

.crp-blog-shape {
  position: absolute;
  top: 145px;
  right: 0;
  z-index: -1;
}
.crp-blog-title {
  font-weight: 600;
  font-size: 180px;
  line-height: 0.7;
  margin-bottom: 0;
  opacity: 0.1;
  margin-left: -100px;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  writing-mode: vertical-lr;
  transform: translateY(-40px) rotate(180deg);
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .crp-blog-title {
    font-size: 175px;
    margin-left: 0;
    transform: translateY(0);
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-blog-title {
    font-size: 150px;
    margin-left: 0;
    transform: translateY(0);
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-blog-title {
    margin-left: 0;
    font-size: 110px;
    margin-bottom: 40px;
    writing-mode: inherit;
    transform: translateY(0);
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-blog-title {
    margin-left: 0;
    font-size: 84px;
    margin-bottom: 40px;
    writing-mode: inherit;
    transform: translateY(0px);
  }
}
@media (max-width: 767px) {
  .crp-blog-title {
    font-size: 67px;
    margin-left: 0;
    margin-bottom: 40px;
    writing-mode: inherit;
    transform: translateY(0px);
  }
}
.crp-blog-title-sm {
  font-weight: 500;
  font-size: 54px;
  line-height: 1;
  margin-bottom: 30px;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-blog-title-sm {
    font-size: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-blog-title-sm {
    font-size: 35px;
  }
}
.crp-blog-meta {
  font-weight: 600;
  font-size: 15px;
  line-height: 1;
  margin-bottom: 22px;
  display: inline-block;
  color: var(--tp-common-cream-3);
}
.crp-blog-thumb {
  border-radius: 20px;
  overflow: hidden;
}
.crp-blog-thumb img {
  width: 100%;
  height: 350px;
  transition: 0.9s;
  border-radius: 20px;
  object-fit: cover;
}
.crp-blog-thumb:hover img {
  transform: scale(1.1) rotate(-2deg);
}
.crp-blog-category span {
  font-weight: 600;
  font-size: 12px;
  line-height: 1;
  transition: 0.3s;
  padding: 7px 18px;
  border-radius: 10px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-cream-3);
  border: 1px solid rgba(255, 255, 230, 0.1);
}
.crp-blog-category span:not(:last-child) {
  margin-right: 7px;
}
.crp-blog-category span:hover {
  background-color: rgba(255, 255, 230, 0.1);
}
@media (max-width: 767px) {
  .crp-blog-item {
    flex-wrap: wrap;
  }
}
.crp-blog-content {
  margin-left: 55px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-blog-content {
    margin-left: 40px;
  }
}
@media (max-width: 767px) {
  .crp-blog-content {
    margin-left: 0;
  }
}
@media (max-width: 767px) {
  .crp-blog-content {
    margin-top: 30px;
  }
}

.st-blog-item:hover .st-blog-item-thumb img {
  transform: scale(1.1);
}
.st-blog-item-thumb {
  overflow: hidden;
  margin-bottom: 25px;
  border-radius: 10px;
}
.st-blog-item-thumb img {
  width: 100%;
  height: 450px;
  object-fit: cover;
  transition: 0.9s;
  border-radius: 10px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-blog-item-thumb img {
    height: 100%;
  }
}
.st-blog-item-title {
  font-size: 24px;
  font-weight: 600;
  margin-bottom: 20px;
  letter-spacing: -0.48px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-blog-item-title br {
    display: none;
  }
}
.st-blog-item-tags span {
  font-size: 14px;
  font-weight: 400;
  padding: 0 10px;
  border-radius: 14px;
  display: inline-block;
  color: var(--tp-common-brown);
  border: 1px solid rgba(69, 48, 48, 0.15);
}
.st-blog-item-tags p {
  color: #494949;
  font-size: 16px;
  font-weight: 400;
  margin: 0;
}
.st-blog-item-tags-devide {
  height: 1px;
  width: 40px;
  margin: 0 15px 0 20px;
  background: rgba(69, 48, 48, 0.15);
}
.st-blog-text p {
  color: #494949;
  letter-spacing: 0;
  margin-bottom: 30px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-blog-text p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-blog-heading {
    margin-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .st-blog-text {
    margin-bottom: 30px;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-blog-heading {
    padding-bottom: 30px;
  }
}
.cr-blog-item {
  border-radius: 20px;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.cr-blog-item:hover .cr-blog-item-thumb img {
  transform: scale(1.1);
}
.cr-blog-item-thumb {
  margin-bottom: 22px;
  border-radius: 20px;
  overflow: hidden;
}
.cr-blog-item-thumb img {
  width: 100%;
  border-radius: 20px;
  transition: 0.9s;
}
.cr-blog-item-content {
  padding-left: 30px;
  padding-bottom: 40px;
}
.cr-blog-item-category {
  color: #FFF6BF;
  font-size: 14px;
  font-weight: 600;
  margin-bottom: 10px;
  display: inline-block;
  letter-spacing: -0.28px;
  text-transform: uppercase;
}
.cr-blog-item-meta {
  margin: 0;
  font-size: 14px;
  font-weight: 600;
  color: rgba(255, 255, 255, 0.4);
}
.cr-blog-item-title {
  font-size: 24px;
  font-weight: 600;
  margin-bottom: 28px;
  letter-spacing: -0.48px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cr-blog-item-title br {
    display: none;
  }
}
.cr-blog-bottom-border {
  padding: 0 40px 120px 40px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.07);
}
@media (max-width: 767px) {
  .cr-blog-bottom-border {
    padding: 0 0px 100px 0px;
  }
}
.cr-blog-bottom-text {
  font-size: 17px;
  font-weight: 500;
  color: var(--tp-common-white);
  border-bottom: 1px solid #626262;
}
.cr-blog-bottom-text:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-white);
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-blog-heading-wrap {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-heading-wrap {
    padding-bottom: 60px;
  }
}
.tp-blog-heading-wrap .tp-section-subtitle {
  margin-bottom: 16px;
  color: var(--tp-common-white);
}
.tp-blog-heading-wrap .tp-section-subtitle.pre::before {
  background: #D0FF71;
}
.tp-blog-title {
  font-size: 120px;
  font-weight: 700;
  line-height: 1.1;
  letter-spacing: -4.8px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-blog-title {
    font-size: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-blog-title {
    font-size: 85px;
  }
}
@media (max-width: 767px) {
  .tp-blog-title {
    font-size: 55px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-blog-title {
    font-size: 65px;
    letter-spacing: 0;
  }
}
.tp-blog-title a {
  height: 90px;
  width: 90px;
  line-height: 70px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  background-color: #1A1B1E;
}
@media (max-width: 767px) {
  .tp-blog-title a {
    display: none;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-blog-title a {
    line-height: 80px;
    display: inline-block;
  }
}
@media (max-width: 767px) {
  .tp-blog-title img {
    display: none;
  }
}
.tp-blog-title.fs-100 {
  font-size: 100px;
  font-weight: 600;
  letter-spacing: -4px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-blog-title.fs-100 {
    font-size: 85px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-blog-title.fs-100 {
    font-size: 75px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-blog-title.fs-100 {
    font-size: 65px;
  }
}
@media (max-width: 767px) {
  .tp-blog-title.fs-100 {
    font-size: 55px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-title.fs-100 br {
    display: none;
  }
}
.tp-blog-shape {
  position: absolute;
  top: 10%;
  right: 16%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-shape {
    display: none;
  }
}
.tp-blog-masonry-item {
  padding: 30px 15px;
  border-radius: 20px;
  transition: 0.9s;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.tp-blog-masonry-item:hover .tp-blog-masonry-thumb img {
  transform: scale(1.1);
}
.tp-blog-masonry-item-top {
  padding: 0 15px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-blog-masonry-item-top {
    padding: 0;
  }
}
.tp-blog-masonry-item-user-thumb {
  margin-right: 12px;
}
.tp-blog-masonry-item-user-thumb img {
  border-radius: 50%;
}
.tp-blog-masonry-item-user-content span {
  font-size: 16px;
  font-weight: 700;
  line-height: 1;
  margin-bottom: 8px;
  display: inline-block;
  letter-spacing: -0.16px;
  color: rgba(255, 255, 255, 0.9);
}
.tp-blog-masonry-item-user-content p {
  font-size: 13px;
  font-weight: 500;
  line-height: 1;
  margin: 0;
  color: rgba(255, 255, 255, 0.6);
}
.tp-blog-masonry-item-time span {
  font-size: 15px;
  font-weight: 500;
  display: inline-block;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-blog-masonry-item-time span {
    font-size: 13px;
  }
}
.tp-blog-masonry-item-time span svg {
  margin-right: 5px;
}
.tp-blog-masonry-item-2 {
  padding: 30px 15px;
  border-radius: 20px;
  background: #19191B;
}
.tp-blog-masonry-item-2 .tp-blog-masonry-item-top {
  margin-bottom: 40px;
  padding-bottom: 30px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.08);
}
.tp-blog-masonry-item-3 {
  padding: 40px 30px;
  border-radius: 20px;
  background: #19191B;
}
.tp-blog-masonry-item-icon span {
  display: grid;
  height: 64px;
  width: 64px;
  margin-bottom: 30px;
  border-radius: 50%;
  text-align: center;
  place-content: center;
  background: #29292B;
}
.tp-blog-masonry-item-text span {
  font-size: 22px;
  font-weight: 500;
  line-height: 1.34;
  margin-bottom: 40px;
  display: inline-block;
  letter-spacing: -0.44px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-masonry-item-text span br {
    display: none;
  }
}
.tp-blog-masonry-item-text p {
  font-size: 15px;
  font-weight: 600;
  line-height: 1;
  color: var(--tp-common-white);
}
.tp-blog-masonry-content {
  padding: 0 15px;
}
.tp-blog-masonry-tag span {
  font-size: 15px;
  font-weight: 500;
  display: inline-block;
  color: rgba(255, 255, 255, 0.6);
}
.tp-blog-masonry-tag span svg {
  margin-right: 5px;
}
.tp-blog-masonry-thumb {
  overflow: hidden;
  border-radius: 14px;
}
.tp-blog-masonry-thumb img {
  width: 100%;
  transition: 0.9s;
  border-radius: 14px;
}
.tp-blog-masonry-thumb-video {
  position: absolute;
  top: 50%;
  left: 50%;
  z-index: 2;
  transform: translate(-50%, -50%);
}
.tp-blog-masonry-thumb-video span {
  display: grid;
  height: 65px;
  width: 65px;
  border-radius: 50%;
  text-align: center;
  place-content: center;
  background-color: var(--tp-common-white);
  animation: animate-pulse 3s linear infinite;
}
.tp-blog-masonry-thumb-video span svg {
  transform: translateX(2px);
}
.tp-blog-masonry-title {
  font-size: 26px;
  font-weight: 600;
  line-height: 1.3;
  margin-bottom: 28px;
  letter-spacing: -0.52px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-blog-masonry-title {
    font-size: 22px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-masonry-title br {
    display: none;
  }
}
.tp-blog-masonry-title.fs-30 {
  font-size: 30px;
  font-weight: 700;
}
.tp-blog-masonry-btn a {
  font-size: 16px;
  font-weight: 600;
  line-height: 1.1;
  color: #D0FF71;
  overflow: hidden;
  display: inline-block;
  padding-right: 5px;
}
.tp-blog-masonry-btn a span {
  position: relative;
  overflow: hidden;
  margin-left: 5px;
}
.tp-blog-masonry-btn a span svg {
  bottom: -1px;
  left: 1px;
  transform: translateY(-2px);
  transition: all 0.2s ease-out;
}
.tp-blog-masonry-btn a span svg:last-child {
  position: absolute;
  left: -22px;
  bottom: -22px;
  transform: translate(0, 0);
}
.tp-blog-masonry-btn a:hover span svg:first-child {
  opacity: 0;
  transform: translate(20px, -20px);
}
.tp-blog-masonry-btn a:hover span svg:last-child {
  transform: translate(23px, -23px);
}
.tp-blog-list-item {
  padding-top: 40px;
  border-top: 1px solid rgba(255, 255, 255, 0.08);
}
.tp-blog-list-item:hover .tp-blog-list-item-thumb img {
  transform: scale(1.1);
}
.tp-blog-list-item-wrap .tp-blog-list-item:last-child {
  padding-bottom: 40px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.08);
}
.tp-blog-list-item-tags p {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  margin-bottom: 14px;
  color: rgba(255, 255, 255, 0.4);
}
.tp-blog-list-item-tags-name {
  font-size: 20px;
  font-weight: 700;
  line-height: 1;
  margin-bottom: 35px;
  display: block;
  letter-spacing: -0.8px;
  color: var(--tp-common-white);
}
.tp-blog-list-item-meta {
  font-size: 14px;
  font-weight: 600;
  line-height: 1;
  color: #D0FF71;
  padding: 6px 15px;
  border-radius: 96px;
  display: inline-block;
  border: 1px solid rgba(208, 255, 113, 0.1);
}
.tp-blog-list-item-title {
  font-size: 34px;
  font-weight: 500;
  line-height: 1.1;
  letter-spacing: -1.36px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-list-item-title {
    font-size: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-list-item-title br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-list-item-title-box {
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-list-item-content {
    margin-bottom: 30px;
  }
}
.tp-blog-list-item-thumb {
  overflow: hidden;
}
.tp-blog-list-item-thumb img {
  width: 100%;
  transition: 0.9s;
}

@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-blog-details-ptb {
    padding-top: 80px;
  }
}
@media (max-width: 767px) {
  .tp-blog-details-ptb {
    padding-top: 50px;
  }
}
.tp-blog-details-without-ptb {
  padding-top: 220px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-blog-details-without-ptb {
    padding-top: 185px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-details-without-ptb {
    padding-top: 150px;
  }
}
.tp-blog-details-without-heading .postbox-details-item .postbox-tag span {
  font-size: 16px;
  font-weight: 600;
  margin-right: 0px;
  color: rgba(255, 255, 255, 0.6);
}
.tp-blog-details-banner {
  height: 830px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-blog-details-banner {
    height: 600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-blog-details-banner {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .tp-blog-details-banner {
    height: 240px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-blog-details-banner {
    margin-bottom: 60px;
  }
}
.tp-blog-details-banner img {
  width: 100%;
}

.creative-blog-style-2 .tp-section-subtitle.fs-17 {
  margin-bottom: 60px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-blog-style-2 .tp-section-subtitle.fs-17 {
    margin-bottom: 20px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-blog-style-2 .tp-section-title.fs-44 {
    margin-bottom: 20px;
  }
}

/*----------------------------------------*/
/*  6.1 Footer Style 1
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-footer-area {
    padding-top: 90px;
  }
}
@media (max-width: 767px) {
  .tp-footer-area {
    padding-top: 80px;
  }
}
.tp-footer-area.tp-footer-white-style .tp-footer-widget-social a {
  background-color: var(--tp-common-white);
}
.tp-footer-area.tp-footer-white-style .tp-footer-widget-social a:hover {
  background-color: var(--tp-common-red-3);
}
.tp-footer-area.tp-footer-white-style .tp-footer-widget-menu ul li a {
  background-color: var(--tp-common-white);
}
.tp-footer-area.tp-footer-white-style .tp-footer-widget-menu ul li a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.tp-footer-col-2 {
  padding-left: 150px;
  padding-right: 50px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-footer-col-2 {
    padding-left: 130px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-footer-col-2 {
    padding-left: 55px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-footer-col-2 {
    padding-left: 40px;
    padding-right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-footer-col-2 {
    padding-left: 0;
    padding-right: 0;
  }
}
@media (max-width: 767px) {
  .tp-footer-col-2 {
    padding-left: 0;
    padding-right: 0;
  }
}
.tp-footer-col-3 {
  padding-left: 20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-footer-col-3 {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-footer-col-3 {
    padding: 0;
  }
}
.tp-footer-widget-title {
  font-weight: 700;
  font-size: 80px;
  line-height: 1;
  margin-bottom: 30px;
  letter-spacing: -0.06em;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-footer-widget-title {
    font-size: 75px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-footer-widget-title {
    font-size: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-footer-widget-title {
    font-size: 65px;
  }
  .tp-footer-widget-title br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-footer-widget-title {
    font-size: 50px;
  }
}
.tp-footer-widget-title-sm {
  font-weight: 600;
  font-size: 18px;
  line-height: 1;
  letter-spacing: -0.02em;
}
.tp-footer-widget-title-sm.pre::before {
  content: "";
  width: 8px;
  height: 8px;
  margin-right: 9px;
  border-radius: 50%;
  display: inline-block;
  transform: translateY(-2px);
  background-color: var(--tp-common-red-3);
}
.tp-footer-widget-social a {
  height: 42px;
  width: 42px;
  line-height: 39px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  color: var(--tp-common-black);
  background-color: var(--tp-grey-2);
  margin-bottom: 8px;
}
.tp-footer-widget-social a:not(:last-child) {
  margin-right: 3px;
}
.tp-footer-widget-social a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.tp-footer-widget-menu ul li {
  list-style-type: none;
  display: inline-block;
}
.tp-footer-widget-menu ul li a {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-black);
  border-radius: 20px;
  padding: 13px 20px;
  display: inline-block;
  margin-bottom: 8px;
  background-color: var(--tp-grey-2);
}
.tp-footer-widget-menu ul li a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.tp-footer-widget-info {
  margin-bottom: 15px;
}
.tp-footer-widget-info a {
  display: block;
  font-weight: 400;
  font-size: 16px;
  line-height: 1.5;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.tp-footer-widget-info a:hover {
  color: var(--tp-common-red-3);
}
.tp-footer-widget-info a:not(:last-child) {
  margin-bottom: 10px;
}
.tp-footer-text-color.tp-footer-style-6 .tp-footer-widget-title {
  color: var(--tp-common-white);
}
.tp-footer-text-color.tp-footer-style-6 .tp-footer-widget-info a {
  color: var(--tp-common-white);
}
.tp-footer-text-color.tp-footer-style-6 .tp-footer-widget-title-sm {
  color: var(--tp-common-white);
}
.tp-footer-text-color.tp-footer-style-6 .tp-copyright-left span {
  color: var(--tp-common-white);
}
.tp-footer-text-color.tp-footer-style-6 .tp-copyright-right a {
  color: var(--tp-common-white);
}

.tp-copyright-img {
  position: absolute;
  right: 0;
  top: 15px;
  animation: rotate2 5s linear infinite;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-copyright-img {
    right: -10px;
    top: -15px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-copyright-img {
    right: -10px;
    top: -25px;
  }
}
.tp-copyright-big-text {
  font-weight: 800;
  font-size: 259px;
  line-height: 1;
  letter-spacing: -16px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-copyright-big-text {
    font-size: 239px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-copyright-big-text {
    font-size: 194px;
    letter-spacing: -10px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-copyright-big-text {
    font-size: 163px;
    letter-spacing: -7px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-copyright-big-text {
    font-size: 120px;
    letter-spacing: -7px;
  }
}
@media (max-width: 767px) {
  .tp-copyright-big-text {
    font-size: 50px;
    letter-spacing: -2px;
  }
}
.tp-copyright-left {
  padding-left: 330px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-copyright-left {
    padding-left: 290px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-copyright-left {
    padding-left: 255px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-copyright-left {
    padding-left: 215px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-copyright-left {
    padding-left: 0;
  }
}
.tp-copyright-left span {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.5;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.tp-copyright-right {
  padding-right: 40px;
}
@media (max-width: 767px) {
  .tp-copyright-right {
    padding-right: 0;
  }
}
.tp-copyright-right a {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.5;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.tp-copyright-right a:hover {
  color: var(--tp-common-red-3);
}
.tp-copyright-right a:not(:first-child) {
  margin-left: 120px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-copyright-right a:not(:first-child) {
    margin-left: 20px;
  }
}
@media (max-width: 767px) {
  .tp-copyright-right a:not(:first-child) {
    margin-left: 0;
    margin: 0 8px;
  }
}
.tp-copyright-bottom {
  position: relative;
  margin-top: -30px;
  padding-bottom: 55px;
  z-index: 2;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-copyright-bottom {
    margin-top: 0;
    padding-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .tp-copyright-bottom {
    margin-top: 0;
    padding-bottom: 20px;
  }
}

.des-footer-bg {
  padding: 45px 50px;
  border-radius: 20px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-footer-bg {
    padding: 45px 30px;
  }
}
@media (max-width: 767px) {
  .des-footer-bg {
    padding: 45px 40px;
  }
}
@media (max-width: 767px) {
  .des-footer-logo {
    padding: 15px 0;
  }
}
.des-footer-title {
  font-weight: 400;
  font-size: 400px;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-mango);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-footer-title {
    font-size: 300px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-footer-title {
    font-size: 210px;
  }
}
@media (max-width: 767px) {
  .des-footer-title {
    font-size: 100px;
  }
}
.des-footer-top {
  margin-bottom: 150px;
}
@media (max-width: 767px) {
  .des-footer-top {
    flex-direction: column;
    margin-bottom: 80px;
  }
}
.des-footer-top span {
  font-weight: 400;
  font-size: 18px;
  line-height: 1;
  display: inline-block;
  color: var(--tp-common-cream);
}
.des-footer-middle {
  padding-bottom: 70px;
}
@media (max-width: 767px) {
  .des-footer-middle {
    padding-bottom: 50px;
  }
}
.des-footer-middle > span {
  font-weight: 500;
  font-size: 18px;
  line-height: 1.3;
  margin-bottom: 20px;
  display: inline-block;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: rgba(249, 244, 232, 0.5);
}
@media (max-width: 767px) {
  .des-footer-middle > span {
    font-size: 16px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-footer-bottom {
    flex-wrap: wrap;
  }
}
@media (max-width: 767px) {
  .des-footer-bottom {
    flex-direction: column;
  }
}
.des-footer-bottom a, .des-footer-bottom span {
  font-weight: 400;
  font-size: 18px;
  line-height: 1;
  color: var(--tp-common-cream);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-footer-bottom a, .des-footer-bottom span {
    font-size: 16px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-footer-bottom a, .des-footer-bottom span {
    margin-bottom: 15px;
  }
}
@media (max-width: 767px) {
  .des-footer-bottom a, .des-footer-bottom span {
    font-size: 14px;
  }
}
.des-footer-bottom a {
  margin: 0px 25px;
  position: relative;
}
.des-footer-bottom a::after {
  position: absolute;
  content: "";
  bottom: 1px;
  left: 0;
  width: 0;
  height: 1px;
  transition: 0.3s ease-in-out;
  background-color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-footer-bottom a {
    margin: 0px 10px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-footer-bottom a {
    margin: 0px 10px;
    margin-bottom: 10px;
  }
}
@media (max-width: 767px) {
  .des-footer-bottom a {
    margin: 15px 4px;
    display: inline-block;
  }
}
.des-footer-bottom a:hover::after {
  width: 100%;
}

.text-scale-anim {
  white-space: pre-wrap;
  transform-origin: top left;
}

.tp-letter-span {
  display: inline-block;
}

.tp-word-span {
  display: inline-block;
}

.tp-footer-style-6 .tp-footer-widget-title {
  color: var(--tp-common-cream);
}
.tp-footer-style-6 .tp-footer-widget-title-sm {
  color: var(--tp-common-cream);
}
.tp-footer-style-6 .tp-footer-widget-title-sm.pre::before {
  background-color: var(--tp-common-red);
}
.tp-footer-style-6 .tp-footer-widget-social a {
  color: var(--tp-common-white);
  background-color: rgba(255, 255, 255, 0.06);
}
.tp-footer-style-6 .tp-footer-widget-social a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red);
}
.tp-footer-style-6 .tp-footer-widget-info a {
  color: var(--tp-common-cream);
}
.tp-footer-style-6 .tp-footer-widget-info a:hover {
  color: var(--tp-common-red);
}
.tp-footer-style-6 .tp-footer-widget-menu ul li a {
  color: var(--tp-common-white);
  background-color: rgba(255, 255, 255, 0.06);
}
.tp-footer-style-6 .tp-footer-widget-menu ul li a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red);
}

.tp-copyright-style-6 .tp-copyright-big-text {
  color: var(--tp-common-red);
}
.tp-copyright-style-6 .tp-copyright-left span {
  color: var(--tp-common-cream);
}
.tp-copyright-style-6 .tp-copyright-right a {
  color: var(--tp-common-cream);
}
.tp-copyright-style-6 .tp-copyright-right a:hover {
  color: var(--tp-common-red);
}

/*----------------------------------------*/
/*  6.2 Footer Style 2
/*----------------------------------------*/
.dgm-footer-widget-paragraph p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.5;
  color: var(--tp-common-white);
}
.dgm-footer-widget-paragraph.color-style p {
  color: #afb2b8;
}
.dgm-footer-widget-social a {
  height: 40px;
  width: 40px;
  line-height: 33px;
  border-radius: 50%;
  display: inline-block;
  text-align: center;
  color: rgba(255, 255, 255, 0.5);
  border: 2px solid rgba(255, 255, 255, 0.1);
}
.dgm-footer-widget-social a:not(:last-child) {
  margin-right: 6px;
}
.dgm-footer-widget-social a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-green-regular);
  background-color: var(--tp-common-green-regular);
}
.dgm-footer-widget-title {
  font-weight: 700;
  font-size: 24px;
  margin-bottom: 25px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-grotesk);
}
.dgm-footer-widget-menu ul li {
  list-style-type: none;
}
.dgm-footer-widget-menu ul li:not(:last-child) {
  margin-bottom: 8px;
}
.dgm-footer-widget-menu ul li a {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  color: #afb2b8;
}
.dgm-footer-widget-menu ul li a:hover {
  color: var(--tp-common-green-regular);
}
.dgm-footer-widget-input input {
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  padding-left: 60px;
  padding-right: 50px;
  border-radius: 10px;
  background-color: #1e1e1e;
  color: var(--tp-common-white);
  border: 1px solid transparent;
}
.dgm-footer-widget-input input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  color: #a1a4aa;
}
.dgm-footer-widget-input input::-moz-placeholder { /* Firefox 19+ */
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  color: #a1a4aa;
}
.dgm-footer-widget-input input:-moz-placeholder { /* Firefox 4-18 */
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  color: #a1a4aa;
}
.dgm-footer-widget-input input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  color: #a1a4aa;
}
.dgm-footer-widget-input input::placeholder { /* MODERN BROWSER */
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  color: #a1a4aa;
}
.dgm-footer-widget-input input:focus {
  border-color: var(--tp-common-green-regular);
}
.dgm-footer-widget-input .input-icon {
  position: absolute;
  left: 30px;
  top: 50%;
  transform: translateY(-55%);
}
.dgm-footer-widget-input .input-button {
  position: absolute;
  right: 23px;
  top: 50%;
  transform: translateY(-50%);
}
.dgm-footer-widget-input .input-button span svg {
  color: var(--tp-common-green-regular);
}
.dgm-footer-widget-input .input-button .animated-border-box.radius-style-2 {
  border-radius: 8px;
}
.dgm-footer-widget-input .input-button .animated-border-box.radius-style-2 .tp-btn-gradient.sm {
  border-radius: 8px;
}
.dgm-footer-col-1 {
  padding-right: 150px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .dgm-footer-col-1 {
    padding-right: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-footer-col-1 {
    padding-right: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-footer-col-1 {
    padding-right: 35px;
  }
}
@media (max-width: 767px) {
  .dgm-footer-col-1 {
    padding-right: 0px;
  }
}
.dgm-footer-col-2 {
  padding-left: 40px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-footer-col-2 {
    padding-left: 0;
  }
}
.dgm-footer-col-3 {
  padding-left: 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-footer-col-3 {
    padding-left: 20px;
  }
}
@media (max-width: 767px) {
  .dgm-footer-col-3 {
    padding-left: 0;
  }
}
.dgm-footer-col-4 {
  padding-left: 65px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-footer-col-4 {
    padding-left: 25px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-footer-col-4 {
    padding-left: 0px;
  }
}
.dgm-footer-bg {
  overflow: hidden;
  border-radius: 24px;
}
.dgm-footer-bg::after {
  position: absolute;
  top: 0;
  left: 0;
  width: 34%;
  height: 100%;
  content: "";
  background-color: #212121;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .dgm-footer-bg::after {
    width: 29%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .dgm-footer-bg::after {
    width: 32%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-footer-bg::after {
    display: none;
  }
}

.tp-copyright-2-left p {
  font-weight: 500;
  font-size: 14px;
  color: #828386;
  margin-bottom: 0;
}
.tp-copyright-2-left p a {
  color: var(--tp-common-white);
}
.tp-copyright-2-middle {
  padding-left: 40px;
}
.tp-copyright-2-middle a {
  font-weight: 500;
  font-size: 14px;
  line-height: 1.71;
  color: #afb2b8;
  transition: all 0.3s;
}
.tp-copyright-2-middle a span {
  margin-right: 5px;
  display: inline-block;
  transform: translateY(-1px);
}
.tp-copyright-2-middle a:hover {
  color: var(--tp-common-green-regular);
}
.tp-copyright-2-right ul li {
  display: inline-block;
  list-style-type: none;
}
.tp-copyright-2-right ul li:not(:first-child) {
  margin-left: 30px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-copyright-2-right ul li:not(:first-child) {
    margin-left: 20px;
  }
}
.tp-copyright-2-right ul li a {
  font-weight: 500;
  font-size: 14px;
  color: #afb2b8;
  transition: all 0.3s;
}
.tp-copyright-2-right ul li a:hover {
  color: var(--tp-common-green-regular);
}
.tp-copyright-2-border {
  padding-top: 22px;
  padding-bottom: 40px;
  border-top: 1px solid rgba(255, 255, 255, 0.06);
}
.tp-copyright-2-border.app-copyright-border {
  border-color: rgba(33, 33, 45, 0.06);
}

/*----------------------------------------*/
/*  6.3 Footer Style 3
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-area {
    padding-top: 80px;
  }
}
.creative-footer-style {
  margin: 40px;
  border-radius: 20px;
  padding: 0 100px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-footer-style {
    padding: 0 70px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-footer-style {
    padding: 0 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-footer-style {
    margin: 0;
    padding: 0 30px;
  }
}
@media (max-width: 767px) {
  .creative-footer-style {
    margin: 0;
    padding: 0 20px;
  }
}
.creative-footer-style .tp-footer-widget-title {
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .creative-footer-style .tp-footer-widget-title {
    font-size: 70px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .creative-footer-style .tp-footer-widget-title {
    font-size: 60px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-footer-style .tp-footer-widget-title {
    font-size: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-footer-style .tp-footer-widget-title br {
    display: none;
  }
}
.creative-footer-style .tp-footer-widget-title-sm {
  color: var(--tp-common-white);
}
.creative-footer-style .tp-footer-widget-title-sm.pre::before {
  background-color: var(--tp-common-green-light);
}
.creative-footer-style .tp-footer-widget-menu ul li a {
  color: var(--tp-common-white);
  background-color: transparent;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.creative-footer-style .tp-footer-widget-menu ul li a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-green-light);
  background-color: var(--tp-common-green-light);
}
.creative-footer-style .tp-footer-widget-info a {
  color: var(--tp-common-white);
}
.creative-footer-style .tp-footer-widget-info a:hover {
  color: var(--tp-common-green-light);
}
.creative-footer-style .tp-copyright-big-text {
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .creative-footer-style .tp-copyright-big-text {
    font-size: 225px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .creative-footer-style .tp-copyright-big-text {
    font-size: 188px;
    letter-spacing: -10px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-footer-style .tp-copyright-big-text {
    font-size: 165px;
    letter-spacing: -10px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-footer-style .tp-copyright-big-text {
    font-size: 140px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-footer-style .tp-copyright-big-text {
    font-size: 115px;
  }
}
@media (max-width: 767px) {
  .creative-footer-style .tp-copyright-big-text {
    font-size: 50px;
  }
}
.creative-footer-style .tp-copyright-left span {
  color: var(--tp-common-white);
}
.creative-footer-style .tp-copyright-right a {
  color: var(--tp-common-white);
}
.creative-footer-style .tp-copyright-right a:hover {
  color: var(--tp-common-green-light);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-footer-style .tp-copyright-right a:not(:first-child) {
    margin-left: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-footer-style .tp-copyright-right a:not(:first-child) {
    margin-left: 30px;
  }
}
.creative-footer-style .tp-footer-widget-social {
  position: absolute;
  top: 0;
  left: 0;
  padding-right: 15px;
  padding-bottom: 25px;
  background-color: #0e0f11;
  border-radius: 0 0 20px 0;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style .tp-footer-widget-social {
    padding-bottom: 15px;
    display: flex;
    padding-bottom: 0;
    gap: 5px;
  }
}
@media (max-width: 767px) {
  .creative-footer-style .tp-footer-widget-social {
    padding-bottom: 15px;
    padding-left: 20px;
  }
}
.creative-footer-style .tp-footer-widget-social::after, .creative-footer-style .tp-footer-widget-social::before {
  content: "";
  position: absolute;
  top: -1px;
  right: -20px;
  height: 40px;
  width: 20px;
  z-index: -1;
  border-top-left-radius: 20px;
  background-color: transparent;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
.creative-footer-style .tp-footer-widget-social::before {
  top: auto;
  bottom: -39px;
  left: 0px;
}
.creative-footer-style .tp-footer-widget-social a {
  display: table;
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-light);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style .tp-footer-widget-social a {
    display: inline-block;
  }
}
.creative-footer-style .tp-footer-widget-social a:not(:last-child) {
  margin-bottom: 8px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style .tp-footer-widget-social a:not(:last-child) {
    margin-bottom: 0;
  }
}
.creative-footer-style .tp-footer-widget-social a:hover {
  background-color: var(--tp-common-white);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .creative-footer-style .tp-footer-col-2 {
    padding-left: 90px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .creative-footer-style .tp-footer-col-2 {
    padding-left: 60px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-footer-style .tp-footer-col-2 br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-footer-style .tp-footer-col-2 {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style .tp-footer-col-2 {
    padding-left: 0;
    padding-right: 0;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-footer-style .tp-footer-col-3 {
    padding-left: 0;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .creative-footer-style .tp-copyright-left {
    padding-left: 260px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style .tp-copyright-left {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style .tp-copyright-bottom {
    margin-top: 0px;
  }
}
.creative-footer-style.blog-details-social {
  margin: 0;
  padding: 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style.blog-details-social {
    margin-bottom: 30px;
  }
}
.creative-footer-style.blog-details-social .tp-footer-widget-social {
  position: static;
  padding: 0;
  display: block;
  background-color: transparent;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-footer-style.blog-details-social .tp-footer-widget-social {
    display: flex;
  }
}
.creative-footer-text {
  position: absolute;
  top: 0;
  right: 0;
  padding: 15px 22px;
  padding-bottom: 20px;
  background-color: #0e0f11;
  border-radius: 0 0 0 20px;
}
.creative-footer-text::after, .creative-footer-text::before {
  content: "";
  position: absolute;
  background-color: transparent;
  bottom: -40px;
  right: 0px;
  height: 40px;
  width: 20px;
  border-top-right-radius: 20px;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
.creative-footer-text::before {
  top: auto;
  bottom: 11px;
  left: -19px;
}
.creative-footer-text p {
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  margin-bottom: 0;
  color: var(--tp-common-white);
}

/*----------------------------------------*/
/*  6.5 Footer Style 5
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-footer-area {
    padding-top: 80px;
  }
}
.design-footer-top-btn {
  transform: translateY(-45px);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-footer-top-btn {
    transform: translateY(0);
  }
}
.design-footer-top-wrap {
  border-bottom: 1px solid rgba(224, 238, 238, 0.2);
}
.design-footer-middle {
  border-bottom: 1px solid rgba(224, 238, 238, 0.2);
}
.design-footer-widget-title {
  font-weight: 500;
  font-size: 24px;
  line-height: 1.25;
  color: #e0eeee;
  margin-bottom: 20px;
  letter-spacing: -0.02em;
}
.design-footer-widget-title.sm {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 20px;
  letter-spacing: -0.02em;
  color: rgba(224, 238, 238, 0.5);
}
.design-footer-widget-input input {
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  height: 60px;
  padding: 0px 35px;
  border-radius: 40px;
  padding-right: 60px;
  background-color: transparent;
  color: var(--tp-common-white);
  border: 2px solid rgba(224, 238, 238, 0.1);
}
.design-footer-widget-input input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  color: rgba(224, 238, 238, 0.6);
}
.design-footer-widget-input input::-moz-placeholder { /* Firefox 19+ */
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  color: rgba(224, 238, 238, 0.6);
}
.design-footer-widget-input input:-moz-placeholder { /* Firefox 4-18 */
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  color: rgba(224, 238, 238, 0.6);
}
.design-footer-widget-input input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  color: rgba(224, 238, 238, 0.6);
}
.design-footer-widget-input input::placeholder { /* MODERN BROWSER */
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  color: rgba(224, 238, 238, 0.6);
}
.design-footer-widget-input input:focus {
  border-color: var(--tp-common-white);
}
.design-footer-widget-input-icon {
  position: absolute;
  top: 50%;
  right: 10px;
  height: 40px;
  width: 40px;
  line-height: 38px;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  transform: translateY(-50%);
  background-color: var(--tp-common-white);
}
.design-footer-widget-info a {
  font-weight: 500;
  font-size: 24px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.design-footer-col-1 {
  padding-right: 40px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-footer-col-1 {
    padding-right: 0;
  }
}
.design-footer-col-3 {
  padding-left: 5px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-footer-col-3 {
    padding-left: 0;
    margin-bottom: 20px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-footer-col-2 {
    margin-bottom: 20px;
  }
}
.design-footer-col-4 {
  padding-left: 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-footer-col-4 {
    padding-left: 0;
  }
}
.design-footer-right {
  padding-left: 160px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-footer-right {
    padding-left: 0;
  }
}

.design-copyright-text p {
  font-weight: 500;
  font-size: 18px;
  line-height: 1.2;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  color: rgba(224, 238, 238, 0.5);
}
.design-copyright-backtoTop a {
  font-weight: 500;
  font-size: 24px;
  line-height: 1;
  color: #e0eeee;
  letter-spacing: -0.02em;
}
.design-copyright-backtoTop a span {
  color: #C5FCFC;
  margin-left: 8px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-copyright-big-text {
    padding-top: 80px;
  }
}
@media (max-width: 767px) {
  .design-copyright-big-text {
    padding-top: 60px;
  }
}
.design-copyright-big-text img {
  width: 100%;
}

/*----------------------------------------*/
/*  6.7 Footer Style 7
/*----------------------------------------*/
@media (max-width: 767px) {
  .ai-footer-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.ai-footer-widget-title {
  font-weight: 600;
  font-size: 48px;
  line-height: 1.1;
  margin-bottom: 50px;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-footer-widget-title {
    font-size: 40px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-footer-widget-title {
    font-size: 45px;
  }
}
.ai-footer-widget-shape {
  position: absolute;
  bottom: -7%;
  right: 20%;
  z-index: -1;
}
.ai-footer-widget-title-sm {
  font-weight: 700;
  font-size: 20px;
  line-height: 1;
  margin-bottom: 25px;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.ai-footer-input input {
  padding: 0 35px;
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  border: none;
  border-radius: 0;
  letter-spacing: -0.02em;
  background-color: transparent;
  color: var(--tp-common-white);
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.ai-footer-input input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.4);
}
.ai-footer-input input::-moz-placeholder { /* Firefox 19+ */
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.4);
}
.ai-footer-input input:-moz-placeholder { /* Firefox 4-18 */
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.4);
}
.ai-footer-input input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.4);
}
.ai-footer-input input::placeholder { /* MODERN BROWSER */
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.4);
}
.ai-footer-input input:focus {
  border-color: var(--tp-common-white);
}
.ai-footer-newsletter label {
  font-weight: 700;
  font-size: 20px;
  line-height: 1;
  margin-bottom: 8px;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.ai-footer-icon-1 {
  position: absolute;
  top: 14px;
  left: 0;
}
.ai-footer-icon-2 {
  position: absolute;
  top: 15px;
  right: 0;
}
.ai-footer-menu ul li {
  list-style-type: none;
}
.ai-footer-menu ul li:not(:last-child) {
  margin-bottom: 10px;
}
.ai-footer-menu ul li a {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.6);
}
.ai-footer-menu ul li a:hover {
  color: var(--tp-common-white);
}
.ai-footer-contact-item a {
  display: block;
  font-weight: 500;
  font-size: 16px;
  line-height: 1.6;
  margin-bottom: 8px;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.6);
}
.ai-footer-contact-item a:hover {
  color: var(--tp-common-white);
}
.ai-footer-col-2 {
  margin-left: 78px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-footer-col-2 {
    margin-left: 0;
    margin-top: 40px;
  }
}
.ai-footer-col-3 {
  margin-left: 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-footer-col-3 {
    margin-left: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-footer-col-3 {
    margin-left: 0;
    margin-top: 40px;
  }
}
.ai-footer-col-4 {
  margin-left: 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-footer-col-4 {
    margin-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-footer-col-4 {
    margin-left: 0;
    margin-top: 40px;
  }
}

.ai-copyright-content p {
  margin-bottom: 0;
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.ai-copyright-ptb {
  padding: 25px 0;
  border-top: 1px solid rgba(255, 255, 255, 0.1);
}
@media (max-width: 767px) {
  .ai-copyright-logo {
    margin-bottom: 20px;
  }
}
.ai-copyright-shape-1 {
  position: absolute;
  bottom: 0;
  right: 0;
  z-index: -1;
}

/*----------------------------------------*/
/*  6.8 Footer Style 8
/*----------------------------------------*/
.ar-footer-widget-content p {
  font-weight: 500;
  font-size: 18px;
  line-height: 1.44;
  margin-bottom: 33px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .ar-footer-widget-content p br {
    display: none;
  }
}
.ar-footer-widget-input input {
  padding-left: 55px;
  padding-right: 145px;
  font-weight: 500;
  font-size: 16px;
  height: 60px;
  color: var(--tp-common-white);
  border: 0;
  border-radius: 0;
  background: rgba(255, 255, 255, 0.1);
}
.ar-footer-widget-input input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-weight: 500;
  font-size: 16px;
  color: rgba(255, 255, 255, 0.6);
}
.ar-footer-widget-input input::-moz-placeholder { /* Firefox 19+ */
  font-weight: 500;
  font-size: 16px;
  color: rgba(255, 255, 255, 0.6);
}
.ar-footer-widget-input input:-moz-placeholder { /* Firefox 4-18 */
  font-weight: 500;
  font-size: 16px;
  color: rgba(255, 255, 255, 0.6);
}
.ar-footer-widget-input input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-weight: 500;
  font-size: 16px;
  color: rgba(255, 255, 255, 0.6);
}
.ar-footer-widget-input input::placeholder { /* MODERN BROWSER */
  font-weight: 500;
  font-size: 16px;
  color: rgba(255, 255, 255, 0.6);
}
.ar-footer-widget-btn {
  position: absolute;
  top: 0;
  right: 0;
  line-height: 1;
  transition: 0.3s;
  font-size: 16px;
  padding: 22px 23px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-medium);
  background-color: var(--tp-common-red-2);
}
.ar-footer-widget-btn:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.ar-footer-widget-envelop {
  position: absolute;
  top: 50%;
  left: 23px;
  transform: translateY(-50%);
}
.ar-footer-widget-envelop svg {
  transform: translateY(-2px);
}
.ar-footer-widget-title {
  font-size: 24px;
  line-height: 1;
  margin-bottom: 33px;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
.ar-footer-widget-menu ul li {
  padding-left: 13px;
  list-style-type: none;
  position: relative;
  display: block;
}
.ar-footer-widget-menu ul li:not(:last-child) {
  margin-bottom: 10px;
}
.ar-footer-widget-menu ul li::after {
  position: absolute;
  content: "";
  top: 11px;
  left: 0;
  width: 4px;
  height: 4px;
  transition: 0.3s;
  border-radius: 50%;
  background-color: rgba(255, 255, 255, 0.6);
}
.ar-footer-widget-menu ul li a {
  font-size: 15px;
  line-height: 1;
  transition: 0.3s;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
  font-family: var(--tp-ff-clash-medium);
}
.ar-footer-widget-menu ul li:hover::after {
  background-color: var(--tp-common-white);
}
.ar-footer-widget-menu ul li:hover a {
  color: var(--tp-common-white);
}
.ar-footer-widget-info a {
  display: block;
  font-size: 15px;
  line-height: 1.67;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
  font-family: var(--tp-ff-clash-medium);
}
.ar-footer-widget-info a:hover {
  color: var(--tp-common-white);
}
.ar-footer-col-1 {
  margin-right: 45px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .ar-footer-col-1 {
    margin-right: 0;
  }
}
.ar-footer-col-2 {
  margin-left: 85px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-footer-col-2 {
    margin-left: 40px;
  }
}
@media (max-width: 767px) {
  .ar-footer-col-2 {
    margin-left: 0;
  }
}
.ar-footer-col-3 {
  margin-left: 165px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-footer-col-3 {
    margin-left: 110px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-footer-col-3 {
    margin-left: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-footer-col-3 {
    margin-left: 0px;
  }
}
.ar-footer-col-4 {
  margin-left: 110px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-footer-col-4 {
    margin-left: 40px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-footer-col-4 {
    margin-left: 0px;
  }
}

.ar-copyright-text p, .ar-copyright-text a, .ar-copyright-social p, .ar-copyright-social a {
  font-size: 15px;
  line-height: 1.4;
  margin-bottom: 0;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-copyright-text p, .ar-copyright-text a, .ar-copyright-social p, .ar-copyright-social a {
    font-size: 14px;
  }
}
@media (max-width: 767px) {
  .ar-copyright-text p, .ar-copyright-text a, .ar-copyright-social p, .ar-copyright-social a {
    font-size: 13px;
  }
}
.ar-copyright-social a:not(:first-child) {
  margin-left: 40px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-copyright-social a:not(:first-child) {
    margin-left: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-copyright-social a:not(:first-child) {
    margin-left: 10px;
  }
}
@media (max-width: 767px) {
  .ar-copyright-social a:not(:first-child) {
    margin-left: 8px;
  }
}
.ar-copyright-social a:hover {
  color: var(--tp-common-white);
}
.ar-copyright-ptb {
  padding: 40px 0;
  border-top: 1px solid rgba(255, 255, 255, 0.1);
}

/*----------------------------------------*/
/*  6.9 Footer Style 9
/*----------------------------------------*/
.crp-footer-bg {
  background-color: #335341;
}
.crp-footer-logo {
  margin-bottom: 20px;
}
.crp-footer-widget p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.6;
  margin-bottom: 35px;
  color: var(--tp-common-cream-3);
}
.crp-footer-widget-title {
  font-weight: 600;
  font-size: 30px;
  line-height: 1;
  margin-bottom: 15px;
  letter-spacing: 0.5px;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
.crp-footer-widget-menu ul li {
  list-style-type: none;
}
.crp-footer-widget-menu ul li:not(:last-child) {
  margin-bottom: 10px;
}
.crp-footer-widget-menu ul li a {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  color: var(--tp-common-cream-3);
}
.crp-footer-widget-info a {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.6;
  color: var(--tp-common-cream-3);
}
.crp-footer-widget-info a.tel {
  font-weight: 600;
  font-size: 22px;
  display: block;
  letter-spacing: -0.02em;
}
.crp-footer-social a {
  height: 42px;
  width: 42px;
  line-height: 39px;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  color: var(--tp-common-cream-3);
  background-color: rgba(255, 255, 230, 0.1);
}
.crp-footer-social a:not(:last-child) {
  margin-right: 5px;
}
.crp-footer-social a:hover {
  color: #325341;
  background-color: var(--tp-common-yellow-green);
}
.crp-footer-big-text {
  padding: 21px 40px;
  padding-top: 40px;
  border-radius: 20px;
  background-color: #2a4c3a;
  font-weight: 600;
  font-size: 150px;
  line-height: 0.6;
  width: 100%;
  display: inline-block;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-yellow-green);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-footer-big-text {
    font-size: 140px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-footer-big-text {
    font-size: 95px;
    padding-top: 20px;
  }
}
@media (max-width: 767px) {
  .crp-footer-big-text {
    font-size: 50px;
  }
}
.crp-footer-big-text span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.crp-footer-big-text span span {
  padding-top: 17px;
}
.crp-footer-big-text span span.text-1 {
  position: relative;
  display: block;
  transition: 0.4s ease-in-out;
}
.crp-footer-big-text span span.text-2 {
  position: absolute;
  bottom: 100%;
  display: block;
  transition: 0.4s ease-in-out;
}
.crp-footer-big-text i {
  position: relative;
  overflow: hidden;
  width: 85px;
  height: 85px;
  margin-left: 40px;
  display: inline-flex;
  transform: translateY(-11px);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-footer-big-text i {
    transform: translateY(11px);
  }
}
@media (max-width: 767px) {
  .crp-footer-big-text i {
    width: 30px;
    height: 30px;
    margin-left: 0;
    transform: translateY(0);
  }
}
.crp-footer-big-text i svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.3s ease-out;
}
.crp-footer-big-text i svg:last-child {
  left: -80px;
  bottom: -80px;
  transform: translate(0, 0);
  opacity: 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-footer-big-text i svg {
    width: 60px;
    transform: translateY(-7px);
  }
}
@media (max-width: 767px) {
  .crp-footer-big-text i svg {
    width: 20px;
    height: 20px;
    margin-top: 10px;
    transform: translateY(0px);
  }
}
.crp-footer-big-text:hover {
  color: var(--tp-common-yellow-green);
}
.crp-footer-big-text:hover span span.text-1 {
  -webkit-transform: translateY(150%);
  transform: translateY(150%);
}
.crp-footer-big-text:hover span span.text-2 {
  bottom: 50%;
  -webkit-transform: translateY(50%);
  transform: translateY(50%);
}
.crp-footer-big-text:hover i svg:first-child {
  transform: translate(85px, -85px);
}
.crp-footer-big-text:hover i svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(80px, -80px);
}
.crp-footer-big-text:focus {
  color: var(--tp-common-yellow-green);
}
.crp-footer-shape {
  position: absolute;
  top: 0;
  right: 0;
  z-index: -1;
}
.crp-footer-col-3 {
  padding-left: 50px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-footer-col-3 {
    padding-left: 0;
  }
}

.crp-copyright-text p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.6;
  margin-bottom: 0;
  color: var(--tp-common-cream-3);
}
.crp-copyright-text p span {
  color: var(--tp-common-yellow-green);
}

/*----------------------------------------*/
/*  6.10 Footer Style 10
/*----------------------------------------*/
.app-footer-widget .dgm-footer-widget-title {
  font-weight: 600;
  font-size: 20px;
  letter-spacing: -0.2px;
  font-family: var(--tp-ff-phudu);
  color: var(--tp-common-black-10);
}
.app-footer-widget .dgm-footer-widget-menu ul li {
  position: relative;
  padding-left: 10px;
}
.app-footer-widget .dgm-footer-widget-menu ul li::before {
  position: absolute;
  content: "";
  left: 0px;
  top: 50%;
  width: 3px;
  height: 3px;
  border-radius: 50%;
  transform: translateY(-50%);
  background-color: #61616A;
}
.app-footer-widget .dgm-footer-widget-menu ul li a {
  color: #61616A;
  letter-spacing: -0.16px;
}
.app-footer-widget .dgm-footer-widget-menu ul li a:hover {
  color: var(--tp-common-black-10);
}
.app-footer-widget .dgm-footer-widget-paragraph.color-style p {
  font-size: 15px;
  font-weight: 400;
  color: #61616A;
  margin: 0;
  letter-spacing: -0.15px;
}
.app-footer-widget .dgm-footer-widget-input input {
  border-radius: 12px;
  padding-left: 20px;
  padding-right: 125px;
  color: var(--tp-common-black-10);
  background: var(--tp-common-white);
  border: 1px solid rgba(33, 33, 45, 0.08);
}
.app-footer-widget .dgm-footer-widget-input input:focus {
  border-color: var(--tp-common-black-10);
}
.app-footer-widget .dgm-footer-widget-input .input-button {
  right: 8px;
  font-size: 14px;
  border-radius: 8px;
  line-height: 1;
}
.app-footer-widget .dgm-footer-widget-input .input-button span svg {
  margin-left: 4px;
  color: var(--tp-common-white);
}
.app-footer-widget-info a {
  font-size: 16px;
  font-weight: 600;
  letter-spacing: -0.32px;
  color: var(--tp-common-black-10);
}
.app-footer-widget-info-title {
  color: #61616A;
  font-size: 14px;
  font-weight: 400;
  letter-spacing: -0.14px;
}
.app-footer-rating {
  padding: 15px;
  width: 270px;
  border-radius: 12px;
  background: var(--tp-common-white);
  border: 1px solid rgba(33, 33, 45, 0.08);
}
.app-footer-rating .app-hero-bottom-rating-point span {
  font-size: 44px;
  letter-spacing: -0.44px;
  color: var(--tp-common-black-10);
}
.app-footer-rating .app-hero-bottom-rating-star a {
  color: var(--tp-common-black-10);
}
.app-footer-col-1 .dgm-footer-widget-paragraph p {
  color: #61616A;
}
.app-footer-col-3 {
  padding-left: 25px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-footer-col-3 {
    padding-left: 0;
  }
}
.app-footer-col-4 {
  padding-left: 70px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-footer-col-4 {
    padding-left: 25px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-footer-col-4 {
    padding-left: 0px;
  }
}
.app-copyright-text p {
  margin: 0;
  color: #61616A;
  font-size: 14px;
  font-weight: 500;
  letter-spacing: -0.14px;
}
.app-copyright-text p a:hover {
  border-bottom: 1px solid black;
}

/*----------------------------------------*/
/*  6.11 Footer Style 11
/*----------------------------------------*/
.it-footer-style.crp-footer-bg {
  background-color: #0C5752;
}
.it-footer-style .crp-footer-big-text {
  background-color: #0C4642;
  color: var(--tp-common-white);
}
.it-footer-style .crp-footer-widget p {
  color: var(--tp-common-white);
}
.it-footer-style .crp-footer-social a {
  color: var(--tp-common-white);
  background-color: rgba(255, 255, 255, 0.1);
}
.it-footer-style .crp-footer-social a:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.it-footer-style .crp-footer-widget-title {
  color: var(--tp-common-white);
}
.it-footer-style .crp-footer-widget-menu ul li a {
  color: rgba(255, 255, 255, 0.7);
}
.it-footer-style .crp-footer-widget-menu ul li a:hover {
  color: var(--tp-common-white);
}
.it-footer-style .crp-footer-widget-info a {
  color: rgba(255, 255, 255, 0.7);
}
.it-footer-style .crp-footer-widget-info a:hover {
  color: var(--tp-common-white);
}
.it-footer-style .crp-copyright-text p span {
  color: var(--tp-common-white);
}
.it-footer-style .crp-copyright-text p {
  color: rgba(255, 255, 255, 0.7);
}
.it-footer-shape {
  position: absolute;
  bottom: 0;
  right: 0;
  z-index: -1;
}

/*----------------------------------------*/
/*  6.12 Footer Style 12
/*----------------------------------------*/
.st-footer-widget-content p {
  color: #494949;
  margin-bottom: 35px;
}
.st-footer-widget-title {
  margin: 0;
  font-size: 18px;
  font-weight: 600;
  margin-right: 40px;
  letter-spacing: -0.36px;
  color: var(--tp-common-brown);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-footer-widget-title {
    margin-right: 0;
    margin-bottom: 30px;
  }
}
.st-footer-widget-menu ul li {
  list-style-type: none;
}
.st-footer-widget-menu ul li:not(:last-child) {
  margin-bottom: 10px;
}
.st-footer-widget-menu ul li a {
  font-size: 18px;
  font-weight: 500;
  line-height: 1;
  color: #494949;
  letter-spacing: -0.36px;
}
.st-footer-widget-info-title {
  margin-bottom: 10px;
}
.st-footer-widget-info-title a {
  font-size: 18px;
  font-weight: 500;
  color: #494949;
  letter-spacing: -0.36px;
}
.st-footer-widget-info-title a:hover {
  color: var(--tp-common-brown);
}
.st-footer-widget-social-title {
  font-size: 18px;
  font-weight: 500;
  margin-bottom: 35px;
  display: inline-block;
  color: var(--tp-common-brown);
}
.st-footer-widget-social .tp-footer-widget-social a {
  color: var(--tp-common-brown);
  background-color: var(--tp-common-white);
}
.st-footer-widget-social .tp-footer-widget-social a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-brown);
}
.st-footer-top-border {
  border-bottom: 1px solid rgba(69, 48, 48, 0.15);
}
.st-footer-top-icon {
  position: absolute;
  bottom: 0;
  left: 0;
  right: 0;
  text-align: center;
}
.st-footer-top-icon span {
  width: 170px;
  display: inline-block;
  border-bottom: 7px solid var(--tp-common-brown);
}
.st-footer-top-icon span svg {
  transform: translateY(4px);
}
@media (max-width: 767px) {
  .st-footer-col-3 {
    margin-bottom: 120px;
  }
}

.st-copyright-ptb {
  padding-top: 40px;
  padding-bottom: 60px;
}
.st-copyright-sub {
  font-size: 18px;
  font-weight: 500;
  line-height: 1;
  color: #494949;
  margin-bottom: 20px;
  display: inline-block;
  text-transform: uppercase;
}
.st-copyright-title {
  margin: 0;
  font-size: 140px;
  font-weight: 700;
  line-height: 0.7;
  position: relative;
  letter-spacing: -5.6px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-copyright-title {
    font-size: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .st-copyright-title {
    font-size: 64px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .st-copyright-title {
    font-size: 60px;
  }
}
.st-copyright-title a {
  display: inline-block;
  line-height: 1;
}
.st-copyright-title a:hover span {
  transform: translateX(12);
}
.st-copyright-title span {
  position: absolute;
  top: -20px;
  right: 5%;
  display: grid;
  height: 60px;
  width: 60px;
  border-radius: 50%;
  place-content: center;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  color: var(--tp-common-white);
  background-color: var(--tp-common-brown);
}

/*----------------------------------------*/
/*  6.13 Footer Style 13
/*----------------------------------------*/
.cr-footer-bg {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}
.cr-footer-bg img {
  height: 100%;
}
.cr-footer-widget-social .tp-footer-widget-social a {
  color: var(--tp-common-white);
  background: rgba(255, 255, 255, 0.1);
}
.cr-footer-widget-social .tp-footer-widget-social a:hover {
  color: #325341;
  background-color: var(--tp-common-white);
}
.cr-footer-border-wrap {
  border-right: 1px solid rgba(255, 255, 255, 0.06);
  border-left: 1px solid rgba(255, 255, 255, 0.06);
}
@media (max-width: 767px) {
  .cr-footer-border-wrap {
    border: none;
    padding-top: 100px;
  }
}
.cr-footer-col-1 .dgm-footer-widget-paragraph p {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.5;
  letter-spacing: -0.18px;
  font-family: var(--tp-ff-onest);
  color: rgba(255, 255, 255, 0.6);
}
.cr-footer-col-1 .app-footer-rating {
  background: #131416;
  box-shadow: 0px 0px 4px 0px rgba(255, 255, 255, 0.12) inset, 0px 0px 2px 2px rgba(0, 0, 0, 0.4);
}
.cr-footer-col-1 .app-footer-rating .app-hero-bottom-rating-point span {
  color: var(--tp-common-white);
}
.cr-footer-col-1 .app-footer-rating .app-hero-bottom-rating-star a {
  border: none;
  color: var(--tp-common-white);
}
.cr-footer-col-2 .dgm-footer-widget-title, .cr-footer-col-3 .dgm-footer-widget-title, .cr-footer-col-4 .dgm-footer-widget-title {
  font-size: 20px;
  font-weight: 600;
  letter-spacing: -0.2px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
.cr-footer-col-2 .dgm-footer-widget-menu ul li a, .cr-footer-col-3 .dgm-footer-widget-menu ul li a, .cr-footer-col-4 .dgm-footer-widget-menu ul li a {
  color: rgba(255, 255, 255, 0.6);
}
.cr-footer-col-2 .dgm-footer-widget-menu ul li a:hover, .cr-footer-col-3 .dgm-footer-widget-menu ul li a:hover, .cr-footer-col-4 .dgm-footer-widget-menu ul li a:hover {
  color: var(--tp-common-white);
}
.cr-footer-col-2 {
  padding-left: 78px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cr-footer-col-2 {
    padding-left: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-footer-col-2 {
    padding-left: 0;
  }
}
.cr-footer-col-3 {
  padding-left: 30px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-footer-col-3 {
    padding-left: 0;
  }
}
.cr-footer-col-4 .app-footer-widget-info-title {
  font-weight: 500;
  letter-spacing: 0;
  color: rgba(255, 255, 255, 0.6);
}
.cr-footer-col-4 .app-footer-widget-info a {
  color: var(--tp-common-white);
}

.cr-copyright-border {
  position: relative;
  padding-top: 34px;
  border-color: rgba(255, 255, 255, 0.06);
}
.cr-copyright-border .app-copyright-text p {
  color: rgba(255, 255, 255, 0.6);
}

/*----------------------------------------*/
/*  6.14 Footer Style 14
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-footer-ptb {
    padding-top: 0;
  }
}
.pp-footer-box {
  padding: 175px 0;
  border-radius: 30px;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-footer-box {
    padding: 150px 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-footer-box {
    padding: 100px 0;
  }
}
@media (max-width: 767px) {
  .pp-footer-box {
    padding: 100px 15px 80px;
  }
}
.pp-footer-subtitle {
  font-size: 60px;
  font-weight: 300;
  line-height: 0.8;
  padding-bottom: 26px;
  display: inline-block;
  letter-spacing: -1.8px;
  font-family: var(--tp-ff-teko);
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-footer-subtitle {
    font-size: 45px;
  }
}
@media (max-width: 767px) {
  .pp-footer-subtitle {
    font-size: 38px;
  }
}
.pp-footer-title {
  font-size: 180px;
  font-weight: 500;
  line-height: 0.8;
  margin-bottom: 35px;
  letter-spacing: -5.4px;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-yellow-1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-footer-title {
    font-size: 150px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-footer-title {
    font-size: 115px;
  }
}
@media (max-width: 767px) {
  .pp-footer-title {
    font-size: 52px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .pp-footer-title {
    font-size: 65px;
  }
}
.pp-footer-btn {
  font-size: 20px;
  font-weight: 600;
  border-radius: 14px;
  padding: 10px 21px;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.pp-footer-btn:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.pp-footer-btn span {
  display: inline-block;
  margin-left: 3px;
}
@media (max-width: 767px) {
  .pp-footer-btn-box {
    flex-wrap: wrap;
  }
}
@media (max-width: 767px) {
  .pp-footer-btn-box .pp-footer-btn {
    margin-bottom: 20px;
  }
}

.pp-footer-copyright-ptb {
  padding: 25px 0 35px;
}
.pp-footer-copyright-wrap {
  display: flex;
  justify-content: space-between;
}
@media (max-width: 767px) {
  .pp-footer-copyright-wrap {
    display: block;
    text-align: center;
  }
}
.pp-footer-copyright-text p {
  margin: 0;
  font-size: 16px;
  font-weight: 500;
  line-height: 1;
  color: rgba(255, 255, 255, 0.4);
}
.pp-footer-copyright-text-center {
  position: relative;
}
@media (max-width: 767px) {
  .pp-footer-copyright-text-center {
    display: inline-block;
    margin: 20px 0 20px 25px;
  }
}
.pp-footer-copyright-text-center::before {
  position: absolute;
  content: "";
  top: 6px;
  left: -20px;
  width: 8px;
  height: 8px;
  border-radius: 50%;
  background-color: var(--tp-common-yellow-1);
}
.pp-footer-copyright-text-center::after {
  position: absolute;
  content: "";
  top: 0px;
  left: -26px;
  width: 20px;
  height: 20px;
  border-radius: 50%;
  background-color: rgba(255, 246, 105, 0.1);
  animation: animate-pulse-2 3s linear infinite;
}
.pp-footer-copyright-text-center p {
  margin: 0;
  font-size: 18px;
  font-weight: 500;
  line-height: 1;
  color: var(--tp-common-white);
}

/*----------------------------------------*/
/*  6.15 Footer Style 15
/*----------------------------------------*/
.tp-footer-15-cta-wrap .tp-about-5-subtitle {
  top: 50px;
  left: 170px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-footer-15-cta-wrap .tp-about-5-subtitle {
    top: 40px;
    left: 140px;
  }
}
.tp-footer-15-social {
  position: relative;
  padding-left: 15px;
}
@media (max-width: 767px) {
  .tp-footer-15-social {
    margin-bottom: 50px;
    margin-right: 30px;
  }
}
.tp-footer-15-social::after {
  position: absolute;
  top: -9px;
  left: 0;
  width: 2px;
  height: 70px;
  content: "";
  background-color: var(--tp-cream-2);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-footer-15-social::after {
    top: -14px;
  }
}
.tp-footer-15-social span {
  font-size: 12px;
  font-weight: 500;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-poppins);
  display: block;
  margin-bottom: 6px;
}
.tp-footer-15-social a {
  font-size: 34px;
  font-weight: 400;
  line-height: 1;
  letter-spacing: -1.36px;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
  position: relative;
}
.tp-footer-15-social a::after {
  position: absolute;
  bottom: -5px;
  left: 0;
  width: 0;
  height: 1px;
  content: "";
  background-color: var(--tp-cream-2);
  transition: 0.4s;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-footer-15-social a {
    font-size: 25px;
  }
}
.tp-footer-15-social a span {
  width: 16px;
  height: 16px;
  left: 10px;
  top: 5px;
  overflow: hidden;
  position: relative;
}
.tp-footer-15-social a span svg {
  -webkit-transform: translateY(-2px);
  -moz-transform: translateY(-2px);
  -ms-transform: translateY(-2px);
  -o-transform: translateY(-2px);
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  -o-transition: all 0.2s ease-out;
  transition: all 0.2s ease-out;
}
.tp-footer-15-social a span svg:last-child {
  left: -12px;
  bottom: -12px;
  -webkit-transform: translate(0, 0);
  -moz-transform: translate(0, 0);
  -ms-transform: translate(0, 0);
  -o-transform: translate(0, 0);
  transform: translate(0, 0);
  opacity: 0;
}
.tp-footer-15-social a:hover span svg:first-child {
  -webkit-transform: translate(16px, -16px);
  -moz-transform: translate(16px, -16px);
  -ms-transform: translate(16px, -16px);
  -o-transform: translate(16px, -16px);
  transform: translate(16px, -16px);
}
.tp-footer-15-social a:hover span svg:last-child {
  opacity: 1;
  visibility: visible;
  -webkit-transform: translate(13px, -13px);
  -moz-transform: translate(13px, -13px);
  -ms-transform: translate(13px, -13px);
  -o-transform: translate(13px, -13px);
  transform: translate(13px, -13px);
}
.tp-footer-15-social a:hover::after {
  width: 100%;
}
@media (max-width: 767px) {
  .tp-footer-15-social-wrap {
    flex-wrap: wrap;
  }
}
.tp-footer-15-instagram-thumb:hover img {
  transform: scale(1.1) rotate(-2deg);
}
.tp-footer-15-instagram-thumb img {
  width: 100%;
  transition: 0.9s;
}
.tp-footer-15-copyright-text span {
  font-size: 18px;
  font-weight: 500;
  line-height: 1;
  letter-spacing: -1.08px;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
}
.tp-footer-15-copyright-text span a {
  position: relative;
}
.tp-footer-15-copyright-text span a::after {
  position: absolute;
  bottom: 0;
  left: 0;
  width: 0;
  height: 1px;
  content: "";
  background-color: var(--tp-cream-2);
  transition: 0.4s;
}
.tp-footer-15-copyright-text span a:hover::after {
  width: 100%;
}
.tp-footer-15-bdr-tb {
  border-top: 2px solid var(--tp-cream-2);
  border-bottom: 2px solid var(--tp-cream-2);
  padding-top: 110px;
  padding-bottom: 110px;
}

.tp-footer-shop-style {
  margin-top: -2px;
}
.tp-footer-shop-top {
  border-top: 1px solid rgba(255, 255, 255, 0.1);
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-footer-shop-widget {
  padding: 50px 0 40px 110px;
  border-right: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-footer-shop-widget {
    padding: 50px 0 40px 80px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-footer-shop-widget {
    padding: 50px 0 40px 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-footer-shop-widget {
    padding: 50px 0 25px 40px;
  }
}
@media (max-width: 767px) {
  .tp-footer-shop-widget {
    padding: 30px 0 25px 30px;
  }
}
.tp-footer-shop-widget ul li {
  font-size: 18px;
  font-weight: 400;
  list-style: none;
  margin-bottom: 6px;
  color: rgba(255, 255, 255, 0.7);
}
.tp-footer-shop-widget ul li:hover a {
  color: var(--tp-common-white);
}
.tp-footer-shop-widget-title {
  font-size: 18px;
  font-weight: 600;
  margin-bottom: 20px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
.tp-footer-shop-big-text {
  padding-top: 50px;
  padding-bottom: 50px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-footer-shop-big-text .tp-hero-shop-title {
  color: #F4F0EA;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-footer-shop-copyright-text {
    padding: 0;
    text-align: center;
  }
}
.tp-footer-shop-copyright-text p {
  font-size: 18px;
  font-weight: 400;
  color: rgba(255, 255, 255, 0.7);
}
.tp-footer-shop-copyright-text p.space {
  word-spacing: 8px;
}

/*----------------------------------------*/
/*  7.1 Hero css
/*----------------------------------------*/
.tp-hero-ptb {
  padding-top: 225px;
  padding-bottom: 135px;
  border-radius: 0 0 50px 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-ptb {
    padding-top: 180px;
    padding-bottom: 70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-ptb {
    padding-top: 170px;
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .tp-hero-ptb {
    padding-top: 155px;
    padding-bottom: 70px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-title-box {
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-title-box {
    margin-bottom: 30px;
  }
}
.tp-hero-shape-1 {
  margin-left: 25px;
  margin-top: -30px;
}
.tp-hero-video {
  margin-right: 30px;
  border-radius: 200px;
  transform: translateY(-21px);
  box-shadow: 0 4px 4px 0 rgba(20, 20, 20, 0.2);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-hero-video {
    transform: translateY(-9px);
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-video {
    width: 220px;
    transform: translateY(-4px);
  }
}
.tp-hero-content-wrap {
  margin-left: 60px;
  height: 100%;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-content-wrap {
    margin-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-hero-content-wrap {
    flex-wrap: wrap;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-hero-content-wrap {
    flex-wrap: wrap;
    flex-direction: row-reverse;
  }
}
.tp-hero-info {
  z-index: 9;
  padding: 0 10px;
  padding-top: 20px;
  border-top: 1px solid rgba(255, 255, 255, 0.7);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-info {
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-info {
    margin-top: 80px;
  }
}
@media (max-width: 767px) {
  .tp-hero-info {
    width: 100%;
    flex-wrap: wrap;
    margin-bottom: 30px;
  }
}
.tp-hero-info p {
  font-size: 16px;
  line-height: 1.5;
  margin-bottom: 0;
  font-weight: 500;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-info p br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-info p {
    padding-right: 50px;
  }
}
.tp-hero-info span {
  margin-left: 30px;
  transform: translateY(10px);
  color: var(--tp-common-white);
}
.tp-hero-info span a {
  position: relative;
  height: 23px;
  width: 23px;
  overflow: hidden;
  display: inline-block;
}
.tp-hero-info span a svg {
  position: absolute;
  bottom: -1px;
  left: 1px;
  transform: translateY(-2px);
  transition: all 0.2s ease-out;
}
.tp-hero-info span a svg:last-child {
  left: -22px;
  bottom: -22px;
  transform: translate(0, 0);
}
.tp-hero-info span a:hover svg:first-child {
  opacity: 0;
  transform: translate(20px, -20px);
}
.tp-hero-info span a:hover svg:last-child {
  transform: translate(23px, -23px);
}
.tp-hero-more-info {
  width: 220px;
  min-height: 300px;
  background-size: cover;
  background-repeat: no-repeat;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-more-info {
    min-height: 310px;
  }
}
.tp-hero-more-info-wrap {
  margin-left: 133px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-more-info-wrap {
    margin-left: 0;
  }
}
.tp-hero-more-info p {
  font-style: italic;
  font-weight: 400;
  font-size: 20px;
  line-height: 1.3;
  margin-bottom: 0;
  padding: 0px 25px;
  padding-bottom: 40px;
  color: var(--tp-common-black);
}
.tp-hero-avater {
  padding: 12px 20px 35px 11px;
}
.tp-hero-avater span {
  font-weight: 600;
  font-size: 16px;
  line-height: 1.62;
  letter-spacing: -0.01em;
  color: var(--tp-common-black);
}
.tp-hero-link {
  padding: 15px;
}
@media (max-width: 767px) {
  .tp-hero-link {
    padding: 20px;
  }
}
.tp-hero-link a {
  display: inline-block;
  border-radius: 30px;
  padding: 8px 24px;
  font-weight: 600;
  font-size: 17px;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.tp-hero-link a:hover {
  background-color: var(--tp-common-red-3);
}
.tp-hero-line {
  position: absolute;
  top: 65px;
  right: 100%;
  height: 1px;
  width: 60px;
  display: inline-block;
  background-color: var(--tp-common-white);
}
.tp-hero-line::before {
  content: "";
  height: 9px;
  width: 9px;
  border-radius: 50%;
  display: inline-block;
  transform: translateY(-14px);
  background-color: var(--tp-common-white);
}
.tp-hero-2-title {
  font-weight: 400;
  font-size: 450px;
  line-height: 1;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-mango);
  color: var(--tp-common-cream);
  position: relative;
  z-index: 99;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-2-title {
    font-size: 365px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-2-title {
    font-size: 300px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-2-title {
    font-size: 230px;
  }
}
@media (max-width: 767px) {
  .tp-hero-2-title {
    font-size: 105px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-hero-2-title {
    font-size: 150px;
  }
}
.tp-hero-2-title.about-us {
  text-transform: uppercase;
}
.tp-hero-2-subtitle {
  font-weight: 400;
  font-size: 46px;
  line-height: 0.87;
  margin-bottom: 10px;
  display: inline-block;
  letter-spacing: 0.01em;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-mango);
}
@media (max-width: 767px) {
  .tp-hero-2-avater-box {
    margin-bottom: 30px;
  }
}
.tp-hero-2-avater-content {
  margin-left: 10px;
}
.tp-hero-2-avater-content h4 {
  font-weight: 700;
  font-size: 16px;
  line-height: 1.25;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  color: var(--tp-common-cream);
}
.tp-hero-2-avater-content span {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.25;
  letter-spacing: -0.01em;
  color: rgba(249, 244, 232, 0.5);
}
@media (max-width: 767px) {
  .tp-hero-2-avater-content span {
    font-size: 15px;
  }
}
.tp-hero-2-img-1 img {
  transform: rotate(-14deg);
  position: relative;
  z-index: 3;
}
.tp-hero-2-img-2 img {
  margin-top: -190px;
  margin-bottom: 115px;
  transform: rotate(14deg);
  position: relative;
  z-index: 3;
}
.tp-hero-2-img-3 {
  position: relative;
  z-index: 1;
}
.tp-hero-2-img-3 img {
  transform: rotate(-16deg);
  margin-right: 280px;
}
.tp-hero-2-img-box.last-item {
  margin-bottom: 900px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-2-img-box.last-item {
    margin-bottom: 700px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-2-img-box.last-item {
    margin-bottom: 640px;
  }
}
.tp-hero-2-img-wrap {
  margin-top: -800px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-2-img-wrap {
    margin-top: -630px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-2-img-wrap {
    margin-top: -600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-2-img-wrap {
    margin-top: -530px;
  }
}
@media (max-width: 767px) {
  .tp-hero-2-area {
    padding-bottom: 0;
  }
}

@media (max-width: 767px) {
  .dgm-hero-top {
    padding-top: 0;
  }
}
.dgm-hero-ptb {
  padding-top: 190px;
  border-radius: 20px;
  padding-bottom: 15px;
}
.dgm-hero-bg {
  position: absolute;
  height: 100%;
  width: 100%;
  z-index: -1;
  padding-top: 190px;
  border-radius: 20px;
  padding-bottom: 15px;
  background-size: cover;
  background-repeat: no-repeat;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-hero-bg {
    padding-top: 150px;
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-hero-bg {
    padding-top: 170px;
    padding-bottom: 0;
  }
}
.dgm-hero-title {
  font-weight: 700;
  font-size: 110px;
  line-height: 0.8;
  margin-bottom: 0;
  margin-bottom: 40px;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-hero-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-hero-title {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .dgm-hero-title {
    font-size: 59px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .dgm-hero-title {
    font-size: 65px;
  }
}
.dgm-hero-title span svg {
  position: absolute;
  bottom: -75px;
  right: 130px;
  z-index: -1;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-hero-title span svg {
    right: 50px;
  }
}
.dgm-hero-title-mike {
  display: inline-block;
  transform: translateY(-20px);
}
.dgm-hero-subtitle {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  margin-bottom: 25px;
  display: inline-block;
  color: var(--tp-common-black);
}
.dgm-hero-thumb {
  position: absolute;
  top: 0;
  right: 0;
  width: 44.4%;
  height: 100%;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-hero-thumb {
    position: static;
    width: 100%;
  }
}
.dgm-hero-thumb > img {
  width: 100%;
  height: 100%;
  border-radius: 20px;
  object-fit: cover;
}
.dgm-hero-thumb div.anim-zoomin-wrap {
  height: 100%;
}
.dgm-hero-thumb div.anim-zoomin-wrap div.anim-zoomin {
  height: 100%;
}
.dgm-hero-thumb div.anim-zoomin-wrap div.anim-zoomin > img {
  width: 100%;
  height: 100%;
  border-radius: 20px;
  object-fit: cover;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-hero-content {
    margin-bottom: 50px;
  }
}
.dgm-hero-content p {
  font-weight: 500;
  font-size: 20px;
  line-height: 1.5;
  color: #6a6b6d;
  margin-bottom: 40px;
  letter-spacing: -0.01em;
}
@media (max-width: 767px) {
  .dgm-hero-content p {
    font-size: 18px;
  }
  .dgm-hero-content p br {
    display: none;
  }
}
.dgm-hero-rotate-text {
  position: absolute;
  bottom: 0;
  right: 47%;
  writing-mode: vertical-lr;
}
.dgm-hero-rotate-text span {
  font-weight: 700;
  font-size: 16px;
  letter-spacing: 0.04em;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-hero-rotate-text span::after {
  content: "";
  height: 60px;
  width: 1px;
  margin-top: 14px;
  display: inline-block;
  transform: translateX(-1px);
  background-color: var(--tp-common-black);
}
.dgm-hero-text-box {
  width: 260px;
  height: 260px;
  position: absolute;
  bottom: 30px;
  left: 30px;
  padding: 30px;
}
.dgm-hero-text-box img {
  margin-bottom: 55px;
}
.dgm-hero-text-box p {
  font-weight: 700;
  font-size: 32px;
  line-height: 1.06;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-hero-text-box p {
    font-size: 28px;
  }
}
.dgm-hero-arrow {
  height: 46px;
  width: 46px;
  line-height: 46px;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  background-color: var(--tp-common-white);
  position: absolute;
  top: 10px;
  right: 2px;
}
.dgm-hero-funfact span {
  display: inline-block;
  font-weight: 500;
  font-size: 60px;
  line-height: 0.47;
  margin-bottom: 23px;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-hero-funfact span i {
  font-style: normal;
}
.dgm-hero-funfact p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.3;
  margin-bottom: 0;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-hero-funfact-wrap {
    margin-bottom: 30px;
  }
}
.dgm-hero-social-box {
  position: absolute;
  top: 50%;
  left: 40px;
  transform: translateY(-50%);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-hero-social-box {
    display: none;
  }
}
.dgm-hero-social-text {
  writing-mode: vertical-lr;
  margin-bottom: 20px;
}
.dgm-hero-social-text span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  color: var(--tp-common-black);
}
.dgm-hero-social-text span::after {
  margin-top: 7px;
  content: "";
  height: 60px;
  width: 1px;
  display: inline-block;
  transform: translateX(-2px);
  background-color: rgba(20, 20, 20, 0.1);
}
.dgm-hero-social a {
  margin-bottom: 20px;
  display: table;
}
.dgm-hero-social a span {
  color: #141414;
}

.creative-hero-bg {
  padding-top: 155px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-bg {
    padding-bottom: 30px;
  }
}
.creative-hero-title {
  font-weight: 600;
  font-size: 100px;
  line-height: 1;
  letter-spacing: -0.04em;
  text-transform: uppercase;
  color: var(--tp-common-white);
  margin-bottom: 0;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-hero-title {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .creative-hero-title {
    font-size: 55px;
  }
  .creative-hero-title br {
    display: none;
  }
}
.creative-hero-title em {
  font-style: normal;
  background-color: #0E0F11;
  display: inline-block;
  padding: 0 35px;
  position: relative;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-title em {
    padding: 0;
    background-color: transparent;
  }
}
@media (max-width: 767px) {
  .creative-hero-title em br {
    display: none;
  }
}
.creative-hero-title em::before {
  content: "";
  position: absolute;
  background-color: transparent;
  bottom: 55px;
  right: -20px;
  height: 40px;
  width: 20px;
  border-top-left-radius: 20px;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-hero-title em::before {
    bottom: 75px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-title em::before {
    display: none;
  }
}
.creative-hero-title em::after {
  content: "";
  position: absolute;
  background-color: transparent;
  bottom: 0;
  right: -19px;
  height: 40px;
  width: 20px;
  border-bottom-left-radius: 20px;
  box-shadow: 0px 18px 0 0 #0e0f11;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-title em::after {
    display: none;
  }
}
.creative-hero-title em span {
  font-style: italic;
  font-weight: 500;
  font-size: 120px;
  line-height: 0.92;
  padding-left: 35px;
  letter-spacing: -0.04em;
  text-transform: capitalize;
  font-family: var(--tp-ff-playfair);
}
@media (max-width: 767px) {
  .creative-hero-title em span {
    font-size: 70px;
    padding-left: 0;
  }
}
.creative-hero-title i {
  font-style: normal;
  background-color: #0E0F11;
  border-radius: 0px 20px 20px 0;
  padding: 5px 35px;
  padding-top: 0;
  display: inline-block;
  position: relative;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-title i {
    padding: 0;
    background-color: transparent;
  }
}
.creative-hero-title img {
  transform: translateY(-10px);
  margin-left: -15px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-hero-title-box {
    margin-left: 80px;
  }
}
.creative-hero-banner {
  width: 100%;
  height: 700px;
  overflow: hidden;
  border-radius: 20px;
  position: relative;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-hero-banner {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .creative-hero-banner {
    height: 400px;
  }
}
.creative-hero-banner img {
  width: 100%;
  object-fit: cover;
}
.creative-hero-banner video {
  height: 100%;
  width: 100%;
  background-position: center center;
  background-size: cover;
  object-fit: cover;
}
.creative-hero-banner-area {
  margin-top: -285px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-banner-area {
    margin-top: 0;
  }
}
.creative-hero-btn {
  padding: 0 35px;
  padding-bottom: 10px;
  padding-top: 15px;
  display: inline-block;
  background-color: #0E0F11;
  border-radius: 0 0 20px 20px;
  position: relative;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-btn {
    padding: 0;
    padding-top: 15px;
    background-color: transparent;
  }
}
.creative-hero-btn::before {
  content: "";
  position: absolute;
  background-color: transparent;
  bottom: 45px;
  right: -20px;
  height: 40px;
  width: 20px;
  border-top-left-radius: 20px;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-btn::before {
    display: none;
  }
}
.creative-hero-black-box {
  position: absolute;
  top: 0;
  left: 0;
  height: 134px;
  width: 180px;
  z-index: 1;
  display: inline-block;
  background-color: #0e0f11;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-black-box {
    display: none;
  }
}
.creative-hero-black-box::before {
  content: "";
  position: absolute;
  background-color: transparent;
  bottom: -40px;
  right: 5px;
  height: 40px;
  width: 20px;
  border-top-right-radius: 20px;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
.creative-hero-black-box::after {
  content: "";
  position: absolute;
  background-color: transparent;
  bottom: -40px;
  left: -2px;
  height: 40px;
  width: 20px;
  border-top-left-radius: 20px;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-hero-black-box::after {
    display: none;
  }
}
.creative-hero-avater img {
  flex: 0 0 auto;
  border-radius: 50%;
  margin-right: 13px;
  height: 54px;
  width: 54px;
}
.creative-hero-avater-box {
  position: absolute;
  bottom: 0;
  right: 0;
  margin: 20px;
  padding: 10px;
  padding-right: 42px;
  border-radius: 100px;
  background-color: var(--tp-common-black-7);
}
.creative-hero-avater-info {
  line-height: 1;
}
.creative-hero-avater-info h4 {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 8px;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
}
.creative-hero-avater-info span {
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  letter-spacing: -0.03em;
  color: rgba(255, 255, 255, 0.6);
}

.design-hero-ptb {
  padding-top: 250px;
  padding-bottom: 70px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .design-hero-ptb {
    padding-top: 200px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-hero-ptb {
    padding-top: 180px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-hero-ptb {
    padding-top: 220px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-hero-ptb {
    padding-top: 160px;
  }
}
@media (max-width: 767px) {
  .design-hero-ptb {
    padding-top: 160px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .design-hero-ptb {
    padding-top: 190px;
  }
}
.design-hero-slide-text span {
  font-weight: 400;
  font-size: 280px;
  line-height: 1;
  color: #e0eeee;
  white-space: nowrap;
  letter-spacing: -0.03em;
  font-family: var(--tp-ff-dirtyline);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .design-hero-slide-text span {
    font-size: 200px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-hero-slide-text span {
    font-size: 170px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-hero-slide-text span {
    font-size: 180px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-hero-slide-text span {
    font-size: 140px;
  }
}
@media (max-width: 767px) {
  .design-hero-slide-text span {
    font-size: 100px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .design-hero-slide-text span {
    font-size: 130px;
  }
}
.design-hero-slide-text span i {
  font-style: normal;
  margin-left: 40px;
}
.design-hero-slide-active .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.design-hero-slide-active .swiper-slide {
  width: auto;
}
.design-hero-circle-1 {
  position: absolute;
  top: -25%;
  left: -6%;
  height: 600px;
  width: 600px;
  filter: blur(70px);
  -webkit-filter: blur(70px);
  border-radius: 50%;
  display: inline-block;
  background-color: rgba(5, 45, 146, 0.6);
}
.design-hero-circle-2 {
  position: absolute;
  bottom: -50%;
  right: -8%;
  height: 800px;
  width: 800px;
  filter: blur(140px);
  -webkit-filter: blur(140px);
  border-radius: 50%;
  display: inline-block;
  background-color: rgba(109, 97, 255, 0.4);
}
.design-hero-content p {
  font-weight: 500;
  font-size: 24px;
  line-height: 1.3;
  color: #e0eeee;
  margin-bottom: 35px;
  letter-spacing: -0.02em;
}
@media (max-width: 767px) {
  .design-hero-content p {
    font-size: 17px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .design-hero-content p {
    font-size: 19px;
  }
  .design-hero-content p br {
    display: none;
  }
}
@media (max-width: 767px) {
  .design-hero-content-wrap {
    margin-bottom: 60px;
  }
}
@media (max-width: 767px) {
  .design-hero-social {
    margin-bottom: 20px;
  }
}
.design-hero-social a {
  font-weight: 600;
  font-size: 14px;
  line-height: 1;
  color: #e0eeee;
  text-transform: uppercase;
  position: relative;
}
.design-hero-social a:not(:last-child) {
  padding-right: 20px;
  margin-right: 20px;
}
.design-hero-social a:not(:last-child)::after {
  position: absolute;
  content: "";
  top: 0;
  right: 0;
  width: 1px;
  height: 16px;
  background-color: #e0eeee;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-hero-wrap {
    margin-bottom: 50px;
  }
}

.content__img {
  width: 250px;
  aspect-ratio: 1.1;
  border-radius: 10px;
  position: absolute;
  top: 0;
  left: 0;
  opacity: 0;
  overflow: hidden;
  will-change: transform, filter;
}

.content__img-inner {
  background-position: 50% 50%;
  width: calc(100% + 20px);
  height: calc(100% + 20px);
  background-size: cover;
  position: absolute;
  top: -10px;
  left: -10px;
}

.studio-hero-bg {
  padding-top: 320px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-hero-bg {
    padding-top: 240px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-hero-bg {
    padding-top: 200px;
  }
}
@media (max-width: 767px) {
  .studio-hero-bg {
    padding-top: 170px;
  }
}
.studio-hero-title {
  font-weight: 700;
  font-size: 450px;
  line-height: 0.7;
  margin-bottom: 0;
  display: inline-block;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-red);
  font-family: var(--tp-ff-clash-bold);
}
@media only screen and (min-width: 1801px) and (max-width: 1850px) {
  .studio-hero-title {
    font-size: 430px;
  }
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .studio-hero-title {
    font-size: 415px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .studio-hero-title {
    font-size: 390px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .studio-hero-title {
    font-size: 345px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-hero-title {
    font-size: 280px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-hero-title {
    font-size: 235px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-hero-title {
    font-size: 175px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .studio-hero-title {
    font-size: 80px;
    letter-spacing: 0;
  }
}
.studio-hero-title.fs-400 {
  font-size: 400px;
}
@media only screen and (min-width: 1801px) and (max-width: 1850px) {
  .studio-hero-title.fs-400 {
    font-size: 350px;
  }
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .studio-hero-title.fs-400 {
    font-size: 365px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .studio-hero-title.fs-400 {
    font-size: 340px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .studio-hero-title.fs-400 {
    font-size: 295px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-hero-title.fs-400 {
    font-size: 230px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-hero-title.fs-400 {
    font-size: 180px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-hero-title.fs-400 {
    font-size: 150px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .studio-hero-title.fs-400 {
    font-size: 80px;
    letter-spacing: 0;
  }
}
.studio-hero-info {
  padding-bottom: 230px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-hero-info {
    padding-bottom: 160px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-hero-info {
    padding-bottom: 150px;
  }
}
@media (max-width: 767px) {
  .studio-hero-info {
    flex-wrap: wrap;
    padding-bottom: 120px;
  }
}
.studio-hero-info a, .studio-hero-info span {
  font-weight: 600;
  font-size: 20px;
  line-height: 1.3;
  margin: 6px 20px;
  text-align: center;
  text-transform: uppercase;
  color: var(--tp-common-cream);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-hero-info a, .studio-hero-info span {
    font-size: 18px;
  }
  .studio-hero-info a br, .studio-hero-info span br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-hero-info a, .studio-hero-info span {
    font-size: 16px;
  }
  .studio-hero-info a br, .studio-hero-info span br {
    display: none;
  }
}
@media (max-width: 767px) {
  .studio-hero-info a, .studio-hero-info span {
    font-size: 16px;
  }
  .studio-hero-info a br, .studio-hero-info span br {
    display: none;
  }
}

.ai-hero-subtitle {
  font-weight: 600;
  font-size: 13px;
  line-height: 1;
  margin-bottom: 25px;
  padding: 9px 16px;
  border-radius: 28px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  backdrop-filter: blur(10px);
  background: rgba(255, 255, 255, 0.08);
}
.ai-hero-title {
  font-weight: 600;
  font-size: 120px;
  line-height: 0.88;
  margin-bottom: 50px;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-hero-title {
    font-size: 75px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ai-hero-title {
    font-size: 70px;
  }
}
@media (max-width: 767px) {
  .ai-hero-title {
    font-size: 65px;
    margin-bottom: 30px;
  }
}
.ai-hero-title img {
  transform: translateY(-8px);
}
.ai-hero-title-box {
  padding-left: 350px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .ai-hero-title-box {
    padding-left: 260px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .ai-hero-title-box {
    padding-left: 130px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-hero-title-box {
    padding-left: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .ai-hero-title-box {
    padding-left: 15px;
  }
}
@media (max-width: 767px) {
  .ai-hero-title-box {
    padding-left: 0px;
  }
}
.ai-hero-video {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  z-index: -1;
}
.ai-hero-video video {
  height: 100%;
  width: 100%;
  background-position: center center;
  background-size: cover;
  object-fit: cover;
}
.ai-hero-ptb {
  padding-top: 110px;
}
@media (max-width: 767px) {
  .ai-hero-ptb {
    padding-top: 180px;
    padding-bottom: 40px;
  }
}
.ai-hero-slider-main {
  height: 950px;
  margin-left: 95px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .ai-hero-slider-main {
    margin-left: 55px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-hero-slider-main {
    margin-left: 0px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-hero-slider-main {
    height: 750px;
    margin-left: 0px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ai-hero-slider-main {
    height: 800px;
    margin-left: 0px;
  }
}
@media (max-width: 767px) {
  .ai-hero-slider-main {
    height: 400px;
    margin-left: 0;
  }
}
.ai-hero-slider-main::after {
  position: absolute;
  content: "";
  top: -3px;
  left: 0;
  width: 100%;
  height: 101%;
  background: linear-gradient(180deg, rgb(8, 4, 29) 1.05%, rgba(8, 4, 29, 0) 24.26%, rgba(8, 4, 29, 0) 68.54%, rgb(8, 4, 29) 98.06%);
}
.ai-hero-slider-item {
  margin-bottom: 12px;
}
.ai-hero-slider-2 {
  transform: scale(1, -1);
}
.ai-hero-slider-2 img {
  transform: scale(1, -1);
}

.ar-hero-ptb {
  padding-top: 195px;
  padding-bottom: 120px;
}
@media (max-width: 767px) {
  .ar-hero-ptb {
    padding-top: 160px;
    padding-bottom: 95px;
  }
}
.ar-hero-border {
  border-bottom: 1px solid rgba(25, 25, 25, 0.08);
}
.ar-hero-bg {
  border-left: 1px solid rgba(25, 25, 25, 0.08);
  border-right: 1px solid rgba(25, 25, 25, 0.08);
}
.ar-hero-title {
  font-size: 110px;
  line-height: 1;
  letter-spacing: -0.05em;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-regular);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-hero-title {
    font-size: 105px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-hero-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-hero-title {
    font-size: 95px;
  }
}
@media (max-width: 767px) {
  .ar-hero-title {
    font-size: 60px;
  }
}
.ar-hero-title i {
  font-style: normal;
  padding-left: 100px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-hero-title i {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-hero-title-box.service-5-heading {
    margin-bottom: 40px;
  }
}
.ar-hero-shape-1 {
  margin-right: 20px;
  transform: translateY(-23px);
}
.ar-hero-shape-2 {
  transform: translateY(-10px);
}
.ar-hero-shape-3 {
  margin-left: 20px;
  transform: translateY(-23px);
}

.crp-hero-ptb {
  padding-top: 220px;
  padding-bottom: 220px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-hero-ptb {
    padding-top: 190px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-hero-ptb {
    padding-top: 200px;
    padding-bottom: 70px;
  }
}
@media (max-width: 767px) {
  .crp-hero-ptb {
    padding-top: 190px;
    padding-bottom: 70px;
  }
}
.crp-hero-title {
  font-size: 150px;
  font-weight: 600;
  line-height: 0.8;
  color: var(--tp-common-cream-3);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .crp-hero-title {
    font-size: 130px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-hero-title {
    font-size: 105px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-hero-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-hero-title {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .crp-hero-title {
    font-size: 65px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .crp-hero-title {
    font-size: 80px;
  }
}
.crp-hero-title span {
  color: var(--tp-common-yellow-green);
}
.crp-hero-title.fs-100 {
  font-size: 100px;
  letter-spacing: -2px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-hero-title.fs-100 {
    font-size: 82px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .crp-hero-title.fs-100 {
    font-size: 70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-hero-title.fs-100 {
    font-size: 65px;
  }
}
@media (max-width: 767px) {
  .crp-hero-title.fs-100 {
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .crp-hero-title.fs-100 br {
    display: none;
  }
}
.crp-hero-bg {
  background-size: cover;
  background-repeat: no-repeat;
}
.crp-hero-ratting {
  line-height: 1;
}
.crp-hero-ratting-text {
  flex: 0 0 auto;
  margin-right: 18px;
}
.crp-hero-ratting-text span {
  font-weight: 600;
  font-size: 50px;
  line-height: 0.8;
  display: inline-block;
  transform: translateY(7px);
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
.crp-hero-ratting-details {
  line-height: 1;
}
.crp-hero-ratting-details a {
  font-weight: 600;
  font-size: 12px;
  line-height: 1;
  letter-spacing: 0;
  text-transform: uppercase;
  color: rgba(238, 241, 234, 0.7);
  border-bottom: 1px solid rgba(238, 241, 234, 0.2);
}
.crp-hero-ratting-details a:hover {
  color: var(--tp-common-white);
}
.crp-hero-ratting-details a span svg {
  margin-left: 2px;
  display: inline-block;
  transform: translateY(-1px);
}
.crp-hero-ratting-icon {
  line-height: 1;
}
.crp-hero-ratting-icon span {
  margin-bottom: 7px;
  display: inline-block;
}
@media (max-width: 767px) {
  .crp-hero-ratting-box {
    flex-wrap: wrap;
  }
}
.crp-hero-avater {
  flex: 0 0 auto;
  margin-right: 30px;
}
@media (max-width: 767px) {
  .crp-hero-avater {
    margin-right: 0;
    margin-bottom: 20px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .crp-hero-avater {
    margin-right: 20px;
    margin-bottom: 20px;
  }
}
.crp-hero-funfact-bg {
  width: 340px;
  padding: 40px;
  background-repeat: no-repeat;
}
.crp-hero-funfact-top-content {
  padding-right: 60px;
  margin-bottom: 45px;
}
.crp-hero-funfact-top-content h4 {
  font-weight: 600;
  font-size: 28px;
  color: #17312f;
  margin-bottom: 7px;
  font-family: var(--tp-ff-teko);
}
.crp-hero-funfact-top-content p {
  font-weight: 400;
  font-size: 17px;
  line-height: 1.4;
  letter-spacing: -0.01em;
  color: rgba(23, 49, 47, 0.8);
}
.crp-hero-funfact-item h4 {
  font-weight: 500;
  font-size: 70px;
  color: #17312f;
  margin-bottom: 8px;
  line-height: 0.7;
  font-family: var(--tp-ff-teko);
}
.crp-hero-funfact-more-details p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.5;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  color: rgba(23, 49, 47, 0.8);
}
.crp-hero-funfact-wrap {
  margin-left: 20px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .crp-hero-funfact-wrap {
    margin-left: 0;
    margin-left: -40px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-hero-funfact-wrap {
    margin-left: 0;
    margin-left: -60px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-hero-funfact-wrap {
    margin-left: 0;
    margin-left: -30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-hero-funfact-wrap {
    margin-left: 0;
    margin-bottom: 60px;
  }
}
.crp-hero-funfact-wrap .crp-hero-funfact-item:not(:last-child) {
  margin-bottom: 30px;
  padding-bottom: 30px;
  border-bottom: 1px solid rgba(23, 49, 47, 0.1);
}
.crp-hero-funfact-line {
  position: absolute;
  top: 120px;
  right: 100%;
  height: 1px;
  width: 80px;
  display: inline-block;
  background-color: var(--tp-common-yellow-green);
}
.crp-hero-funfact-line::before {
  content: "";
  height: 15px;
  width: 15px;
  border-radius: 50%;
  display: inline-block;
  transform: translateY(-11px);
  background-color: var(--tp-common-yellow-green);
}
.crp-hero-funfact-img {
  position: absolute;
  top: 3px;
  right: 3px;
}
@media (max-width: 767px) {
  .crp-hero-review-box {
    flex-wrap: wrap;
  }
}

.app-hero-ptb {
  padding-top: 210px;
}
@media (max-width: 767px) {
  .app-hero-ptb {
    padding-top: 230px;
  }
}
.app-hero-round-shape {
  margin-top: -100px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-hero-round-shape {
    display: none;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-hero-wrap {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .app-hero-wrap {
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .app-hero-btn-box {
    flex-wrap: wrap;
  }
}
.app-hero-btn-text p {
  margin: 0;
  font-size: 16px;
  color: #66666C;
  line-height: 24px;
}
@media (max-width: 767px) {
  .app-hero-bottom-wrap {
    padding-top: 80px;
    padding-left: 30px;
  }
}
.app-hero-bottom-wrapper {
  border-radius: 30px;
}
@media (max-width: 767px) {
  .app-hero-bottom-wrapper {
    background-position: top left;
  }
}
.app-hero-bottom-subtitle {
  font-size: 18px;
  font-weight: 500;
  margin-bottom: 20px;
  display: inline-block;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-phudu);
}
.app-hero-bottom-thumb-main {
  position: absolute;
  bottom: 0;
  right: 17%;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .app-hero-bottom-thumb-main {
    right: 5%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-hero-bottom-thumb-main {
    right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .app-hero-bottom-thumb-main {
    right: 0;
    bottom: -104px;
    transform: scale(0.7) translateX(115px);
  }
}
@media (max-width: 767px) {
  .app-hero-bottom-thumb-main {
    position: static;
  }
}
.app-hero-bottom-thumb-main .shape-1 {
  position: absolute;
  bottom: 108px;
  left: -110px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-hero-bottom-thumb-main .shape-1 {
    display: none;
  }
}
.app-hero-bottom-thumb-main .shape-2 {
  position: absolute;
  bottom: 0;
  left: -20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .app-hero-bottom-thumb-main .shape-2 {
    left: 110px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-hero-bottom-thumb-main .shape-2 {
    left: 255px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-hero-bottom-thumb-main .shape-2 {
    display: none;
  }
}
.app-hero-bottom-thumb-main .shape-3 {
  position: absolute;
  bottom: 130px;
  left: 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-hero-bottom-thumb-main .shape-3 {
    left: 150px;
    bottom: 190px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-hero-bottom-thumb-main .shape-3 {
    display: none;
  }
}
.app-hero-bottom-thumb-main .shape-4 {
  position: absolute;
  right: 0;
  bottom: 65px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-hero-bottom-thumb-main .shape-4 {
    display: none;
  }
}
.app-hero-bottom-thumb-main .shape-5 {
  position: absolute;
  top: 95px;
  right: -75px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-hero-bottom-thumb-main .shape-5 {
    right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-hero-bottom-thumb-main .shape-5 {
    display: none;
  }
}
.app-hero-bottom-rating {
  display: flex;
  align-items: center;
}
.app-hero-bottom-rating-point span {
  font-size: 60px;
  font-weight: 500;
  margin-right: 10px;
  letter-spacing: -0.6px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-phudu);
}
.app-hero-bottom-rating-star {
  transform: translateY(-4px);
}
.app-hero-bottom-rating-star a {
  font-size: 12px;
  font-weight: 700;
  margin: 0;
  letter-spacing: -0.12px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  border-bottom: 1px solid rgba(255, 255, 255, 0.5);
}
.app-hero-bottom-rating-star a svg {
  margin-left: 4px;
}
.app-hero-bottom-rating-stars {
  line-height: 1;
  margin-bottom: 0px;
}

.box {
  display: inline-flex;
}

.box .eye {
  position: relative;
  width: 74px;
  height: 74px;
  display: block;
  background: var(--tp-common-yellow-green);
  margin: 0 5px;
  border-radius: 50%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .box .eye {
    width: 64px;
    height: 64px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .box .eye {
    width: 54px;
    height: 54px;
  }
}

.box .eye:before {
  content: "";
  position: absolute;
  top: 50%;
  left: 22px;
  width: 30px;
  height: 30px;
  border-radius: 50%;
  background: #17312f;
  transform: translate(-50%, -50%);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .box .eye:before {
    width: 25px;
    height: 25px;
  }
}

.it-hero-ptb {
  padding-top: 235px;
  padding-bottom: 290px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .it-hero-ptb {
    padding-bottom: 70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-hero-ptb {
    padding-top: 200px;
  }
}
@media (max-width: 767px) {
  .it-hero-ptb {
    padding-bottom: 50px;
  }
}
.it-hero-subtitle {
  font-style: italic;
  font-weight: 400;
  font-size: 18px;
  margin-bottom: 23px;
  display: inline-block;
  letter-spacing: 0.03em;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-platform);
}
.it-hero-title {
  font-weight: 700;
  font-size: 90px;
  line-height: 1;
  margin-bottom: 15px;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-platform);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .it-hero-title {
    font-size: 80px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .it-hero-title {
    font-size: 65px;
  }
}
@media (max-width: 767px) {
  .it-hero-title {
    font-size: 60px;
  }
}
.it-hero-title .img-1 {
  transform: translateY(-7px);
}
@media (max-width: 767px) {
  .it-hero-title .img-1 {
    display: none;
  }
}
.it-hero-title .img-2 {
  transform: translateY(-7px);
}
@media (max-width: 767px) {
  .it-hero-title .img-2 {
    display: none;
  }
}
.it-hero-content p {
  font-weight: 400;
  font-size: 26px;
  color: #45454f;
  margin-bottom: 40px;
  letter-spacing: 0.02em;
  font-family: var(--tp-ff-platform);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-hero-content p {
    font-size: 20px;
  }
}
.it-hero-thumb img {
  margin-left: -25px;
  margin-bottom: -3px;
  max-width: inherit;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .it-hero-thumb img {
    margin-left: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-hero-thumb img {
    margin-left: 0;
  }
}
@media (max-width: 767px) {
  .it-hero-thumb img {
    max-width: 100%;
    margin-left: -30px;
  }
}
.it-hero-shape-1 {
  position: absolute;
  bottom: 0;
  left: 0;
  right: 0;
  width: 100%;
  z-index: 1;
}
.it-hero-shape-1 img {
  width: 100%;
}
.it-hero-shape-2 {
  position: absolute;
  top: 0;
  right: 0;
  z-index: -1;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .it-hero-shape-2 {
    right: -30%;
  }
}
@media (max-width: 767px) {
  .it-hero-shape-2 {
    display: none;
  }
}
.it-hero-thumb .inner-img {
  position: absolute;
  top: 24%;
  left: -12%;
}
@media (max-width: 767px) {
  .it-hero-thumb .inner-img {
    display: none;
  }
}
@media (max-width: 767px) {
  .it-hero-btn-box a {
    margin-bottom: 20px;
  }
}

.st-hero-ptb {
  padding-top: 250px;
  padding-bottom: 60px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .st-hero-ptb {
    padding-top: 215px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-hero-ptb {
    padding-top: 200px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-hero-ptb {
    padding-top: 175px;
  }
}
.st-hero-shape {
  position: absolute;
  top: 25%;
  right: 10%;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .st-hero-shape {
    top: 16%;
    right: 4%;
  }
}
@media (max-width: 767px) {
  .st-hero-shape {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-hero-border {
    display: none;
  }
}
.st-hero-border .tp-border-line {
  top: 100px;
  width: 23.2%;
  border-right: 1px solid rgba(25, 25, 25, 0.08);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-hero-border .tp-border-line {
    top: 70px;
  }
}
.st-hero-border .tp-border-line::after {
  content: none;
}
.st-hero-border .tp-border-line.line-2 {
  width: 40.8%;
}
.st-hero-border .tp-border-line.line-3 {
  width: 58.6%;
}
.st-hero-border .tp-border-line.line-4 {
  width: 76%;
}
@media (max-width: 767px) {
  .st-hero-heading {
    margin-bottom: 30px;
  }
}
.st-hero-title {
  font-size: 160px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -3.2px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-hero-title {
    font-size: 135px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .st-hero-title {
    font-size: 124px;
  }
}
@media (max-width: 767px) {
  .st-hero-title {
    font-size: 70px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .st-hero-title {
    font-size: 100px;
  }
}
.st-hero-title i {
  padding-left: 300px;
  font-family: var(--tp-ff-playfair);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-hero-title i {
    padding-left: 280px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-hero-title i {
    padding-left: 0;
  }
}
.st-hero-plain {
  position: absolute;
  right: 30%;
  top: 10%;
  width: 122px;
  height: 122px;
  display: inline-block;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-hero-plain {
    right: 18%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-hero-plain {
    display: none;
  }
}
.st-hero-plain span {
  width: 114px;
  height: 114px;
  border-radius: 50%;
  display: inline-block;
  background-color: var(--tp-common-white);
}
.st-hero-plain img {
  top: 0;
  left: 25px;
  position: absolute;
  transform-origin: top;
  animation: loadingAnimation 2s ease-in-out;
}
.st-hero-btn {
  margin-bottom: 35px;
}
.st-hero-btn a {
  height: 150px;
  width: 150px;
  border-radius: 50%;
  text-align: center;
  display: grid;
  place-content: center;
  color: var(--tp-common-brown);
  background-color: var(--tp-common-white);
}
.st-hero-btn a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-brown);
}
.st-hero-btn a:hover .st-hero-btn-text {
  color: var(--tp-common-white);
}
.st-hero-btn-text {
  font-size: 18px;
  font-weight: 600;
  position: relative;
  display: block;
  margin-bottom: 5px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.st-hero-btn-icon {
  display: block;
  margin-left: 8px;
}
.st-hero-user-content span {
  font-size: 16px;
  font-weight: 400;
  color: #494949;
  line-height: 18px;
  letter-spacing: -0.32px;
  font-family: var(--tp-ff-poppins);
}
.st-hero-bottom-left {
  margin-top: -40px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-hero-bottom-left {
    margin-top: 0;
  }
}
.st-hero-bottom-right p {
  margin: 0;
  font-size: 18px;
  font-weight: 500;
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-hero-bottom-right p br {
    display: none;
  }
}

.cr-hero-ptb {
  border-bottom: 1px solid rgba(255, 255, 255, 0.06);
}
.cr-hero-bg {
  top: 0;
  left: 0;
  right: 0;
  width: 100%;
  z-index: -1;
  margin: 0 auto;
  text-align: center;
  position: absolute;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-hero-left {
    display: none;
  }
}
.cr-hero-left .shape-1 {
  position: absolute;
  left: -2px;
  top: 16%;
  z-index: 1;
}
.cr-hero-left .shape-2 {
  position: absolute;
  left: 3%;
  top: 22%;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-hero-right {
    display: none;
  }
}
.cr-hero-right .shape-1 {
  position: absolute;
  right: -2px;
  top: 16%;
  z-index: 1;
}
.cr-hero-right .shape-2 {
  position: absolute;
  right: 3%;
  top: 22%;
}
.cr-hero-heading {
  padding-bottom: 350px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-hero-heading {
    padding-bottom: 250px;
  }
}
.cr-hero-thumb {
  left: 0;
  right: 0;
  bottom: 9%;
  width: 100%;
  margin: 0 auto;
  position: absolute;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cr-hero-thumb {
    bottom: 18%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cr-hero-thumb {
    bottom: 22%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cr-hero-thumb {
    bottom: 30%;
  }
}
@media (max-width: 767px) {
  .cr-hero-thumb {
    bottom: 35%;
  }
}
.cr-hero-thumb img {
  width: 100%;
}
.cr-hero-content {
  padding-bottom: 50px;
}
.cr-hero-content p {
  font-size: 17px;
  font-weight: 500;
  line-height: 26px;
  margin-bottom: 25px;
  color: rgba(255, 255, 255, 0.5);
}
.cr-hero-bottom-big {
  position: absolute;
  bottom: -420px;
  left: 50%;
  z-index: 2;
  height: 660px;
  width: 660px;
  border-radius: 660px;
  display: inline-block;
  transform: translateX(-50%);
  background: #151618;
  box-shadow: 0px -20px 80px 0px rgba(0, 0, 0, 0.2);
}
.cr-hero-bottom-small {
  bottom: 0;
  height: 440px;
  width: 440px;
  position: absolute;
  border-radius: 440px;
  display: inline-block;
  box-shadow: 0px -20px 80px 0px rgba(0, 0, 0, 0.2);
  background: linear-gradient(287deg, rgba(255, 255, 255, 0.02) 16.08%, rgba(255, 255, 255, 0) 69.12%);
}
.cr-hero-bottom-small.bg-l {
  position: absolute;
  bottom: -280px;
  left: -80px;
  z-index: -1;
  background: linear-gradient(249deg, rgba(255, 255, 255, 0) 22.41%, rgba(255, 255, 255, 0.02) 69.72%);
}
.cr-hero-bottom-small.bg-r {
  position: absolute;
  bottom: -280px;
  right: -80px;
  z-index: -1;
}

.pp-hero-ptb {
  padding-top: 120px;
}
.pp-hero-hight {
  height: 100vh;
  overflow: hidden;
}
@media (max-width: 767px) {
  .pp-hero-hight {
    height: 700px;
  }
}
.pp-hero-bg {
  position: absolute;
  left: 0;
  right: 0;
  z-index: 0;
  bottom: -54%;
  margin: 0 auto;
  text-align: center;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-hero-bg {
    bottom: -25%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-hero-bg {
    bottom: 0%;
  }
}
.pp-hero-text {
  font-size: 50px;
  font-weight: 700;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .pp-hero-text {
    font-size: 40px;
  }
}
.pp-hero-left {
  transform: translateY(30px);
}
@media (max-width: 767px) {
  .pp-hero-left {
    margin-bottom: 30px;
    padding-bottom: 20px;
  }
}
.pp-hero-right {
  padding-left: 70px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-hero-right {
    padding-left: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-hero-right {
    padding-left: 45px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-hero-right {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-hero-right {
    padding-top: 205px;
  }
}
.pp-hero-right p {
  font-size: 16px;
  font-weight: 600;
  line-height: 26px;
  margin-bottom: 35px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-hero-right p br {
    display: none;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .pp-hero-heading {
    padding-top: 50px;
  }
}
.pp-hero-title {
  margin: 0;
  line-height: 0.8;
  font-size: 380px;
  font-weight: 600;
  letter-spacing: -16px;
  padding-bottom: 15px;
  white-space: nowrap;
  text-transform: uppercase;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-yellow-1);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .pp-hero-title {
    font-size: 315px;
    letter-spacing: -12px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .pp-hero-title {
    font-size: 300px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-hero-title {
    font-size: 242px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-hero-title {
    font-size: 200px;
    letter-spacing: -10px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-hero-title {
    font-size: 135px;
    letter-spacing: -6px;
  }
}
@media (max-width: 767px) {
  .pp-hero-title {
    font-size: 65px;
    letter-spacing: 0px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .pp-hero-title {
    font-size: 100px;
    letter-spacing: 0px;
  }
}

.tp-hero-5-ptb {
  padding-top: 240px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-5-ptb {
    padding-top: 170px;
  }
}
@media (max-width: 767px) {
  .tp-hero-5-ptb {
    padding-top: 130px;
  }
}
.tp-hero-5-big-thumb {
  position: absolute;
  top: 0;
  right: 0;
  height: 100%;
  width: auto;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-5-big-thumb {
    width: 50%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-5-big-thumb {
    position: static;
  }
}
.tp-hero-5-big-thumb div {
  height: 100%;
  width: 100%;
  display: inline-block;
}
.tp-hero-5-big-thumb div > div {
  width: 100%;
  height: 100%;
}
.tp-hero-5-big-thumb img {
  height: 100%;
  width: 100%;
  object-fit: cover;
}
.tp-hero-5-thumb-content {
  padding-left: 20px;
  margin-bottom: 110px;
  position: relative;
}
.tp-hero-5-thumb-content::after {
  position: absolute;
  top: -6px;
  left: -1px;
  width: 1px;
  height: 100px;
  content: "";
  background-color: var(--tp-cream-2);
}
.tp-hero-5-thumb-content p {
  font-size: 20px;
  font-style: normal;
  font-weight: 400;
  line-height: 24px;
  letter-spacing: -0.4px;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
  margin-bottom: 0;
}
.tp-hero-5-thumb-content p span {
  margin-bottom: 10px;
  display: inline-block;
}
.tp-hero-5-thumb-wrap {
  display: none;
}
@media (min-width: 1600px) {
  .tp-hero-5-thumb-wrap {
    display: block;
  }
}
.tp-hero-5-title {
  font-size: 170px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -10.2px;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-poppins);
  margin-left: -8px;
  margin-bottom: 20px;
  display: inline-block;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-5-title {
    font-size: 150px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-5-title {
    font-size: 115px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-5-title {
    font-size: 150px;
  }
}
@media (max-width: 767px) {
  .tp-hero-5-title {
    font-size: 60px;
    margin-left: 0;
    letter-spacing: 1px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-hero-5-title {
    font-size: 110px;
    letter-spacing: 1px;
  }
}
.tp-hero-5-title span {
  -webkit-text-stroke: 2px var(--tp-cream-2);
  text-stroke: 2px var(--tp-cream-2);
  color: transparent;
}
.tp-hero-5-title-box {
  padding-left: 140px;
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .tp-hero-5-title-box {
    padding-left: 95px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-5-title-box {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-hero-5-title-box {
    margin-bottom: 80px;
  }
}
.tp-hero-5-title-box p {
  font-size: 24px;
  font-weight: 400;
  line-height: 1;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
  margin-bottom: 40px;
}
@media (min-width: 1800px) {
  .tp-hero-5-bdr-left {
    border-left: 1px solid rgba(183, 171, 152, 0.14);
  }
}
.tp-hero-5-thumb-sm {
  height: 410px;
  overflow: hidden;
}

.tp-image-distortion {
  overflow: hidden;
  height: 100%;
  position: relative;
}
.tp-image-distortion canvas {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  z-index: -1;
}

.creative-2-hero-title {
  font-weight: 600;
  font-size: 100px;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: -0.04em;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-2-hero-title {
    font-size: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-2-hero-title {
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-2-hero-title {
    font-size: 90px;
    margin-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .creative-2-hero-title {
    font-size: 70px;
    margin-bottom: 20px;
  }
}
.creative-2-hero-title img {
  transform: translateY(-10px);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-2-hero-text {
    display: none;
  }
}
.creative-2-hero-text {
  transform: translate(-140px, -12px);
}
.creative-2-hero-text p {
  font-weight: 600;
  font-size: 16px;
  line-height: 1.6;
  margin-bottom: 0;
  color: var(--tp-common-white);
}
.creative-2-hero-icon {
  position: absolute;
  left: 60%;
  bottom: -15px;
  display: inline-block;
  margin-bottom: 15px;
  color: var(--tp-common-white);
}

/*----------------------------------------*/
/*  7.2 About Css
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.tp-about-wrap {
  margin-left: 70px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-wrap {
    margin-left: 0;
  }
}
.tp-about-text p {
  font-weight: 600;
  font-size: 50px;
  line-height: 1.2;
  margin-right: 60px;
  margin-bottom: 80px;
  letter-spacing: -0.06em;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-about-text p {
    font-size: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-about-text p {
    font-size: 38px;
  }
}
@media (max-width: 767px) {
  .tp-about-text p {
    font-size: 30px;
  }
  .tp-about-text p br {
    display: none;
  }
}
.tp-about-thumb {
  height: 415px;
  width: 315px;
  overflow: hidden;
  margin-left: 100px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-thumb {
    margin-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-about-thumb {
    width: 100%;
  }
}
.tp-about-thumb img {
  width: 100%;
  margin-top: -100px;
}
.tp-about-funcact-wrap {
  margin-top: 25px;
  margin-left: 60px;
}
@media (max-width: 767px) {
  .tp-about-funcact-wrap {
    margin-left: 0;
  }
}
.tp-about-funcact-item span {
  font-weight: 400;
  font-size: 70px;
  line-height: 1;
  margin-bottom: 17px;
  display: inline-block;
  letter-spacing: -0.04em;
}
.tp-about-funcact-item span i {
  font-style: normal;
}
.tp-about-funcact-item p {
  line-height: 1.33;
  margin-bottom: 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-about-funcact-item p {
    font-size: 16px;
  }
  .tp-about-funcact-item p br {
    display: none;
  }
}
.tp-about-avater-info {
  margin-bottom: 38px;
  padding-bottom: 33px;
  border-bottom: 1px solid var(--tp-border-2);
}
.tp-about-avater-info img {
  margin-bottom: 18px;
}
.tp-about-avater-info p {
  line-height: 1.44;
  margin-bottom: 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-about-avater-info p {
    font-size: 17px;
  }
  .tp-about-avater-info p br {
    display: none;
  }
}
@media (max-width: 767px) {
  .tp-about-avater-info p br {
    display: none;
  }
}
.tp-about-shape-1 {
  position: absolute;
  bottom: 0;
  left: 0;
}
.tp-about-shape-1 img {
  animation: rotate2 5s linear infinite;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-about-title-box {
    margin-bottom: 20px;
  }
}
@media (max-width: 767px) {
  .tp-about-us-area {
    padding-bottom: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-about-us-2-ptb {
    padding-top: 150px;
  }
}
@media (max-width: 767px) {
  .tp-about-us-2-ptb {
    padding-top: 130px;
  }
}
.tp-about-us-2-line {
  padding-bottom: 20px;
}
.tp-about-us-2-line img {
  position: absolute;
  left: 0;
  right: 0;
  width: 100%;
  margin: 0 auto;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-about-us-2-top {
    padding: 0 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-top {
    display: none;
  }
}
.tp-about-us-2-text p {
  position: relative;
  font-size: 14px;
  font-weight: 500;
  padding-left: 10px;
  margin-bottom: 5px;
  display: inline-block;
  text-transform: uppercase;
  color: rgba(33, 33, 45, 0.5);
  font-family: var(--tp-ff-clash-medium);
}
.tp-about-us-2-text p::before {
  position: absolute;
  content: "";
  height: 3px;
  width: 3px;
  left: 0;
  top: 10px;
  border-radius: 50%;
  background-color: rgba(33, 33, 45, 0.5);
}
.tp-about-us-2-wrap {
  position: relative;
  padding: 30px;
  border: 1px solid rgba(34, 34, 34, 0.08);
}
@media (max-width: 767px) {
  .tp-about-us-2-wrap {
    border: none;
    padding: 0;
  }
}
.tp-about-us-2-wrap::after {
  position: absolute;
  content: "";
  width: 1px;
  height: 100%;
  top: 0;
  left: 50%;
  transform: translateX(-50%);
  background-color: rgba(34, 34, 34, 0.08);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-wrap::after {
    content: none;
  }
}
.tp-about-us-2-thumb {
  padding: 70px 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-thumb {
    padding: 30px 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-thumb img {
    width: 100%;
  }
}
.tp-about-us-2-thumb-shape .shape-1 {
  position: absolute;
  top: 50%;
  left: 0;
  transform: translateY(-50%);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-about-us-2-thumb-shape .shape-1 {
    left: -8px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-thumb-shape .shape-1 {
    display: none;
  }
}
.tp-about-us-2-thumb-shape .shape-2 {
  position: absolute;
  top: 50%;
  right: 30px;
  transform: translateY(-50%);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-about-us-2-thumb-shape .shape-2 {
    right: -8px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-thumb-shape .shape-2 {
    display: none;
  }
}
.tp-about-us-2-right {
  height: 100%;
  padding-left: 15px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-about-us-2-right {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-about-us-2-right {
    padding-left: 20px;
  }
}
.tp-about-us-2-right-shape {
  position: absolute;
  top: 0;
  right: 0;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-right-shape {
    display: none;
  }
}
.tp-about-us-2-text-title {
  font-size: 16px;
  font-weight: 500;
  padding: 5px 25px;
  margin-right: 6px;
  border-radius: 130px;
  display: inline-block;
  letter-spacing: -0.32px;
  color: rgba(33, 33, 45, 0.7);
  border: 1px solid rgba(33, 33, 45, 0.08);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-us-2-btn {
    padding-bottom: 50px;
  }
}
.tp-about-us-2-btn a {
  font-size: 16px;
  font-weight: 500;
  padding: 5px 25px;
  margin-right: 6px;
  border-radius: 130px;
  display: inline-block;
  letter-spacing: -0.32px;
  color: rgba(33, 33, 45, 0.7);
  border: 1px solid rgba(33, 33, 45, 0.1);
}
.tp-about-us-2-btn a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.tp-about-us-2-subtitle {
  font-size: 30px;
  font-weight: 700;
  margin-bottom: 10px;
  display: inline-block;
  letter-spacing: -0.9px;
  text-transform: uppercase;
  color: var(--tp-common-red);
  font-family: var(--tp-ff-clash-semibold);
}
@media (max-width: 767px) {
  .tp-about-us-2-subtitle {
    font-size: 20px;
    letter-spacing: 0;
    margin-bottom: 20px;
  }
}
.tp-about-us-2-title {
  font-size: 200px;
  font-weight: 700;
  line-height: 0.75;
  letter-spacing: -6px;
  text-transform: uppercase;
  color: var(--tp-common-red);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-about-us-2-title {
    font-size: 170px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-about-us-2-title {
    font-size: 115px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-about-us-2-title {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .tp-about-us-2-title {
    font-size: 70px;
    letter-spacing: -1px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-about-us-2-title {
    font-size: 100px;
    letter-spacing: -1px;
  }
}

.des-about-text p {
  font-weight: 400;
  font-size: 75px;
  line-height: 1;
  letter-spacing: 1px;
  font-family: var(--tp-ff-mango);
  color: var(--tp-common-cream);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-about-text p {
    font-size: 65px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-about-text p {
    font-size: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-about-text p {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .des-about-text p {
    font-size: 50px;
  }
}
.des-about-text p span {
  color: #FB4566;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-about-area {
    padding-bottom: 160px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-about-area {
    padding-bottom: 150px;
  }
}
@media (max-width: 767px) {
  .des-about-area {
    padding-bottom: 110px;
  }
}
@media (max-width: 767px) {
  .des-about-inner-ptb {
    padding-bottom: 0;
  }
}

.dgm-about-thumb-1 {
  position: absolute;
  bottom: 0;
  right: 0;
  box-shadow: 0 20px 30px 0 rgba(20, 20, 20, 0.12);
}
@media (max-width: 767px) {
  .dgm-about-thumb-1 {
    position: static;
    margin-top: 30px;
    width: 100%;
  }
}
.dgm-about-thumb-wrap {
  margin-left: 80px;
  padding-bottom: 90px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-about-thumb-wrap {
    margin-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-about-thumb-wrap {
    margin-left: 0;
    margin-bottom: 50px;
  }
}
@media (max-width: 767px) {
  .dgm-about-thumb-wrap {
    margin-left: 0;
    padding-bottom: 40px;
  }
}
.dgm-about-content {
  padding-left: 50px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-about-content {
    padding-left: 0;
  }
}
.dgm-about-content p {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.56;
  margin-bottom: 45px;
  padding-right: 60px;
  letter-spacing: -0.01em;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .dgm-about-content p {
    padding-right: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-about-content p {
    font-size: 17px;
    padding-right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-about-content p {
    padding-right: 0;
  }
}
.dgm-about-review {
  padding-right: 25px;
  margin-right: 25px;
  padding-top: 12px;
  position: relative;
}
.dgm-about-review::after {
  position: absolute;
  top: 0;
  right: 0;
  width: 1px;
  height: 80px;
  content: "";
  background-color: rgba(20, 20, 20, 0.1);
}
.dgm-about-review-box {
  border-top: 1px solid rgba(20, 20, 20, 0.1);
}
.dgm-about-review h4 {
  font-weight: 700;
  font-size: 44px;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-about-review span {
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  letter-spacing: -0.03em;
  color: var(--tp-common-black);
}
.dgm-about-ratting {
  padding-top: 18px;
}
.dgm-about-ratting h4 {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  margin-bottom: 7px;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.dgm-about-ratting-icon span {
  height: 26px;
  width: 26px;
  line-height: 22px;
  text-align: center;
  display: inline-block;
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.dgm-about-right {
  margin-left: 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-about-right {
    margin-left: 0;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-about-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.creative-about-text p {
  font-weight: 600;
  font-size: 44px;
  line-height: 1.18;
  margin-bottom: 40px;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .creative-about-text p {
    font-size: 40px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-about-text p {
    font-size: 41px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-about-text p {
    font-size: 35px;
  }
}
@media (max-width: 767px) {
  .creative-about-text p {
    font-size: 29px;
  }
}
.creative-about-text p span {
  padding-left: 150px;
  display: inline-block;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-about-text p span {
    padding-left: 0;
  }
}

.creative-brand-item {
  text-align: center;
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-about-area {
    padding-top: 120px;
  }
}
@media (max-width: 767px) {
  .studio-about-area {
    padding-top: 60px;
    padding-bottom: 100px;
  }
}
.studio-about-wrap {
  padding-left: 195px;
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .studio-about-wrap {
    padding-left: 160px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .studio-about-wrap {
    padding-left: 60px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-about-wrap {
    padding-left: 0;
  }
}
.studio-about-title-box {
  padding-left: 110px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-about-title-box {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .studio-about-title-box {
    margin-bottom: 40px;
  }
}
.studio-about-content {
  padding-left: 45px;
  padding-bottom: 150px;
  padding-right: 90px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .studio-about-content {
    padding-right: 55px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-about-content {
    padding-left: 30px;
    padding-bottom: 0;
    padding-right: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-about-content {
    padding-right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-about-content {
    padding-left: 0;
    padding-bottom: 0;
    padding-right: 0;
  }
}
.studio-about-content p {
  font-weight: 500;
  font-size: 20px;
  line-height: 1.4;
  color: #f9f4e8;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-about-content p {
    font-size: 18px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-about-content p {
    font-size: 16px;
  }
  .studio-about-content p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-about-content p {
    font-size: 18px;
  }
}
@media (max-width: 767px) {
  .studio-about-content p {
    font-size: 19px;
  }
}
.studio-about-content.about-us-2 p {
  color: var(--tp-common-black-10);
}
.studio-about-thumb.thumb-1 {
  height: 580px;
  width: 460px;
  overflow: hidden;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-about-thumb.thumb-1 {
    width: 100%;
    height: 400px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-about-thumb.thumb-1 {
    width: 100%;
    height: 300px;
  }
}
@media (max-width: 767px) {
  .studio-about-thumb.thumb-1 {
    height: 300px;
    width: 100%;
    margin-bottom: 30px;
  }
}
.studio-about-thumb.thumb-1 img {
  margin-top: -20px;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-about-area {
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-about-area {
    padding-bottom: 0px;
  }
}
.ai-about-thumb {
  position: relative;
}
.ai-about-thumb.thumb-1 {
  margin-top: 190px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-about-thumb.thumb-1 {
    margin-top: 0;
    margin-right: 20px;
  }
}
.ai-about-thumb.thumb-2 {
  margin-left: -190px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-about-thumb.thumb-2 {
    margin-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-about-thumb-box {
    margin-bottom: 30px;
  }
}
.ai-about-thumb.tp--hover-img canvas {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  position: absolute;
}
.ai-about-thumb img {
  width: 100%;
  display: block;
  object-fit: cover;
}
.ai-about-right {
  margin-left: 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-about-right {
    margin-left: 20px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-about-right {
    margin-left: 0px;
  }
}
.ai-about-title-box p {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.56;
  color: var(--tp-common-white);
}
.ai-about-list ul li {
  position: relative;
  padding-left: 90px;
  list-style-type: none;
  margin-bottom: 50px;
}
@media (max-width: 767px) {
  .ai-about-list ul li {
    padding-left: 75px;
  }
}
.ai-about-list ul li > span {
  position: absolute;
  top: -16px;
  left: 0;
  line-height: 1;
}
.ai-about-list ul li > span > span {
  position: relative;
  display: inline-block;
  line-height: 1;
}
.ai-about-list ul li > span > span i {
  height: 60px;
  width: 60px;
  transition: 0.3s;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  background-color: #221939;
}
.ai-about-list ul li > span > span svg {
  position: absolute;
  top: 50%;
  left: 0;
  right: 0;
  margin: 0 auto;
  transform: translateY(-50%);
  color: var(--tp-common-cream-2);
  transition: 0.3s;
}
.ai-about-list ul li p {
  font-weight: 600;
  font-size: 20px;
  line-height: 1.2;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .ai-about-list ul li p {
    font-size: 17px;
  }
}
.ai-about-list ul li:hover span span i {
  transform: scale(1.1);
  background-color: var(--tp-common-cream-2);
}
.ai-about-list ul li:hover span span svg {
  color: var(--tp-common-black);
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.ar-about-thumb {
  margin-left: 130px;
  display: inline-block;
  height: 500px;
  width: 400px;
  overflow: hidden;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-about-thumb {
    margin-left: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-about-thumb {
    margin-left: 0;
    width: auto;
  }
}
@media (max-width: 767px) {
  .ar-about-thumb {
    margin-left: 0;
    width: auto;
    margin-bottom: 40px;
  }
}
.ar-about-thumb img {
  margin-top: -60px;
}
.ar-about-shape {
  position: absolute;
  bottom: 0;
  left: -62%;
  z-index: -1;
  max-width: inherit;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-shape {
    left: 0;
  }
}
.ar-about-title-sm {
  font-weight: 400;
  font-size: 36px;
  line-height: 1.17;
  margin-bottom: 15px;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .ar-about-title-sm {
    font-size: 33px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-about-title-sm {
    font-size: 32px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-about-title-sm {
    font-size: 27px;
  }
}
@media (max-width: 767px) {
  .ar-about-title-sm {
    font-size: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-title-wrap {
    margin-bottom: 0;
  }
}
.ar-about-content {
  margin-bottom: 40px;
  padding-right: 80px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-content {
    padding-right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-content {
    margin-top: 40px;
  }
}
.ar-about-content p {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.44;
  margin-right: 80px;
  margin-bottom: 40px;
  letter-spacing: -0.01em;
  color: rgba(20, 20, 20, 0.6);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .ar-about-content p {
    margin-right: 50px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-content p {
    margin-right: 0px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-about-content p {
    font-size: 17px;
  }
}
.ar-about-exp-box {
  margin-left: -30px;
  padding: 30px;
  background-position: bottom;
  background-repeat: no-repeat;
  display: inline-block;
  border: 1px solid rgba(20, 20, 20, 0.06);
  border-top: 4px solid var(--tp-common-red-2);
}
@media (max-width: 767px) {
  .ar-about-exp-box {
    width: 100%;
  }
}
.ar-about-exp-box span {
  font-size: 15px;
  line-height: 1.2;
  margin-bottom: 17px;
  display: inline-block;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: var(--tp-common-red-2);
  font-family: var(--tp-ff-clash-medium);
}
.ar-about-exp-box h4 {
  font-size: 160px;
  line-height: 0.69;
  margin-bottom: 0;
  text-transform: uppercase;
  color: var(--tp-common-red-2);
  font-family: var(--tp-ff-clash-semibold);
}
.ar-about-us-4-hero-ptb {
  padding-top: 195px;
  padding-bottom: 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-about-us-4-hero-ptb {
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-us-4-hero-ptb {
    padding-bottom: 40px;
  }
}
@media (max-width: 767px) {
  .ar-about-us-4-hero-ptb {
    padding-top: 150px;
  }
}
.ar-about-us-4-hero-ptb.pb-70 {
  padding-bottom: 60px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-us-4-hero-ptb.pb-70 {
    padding-bottom: 40px;
  }
}
.ar-about-us-4-title {
  color: #111013;
  font-size: 100px;
  font-weight: 800;
  line-height: 1;
  margin-bottom: 50px;
  letter-spacing: -4px;
  text-transform: uppercase;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-about-us-4-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-us-4-title {
    font-size: 70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-us-4-title-box {
    flex-wrap: wrap;
    justify-content: start !important;
  }
}
.ar-about-us-4-title-box p {
  color: #111013;
  font-size: 18px;
  font-weight: 400;
  line-height: 26px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-us-4-title-box p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-us-4-title-box p {
    padding-top: 20px;
  }
}
.ar-about-us-4-title-box .tp-section-subtitle {
  margin-right: 15px;
}
.ar-about-us-4-title-box .ar-about-us-4-icon {
  margin-right: 75px;
}
.ar-about-us-4-shape {
  position: absolute;
  top: 31%;
  right: 10%;
}
@media (max-width: 767px) {
  .ar-about-us-4-shape {
    display: none;
  }
}
.ar-about-us-4-text-warp.title-black-color .ar-about-us-4-text-title {
  color: #111013;
}
.ar-about-us-4-text-title {
  font-size: 200px;
  font-weight: 800;
  letter-spacing: -8px;
  text-transform: uppercase;
  color: rgba(249, 244, 232, 0.1);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-about-us-4-text-title {
    font-size: 145px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-about-us-4-text-title {
    font-size: 90px;
    letter-spacing: -5px;
  }
}
.ar-about-funfact-color .crp-hero-funfact-line {
  background-color: var(--tp-common-red-3);
}
.ar-about-funfact-color .crp-hero-funfact-line::before {
  background-color: var(--tp-common-red-3);
}
.ar-about-funfact-top-content h4 {
  font-size: 34px;
  font-weight: 800;
  line-height: 36px;
  margin-bottom: 35px;
  letter-spacing: -0.68px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.ar-about-funfact-item:not(:last-of-type) {
  margin-bottom: 20px;
  padding-bottom: 20px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.ar-about-funfact-item-icon {
  margin-right: 10px;
}
.ar-about-funfact-item-icon span {
  display: grid;
  height: 54px;
  width: 54px;
  border-radius: 50%;
  place-content: center;
  border: 1px solid rgba(255, 255, 255, 0.14);
}
.ar-about-funfact-item-content p {
  margin: 0;
  font-size: 13px;
  font-weight: 500;
  margin-bottom: 3px;
  color: var(--tp-common-white);
}
.ar-about-funfact-item-content a {
  font-size: 18px;
  font-weight: 700;
  color: var(--tp-common-white);
}
.ar-about-funfact-item-bottom p {
  font-size: 13px;
  font-weight: 500;
  line-height: 1;
  color: rgba(255, 255, 255, 0.7);
}
.ar-about-funfact-item-bottom p span {
  font-weight: 600;
  color: var(--tp-common-white);
}

@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-about-area {
    padding-top: 80px;
  }
}
@media (max-width: 767px) {
  .crp-about-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.crp-about-exp {
  height: 250px;
  width: 250px;
  border-radius: 50%;
  display: inline-block;
  background-color: #FFEB53;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-about-exp {
    height: 155px;
    width: 155px;
    display: grid;
    margin-bottom: 20px;
    place-content: center;
  }
}
.crp-about-exp-item span {
  font-weight: 600;
  font-size: 250px;
  line-height: 0.5;
  color: #2A4C3A;
  margin-top: 35px;
  margin-bottom: 10px;
  display: inline-block;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-about-exp-item span {
    font-size: 80px;
    margin-top: 0;
    margin-bottom: 0;
  }
}
.crp-about-exp-item i {
  display: block;
  font-weight: 500;
  font-size: 28px;
  line-height: 0.86;
  color: #17312f;
  font-style: normal;
  font-family: var(--tp-ff-teko);
}
.crp-about-btn-box {
  flex: 0 0 auto;
  margin-right: 80px;
  margin-top: 7px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-about-btn-box {
    margin-right: 40px;
  }
}
@media (max-width: 767px) {
  .crp-about-btn-box {
    margin-right: 0;
    margin-bottom: 20px;
  }
}
.crp-about-text p {
  max-width: 345px;
  font-weight: 500;
  font-size: 18px;
  line-height: 1.56;
  color: rgba(255, 255, 230, 0.8);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-about-text p {
    max-width: 100%;
    font-size: 16px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-about-text p {
    max-width: 100%;
    font-size: 16px;
  }
}
.crp-about-right {
  padding-left: 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-about-right {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .crp-about-right .tp-section-title-teko {
    margin-bottom: 20px;
  }
}
.crp-about-shape {
  position: absolute;
  top: -16%;
  left: 13%;
  z-index: -1;
}
@media (max-width: 767px) {
  .crp-about-bottom-wrap {
    flex-wrap: wrap;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-about-left .tp-section-subtitle-teko {
    margin-bottom: 20px;
  }
}
.crp-about-3-hero-ptb {
  padding-top: 245px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-about-3-hero-ptb {
    padding-top: 200px;
  }
}
.crp-about-3-funfact {
  padding-top: 65px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-about-3-funfact {
    padding-top: 0;
  }
}

@media (max-width: 767px) {
  .it-about-ptb {
    padding-top: 100px;
    padding-bottom: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-about-title-box {
    margin-bottom: 50px;
  }
}
.it-about-title-box p {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.44;
  color: #61616a;
  margin-bottom: 45px;
  padding-right: 40px;
}
.it-about-thumb img {
  border-radius: 12px;
  max-width: inherit;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-about-thumb img {
    max-width: 100%;
  }
}
.it-about-thumb img.img-2 {
  margin-left: -150px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-about-thumb img.img-2 {
    margin-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-about-thumb img.img-2 {
    margin-bottom: 60px;
  }
}
.it-about-thumb-inner {
  width: 360px;
  height: 500px;
  overflow: hidden;
  border-radius: 12px;
}
.it-about-thumb-inner img {
  margin-top: -100px;
  margin-left: -100px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-about-thumb-inner img {
    margin-left: 0;
    margin-top: 0;
  }
}
.it-about-info-wrap {
  position: absolute;
  display: grid;
  top: 15%;
  right: -40%;
  z-index: 2;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .it-about-info-wrap {
    right: 0;
  }
}
@media (max-width: 767px) {
  .it-about-info-wrap {
    display: none;
  }
}
.it-about-info-item {
  padding: 28px;
  margin: 6px 0;
  padding-right: 50px;
  border-radius: 12px;
  display: inline-block;
  background: #cdfaa4;
  box-shadow: inset 0 20px 40px 0 rgba(255, 255, 255, 0.45);
}
.it-about-info-item i {
  font-weight: 500;
  font-size: 60px;
  line-height: 0.7;
  font-style: normal;
  margin-right: 20px;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-platform);
}
.it-about-info-item p {
  font-weight: 500;
  font-size: 17px;
  margin-bottom: 0;
  line-height: 1.35;
  color: var(--tp-common-black-10);
}
.it-about-shape-1 {
  position: absolute;
  bottom: 0;
  left: 0;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .it-about-shape-1 {
    bottom: -7%;
  }
}
.it-about-shape-2 {
  position: absolute;
  top: -5%;
  right: 0;
  z-index: 2;
}
@media (max-width: 767px) {
  .it-about-shape-2 {
    display: none;
  }
}

@media (max-width: 767px) {
  .st-about-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
.st-about-shape {
  position: absolute;
  bottom: 20%;
  left: 10%;
}
@media (max-width: 767px) {
  .st-about-shape {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-about-wrap {
    padding-left: 0;
    padding-bottom: 40px;
  }
}
.st-about-title {
  font-size: 36px;
  font-weight: 600;
  line-height: 48px;
  letter-spacing: -0.36px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media (max-width: 767px) {
  .st-about-title {
    font-size: 30px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .st-about-title br {
    display: none;
  }
}
.st-about-card {
  padding: 40px;
  width: 375px;
  border-radius: 15px;
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .st-about-card {
    width: 100%;
  }
}
.st-about-card-tag span {
  color: #494949;
  font-size: 17px;
  font-weight: 400;
  border-radius: 16px;
  padding: 2px 11px;
  display: inline-block;
  letter-spacing: -0.34px;
  text-transform: uppercase;
  border: 1px solid rgba(69, 48, 48, 0.15);
}
.st-about-card-btn a {
  width: 36px;
  height: 36px;
  display: grid;
  border-radius: 50%;
  place-content: center;
  color: var(--tp-common-white);
  background-color: var(--tp-common-brown);
}
.st-about-card-bottom span {
  font-size: 18px;
  font-weight: 600;
  line-height: 24px;
  display: inline-block;
  letter-spacing: -0.36px;
  text-transform: uppercase;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
.st-about-card-thumb img {
  animation: roteted 6s linear infinite;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-about-box {
    padding-bottom: 40px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-about-box .tp-about-funcact-wrap {
    margin-left: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-about-box .tp-about-funcact-wrap .tp-about-avater-info p br {
    display: none;
  }
}
.st-about-box .tp-about-funcact-item span {
  font-weight: 600;
  color: var(--tp-common-brown);
}
.st-about-box .tp-about-avater-info {
  border-color: rgba(69, 48, 48, 0.15);
}
.st-about-thumb-box img {
  border-radius: 15px;
}

@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-about-ptb {
    padding-top: 120px;
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
.pp-about-shape {
  position: absolute;
  right: 0;
  bottom: 30%;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-shape {
    bottom: 0;
  }
}
@media (max-width: 767px) {
  .pp-about-shape {
    display: none;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .pp-about-shape {
    display: block;
  }
}
.pp-about-left {
  padding-left: 60px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-left {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-left {
    padding-bottom: 30px;
  }
}
.pp-about-wrap {
  padding-left: 115px;
  display: flex;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-wrap {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .pp-about-heading {
    padding-bottom: 35px;
  }
}
.pp-about-bottom-btn {
  margin-right: 45px;
}
@media (max-width: 767px) {
  .pp-about-bottom-btn {
    margin-right: 30px;
  }
}
.pp-about-bottom-btn a span {
  height: 66px;
  width: 40px;
  display: grid;
  place-content: center;
  text-align: center;
  border-radius: 30px;
  color: var(--tp-common-white);
  display: inline-block;
  border: 1px solid rgba(222, 213, 191, 0.1);
}
.pp-about-bottom-btn a span svg {
  -webkit-animation: scroll_anim 3s infinite;
  animation: scroll_anim 3s infinite;
}
.pp-about-content p {
  font-size: 20px;
  font-weight: 500;
  margin-bottom: 40px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-about-content p {
    font-size: 18px;
  }
}
@media (max-width: 767px) {
  .pp-about-content p {
    font-size: 16px;
  }
}
@media (max-width: 767px) {
  .pp-about-content p br {
    display: none;
  }
}

.pp-about-me-ptb {
  padding-top: 210px;
}
@media (max-width: 767px) {
  .pp-about-me-ptb {
    padding-top: 170px;
  }
}
.pp-about-me-shape .shape-left {
  position: absolute;
  bottom: -100%;
  left: 15%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-about-me-shape .shape-left {
    left: 7%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-about-me-shape .shape-left {
    left: 2px;
    bottom: -72%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-about-me-shape .shape-left {
    left: 0;
    bottom: -52%;
  }
}
@media (max-width: 767px) {
  .pp-about-me-shape .shape-left {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-about-me-shape .shape-left img {
    max-width: 85%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-about-me-shape .shape-left img {
    max-width: 75%;
  }
}
.pp-about-me-shape .shape-right {
  position: absolute;
  bottom: -100%;
  right: 9%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-about-me-shape .shape-right {
    right: 0%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-about-me-shape .shape-right {
    right: -5%;
    bottom: -69%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-about-me-shape .shape-right {
    right: -10%;
    bottom: -48%;
  }
}
@media (max-width: 767px) {
  .pp-about-me-shape .shape-right {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-about-me-shape .shape-right img {
    max-width: 85%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-about-me-shape .shape-right img {
    max-width: 75%;
  }
}
.pp-about-me-title {
  margin: 0;
  line-height: 0.4;
  font-size: 280px;
  font-weight: 600;
  white-space: nowrap;
  letter-spacing: -14px;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-yellow-1);
}
@media only screen and (min-width: 1701px) and (max-width: 1800px), only screen and (min-width: 1600px) and (max-width: 1700px) {
  .pp-about-me-title {
    font-size: 220px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .pp-about-me-title {
    font-size: 200px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-about-me-title {
    font-size: 180px;
    letter-spacing: -8px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-about-me-title {
    font-size: 150px;
    letter-spacing: -6px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-about-me-title {
    font-size: 110px;
    letter-spacing: -4px;
  }
}
@media (max-width: 767px) {
  .pp-about-me-title {
    font-size: 100px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-hero-left {
    padding-top: 50px;
    padding-bottom: 70px;
  }
}
@media (max-width: 767px) {
  .pp-about-me-hero-left {
    padding-top: 30px;
    padding-bottom: 20px;
  }
}
.pp-about-me-hero-left a {
  display: inline-block;
  margin-bottom: 20px;
}
.pp-about-me-hero-left .pp-hero-text {
  margin-bottom: 25px;
  display: inline-block;
  text-transform: inherit;
}
.pp-about-me-hero-left p {
  margin: 0;
  font-size: 16px;
  font-weight: 500;
  line-height: 1;
  padding-left: 25px;
  position: relative;
  color: var(--tp-common-white);
}
.pp-about-me-hero-left p::before {
  position: absolute;
  content: "";
  top: 6px;
  left: 0px;
  width: 8px;
  height: 8px;
  border-radius: 50%;
  background-color: var(--tp-common-yellow-1);
}
.pp-about-me-hero-left p::after {
  position: absolute;
  content: "";
  top: 0px;
  left: -6px;
  width: 20px;
  height: 20px;
  border-radius: 50%;
  background-color: rgba(255, 246, 105, 0.1);
  animation: animate-pulse-2 3s linear infinite;
}
.pp-about-me-thumb {
  margin-left: -185px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-thumb {
    margin-left: 0;
  }
}
.pp-about-me-thumb img {
  max-width: inherit;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-thumb img {
    max-width: 100%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-social {
    padding-top: 0;
  }
}
.pp-about-me-social .tp-footer-widget-social a {
  background-color: transparent;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.pp-about-me-social .tp-footer-widget-social a:hover {
  color: #2F1F19;
  background-color: var(--tp-common-white);
}
.pp-about-me-skill.pp-skill-list-wrap {
  padding-left: 20px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-skill.pp-skill-list-wrap {
    padding-left: 0;
  }
}
.pp-about-me-skill.pp-skill-list-wrap .pp-skill-list ul li {
  color: rgba(255, 255, 255, 0.7);
}
.pp-about-me-skill.pp-skill-list-wrap .pp-skill-list-title {
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-about-me-skill.pp-skill-list-wrap .pp-skill-list-title {
    font-size: 35px;
  }
}
.pp-about-me-tool-item {
  padding: 10px;
  border-radius: 260px;
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.pp-about-me-tool-item-icon {
  margin-right: 14px;
}
.pp-about-me-tool-item-icon span {
  width: 100px;
  height: 100px;
  display: grid;
  place-content: center;
  border-radius: 60px;
  background: #1A1B1E;
  backdrop-filter: blur(20px);
}
.pp-about-me-tool-item-icon span img {
  mix-blend-mode: luminosity;
}
.pp-about-me-tool-item-content span {
  display: inline-block;
  font-size: 46px;
  font-weight: 500;
  margin-bottom: 10px;
  letter-spacing: -0.46px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
.pp-about-me-tool-item-content p {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  margin: 0;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.4);
}
@media (max-width: 767px) {
  .pp-about-me-experience-item {
    padding-bottom: 55px;
  }
}
.pp-about-me-experience-item p {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  margin: 0;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.4);
}
.pp-about-me-experience-title {
  font-size: 46px;
  font-weight: 500;
  line-height: 1;
  margin: 19px 0 11px;
  letter-spacing: -0.46px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media (max-width: 767px) {
  .pp-about-me-experience-title {
    font-size: 40px;
  }
}
.pp-about-me-recognitions .studio-award-item span {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  margin: 0;
  text-transform: uppercase;
  font-family: var(--tp-ff-body);
  color: rgba(255, 255, 255, 0.4);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-service-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-service-item {
    padding-bottom: 50px;
  }
}
@media (max-width: 767px) {
  .pp-about-me-service-heading {
    margin-bottom: 30px;
  }
}
.pp-about-me-service-subtitle {
  font-size: 18px;
  font-weight: 500;
  line-height: 20px;
  margin-right: 20px;
  display: inline-block;
  letter-spacing: -0.36px;
  color: var(--tp-common-white);
}
.pp-about-me-service-title {
  font-size: 80px;
  font-weight: 400;
  line-height: 1;
  letter-spacing: -0.8px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-about-me-service-title {
    font-size: 65px;
    margin-bottom: 15px;
  }
}

.tp-about-5-title-box {
  display: inline-block;
}
.tp-about-5-title-box p {
  text-align: left;
  max-width: 245px;
  font-size: 15px;
  font-weight: 400;
  line-height: 22px;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-poppins);
  position: absolute;
  bottom: 15px;
  left: 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-about-5-title-box p {
    bottom: 3px;
    left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-5-title-box p {
    position: static;
    text-align: center;
    margin: 0 auto;
    margin-top: 30px;
  }
}
.tp-about-5-subtitle {
  font-size: 14px;
  font-weight: 600;
  line-height: 1.3;
  text-transform: uppercase;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-poppins);
  display: inline-block;
  position: absolute;
  top: 50px;
  left: 80px;
  z-index: 5;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-about-5-subtitle {
    top: 40px;
    left: 0px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-about-5-subtitle {
    position: static;
    margin-bottom: 20px;
  }
}

@media (max-width: 767px) {
  .creative-about-2-style.creative-about-area {
    padding-top: 60px;
    padding-bottom: 60px;
  }
}

/*----------------------------------------*/
/*  7.3 Banner Css
/*----------------------------------------*/
.tp-banner-img {
  height: 900px;
  overflow: hidden;
  border-top: 16px solid var(--tp-common-red-3);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-banner-img {
    height: 700px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-banner-img {
    height: 500px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-banner-img {
    height: 340px;
  }
}
@media (max-width: 767px) {
  .tp-banner-img {
    height: 200px;
  }
}
.tp-banner-img.pink-style {
  border-color: var(--tp-common-red);
}
.tp-banner-img img {
  margin-top: -370px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-banner-img img {
    margin-top: -70px;
  }
}
@media (max-width: 767px) {
  .tp-banner-img img {
    margin-top: -30px;
    height: 400px;
    object-fit: cover;
  }
}

.studio-hero-banner {
  height: 900px;
  overflow: hidden;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .studio-hero-banner {
    height: 700px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-hero-banner {
    height: 600px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-hero-banner {
    height: 400px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-hero-banner {
    height: 320px;
  }
}
@media (max-width: 767px) {
  .studio-hero-banner {
    height: 150px;
  }
}
.studio-hero-banner img {
  margin-top: -340px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-hero-banner img {
    margin-top: -100px;
  }
}
@media (max-width: 767px) {
  .studio-hero-banner img {
    margin-top: -30px;
  }
}
@media (max-width: 767px) {
  .studio-hero-banner-text {
    flex-wrap: wrap;
  }
}
.studio-hero-banner-text span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  color: #f9f4e8;
  text-transform: uppercase;
  font-family: var(--tp-ff-clash-medium);
}
@media (max-width: 767px) {
  .studio-hero-banner-text span {
    margin-right: 20px;
    margin-bottom: 10px;
  }
}
.studio-hero-banner.about-us-2 {
  height: 860px;
}
@media (max-width: 767px) {
  .studio-hero-banner-area {
    padding-bottom: 50px;
  }
}

.ar-banner-wrap {
  height: 820px;
  overflow: hidden;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .ar-banner-wrap {
    height: 720px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-banner-wrap {
    height: 580px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-banner-wrap {
    height: 470px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-banner-wrap {
    height: 370px;
  }
}
@media (max-width: 767px) {
  .ar-banner-wrap {
    height: 250px;
  }
}
.ar-banner-wrap img {
  margin-top: -150px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-banner-wrap img {
    margin-top: -50px;
  }
}
@media (max-width: 767px) {
  .ar-banner-wrap img {
    margin-top: -20px;
  }
}
.ar-banner-wrap.about-us-4 {
  height: 900px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .ar-banner-wrap.about-us-4 {
    height: 720px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-banner-wrap.about-us-4 {
    height: 580px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-banner-wrap.about-us-4 {
    height: 470px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-banner-wrap.about-us-4 {
    height: 370px;
  }
}
@media (max-width: 767px) {
  .ar-banner-wrap.about-us-4 {
    height: 130px;
  }
}
.ar-banner-shape img {
  max-width: inherit;
}

.crp-banner-wrap {
  margin-top: -115px;
  height: 860px;
  overflow: hidden;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px) {
  .crp-banner-wrap {
    height: 700px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-banner-wrap {
    height: 600px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-banner-wrap {
    height: 500px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-banner-wrap {
    margin-top: 0;
    height: 400px;
  }
}
@media (max-width: 767px) {
  .crp-banner-wrap {
    margin-top: 0;
    height: 200px;
  }
}
.crp-banner-wrap img {
  margin-top: -130px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-banner-wrap img {
    margin-top: -50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-banner-wrap img {
    margin-top: -20px;
  }
}
@media (max-width: 767px) {
  .crp-banner-wrap img {
    margin-top: -10px;
  }
}
.crp-banner-style .crp-banner-wrap {
  margin-top: 0;
}

.st-banner-wrap {
  height: 640px;
  overflow: hidden;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .st-banner-wrap {
    height: 580px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-banner-wrap {
    height: 470px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .st-banner-wrap {
    height: 370px;
  }
}
@media (max-width: 767px) {
  .st-banner-wrap {
    height: 250px;
  }
}
.st-banner-wrap .w-100 {
  margin-top: -150px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .st-banner-wrap .w-100 {
    margin-top: -50px;
  }
}
@media (max-width: 767px) {
  .st-banner-wrap .w-100 {
    margin-top: -20px;
  }
}
.st-banner-text-shape {
  position: absolute;
  bottom: -1px;
  right: 21.2%;
}
@media (max-width: 767px) {
  .st-banner-text-shape {
    display: none;
  }
}
.st-banner-text-shape .crp-text-shape-wrap {
  top: auto;
  right: 25%;
  bottom: -75px;
}
.st-banner-text-shape .crp-text-shape-wrap .crp-text-shape-2 {
  top: 7px;
  left: 6px;
}

.pp-banner-wrap {
  margin-top: 0;
  height: 930px;
  overflow: hidden;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .pp-banner-wrap {
    height: 800px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-banner-wrap {
    height: 550px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-banner-wrap {
    height: 500px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-banner-wrap {
    height: 380px;
  }
}
@media (max-width: 767px) {
  .pp-banner-wrap {
    height: 200px;
  }
}
.pp-banner-wrap img {
  margin-top: -50px;
  opacity: 0.6;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-banner-wrap img {
    margin-top: -10px;
  }
}
@media (max-width: 767px) {
  .pp-banner-wrap img {
    margin-top: 0;
  }
}

/*----------------------------------------*/
/*  7.4 Text-slide Css
/*----------------------------------------*/
.tp-text-slide-title {
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-text-slide-title::after {
  content: "";
  height: 6px;
  width: 6px;
  margin-left: 30px;
  border-radius: 50%;
  display: inline-block;
  transform: translateY(-4px);
  background-color: var(--tp-common-white);
}
.tp-text-slide-wrapper {
  padding: 24px 0 20px 0;
}
.tp-text-slide-wrapper .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.tp-text-slide-wrapper.pink-bg {
  background-color: var(--tp-common-red);
}
.tp-text-slide-active .swiper-slide {
  width: auto;
}
.tp-text-slide-active.about-us-2 .swiper-slide {
  margin-right: 6px !important;
}

.des-text-item span {
  position: relative;
  padding-right: 80px;
  margin-right: 40px;
  font-weight: 600;
  font-size: 300px;
  line-height: 1;
  white-space: nowrap;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-mango);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-text-item span {
    font-size: 240px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-text-item span {
    font-size: 235px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-text-item span {
    font-size: 200px;
  }
}
@media (max-width: 767px) {
  .des-text-item span {
    font-size: 100px;
  }
}
.des-text-item span::after {
  position: absolute;
  content: "";
  top: 75px;
  right: 0;
  width: 40px;
  height: 40px;
  border-radius: 50%;
  background-color: #fb4566;
}
@media (max-width: 767px) {
  .des-text-item span::after {
    top: 24px;
  }
}
.des-text-item.gradient-bulet span::after {
  background: linear-gradient(180deg, #FAAC60 0%, #E44C2A 100%);
}
.des-text-item.yellow-bulet span::after {
  background: linear-gradient(180deg, #FCCE03 0%, #EF6002 100%);
}
.des-text-item.paste-bulet span::after {
  background: linear-gradient(180deg, #25F4D6 0%, #0FA959 100%);
}
.des-text-item.pink-bulet span::after {
  background: linear-gradient(180deg, #FFCFCF 0%, #FE5E5E 100%);
}
.des-text-item.sm {
  margin-bottom: 160px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .des-text-item.sm {
    margin-bottom: 80px;
  }
}
.des-text-item.sm span {
  font-weight: 300;
  font-size: 160px;
  line-height: 1;
  transition: 0.3s;
  text-transform: capitalize;
  color: rgba(249, 244, 232, 0.1);
  font-family: var(--tp-ff-mango-light);
}
@media (max-width: 767px) {
  .des-text-item.sm span {
    font-size: 115px;
  }
}
.des-text-item.sm span::after {
  top: 50px;
  opacity: 0.1;
  transition: 0.3s;
}
@media (max-width: 767px) {
  .des-text-item.sm span::after {
    top: 30px;
  }
}
.des-text-moving-bottom {
  transform: translateY(-45px);
}
@media (max-width: 767px) {
  .des-text-moving-bottom {
    transform: translateY(0px);
  }
}
.des-text-moving-top.active .des-text-item.sm span {
  color: var(--tp-common-cream);
}
.des-text-moving-top.active .des-text-item.sm span::after {
  opacity: 1;
}
.des-text-title {
  font-size: 56px;
  font-weight: 400;
  line-height: 1;
  text-align: center;
  margin-bottom: 10px;
  display: inline-block;
  padding: 0px 70px;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-mango);
  background-color: var(--tp-common-black-4);
}
@media (max-width: 767px) {
  .des-text-title {
    padding: 0;
    font-size: 50px;
  }
}
.des-text-title.sm {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.01em;
  font-family: var(--tp-ff-inter);
  color: rgba(249, 244, 232, 0.7);
}
.des-text-title-box {
  padding-bottom: 145px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .des-text-title-box {
    padding-bottom: 90px;
  }
}
@media (max-width: 767px) {
  .des-text-title-box {
    padding-bottom: 90px;
  }
}
.des-text-title-box p {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.2;
  letter-spacing: -0.01em;
  color: var(--tp-common-cream);
}
@media (max-width: 767px) {
  .des-text-title-box p {
    font-size: 15px;
  }
}
.des-text-title-wrap {
  position: relative;
}
.des-text-title-wrap::after {
  position: absolute;
  top: 42%;
  left: 0;
  right: 0;
  text-align: center;
  margin: 0 auto;
  content: "";
  height: 1px;
  width: calc(100% - 200px);
  z-index: -1;
  background-color: rgba(249, 244, 232, 0.1);
  transform: translateY(-50%);
}
.des-text-about-us-wrap {
  margin-bottom: 45px;
}
.des-text-about-us-wrap .des-text-title {
  margin-bottom: -5px;
  padding: 0px 24px;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-text-moving-area {
    padding-top: 0;
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-text-moving-area {
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-text-moving-area {
    padding-bottom: 90px;
  }
}
@media (max-width: 767px) {
  .des-text-moving-area {
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-text-moving-2-area {
    padding-top: 0;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-text-moving-2-area {
    padding-bottom: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-text-moving-2-area {
    padding-top: 0;
    padding-bottom: 0;
  }
}
@media (max-width: 767px) {
  .des-text-moving-2-area {
    padding-top: 100px;
  }
}

.creative-text-item {
  display: flex;
  align-items: center;
}
.creative-text-item span {
  font-weight: 400;
  font-size: 200px;
  line-height: 0.8;
  color: #e0eeee;
  white-space: nowrap;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-dirtyline);
}
@media (max-width: 767px) {
  .creative-text-item span {
    font-size: 120px;
  }
}
.creative-text-item span::after {
  content: "";
  height: 8px;
  width: 210px;
  margin: 0 20px;
  display: inline-block;
  transform: translateY(-50px);
  background-color: #e0eeee;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-text-slider-area {
    margin-bottom: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-text-slider-area {
    padding-top: 0;
    margin-bottom: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-text-slider-area .creative-text-item span {
    font-size: 160px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-text-slider-area .creative-text-item span {
    font-size: 160px;
  }
}

.ai-text-slider span {
  font-weight: 800;
  font-size: 140px;
  line-height: 0.76;
  letter-spacing: -0.04em;
  color: rgba(255, 255, 255, 0.02);
  -webkit-text-stroke: 2px rgba(255, 255, 255, 0.197);
  text-shadow: inset 0 -6px 12px 0 rgba(255, 255, 255, 0.14);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-text-slider span {
    font-size: 100px;
  }
}
.ai-text-slider img {
  margin: 0 40px;
  transform: translateY(8px);
}
.ai-text-slider-active {
  padding: 50px 0;
}
.ai-text-slider-active .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.ai-text-slider-active .swiper-slide {
  width: auto;
}

.crp-text-slider-style.ar-brand-style .tp-brand-title {
  font-weight: 500;
  font-size: 40px;
  line-height: 1;
  color: #2A4C3A;
  letter-spacing: -0.01em;
  text-transform: capitalize;
  font-family: var(--tp-ff-teko);
}
.crp-text-slider-style.ar-brand-style .tp-brand-title::after {
  background-color: #2A4C3A;
}
.crp-text-slider-item span {
  font-weight: 600;
  font-size: 240px;
  line-height: 0.46;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  font-family: var(--tp-ff-teko);
  color: rgba(255, 253, 225, 0.1);
}
.crp-text-slider-item.stroke-text span {
  color: transparent;
  -webkit-text-stroke: 2px rgba(255, 253, 225, 0.1);
}
.crp-text-slider-active {
  padding-top: 160px;
  padding-bottom: 150px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-text-slider-active {
    padding-top: 70px;
  }
}
@media (max-width: 767px) {
  .crp-text-slider-active {
    padding-top: 55px;
    padding-bottom: 60px;
  }
}
.crp-text-slider-active .swiper-slide {
  width: auto;
}
.crp-text-slider-active .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.crp-text-slider-active.app-text-slider-color {
  padding-top: 90px;
}
.crp-text-slider-active.app-text-slider-color .swiper-wrapper .crp-text-slider-item.stroke-text span {
  color: transparent;
  -webkit-text-stroke: 2px rgba(25, 25, 25, 0.9);
}
.crp-text-slider-active.app-text-slider-color .swiper-wrapper .crp-text-slider-item span {
  font-size: 160px;
  opacity: 0.1;
  color: #191919;
  letter-spacing: -3.2px;
  font-family: var(--tp-ff-clash-semibold);
}
.crp-text-shape-wrap {
  position: absolute;
  top: 8%;
  right: 18%;
  z-index: 55;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-text-shape-wrap {
    top: 0;
  }
}
.crp-text-shape-wrap.app {
  top: -16%;
}
.crp-text-shape-2 {
  position: absolute;
  top: 16px;
  left: 16px;
  animation: rotate2 15s linear infinite;
}

.pp-text-slider-title {
  font-size: 30px;
  font-weight: 400;
  padding-right: 35px;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-yellow-1);
}

.tp-text-slider-5-style .tp-text-slider-4-wrap {
  padding: 25px 0;
  background-color: var(--tp-coffe-2);
}
.tp-text-slider-5-style .tp-text-slider-4-item span {
  color: var(--tp-cream-2);
  font-size: 34px;
  text-transform: capitalize;
}

.tp-text-slider-4-item span {
  font-size: 40px;
  font-weight: 500;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-playfair);
  margin-right: 30px;
  padding: 5px 0;
}

.slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}

/*----------------------------------------*/
/*  7.5 Service Css
/*----------------------------------------*/
@media (max-width: 767px) {
  .tp-service-area {
    padding-top: 80px;
  }
}
@media (max-width: 767px) {
  .tp-service-thumb img {
    width: 100%;
  }
}
.tp-service-item {
  padding: 40px;
  border-top: 1px dashed #CACACA;
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-service-item {
    padding: 40px 15px;
  }
}
.tp-service-item:last-child {
  border-bottom: 1px dashed #CACACA;
}
.tp-service-title-box {
  padding: 0px 220px;
  padding-bottom: 35px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-service-title-box {
    padding: 0 40px;
    padding-bottom: 35px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-title-box {
    padding: 0px 40px;
    padding-bottom: 35px;
  }
}
@media (max-width: 767px) {
  .tp-service-title-box {
    padding: 0 15px;
    padding-bottom: 35px;
  }
}
.tp-service-number {
  padding-left: 180px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-number {
    padding: 0;
  }
}
.tp-service-number span {
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-black);
}
.tp-service-category span {
  padding: 9px 17px;
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  transition: 0.3s;
  margin-right: 5px;
  margin-bottom: 8px;
  border-radius: 20px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-black);
  border: 1px solid rgba(19, 22, 13, 0.1);
}
.tp-service-category span:hover {
  border-color: #F6F6F9;
  background-color: #F6F6F9;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-category br {
    display: none;
  }
}
@media (max-width: 767px) {
  .tp-service-category {
    margin-bottom: 30px;
  }
  .tp-service-category br {
    display: none;
  }
  .tp-service-category span {
    font-size: 12px;
  }
}
.tp-service-content .tp-section-title {
  margin-bottom: 60px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-content .tp-section-title {
    margin-bottom: 30px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-service-content .tp-section-title {
    margin-bottom: 20px;
    letter-spacing: 0;
  }
}
.tp-service-content p {
  margin-bottom: 50px;
  padding-right: 100px;
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .tp-service-content p br {
    display: none;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-service-content p {
    padding-right: 0;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-service-content p {
    padding-right: 0;
  }
  .tp-service-content p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-content p {
    font-size: 16px;
    padding-right: 0;
    margin-bottom: 20px;
  }
  .tp-service-content p br {
    display: none;
  }
}
.tp-service-content .tp-service-btn {
  margin-bottom: 90px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-content .tp-service-btn {
    margin-bottom: 50px;
  }
}
@media (max-width: 767px) {
  .tp-service-content .tp-service-btn {
    margin-bottom: 40px;
  }
}

.dgm-service-content-left {
  transition: 0.3s;
}
@media (max-width: 767px) {
  .dgm-service-content-left {
    flex-wrap: wrap;
  }
}
.dgm-service-content-left span {
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  min-width: 100px;
  transition: 0.3s;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-grotesk);
}
@media (max-width: 767px) {
  .dgm-service-content-left span {
    min-width: 100%;
    margin-bottom: 20px;
    display: inline-block;
  }
}
.dgm-service-content-left.black-text span {
  color: #111013;
  transition: none;
}
.dgm-service-content-left.black-text .dgm-service-title-sm {
  color: #111013;
  transition: none;
}
@media (max-width: 767px) {
  .dgm-service-content-right {
    flex-wrap: wrap;
  }
}
.dgm-service-content-right p {
  font-weight: 500;
  font-size: 17px;
  line-height: 1.53;
  margin-bottom: 0;
  max-width: 420px;
  letter-spacing: -0.01em;
  color: rgba(255, 255, 255, 0.7);
}
@media (max-width: 767px) {
  .dgm-service-content-right p {
    margin-bottom: 30px;
  }
  .dgm-service-content-right p br {
    display: none;
  }
}
.dgm-service-content-right.black-text p {
  color: rgba(17, 16, 19, 0.7);
}
.dgm-service-content-right.black-text .dgm-service-link {
  color: #111013;
  border-color: rgba(17, 16, 19, 0.2);
}
.dgm-service-link {
  height: 64px;
  width: 64px;
  line-height: 65px;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  color: var(--tp-common-white);
  transition: 0.3s;
  border: 1px solid rgba(255, 255, 255, 0.2);
}
.dgm-service-link span {
  width: 20px;
  height: 20px;
  left: 2px;
  overflow: hidden;
  position: relative;
  display: inline-block;
}
.dgm-service-link span svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.2s ease-out;
}
.dgm-service-link span svg:last-child {
  left: -12px;
  bottom: -12px;
  opacity: 0;
  transform: translate(0, 0);
}
.dgm-service-link:hover span svg:first-child {
  transform: translate(20px, -20px);
}
.dgm-service-link:hover span svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(13px, -13px);
}
.dgm-service-title-sm {
  font-weight: 700;
  font-size: 30px;
  line-height: 1.07;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-service-title-sm br {
    display: none;
  }
}
@media (max-width: 767px) {
  .dgm-service-title-sm {
    margin-bottom: 15px;
  }
  .dgm-service-title-sm br {
    display: none;
  }
}
.dgm-service-item {
  padding: 38px 0;
  overflow: hidden;
  border-top: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-service-item {
    padding: 38px 30px;
  }
}
@media (max-width: 767px) {
  .dgm-service-item {
    padding: 38px 15px;
  }
}
.dgm-service-item:hover .dgm-service-bg img {
  transform: scale(1.3);
  opacity: 1;
  visibility: visible;
}
.dgm-service-item:hover .dgm-service-content-left {
  transform: translateX(30px);
}
@media (max-width: 767px) {
  .dgm-service-item:hover .dgm-service-content-left {
    transform: translateX(0px);
  }
}
.dgm-service-item:hover .dgm-service-link {
  transform: translateX(-30px);
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-regular);
}
@media (max-width: 767px) {
  .dgm-service-item:hover .dgm-service-link {
    transform: translateX(0px);
  }
}
.dgm-service-bg {
  position: absolute;
  top: 0;
  left: 0;
  z-index: -1;
  width: 100%;
  height: 100%;
}
.dgm-service-bg img {
  width: 100%;
  height: 100%;
  transition: 0.4s;
  transform: scale(1);
  opacity: 0;
  visibility: hidden;
}
.dgm-service-wrap .row [class*=col-] .dgm-service-item:last-child {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.dgm-service-wrap.dgm-service-white .dgm-service-item {
  border-color: rgba(17, 16, 19, 0.1);
}
.dgm-service-wrap.dgm-service-white .dgm-service-item:hover .dgm-service-content-left.black-text span {
  color: var(--tp-common-white);
}
.dgm-service-wrap.dgm-service-white .dgm-service-item:hover .dgm-service-content-left.black-text .dgm-service-title-sm {
  color: var(--tp-common-white);
}
.dgm-service-wrap.dgm-service-white .dgm-service-item:hover .dgm-service-content-right p {
  color: rgba(255, 255, 255, 0.7);
}
.dgm-service-wrap.dgm-service-white .dgm-service-item:hover .dgm-service-content-right a {
  border-color: var(--tp-common-green-regular);
}
.dgm-service-radius {
  margin-bottom: -1px;
  border-radius: 20px 20px 0 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-service-radius {
    padding-top: 100px;
  }
}
.dgm-service-title-box.service-4-heading .tp-section-subtitle {
  text-transform: capitalize;
}

@media (max-width: 767px) {
  .creative-service-content {
    flex-wrap: wrap;
  }
}
.creative-service-content > span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  min-width: 125px;
  display: inline-block;
  letter-spacing: -0.04em;
  transform: translateY(18px);
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-service-content > span {
    min-width: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-service-content > span {
    min-width: 50px;
  }
}
@media (max-width: 767px) {
  .creative-service-content > span {
    min-width: auto;
    margin-bottom: 30px;
  }
}
.creative-service-title {
  font-weight: 400;
  font-size: 134px;
  line-height: 1;
  margin-bottom: 20px;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-service-title {
    font-size: 105px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-service-title {
    font-size: 110px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-service-title {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .creative-service-title {
    font-size: 70px;
  }
}
.creative-service-title a {
  background: linear-gradient(#D0FF71, #D0FF71) left no-repeat, #fff;
  background-size: 0% 100%;
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
  transition: 0.5s ease-in-out;
  padding-right: 15px;
}
.creative-service-category span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-service-category span {
    font-size: 15px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-service-category span {
    font-size: 13px;
  }
}
.creative-service-category span:not(:last-child) {
  padding-right: 13px;
  margin-right: 13px;
  position: relative;
}
.creative-service-category span:not(:last-child)::before {
  position: absolute;
  top: 5px;
  right: -3px;
  content: "";
  height: 6px;
  width: 6px;
  border-radius: 50%;
  transform: translateY(3px);
  background-color: var(--tp-common-white);
}
.creative-service-link {
  margin-top: 20px;
}
.creative-service-link a {
  height: 64px;
  width: 64px;
  line-height: 58px;
  text-align: center;
  border-radius: 40px;
  transition: 0.3s;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.creative-service-item {
  margin-left: 80px;
  border-top: 1px solid rgba(255, 255, 255, 0.1);
  padding-top: 28px;
  padding-bottom: 80px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-service-item {
    margin-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-service-item {
    padding-bottom: 40px;
  }
}
@media (max-width: 767px) {
  .creative-service-item {
    flex-wrap: wrap;
  }
}
.creative-service-item:hover .creative-service-link a {
  border-color: #D0FF71;
  background-color: #D0FF71;
  color: var(--tp-common-black);
}
.creative-service-item:hover .creative-service-title a {
  background-size: 100% 100%;
}
.creative-service-item.about-us-4 {
  border-color: #F6F6F9;
}
.creative-service-item.about-us-4:hover .creative-service-link a {
  background-color: #ff5722;
  color: var(--tp-common-white);
  border: 1px solid rgb(255, 87, 34);
}
.creative-service-item.about-us-4:hover .creative-service-title a {
  background-size: 100% 100%;
}
.creative-service-item.about-us-4 .creative-service-title {
  font-size: 120px;
  font-weight: 600;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-service-item.about-us-4 .creative-service-title {
    font-size: 105px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-service-item.about-us-4 .creative-service-title {
    font-size: 110px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-service-item.about-us-4 .creative-service-title {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .creative-service-item.about-us-4 .creative-service-title {
    font-size: 70px;
  }
}
.creative-service-item.about-us-4 .creative-service-title a {
  background: linear-gradient(#FF5722, #FF5722) left no-repeat, #111013;
  background-size: auto, auto;
  background-clip: border-box, border-box;
  background-size: 0% 100%;
  background-clip: text;
  -webkit-background-clip: text;
}
.creative-service-item.about-us-4 .creative-service-content > span {
  color: #111013;
}
.creative-service-item.about-us-4 .creative-service-category span {
  color: #111013;
}
.creative-service-item.about-us-4 .creative-service-category span::before {
  background-color: #111013;
}
.creative-service-item.about-us-4 .creative-service-link a {
  color: #000000;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.creative-service-wrap .row [class*=col-] .creative-service-item:last-child {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.creative-service-subtitle-box .tp-section-subtitle {
  color: #111013;
}
.creative-service-subtitle-box .tp-section-subtitle.fs-17.pre-circle::before {
  background-color: #111013;
}
.creative-service-title-box {
  padding-left: 80px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-service-title-box {
    padding-left: 0;
  }
}
.creative-service-title-box .tp-section-title {
  color: #111013;
}
.creative-service-top-content p {
  color: #111013;
}

@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-service-area {
    padding-top: 80px;
  }
}
@media (max-width: 767px) {
  .design-service-big-text {
    margin-bottom: 50px;
  }
}
.design-service-big-text h4 {
  font-weight: 400;
  font-size: 410px;
  line-height: 0.9;
  color: #e0eeee;
  margin-bottom: 0;
  display: inline-block;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-dirtyline);
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .design-service-big-text h4 {
    font-size: 380px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .design-service-big-text h4 {
    font-size: 360px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .design-service-big-text h4 {
    font-size: 320px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-service-big-text h4 {
    font-size: 275px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-service-big-text h4 {
    font-size: 225px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-service-big-text h4 {
    font-size: 170px;
  }
}
@media (max-width: 767px) {
  .design-service-big-text h4 {
    font-size: 80px;
  }
}
.design-service-left span {
  font-weight: 500;
  font-size: 13px;
  line-height: 1;
  color: #999da6;
  letter-spacing: -0.02em;
  text-transform: uppercase;
}
.design-service-left span::after {
  content: "";
  height: 1px;
  width: 76%;
  margin-left: 20px;
  display: inline-block;
  background-color: #3c3e3f;
  transform: translateY(-3px);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-service-left span::after {
    display: none;
  }
}
.design-service-right {
  margin-top: 8px;
}

@media (max-width: 767px) {
  .studio-service-area {
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .studio-service-title-box {
    margin-bottom: 40px;
  }
}
.studio-service-wrap {
  margin-left: 310px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-service-wrap {
    margin-left: 0;
  }
}
.studio-service-item-wrap {
  margin-left: 200px;
  border-bottom: 1px solid rgba(249, 244, 232, 0.1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-service-item-wrap {
    margin-left: 0;
  }
}
.studio-service-item-wrap .tp-award-item::after {
  background-color: var(--tp-common-red);
}
.studio-service-item-wrap .tp-award-text {
  font-size: 36px;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-service-item-wrap .tp-award-text {
    font-size: 25px;
  }
}
@media (max-width: 767px) {
  .studio-service-item-wrap .tp-award-text {
    font-size: 20px;
    letter-spacing: 0;
  }
}
.studio-service-item-wrap .tp-award-year {
  min-width: 70px;
  color: rgba(249, 244, 232, 0.6);
}
@media (max-width: 767px) {
  .studio-service-item-wrap .tp-award-year {
    min-width: 30px;
  }
}
.studio-service-item-wrap .tp-award-item:hover .tp-award-year,
.studio-service-item-wrap .tp-award-item:hover .tp-award-text,
.studio-service-item-wrap .tp-award-item:hover .tp-award-position,
.studio-service-item-wrap .tp-award-item:hover .tp-award-icon {
  color: var(--tp-common-white);
}
.studio-service-item-wrap .tp-award-box-left {
  transition: 0.3s;
}
.studio-service-item-wrap .tp-award-box-right {
  transition: 0.3s;
}
.studio-service-item-wrap .tp-award-item {
  padding: 31px 13px;
  background-color: transparent;
  border-top: 1px solid rgba(249, 244, 232, 0.1);
}
@media (max-width: 767px) {
  .studio-service-item-wrap .tp-award-item {
    padding: 20px 13px;
  }
}
.studio-service-item-wrap .tp-award-item:hover .tp-award-box-left {
  transform: translateX(40px);
}
@media (max-width: 767px) {
  .studio-service-item-wrap .tp-award-item:hover .tp-award-box-left {
    transform: translateX(0);
  }
}
.studio-service-item-wrap .tp-award-item:hover .tp-award-box-right {
  transform: translateX(-40px);
}
@media (max-width: 767px) {
  .studio-service-item-wrap .tp-award-item:hover .tp-award-box-right {
    transform: translateX(0);
  }
}
.studio-service-item-wrap.black-style .tp-award-item {
  border-color: rgba(0, 0, 0, 0.1);
}
.studio-service-item-wrap.black-style .tp-award-year {
  color: var(--tp-common-black);
}
.studio-service-item-wrap.black-style .tp-award-text {
  color: var(--tp-common-black);
}
.studio-service-item-wrap.black-style .tp-award-icon {
  color: var(--tp-common-black);
}

@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-service-area {
    padding-top: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-service-area {
    padding-top: 80px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-service-area {
    padding-top: 70px;
    padding-bottom: 80px;
  }
}
.ai-service-item {
  position: relative;
  padding: 50px 70px;
  border-radius: 20px;
  background-color: #08041D;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-service-item {
    padding: 50px 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 768px) and (max-width: 991px) {
  .ai-service-item {
    padding: 50px 50px;
  }
}
.ai-service-item:hover::after {
  opacity: 0;
  visibility: hidden;
}
.ai-service-item:hover::before {
  opacity: 1;
  visibility: visible;
}
.ai-service-item::after {
  position: absolute;
  content: "";
  left: 0;
  top: 0;
  z-index: -1;
  margin: -2px;
  height: 100%;
  border-radius: 20px;
  width: calc(100% + 4px);
  transition: all 0.3s ease-out 0s;
  background: linear-gradient(90deg, #08041D 0%, rgba(255, 255, 255, 0.2) 100%);
  background: -moz-linear-gradient(90deg, #08041D 0%, rgba(255, 255, 255, 0.2) 100%);
  background: -webkit-linear-gradient(90deg, #08041D 0%, rgba(255, 255, 255, 0.2) 100%);
  background: -ms-linear-gradient(90deg, #08041D 0%, rgba(255, 255, 255, 0.2) 100%);
}
.ai-service-item::before {
  position: absolute;
  content: "";
  left: 0;
  top: 0;
  z-index: -1;
  margin: -2px;
  border-radius: 20px;
  height: calc(100% + 4px);
  width: calc(100% + 4px);
  opacity: 0;
  visibility: hidden;
  transition: all 0.3s ease-out 0s;
  background: linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
  background: -moz-linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
  background: -webkit-linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
  background: -ms-linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
}
.ai-service-top-text {
  padding-left: 160px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-service-top-text {
    padding-left: 75px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-service-top-text {
    padding-left: 0;
  }
}
.ai-service-top-text p {
  font-size: 16px;
  font-weight: 500;
  line-height: 26px;
  margin-bottom: 0;
  padding-bottom: 30px;
  color: rgba(255, 255, 255, 0.6);
}
.ai-service-title-sm {
  font-weight: 700;
  font-size: 20px;
  line-height: 1.5;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .ai-service-title-wrap {
    margin-bottom: 0;
  }
}
.ai-service-content p {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.47;
  margin-bottom: 25px;
  color: rgba(255, 255, 255, 0.6);
}
.ai-service-link a {
  height: 48px;
  width: 48px;
  transition: 0.4s;
  line-height: 45px;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.ai-service-link a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.ai-service-icon {
  margin-bottom: 30px;
}
.ai-service-icon span {
  display: inline-block;
  min-height: 60px;
}
.ai-service-shape {
  position: absolute;
  top: -26%;
  right: -2%;
  z-index: -1;
}

.ar-service-mr {
  margin-right: 210px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-service-mr {
    margin-right: 0;
  }
}
.ar-service-height {
  height: 800px;
  display: flex;
}
@media (max-width: 767px) {
  .ar-service-height {
    height: 600px;
  }
}
.ar-service-bg {
  position: absolute;
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  z-index: -2;
  opacity: 0;
  visibility: hidden;
  transition: 0.4s linear;
  transform: scale(1);
  background-size: cover;
  background-repeat: no-repeat;
}
.ar-service-bg::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  background-color: rgba(20, 20, 20, 0.3);
}
.ar-service-title {
  font-size: 18px;
  line-height: 1.2;
  text-transform: uppercase;
  letter-spacing: 1px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-medium);
  writing-mode: vertical-rl;
  transform: rotate(180deg);
  margin-bottom: 50px;
  margin-right: 50px;
}
.ar-service-title::before {
  content: "";
  height: 0px;
  width: 2px;
  margin-bottom: 5px;
  transition: all 0.4s;
  display: inline-block;
  transform: translateY(-4px);
  background-color: var(--tp-common-white);
}
.ar-service-item {
  height: 100%;
  width: 25%;
  cursor: pointer;
}
.ar-service-item:not(:last-child) {
  border-right: 1px solid rgba(255, 255, 255, 0.2);
}
.ar-service-item.active .ar-service-bg {
  opacity: 1;
  visibility: visible;
  transform: scale(1.03);
}
.ar-service-item:hover .ar-service-title::before {
  height: 30px;
}
.ar-service-title-box {
  position: absolute;
  top: 0;
  left: 0;
  margin: 150px 100px 100px 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-service-title-box {
    margin: 60px 60px 60px 60px;
  }
}
@media (max-width: 767px) {
  .ar-service-title-box {
    margin: 40px;
  }
}

.crp-service-icon {
  flex: 0 0 auto;
  margin-right: 30px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-service-icon {
    margin-right: 0;
    margin-bottom: 20px;
  }
}
.crp-service-icon span {
  height: 60px;
  width: 60px;
  line-height: 58px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  background-color: var(--tp-common-yellow-green);
}
.crp-service-title-sm {
  font-weight: 600;
  font-size: 34px;
  line-height: 1.1;
  letter-spacing: 0.5px;
  margin-bottom: 10px;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-service-title-sm {
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .crp-service-title-box {
    margin-bottom: 30px;
  }
}
.crp-service-content p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.6;
  margin-bottom: 30px;
  color: rgba(255, 255, 230, 0.7);
}
.crp-service-link {
  font-weight: 600;
  font-size: 15px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-cream-3);
}
.crp-service-link span {
  position: relative;
  z-index: 1;
  overflow: hidden;
  display: inline-block;
}
.crp-service-link span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.crp-service-link span span.text-2 {
  position: absolute;
  bottom: 100%;
  display: block;
  transition: 0.3s;
}
.crp-service-link i {
  position: relative;
  overflow: hidden;
  width: 14px;
  height: 14px;
  color: #E9FF48;
  margin-left: 11px;
  display: inline-flex;
}
.crp-service-link i svg {
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  transition: all 0.2s ease-out;
}
.crp-service-link i svg:last-child {
  left: -12px;
  bottom: -12px;
  transform: translate(0, 0);
  opacity: 0;
}
.crp-service-link:hover {
  color: var(--tp-common-cream-3);
}
.crp-service-link:hover span span.text-1 {
  -webkit-transform: translateY(150%);
  transform: translateY(150%);
}
.crp-service-link:hover span span.text-2 {
  bottom: 50%;
  -webkit-transform: translateY(50%);
  transform: translateY(50%);
}
.crp-service-link:hover i svg:first-child {
  transform: translate(16px, -16px);
}
.crp-service-link:hover i svg:last-child {
  opacity: 1;
  visibility: visible;
  transform: translate(13px, -13px);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-service-item {
    flex-wrap: wrap;
    margin-top: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-service-area {
    padding-bottom: 40px;
  }
}
@media (max-width: 767px) {
  .crp-service-area {
    padding-top: 0;
    padding-bottom: 0;
  }
}
.crp-service-area .row [class*=col-]:nth-child(2n+2) .crp-service-item {
  margin-left: 115px;
  margin-right: 80px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-service-area .row [class*=col-]:nth-child(2n+2) .crp-service-item {
    margin-left: 110px;
    margin-right: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-service-area .row [class*=col-]:nth-child(2n+2) .crp-service-item {
    margin-left: 0;
    margin-right: 0;
  }
}
.crp-service-area .row [class*=col-]:nth-child(2n+1) .crp-service-item {
  margin-right: 180px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-service-area .row [class*=col-]:nth-child(2n+1) .crp-service-item {
    margin-right: 140px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-service-area .row [class*=col-]:nth-child(2n+1) .crp-service-item {
    margin-right: 0;
  }
}
.crp-service-shape-1 {
  position: absolute;
  left: 0;
  bottom: 18%;
  z-index: -1;
}
.crp-service-shape-2 {
  position: absolute;
  right: 16%;
  top: 0;
  z-index: -1;
}
.crp-service-shape-3 {
  position: absolute;
  bottom: 0;
  right: 0;
  z-index: -1;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-service-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-service-heading {
    margin-bottom: 30px;
  }
}
.st-service-heading .tp-section-subtitle {
  color: var(--tp-common-white);
}
.st-service-heading .tp-section-title-playfair {
  color: var(--tp-common-white);
}
.st-service-heading .tp-section-title-playfair span {
  color: rgba(255, 255, 255, 0.6);
}
.st-service-heading p {
  letter-spacing: 0;
  color: rgba(255, 255, 255, 0.65);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-service-heading p br {
    display: none;
  }
}
.st-service-item {
  padding: 40px 0;
  border-top: 1px solid rgba(255, 255, 255, 0.25);
}
.st-service-item:last-child {
  border-bottom: 1px solid rgba(255, 255, 255, 0.25);
}
.st-service-item:hover .row [class*=col-] .st-service-item-wrap {
  transform: translateX(0);
}
.st-service-item-wrap {
  transition: 0.9s;
  transform: translateX(-340px);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-service-item-wrap {
    transform: translateX(0);
  }
}
@media (max-width: 767px) {
  .st-service-item-wrap {
    flex-wrap: wrap;
  }
}
.st-service-item-thumb {
  flex: 0 0 auto;
  margin-right: 50px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-service-item-thumb {
    margin-right: 35px;
  }
}
@media (max-width: 767px) {
  .st-service-item-thumb {
    width: 100%;
  }
}
.st-service-item-thumb img {
  border-radius: 10px;
}
@media (max-width: 767px) {
  .st-service-item-thumb img {
    width: 100%;
  }
}
@media (max-width: 767px) {
  .st-service-item-text {
    padding-top: 30px;
  }
}
.st-service-item-title {
  margin: 0;
  line-height: 1;
  font-size: 50px;
  font-weight: 600;
  letter-spacing: -1px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-service-item-title {
    font-size: 44px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-service-item-title {
    font-size: 40px;
  }
}
.st-service-item-tags {
  flex: none;
  justify-content: flex-start;
  align-items: flex-start;
  display: flex;
  animation: marquee-horizontal 30s linear infinite;
}
.st-service-item-tags span {
  font-size: 14px;
  font-weight: 500;
  margin-right: 6px;
  padding: 1px 15px;
  border-radius: 20px;
  white-space: nowrap;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  background: rgba(255, 255, 255, 0.06);
  border: 1px solid rgba(255, 255, 255, 0.2);
}
.st-service-item-slider {
  position: relative;
}
.st-service-item-slider::after {
  position: absolute;
  top: 0;
  right: 0;
  content: "";
  height: 100%;
  width: 160px;
  display: inline-block;
  background: linear-gradient(-90deg, #151515 0%, rgba(21, 21, 21, 0) 100%);
}
.st-service-item-slider::before {
  position: absolute;
  top: 0;
  left: 0;
  content: "";
  height: 100%;
  width: 160px;
  z-index: 1;
  display: inline-block;
  background: linear-gradient(90deg, #151515 0%, rgba(21, 21, 21, 0) 100%);
}
.st-service-item-wrapper {
  height: 100%;
  text-align: end;
  display: flex;
  flex-direction: column;
  justify-content: space-between;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-service-item-btn {
    margin-bottom: 30px;
  }
}
.st-service-item-btn a {
  display: inline-block;
}
.st-service-item-btn a span {
  height: 60px;
  width: 60px;
  display: grid;
  border-radius: 30px;
  place-content: center;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.2);
}
.st-service-item-btn a:hover span {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}

.cr-service-ptb {
  border-bottom: 1px solid rgba(255, 255, 255, 0.07);
}
@media (max-width: 767px) {
  .cr-service-ptb {
    padding-bottom: 80px;
  }
}
.cr-service-item {
  padding: 40px 0;
  padding-left: 30px;
  position: relative;
  border-left: 1px dashed rgba(255, 255, 255, 0.08);
}
@media (max-width: 767px) {
  .cr-service-item {
    padding: 30px 0;
    padding-left: 30px;
  }
}
.cr-service-item::before {
  position: absolute;
  top: 45%;
  left: -1px;
  content: "";
  width: 1px;
  height: 30px;
  display: inline-block;
  background: linear-gradient(172deg, #926AFF 6.29%, #FF77B0 50.56%, #FEB267 92.25%);
}
.cr-service-item-icon {
  margin-bottom: 30px;
}
.cr-service-item-icon span {
  width: 56px;
  height: 56px;
  display: grid;
  border-radius: 12px;
  place-content: center;
  text-align: center;
  display: inline-block;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.cr-service-item-content p {
  font-size: 16px;
  font-weight: 500;
  line-height: 26px;
  color: rgba(255, 255, 255, 0.5);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cr-service-item-content p br {
    display: none;
  }
}
.cr-service-item-title {
  font-size: 20px;
  line-height: 1;
  font-weight: 700;
  margin-bottom: 16px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-ptb {
    padding-bottom: 100px;
  }
}
.pp-service-shape {
  position: absolute;
  top: -15%;
  left: 0;
  z-index: 2;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-shape {
    display: none;
  }
}
.pp-service-shape.service-details-shape {
  top: auto;
  bottom: 10%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-shape.service-details-shape {
    display: none;
  }
}
.pp-service-heading {
  margin-bottom: 50px;
}
.pp-service-heading span {
  font-size: 18px;
  font-weight: 600;
  display: inline-block;
  color: var(--tp-common-white);
}
.pp-service-wrapper .active-bg {
  top: 0px;
  bottom: 0px;
  left: 0px;
  right: 0px;
  z-index: -1;
  position: absolute;
  -webkit-transition: 0.7s;
  -moz-transition: 0.7s;
  -ms-transition: 0.7s;
  -o-transition: 0.7s;
  transition: 0.7s;
  background: var(--tp-common-yellow-1);
}
.pp-service-item {
  display: block;
  padding: 30px 0 0px 242px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-service-item {
    padding: 30px 0 0px 160px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-service-item {
    padding: 30px 0 0px 95px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-item {
    padding: 30px 0 0px 70px;
  }
}
@media (max-width: 767px) {
  .pp-service-item {
    padding: 25px 0 15px 30px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .pp-service-item {
    padding: 25px 0 15px 50px;
  }
}
.pp-service-item::before {
  position: absolute;
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  content: "";
  background: var(--tp-common-yellow-1);
  -webkit-clip-path: inset(50% 0 50% 0);
  clip-path: inset(50% 0 50% 0);
  -webkit-transition: -webkit-clip-path 0.4s cubic-bezier(0.165, 0.84, 0.44, 1);
  transition: -webkit-clip-path 0.4s cubic-bezier(0.165, 0.84, 0.44, 1);
  transition: clip-path 0.4s cubic-bezier(0.165, 0.84, 0.44, 1);
  transition: clip-path 0.4s cubic-bezier(0.165, 0.84, 0.44, 1), -webkit-clip-path 0.4s cubic-bezier(0.165, 0.84, 0.44, 1);
  z-index: 2;
}
.pp-service-item:first-child {
  border-top: 1px solid rgba(255, 255, 255, 0.1);
}
.pp-service-item:hover::before {
  -webkit-clip-path: inset(0);
  clip-path: inset(0);
  -webkit-transition: -webkit-clip-path 0.6s cubic-bezier(0.165, 0.84, 0.44, 1);
  transition: -webkit-clip-path 0.6s cubic-bezier(0.165, 0.84, 0.44, 1);
  transition: clip-path 0.6s cubic-bezier(0.165, 0.84, 0.44, 1);
  transition: clip-path 0.6s cubic-bezier(0.165, 0.84, 0.44, 1), -webkit-clip-path 0.6s cubic-bezier(0.165, 0.84, 0.44, 1);
}
.pp-service-item:hover .pp-service-item-title {
  color: #120F10;
}
.pp-service-item-title {
  position: relative;
  z-index: 2;
  font-size: 180px;
  font-weight: 600;
  line-height: 0.7;
  letter-spacing: -5.4px;
  display: inline-block;
  vertical-align: middle;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
  -webkit-transition: 0.5s;
  -moz-transition: 0.5s;
  -ms-transition: 0.5s;
  -o-transition: 0.5s;
  transition: 0.5s;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-service-item-title {
    font-size: 150px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-service-item-title {
    font-size: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-item-title {
    font-size: 85px;
    line-height: 1;
    letter-spacing: -1.4px;
  }
}
@media (max-width: 767px) {
  .pp-service-item-title {
    font-size: 45px;
    letter-spacing: 0;
    line-height: 1;
  }
}
.pp-service-2.ar-hero-area {
  padding-top: 205px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-service-2.ar-hero-area {
    padding-top: 200px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-service-2.ar-hero-area {
    padding-top: 180px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-2.ar-hero-area {
    padding-top: 150px;
    padding-bottom: 50px;
  }
}
.pp-service-2 .tp-career-shape-1 {
  top: 50%;
  right: 23%;
}
.pp-service-2-title-box .ar-about-us-4-title {
  font-size: 200px;
  font-weight: 700;
  letter-spacing: -6px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .pp-service-2-title-box .ar-about-us-4-title {
    font-size: 160px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-service-2-title-box .ar-about-us-4-title {
    font-size: 130px;
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-service-2-title-box .ar-about-us-4-title {
    font-size: 115px;
    margin-bottom: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-2-title-box .ar-about-us-4-title {
    font-size: 100px;
    letter-spacing: 0;
    margin-bottom: 0;
  }
}
@media (max-width: 767px) {
  .pp-service-2-title-box .ar-about-us-4-title {
    font-size: 50px;
    letter-spacing: 0;
    margin-bottom: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .pp-service-2-title-box .ar-about-us-4-title {
    font-size: 70px;
  }
}
.pp-service-2-hight {
  height: 950px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .pp-service-2-hight {
    height: 720px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-service-2-hight {
    height: 580px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-service-2-hight {
    height: 470px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-2-hight {
    height: 370px;
  }
}
@media (max-width: 767px) {
  .pp-service-2-hight {
    height: 250px;
  }
}
.pp-service-2-banner-top {
  padding-bottom: 20px;
}
.pp-service-2-banner-text p, .pp-service-2-banner-text a {
  font-size: 16px;
  font-weight: 500;
  color: #111013;
  text-transform: uppercase;
}
.pp-service-2-banner-text p span, .pp-service-2-banner-text a span {
  display: inline-block;
  margin-left: 3px;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .inner-service-1-left {
    margin-bottom: 50px;
  }
}
.inner-service-1-left > span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  color: #f9f4e8;
  margin-bottom: 25px;
  display: inline-block;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  font-family: var(--tp-ff-clash-semibold);
}
.inner-service-1-left ul li {
  list-style-type: none;
}
.inner-service-1-left ul li:not(:last-child) {
  margin-bottom: 12px;
}
.inner-service-1-left ul li span {
  font-weight: 600;
  font-size: 20px;
  line-height: 1;
  color: #ff535b;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .inner-service-1-number {
    padding-bottom: 30px;
  }
}
.inner-service-1-number h1 {
  font-size: 400px;
  font-weight: 600;
  line-height: 0.7;
  color: #ff535b;
  margin-bottom: 0;
  margin-top: 7px;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .inner-service-1-number h1 {
    font-size: 300px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .inner-service-1-number h1 {
    font-size: 200px;
  }
}
@media (max-width: 767px) {
  .inner-service-1-number h1 {
    margin-top: 0;
    font-size: 100px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .inner-service-1-number h1 {
    font-size: 130px;
  }
}
.inner-service-1-text {
  margin-bottom: 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .inner-service-1-text {
    margin-bottom: 45px;
  }
}
.inner-service-1-text span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  margin-bottom: 20px;
  display: inline-block;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  color: rgba(249, 244, 232, 0.6);
}
.inner-service-1-text p {
  font-weight: 400;
  font-size: 30px;
  color: #f9f4e8;
  line-height: 1.33;
  margin-bottom: 40px;
  padding-right: 100px;
  letter-spacing: -0.01em;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .inner-service-1-text p {
    padding-right: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .inner-service-1-text p {
    font-size: 24px;
  }
}
@media (max-width: 767px) {
  .inner-service-1-text p {
    font-size: 20px;
  }
}
.inner-service-1-right {
  padding-left: 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .inner-service-1-right {
    padding-left: 0;
  }
}
.inner-service-1-category {
  margin-bottom: 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .inner-service-1-category {
    margin-bottom: 50px;
  }
}
.inner-service-1-category-item {
  padding: 17px 0;
  border-bottom: 1px solid rgba(255, 255, 255, 0.06);
}
.inner-service-1-category-item:hover span {
  transform: translateX(20px);
}
.inner-service-1-category-item:hover i {
  transform: translateX(-20px);
}
.inner-service-1-category-item:first-child {
  border-top: 1px solid rgba(255, 255, 255, 0.06);
}
.inner-service-1-category-item span {
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  color: #f9f4e8;
  transition: 0.3s ease-in-out;
}
.inner-service-1-category-item span::before {
  content: "";
  height: 6px;
  width: 6px;
  margin-right: 12px;
  border-radius: 50%;
  display: inline-block;
  background-color: #FF535B;
}
.inner-service-1-category-item i {
  transition: 0.3s ease-in-out;
  color: var(--tp-common-white);
}
.inner-service-1-thumb {
  position: relative;
  border-radius: 10px;
  overflow: hidden;
}
.inner-service-1-thumb .tp--hover-img {
  overflow: hidden;
}
.inner-service-1-thumb .tp--hover-img canvas {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  position: absolute;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .inner-service-1-thumb {
    margin-bottom: 30px;
  }
}
.inner-service-1-thumb img {
  border-radius: 10px;
}
.inner-service-1-thumb-text span {
  display: inline-block;
  font-weight: 600;
  font-size: 12px;
  line-height: 1;
  margin-bottom: 15px;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.5);
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-inner-service-area {
    padding-top: 20px;
    padding-bottom: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-inner-service-item {
    margin-bottom: 50px;
  }
}

.tp-service-4-area .tp-career-shape-1 {
  top: 55%;
  right: auto;
  left: 44%;
  transform: scaleX(-1) rotate(50deg);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-4-area .ar-about-us-4-hero-ptb {
    padding-top: 160px;
  }
}
.tp-service-4-bg-shape {
  position: absolute;
  top: -450px;
  left: 0;
}
.tp-service-4-border {
  margin-bottom: 25px;
  border-bottom: 1px solid #EEE;
}
.tp-service-4-title {
  font-size: 70px;
  font-weight: 700;
  line-height: 1;
  color: #030303;
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-4-title {
    font-size: 56px;
  }
}
@media (max-width: 767px) {
  .tp-service-4-title {
    font-size: 43px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-service-4-title {
    font-size: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-title {
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-title br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-text {
    padding-top: 0;
  }
}
.tp-service-4-text p {
  font-size: 20px;
  font-weight: 500;
  line-height: 28px;
  color: #525252;
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-4-text p {
    font-size: 18px;
  }
}
@media (max-width: 767px) {
  .tp-service-4-text p {
    font-size: 17px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-service-4-text p {
    font-size: 18px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-text p br {
    display: none;
  }
}
.tp-service-4-banner-breadcrumb span {
  position: relative;
  font-size: 18px;
  font-weight: 500;
  line-height: 26px;
  display: inline-block;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.tp-service-4-banner-breadcrumb span:not(:last-of-type) {
  margin-right: 25px;
}
.tp-service-4-banner-breadcrumb span:not(:last-of-type)::after {
  position: absolute;
  content: "";
  height: 8px;
  width: 8px;
  top: 10px;
  right: -18px;
  border-radius: 50%;
  background-color: #525252;
}
.tp-service-4-banner-breadcrumb span a {
  color: #525252;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-service-4-solution-area {
    padding-top: 120px;
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-solution-area {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-solution-subtitle {
    padding-bottom: 10px;
  }
}
.tp-service-4-solution-subtitle p {
  position: relative;
  font-size: 16px;
  font-weight: 500;
  border-radius: 100px;
  display: inline-block;
  border: 1px solid #EEE;
  padding: 6px 16px 6px 27px;
  color: var(--tp-common-black);
}
.tp-service-4-solution-subtitle p::before {
  position: absolute;
  content: "";
  height: 10px;
  width: 10px;
  top: 12px;
  left: 10px;
  border-radius: 50%;
  background-color: var(--tp-common-black);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-service-4-solution-heading {
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-solution-heading {
    padding-bottom: 40px;
  }
}
.tp-service-4-solution-title {
  font-size: 50px;
  font-weight: 700;
  line-height: 1;
  color: #030303;
  letter-spacing: -1px;
  font-family: var(--tp-ff-grotesk);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-service-4-solution-title {
    font-size: 45px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-solution-title {
    font-size: 40px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-solution-title br {
    display: none;
  }
}
.tp-service-4-solution-item {
  padding: 40px 35px 35px;
  border: 1px solid rgba(3, 3, 3, 0.1);
}
.tp-service-4-solution-item:hover .tp-service-4-solution-item-icon span {
  animation-name: tpshake;
  animation-timing-function: ease-in-out;
  animation-duration: 0.4s;
  animation-iteration-count: 1;
}
.tp-service-4-solution-item-icon {
  padding-bottom: 165px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-solution-item-icon {
    padding-bottom: 100px;
  }
}
.tp-service-4-solution-item-icon span {
  display: inline-block;
  transition: all 0.4s ease;
}
.tp-service-4-solution-item-title {
  font-size: 34px;
  font-weight: 700;
  color: #030303;
  margin-bottom: 16px;
  letter-spacing: -0.34px;
  font-family: var(--tp-ff-grotesk);
}
@media (max-width: 767px) {
  .tp-service-4-solution-item-title {
    font-size: 30px;
  }
}
.tp-service-4-solution-item-content {
  margin-bottom: 22px;
  padding-bottom: 26px;
  border-bottom: 1px solid rgba(3, 3, 3, 0.1);
}
.tp-service-4-solution-item-content p {
  font-size: 17px;
  font-weight: 400;
  letter-spacing: -0.17px;
  color: rgba(17, 16, 19, 0.7);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-solution-item-content p br {
    display: none;
  }
}
.tp-service-4-solution-item-btn a {
  font-size: 15px;
  font-weight: 700;
  color: #030303;
  text-transform: uppercase;
}
.tp-service-4-solution-item-btn a span {
  margin-left: 4px;
  display: inline-block;
}
.tp-service-4-solution-item.service-details {
  border-color: rgba(255, 255, 255, 0.1);
}
.tp-service-4-solution-item.service-details .tp-service-4-solution-item-icon {
  padding-bottom: 60px;
}
.tp-service-4-solution-item.service-details .tp-service-4-solution-item-title {
  font-size: 40px;
  font-weight: 500;
  line-height: 1;
  margin-bottom: 40px;
  padding-bottom: 36px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-service-4-solution-item.service-details .tp-service-4-solution-item-title {
    font-size: 32px;
  }
}
.tp-service-4-solution-item.service-details .tp-service-4-solution-item-title a {
  display: inline;
  transition: all 0.3s linear;
  background-repeat: no-repeat;
  background-size: 0% 1px, 0 1px;
  background-position: 100% 100%, 0px 82%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.tp-service-4-solution-item.service-details .tp-service-4-solution-item-title a:hover {
  background-size: 0% 1px, 100% 1px;
}
.tp-service-4-solution-item.service-details .tp-service-4-solution-item-content {
  border: none;
  margin-bottom: 0;
  padding-bottom: 0;
}
.tp-service-4-solution-item.service-details .tp-service-4-solution-item-content p {
  color: var(--tp-common-white);
}
.tp-service-4-solution-item.service-details .tp-service-4-solution-item-content ul li {
  font-size: 16px;
  font-weight: 400;
  list-style: none;
  margin-bottom: 6px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-service-4-solution-item.service-details .tp-service-4-solution-item-content ul li {
    font-size: 14px;
  }
}
.tp-service-4-dot .swiper-pagination-bullet {
  width: 12px;
  height: 12px;
  opacity: 1;
  transition: 0.3s;
  border-radius: 50%;
  display: inline-block;
  background: transparent;
  border: 1px solid #999;
}
.tp-service-4-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {
  border-color: var(--tp-common-green-regular);
  background-color: var(--tp-common-green-regular);
}
.tp-service-4-padding-area {
  margin: 0 20px;
  border-radius: 24px;
}
@media (max-width: 767px) {
  .tp-service-4-padding-area {
    margin: 0;
  }
}
.tp-service-4-padding-area .dgm-footer-bg {
  overflow: hidden;
  border-radius: 24px;
}
@media (max-width: 767px) {
  .tp-service-4-price-ptb {
    padding-bottom: 100px;
  }
}
.tp-service-4-price-shape {
  position: absolute;
  bottom: 0;
  right: 0;
  z-index: -1;
}
.tp-service-4-price-shape img {
  border-radius: 0 0 24px 0;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-process-ptb {
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-process-ptb {
    padding-top: 100px;
  }
}
.tp-service-4-process-list {
  display: flex;
  position: relative;
  align-items: center;
  padding-bottom: 60px;
}
@media (max-width: 767px) {
  .tp-service-4-process-list {
    padding-bottom: 30px;
  }
}
.tp-service-4-process-list span {
  position: relative;
  font-size: 18px;
  font-weight: 500;
  color: #111013;
  display: grid;
  height: 70px;
  width: 70px;
  margin-right: 20px;
  border-radius: 50%;
  place-content: center;
  border: 1px solid rgba(17, 16, 19, 0.08);
}
.tp-service-4-process-list:not(:last-child) span::before {
  position: absolute;
  content: "";
  height: 50px;
  width: 1px;
  left: 0;
  right: 0;
  margin: 0 auto;
  top: calc(100% + 10px);
  background-color: rgba(17, 16, 19, 0.08);
}
@media (max-width: 767px) {
  .tp-service-4-process-list:not(:last-child) span::before {
    content: none;
  }
}
.tp-service-4-process-list p {
  font-size: 26px;
  font-weight: 500;
  color: #111013;
  line-height: 1.2;
  letter-spacing: -0.26px;
}
@media (max-width: 767px) {
  .tp-service-4-process-list p {
    font-size: 20px;
  }
}
.tp-service-4-process-wrap {
  padding-top: 110px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-process-wrap {
    padding-top: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-process-wrapper {
    padding-left: 0;
  }
}
.tp-service-4-process-wrapper p {
  font-size: 16px;
  color: rgba(17, 16, 19, 0.7);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-process-wrapper p br {
    display: none;
  }
}
@media (max-width: 767px) {
  .tp-service-4-process-wrapper p {
    padding-left: 0;
  }
}
.tp-service-4-process-video {
  position: absolute;
  left: -20px;
  top: 20%;
}
@media (max-width: 767px) {
  .tp-service-4-process-video {
    position: static;
  }
}
.tp-service-4-process-video .dgm-testimonial-playbtn {
  height: 220px;
  width: 220px;
  display: grid;
  place-content: center;
  background-color: var(--tp-common-green-regular);
}
@media (max-width: 767px) {
  .tp-service-4-process-video .dgm-testimonial-playbtn {
    position: static;
    margin: 0;
    transform: translateY(30px);
  }
}
.tp-service-4-process-video.service-5-pos {
  top: auto;
  left: auto;
  right: 30%;
  bottom: 0px;
  z-index: 1;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-process-video.service-5-pos {
    position: static;
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-4-process-video.service-5-pos .dgm-testimonial-playbtn {
    position: static;
    margin: 0;
    transform: translateY(0px);
  }
}
.tp-service-4-process-video.service-5-pos .dgm-testimonial-playbtn:hover span {
  color: #111013;
}
.tp-service-4-process-video.service-5-pos .dgm-testimonial-playbtn span {
  font-size: 18px;
  font-weight: 500;
  color: #111013;
  letter-spacing: -0.36px;
  text-transform: uppercase;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}

.tp-service-5-text {
  margin-bottom: 35px;
}
.tp-service-5-text p {
  font-size: 20px;
  color: #535156;
  line-height: 28px;
}
@media (max-width: 767px) {
  .tp-service-5-text p br {
    display: none;
  }
}
.tp-service-5-list ul li {
  list-style: none;
  width: 50%;
  float: left;
  font-size: 18px;
  font-weight: 500;
  color: #111013;
  margin-bottom: 8px;
}
@media (max-width: 767px) {
  .tp-service-5-list ul li {
    width: 100%;
  }
}
.tp-service-5-feature-wrap {
  height: 640px;
  overflow: hidden;
  position: relative;
  border-radius: 20px;
}
@media (max-width: 767px) {
  .tp-service-5-feature-wrap {
    height: 300px;
  }
}
.tp-service-5-feature-wrap img {
  border-radius: 20px;
}
.tp-service-5-feature img {
  position: absolute;
  top: 0;
  left: 0;
}
.tp-service-5-feature-content {
  position: absolute;
  z-index: 1;
  bottom: 0;
  padding: 215px 0 70px 170px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-service-5-feature-content {
    padding: 215px 0 60px 120px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-service-5-feature-content {
    padding: 215px 0 60px 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-5-feature-content {
    padding: 100px 0 60px 40px;
  }
}
@media (max-width: 767px) {
  .tp-service-5-feature-content {
    padding: 20px;
  }
}
.tp-service-5-feature-content span {
  margin-bottom: 45px;
  display: inline-block;
}
.tp-service-5-feature-title {
  font-size: 60px;
  font-weight: 900;
  line-height: 0.92;
  letter-spacing: -2.4px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-5-feature-title {
    letter-spacing: -0.4px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-5-feature-title {
    font-size: 52px;
  }
}
@media (max-width: 767px) {
  .tp-service-5-feature-title {
    font-size: 30px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-service-5-feature-title br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-5-price-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media (max-width: 767px) {
  .tp-service-5-price-heading {
    flex-wrap: wrap;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-service-5-price-heading {
    padding-bottom: 40px;
  }
}
.tp-service-5-price-heading .tp-career-title {
  text-transform: uppercase;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-service-5-price-heading .tp-career-title.fs-60 {
    font-size: 50px;
  }
}
.tp-service-5-price-heading.service-details .tp-career-title {
  font-weight: 600;
  line-height: 0.8;
  letter-spacing: -1px;
  text-transform: capitalize;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
.tp-service-5-price-item {
  padding-top: 45px;
  padding-bottom: 45px;
  border-top: 1px solid rgba(17, 16, 19, 0.08);
}
.tp-service-5-price-item:last-child {
  border-bottom: 1px solid rgba(17, 16, 19, 0.08);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-5-price-item-heading {
    margin-bottom: 20px;
  }
}
.tp-service-5-price-item-title {
  font-size: 30px;
  font-weight: 600;
  color: #111013;
  letter-spacing: -0.3px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-service-5-price-item-list {
    margin-bottom: 20px;
  }
}
.tp-service-5-price-item-list ul {
  display: grid;
  gap: 0px 30px;
  grid-template-columns: repeat(2, 1fr);
}
@media (max-width: 767px) {
  .tp-service-5-price-item-list ul {
    grid-template-columns: none;
  }
}
.tp-service-5-price-item-list ul li {
  font-size: 16px;
  list-style: none;
  font-weight: 400;
  color: #111013;
  margin-bottom: 4px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-service-5-price-item-list ul li {
    font-size: 14px;
  }
}
.tp-service-5-price-item-list ul li span {
  margin-right: 10px;
  display: inline-block;
}
.tp-service-5-price-item-head h4 {
  font-size: 40px;
  font-weight: 600;
  color: #111013;
  letter-spacing: -0.4px;
  text-transform: uppercase;
}
.tp-service-5-price-item.service-details {
  border-color: rgba(255, 255, 255, 0.08);
}
.tp-service-5-price-item.service-details .tp-service-5-price-item-title {
  color: var(--tp-common-white);
}
.tp-service-5-price-item.service-details .tp-service-5-price-item-list ul li {
  color: var(--tp-common-white);
}
.tp-service-5-price-item.service-details .tp-service-5-price-item-head h4 {
  color: var(--tp-common-white);
}

.pp-service-details-ptb {
  padding-top: 215px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-ptb {
    padding-top: 170px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-ptb .pp-about-shape {
    display: none;
  }
}
.pp-service-details-about-wrap {
  padding-left: 485px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-about-wrap {
    padding-left: 0;
  }
}
.pp-service-details-about-item {
  display: flex;
  align-items: center;
  border-radius: 170px;
  padding: 38px 50px 30px;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-service-details-about-item {
    padding: 38px 30px 30px;
  }
}
.pp-service-details-about-item span {
  width: 105px;
  font-size: 70px;
  font-weight: 400;
  line-height: 1;
  margin-right: 20px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media (max-width: 767px) {
  .pp-service-details-about-item span {
    width: 145px;
  }
}
.pp-service-details-about-item span i {
  margin-right: -5px;
  font-style: normal;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-details-about-item span {
    font-size: 52px;
  }
}
.pp-service-details-about-item p {
  margin: 0;
  font-size: 20px;
  font-weight: 600;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-service-details-about-item p {
    font-size: 18px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-about-item p {
    font-size: 14px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-about-item p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-heading {
    padding-bottom: 0px;
    margin-bottom: 45px;
  }
}
.pp-service-details-title {
  margin: 0;
  font-size: 140px;
  font-weight: 600;
  line-height: 0.8;
  letter-spacing: -1.4px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-service-details-title {
    font-size: 120px;
    line-height: 0.7;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-service-details-title {
    font-size: 99px;
    line-height: 0.6;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-details-title {
    font-size: 80px;
    line-height: 0.9;
  }
}
@media (max-width: 767px) {
  .pp-service-details-title {
    font-size: 60px;
    line-height: 0.9;
  }
}
@media (max-width: 767px) {
  .pp-service-details-title br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-title i {
    display: none;
  }
}
.pp-service-details-title span {
  position: relative;
  font-size: 16px;
  font-weight: 600;
  color: #0E0F11;
  margin-bottom: 0;
  padding: 16px 29px;
  border-radius: 56px;
  display: inline-block;
  letter-spacing: -0.16px;
  text-transform: uppercase;
  border: 1px solid #FFF669;
  transform: translateY(-24px);
  font-family: var(--tp-ff-p);
  background: var(--tp-common-yellow-1);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-details-title span {
    transform: translateY(-16px);
  }
}
@media (max-width: 767px) {
  .pp-service-details-title span {
    transform: translateY(-4px);
  }
}
.pp-service-details-title span svg {
  position: absolute;
  bottom: -13px;
  right: -13px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-overview-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
.pp-service-details-overview-heading {
  margin-bottom: 70px;
  padding-bottom: 10px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-details-overview-heading {
    margin-bottom: 55px;
  }
}
@media (max-width: 767px) {
  .pp-service-details-overview-heading {
    margin-bottom: 45px;
  }
}
.pp-service-details-overview-title {
  font-size: 60px;
  font-weight: 500;
  line-height: 60px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media (max-width: 767px) {
  .pp-service-details-overview-title {
    font-size: 52px;
  }
}
.pp-service-details-overview-wrapper {
  padding-right: 10px;
}
.pp-service-details-overview-wrapper p {
  font-size: 18px;
  font-weight: 500;
  margin-bottom: 45px;
  color: var(--tp-common-white);
}
.pp-service-details-overview-wrapper h4 {
  font-size: 34px;
  font-weight: 500;
  margin-bottom: 20px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-overview-list {
    margin-bottom: 30px;
  }
}
.pp-service-details-overview-list ul {
  display: block;
}
.pp-service-details-overview-list ul li {
  font-size: 16px;
  font-weight: 500;
  list-style: none;
  margin-bottom: 20px;
  display: inline-flex;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-overview-list ul li br {
    display: none;
  }
}
.pp-service-details-overview-list ul li span {
  display: grid;
  height: 24px;
  width: 24px;
  margin-right: 12px;
  border-radius: 50%;
  text-align: center;
  flex: 0 0 auto;
  place-content: center;
  transform: translateY(4px);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.pp-service-details-overview-thumb {
  margin-left: 75px;
  overflow: hidden;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-overview-thumb {
    margin-left: 0;
  }
}
.pp-service-details-overview-thumb img {
  width: 100%;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-process-ptb {
    padding-top: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-process-heading {
    padding-bottom: 60px;
  }
}
.pp-service-details-process-subtitle {
  font-size: 16px;
  font-weight: 500;
  color: #C4EE18;
  padding: 6px 16px;
  margin-bottom: 15px;
  display: inline-block;
  border-radius: 100px;
  font-family: var(--tp-ff-grotesk);
  background: rgba(3, 3, 3, 0.4);
}
.pp-service-details-process-subtitle svg {
  margin-right: 4px;
  display: inline-block;
  transform: translateY(-1px);
}
.pp-service-details-process-title {
  font-size: 70px;
  font-weight: 600;
  line-height: 0.9;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-service-details-process-title {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .pp-service-details-process-title {
    font-size: 50px;
  }
}
.pp-service-details-process-box::before {
  position: absolute;
  content: "";
  left: 0;
  top: 20px;
  height: 1px;
  width: 100%;
  z-index: -1;
  background-color: rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-process-box::before {
    content: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-process-item {
    margin-bottom: 40px;
  }
}
.pp-service-details-process-item span {
  font-size: 16px;
  font-weight: 600;
  color: #030303;
  height: 40px;
  width: 40px;
  text-align: center;
  border-radius: 50%;
  margin-bottom: 45px;
  display: inline-block;
  place-content: center;
  background-color: #C4EE18;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-service-details-process-item span {
    margin-bottom: 30px;
  }
}
.pp-service-details-process-item h4 {
  font-size: 30px;
  font-weight: 500;
  line-height: 1.1;
  margin-bottom: 20px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
.pp-service-details-process-item p {
  color: #999;
  line-height: 1.4;
}
.pp-service-details-process-bottom span {
  font-size: 16px;
  font-weight: 500;
  border-radius: 100px;
  padding: 8px 34px;
  display: inline-block;
  background: transparent;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.pp-service-details-process-bottom span a {
  font-size: 15px;
  color: #C4EE18;
  margin-left: 5px;
  text-transform: uppercase;
}
.pp-service-details-process-bottom span a svg {
  margin-right: 4px;
}

.creative-service-2-style .tp-section-subtitle {
  margin-bottom: 70px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-service-2-style .tp-section-subtitle {
    margin-bottom: 15px;
  }
}
.creative-service-2-style .tp-service-5-feature-wrap {
  border-radius: 0;
  position: relative;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-service-2-style .tp-service-5-feature-wrap {
    height: 450px;
  }
}
.creative-service-2-style .tp-service-5-feature-wrap img {
  border-radius: 0;
}
.creative-service-2-style .tp-service-5-feature-wrap::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background-color: rgba(0, 0, 0, 0.2);
}

/*----------------------------------------*/
/*  7.6 Project Css
/*----------------------------------------*/
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-project-area {
    padding-top: 130px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-area {
    padding-top: 120px;
    padding-bottom: 0;
  }
}
@media (max-width: 767px) {
  .tp-project-area {
    padding-top: 80px;
    padding-bottom: 0px;
  }
}
.tp-project-title {
  font-weight: 700;
  font-size: 34px;
  line-height: 1.2;
  margin-bottom: 13px;
  letter-spacing: -0.06em;
  text-transform: uppercase;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-title {
    font-size: 28px;
  }
}
@media (max-width: 767px) {
  .tp-project-title {
    font-size: 25px;
  }
}
.tp-project-category span {
  padding: 7px 17px;
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  transition: 0.3s;
  margin-right: 5px;
  margin-bottom: 8px;
  border-radius: 20px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-black);
  border: 1px solid rgba(19, 22, 13, 0.1);
}
.tp-project-category span:hover {
  border-color: #F6F6F9;
  background-color: #F6F6F9;
  color: var(--tp-common-black);
}
.tp-project-thumb {
  margin-bottom: 25px;
  position: relative;
}
.tp-project-thumb .tp--hover-img {
  overflow: hidden;
}
.tp-project-thumb .tp--hover-img img {
  width: 100%;
  display: block;
  object-fit: cover;
}
.tp-project-thumb .tp--hover-img canvas {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  position: absolute;
}
.tp-project-subtitle-wrap .tp-section-subtitle {
  margin-bottom: 20px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-item {
    margin-bottom: 50px;
  }
}
@media (max-width: 767px) {
  .tp-project-item {
    margin-bottom: 40px;
  }
}

.des-portfolio-item img {
  width: 100%;
  border-radius: 20px;
}
.des-portfolio-thumb {
  position: relative;
  border-radius: 20px;
}
.des-portfolio-thumb::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  border-radius: 20px;
  background: linear-gradient(180deg, rgba(20, 20, 20, 0) 0%, rgba(20, 20, 20, 0.4) 100%);
}
.des-portfolio-category {
  position: absolute;
  top: 45px;
  left: 50px;
  z-index: 2;
}
@media (max-width: 767px) {
  .des-portfolio-category {
    top: 15px;
    left: 15px;
  }
}
.des-portfolio-category.portfolio-meta {
  left: auto;
  right: 50px;
}
@media (max-width: 767px) {
  .des-portfolio-category.portfolio-meta {
    right: 15px;
  }
}
.des-portfolio-category span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  border-radius: 20px;
  padding: 7px 12px;
  transition: 0.3s;
  letter-spacing: 0.4px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.2);
}
@media (max-width: 767px) {
  .des-portfolio-category span {
    font-size: 12px;
    padding: 7px 7px;
  }
}
.des-portfolio-category span:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.des-portfolio-content {
  position: absolute;
  bottom: 50px;
  left: 0;
  right: 0;
  display: inline-block;
  text-align: center;
}
@media (max-width: 767px) {
  .des-portfolio-content {
    bottom: 5px;
  }
}
.des-portfolio-title {
  font-weight: 600;
  font-size: 180px;
  line-height: 1;
  margin-bottom: 0;
  display: inline-block;
  font-family: var(--tp-ff-mango);
  color: var(--tp-common-cream);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-portfolio-title {
    font-size: 125px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-portfolio-title {
    font-size: 110px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-portfolio-title {
    font-size: 90px;
  }
}
@media (max-width: 767px) {
  .des-portfolio-title {
    font-size: 60px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-portfolio-area {
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .des-portfolio-area {
    padding-bottom: 110px;
  }
}
@media (max-width: 767px) {
  .des-portfolio-area {
    padding-bottom: 0px;
  }
}

.des-project-banner {
  height: 800px;
  overflow: hidden;
}
.des-project-banner img {
  margin-top: -350px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-project-banner img {
    margin-top: -200px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-project-banner img {
    margin-top: -150px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-project-banner img {
    margin-top: -70px;
  }
}
@media (max-width: 767px) {
  .des-project-banner img {
    margin-top: -30px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-project-banner {
    height: 620px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-project-banner {
    height: 480px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-project-banner {
    height: 300px;
  }
}
@media (max-width: 767px) {
  .des-project-banner {
    height: 250px;
  }
}
.des-project-top-text p {
  font-weight: 400;
  font-size: 20px;
  line-height: 1.5;
  margin-bottom: 0;
  padding-right: 35px;
  color: rgba(249, 244, 232, 0.7);
}
@media (max-width: 767px) {
  .des-project-top-text p {
    padding-right: 0;
  }
}
.des-project-total {
  padding-right: 20px;
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .des-project-total {
    margin-right: 30px;
  }
}
.des-project-total span {
  width: 380px;
  font-weight: 500;
  font-size: 180px;
  line-height: 1;
  display: inline-block;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-mango-medium);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-project-total span {
    width: 360px;
  }
}
@media (max-width: 767px) {
  .des-project-total span {
    width: 100%;
    font-size: 120px;
  }
}
.des-project-total span::before {
  content: "";
  height: 20px;
  width: 20px;
  border-radius: 50%;
  display: inline-block;
  margin-right: 35px;
  transform: translateY(-50px);
  background-color: var(--tp-common-cream);
}
.des-project-total span i {
  font-style: normal;
}
.des-project-info span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  color: rgba(249, 244, 232, 0.5);
}
.des-project-info h4 {
  font-weight: 300;
  font-size: 46px;
  line-height: 1.2;
  font-family: var(--tp-ff-mango);
  color: var(--tp-common-cream);
}
.des-project-item {
  margin-bottom: 40px;
  padding: 0px 25px;
  border-bottom: 1px solid rgba(249, 244, 232, 0.1);
}
@media (max-width: 767px) {
  .des-project-item {
    flex-wrap: wrap;
    padding: 15px 0;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .des-project-area {
    padding-bottom: 120px;
  }
}
@media (max-width: 767px) {
  .des-project-area {
    padding-bottom: 80px;
    padding-top: 70px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .des-project-title-box {
    margin-bottom: 30px;
  }
}

.dgm-project-top-text {
  padding-left: 180px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .dgm-project-top-text {
    padding-left: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-project-top-text {
    padding-left: 0px;
  }
}
.dgm-project-top-text p {
  font-weight: 500;
  font-size: 17px;
  line-height: 1.5;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  color: rgba(255, 255, 255, 0.7);
}
.dgm-project-top-wrap {
  margin-bottom: 45px;
}
.dgm-project-active {
  margin: 0px -460px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-project-active {
    margin: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-project-active {
    margin: 0;
    margin: 0px 15px;
  }
}
.dgm-project-title-sm {
  font-weight: 700;
  font-size: 46px;
  line-height: 1.2;
  margin-bottom: 0px;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-grotesk);
}
@media (max-width: 767px) {
  .dgm-project-title-sm {
    font-size: 35px;
  }
}
.dgm-project-content h5 {
  overflow: hidden;
  margin-top: 10px;
}
.dgm-project-content h5 span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-white);
  transform: translateY(50px);
  transition: all 0.8s;
}
.dgm-project-slider-wrap .swiper-container.dgm-project-text-active {
  height: 100px !important;
}
.dgm-project-slider-wrap .dgm-project-text-active .swiper-slide-active .dgm-project-content h5 span {
  transform: translateY(0);
  transition-delay: 0.5s;
}
.dgm-project-arrow button {
  width: 64px;
  height: 64px;
  line-height: 1;
  margin-left: 8px;
  border-radius: 40px;
  text-align: center;
  position: relative;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.2);
}
.dgm-project-arrow button::after {
  position: absolute;
  top: 0;
  left: 0;
  content: "";
  width: 100%;
  height: 100%;
  z-index: -1;
  opacity: 0;
  transition: 0.3s;
  visibility: hidden;
  border-radius: 50%;
  transform: scale(0.3);
  background-color: var(--tp-common-green-regular);
}
.dgm-project-arrow button:hover {
  transition: 0.4s;
  color: var(--tp-common-black);
}
.dgm-project-arrow button:hover::after {
  transform: scale(1.1);
  opacity: 1;
  visibility: visible;
}
.dgm-project-area {
  margin-top: -1px;
  border-radius: 0 0 20px 20px;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-project-area {
    padding-bottom: 80px;
  }
}
.creative-project-thumb {
  overflow: hidden;
  border-radius: 20px;
  margin-bottom: 25px;
}
.creative-project-thumb img {
  width: 100%;
  border-radius: 20px;
  transition: transform 500ms;
  transform-origin: center center;
  transform: perspective(0) rotateX(0) rotateY(0) scaleX(1) scaleY(1);
}
.creative-project-meta span {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 10px;
  display: inline-block;
  color: var(--tp-common-white);
}
.creative-project-meta span:not(:last-child) {
  padding-right: 13px;
  margin-right: 13px;
  position: relative;
}
.creative-project-meta span:not(:last-child)::after {
  position: absolute;
  top: 7px;
  right: -2px;
  content: "";
  height: 6px;
  width: 6px;
  border-radius: 50%;
  display: inline-block;
  background-color: var(--tp-common-white);
}
.creative-project-title-sm {
  font-weight: 600;
  font-size: 30px;
  line-height: 1.1;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.creative-project-social a {
  width: 54px;
  height: 54px;
  line-height: 50px;
  text-align: center;
  border-radius: 40px;
  display: inline-block;
  border: 2px solid #161618;
  background-color: #212123;
  color: var(--tp-common-white);
}
.creative-project-social a:last-child {
  margin-left: -15px;
}
.creative-project-social a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-green-light);
  background-color: var(--tp-common-green-light);
}
.creative-project-social::after {
  content: "";
  height: 2px;
  width: 212px;
  margin-left: 14px;
  display: inline-block;
  background-color: #212123;
  transform: translateY(-2px);
}
@media (max-width: 767px) {
  .creative-project-social::after {
    width: 200px;
  }
}
.creative-project-btn-box {
  padding-left: 175px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-project-btn-box {
    padding-left: 0;
  }
}
.creative-project-btn-box p {
  font-weight: 500;
  font-size: 30px;
  line-height: 1.2;
  margin-bottom: 35px;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .creative-project-btn-box p br {
    display: none;
  }
}
.creative-project-category {
  position: absolute;
  top: -2px;
  right: 0;
  padding: 15px;
  padding-top: 7px;
  background-color: #0e0f11;
  border-radius: 0 0 0 20px;
  opacity: 0;
  visibility: hidden;
  transition: 0.4s;
  transform: translateY(-50px);
}
.creative-project-category span {
  border-radius: 20px;
  padding: 9px 18px;
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  display: inline-block;
  background-color: #242426;
  color: var(--tp-common-white);
}
.creative-project-category span:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-light);
}
.creative-project-category::before {
  content: "";
  position: absolute;
  background-color: transparent;
  bottom: -40px;
  right: 0;
  height: 40px;
  width: 20px;
  border-top-right-radius: 20px;
  box-shadow: 0px -17px 0 0 #0E0F11;
}
.creative-project-category::after {
  content: "";
  position: absolute;
  background-color: transparent;
  top: 1px;
  left: -20px;
  height: 40px;
  width: 20px;
  border-top-right-radius: 20px;
  box-shadow: 0 -18px 0 0 #0E0F11;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-project-item {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-project-item {
    margin-bottom: 50px;
  }
}
.creative-project-item:hover .creative-project-category {
  opacity: 1;
  visibility: visible;
  transform: translateY(-1px);
}
.creative-project-item:hover .creative-project-thumb img {
  transform: perspective(400px) rotateX(0.09deg) rotateY(0) scaleX(1.1) scaleY(1.1);
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .design-project-area {
    padding-top: 120px;
    padding-bottom: 0px;
  }
}
@media (max-width: 767px) {
  .design-project-area {
    padding-top: 120px;
    padding-bottom: 0px;
  }
}
@media (max-width: 767px) {
  .design-project-item {
    margin-bottom: 60px;
  }
}
.design-project-title {
  font-weight: 400;
  font-size: 80px;
  line-height: 0.9;
  color: #e0eeee;
  margin-bottom: 10px;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-dirtyline);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-project-title {
    font-size: 65px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-project-title {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .design-project-title {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .design-project-title-box {
    margin-bottom: 20px;
  }
}
.design-project-title-box p {
  font-weight: 500;
  font-size: 24px;
  line-height: 1.25;
  color: #e0eeee;
  margin-bottom: 0;
  max-width: 300px;
  letter-spacing: -0.02em;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-project-title-box p {
    max-width: 100%;
    font-size: 20px;
  }
}
@media (max-width: 767px) {
  .design-project-title-box p {
    max-width: 100%;
    font-size: 18px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-project-title-wrap {
    margin-bottom: 80px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-project-content {
    padding-left: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-project-content {
    padding-left: 0px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-project-content.pr-200 {
    padding-right: 0;
  }
}
.design-project-content span {
  display: block;
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  color: #e0eeee;
  margin-bottom: 45px;
  letter-spacing: -0.02em;
}
.design-project-thumb img {
  border-radius: 30px;
  will-change: transform;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .design-project-thumb img {
    margin-bottom: 60px;
  }
}
@media (max-width: 767px) {
  .design-project-thumb img {
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-project-title-box .tp-section-title-dirtyline {
    font-size: 110px;
  }
}

.tp_text_invert > div {
  background-image: linear-gradient(to right, #111013 50%, #e4e4e4 50%);
  background-size: 200% 100%;
  background-position: 100%;
  color: transparent;
  background-clip: text;
  -webkit-background-clip: text;
}

.tp_text_invert_2 > div {
  background-image: linear-gradient(to right, #e0eeee 50%, #383C3E 50%);
  padding: 10px 0;
  background-size: 200% 100%;
  background-position: 100%;
  -webkit-background-clip: text;
  background-clip: text;
  color: transparent;
}

.tp_text_invert_3 > div {
  background-image: linear-gradient(to right, #f9f4e8 50%, #383C3E 50%);
  padding: 10px 0;
  background-size: 200% 100%;
  background-position: 100%;
  -webkit-background-clip: text;
  background-clip: text;
  color: transparent;
}

.tp-text-right-scroll {
  display: inline-block;
}

.tp-text-left-scroll {
  display: inline-block;
}

.tp-reveal-line {
  overflow: hidden;
}

@media (max-width: 767px) {
  .studio-project-ptb {
    padding-bottom: 0;
  }
}
.studio-project-btn {
  transform: translateY(-10px);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-project-top-wrap {
    margin-bottom: 0;
  }
}
.studio-project-title-wrap {
  margin-left: 90px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-project-title-wrap {
    margin-left: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-project-title-box {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-project-title-box {
    margin-bottom: 40px;
  }
}
.studio-project-thumb {
  height: 630px;
  width: 1090px;
  margin-left: 90px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-project-thumb {
    width: 100%;
    margin-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-project-thumb {
    height: 100%;
    width: 100%;
    margin-left: 0;
  }
}
.studio-project-thumb img {
  width: 100%;
}
.studio-project-number {
  flex: 0 0 auto;
  margin-right: 45px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .studio-project-number {
    margin-right: 0;
    margin-bottom: 20px;
  }
}
.studio-project-number span {
  font-size: 20px;
  line-height: 1;
  margin-right: 25px;
  letter-spacing: -0.02em;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-medium);
}
.studio-project-number i {
  color: var(--tp-common-white);
  transform: translateY(-1px);
}
.studio-project-title-sm {
  font-size: 50px;
  line-height: 0.9;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-project-title-sm {
    font-size: 40px;
  }
}
@media (max-width: 767px) {
  .studio-project-title-sm {
    font-size: 30px;
    letter-spacing: 0;
  }
}
.studio-project-content {
  margin-top: 5px;
}
.studio-project-content span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: rgba(249, 244, 232, 0.6);
}
.studio-project-content-wrap {
  margin-top: 55px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-project-content-wrap {
    flex-wrap: wrap;
  }
}
@media (max-width: 767px) {
  .studio-project-content-wrap {
    flex-wrap: wrap;
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-project-item {
    margin-bottom: 0;
  }
}

.studio-showcase-wrap {
  height: 1700px;
  overflow: hidden;
  margin: 0px -370px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-showcase-wrap {
    height: 1000px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-showcase-wrap {
    height: 700px;
  }
}
@media (max-width: 767px) {
  .studio-showcase-wrap {
    height: 700px;
    margin: 0;
  }
}
.studio-showcase-main {
  gap: 30px;
  margin-top: -370px;
}
.studio-showcase-thumb img {
  width: 100%;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-showcase-area {
    margin-bottom: 120px;
  }
}
@media (max-width: 767px) {
  .studio-showcase-area {
    margin-bottom: 80px;
  }
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-project-area {
    padding-bottom: 80px;
  }
}
.ai-project-content {
  position: absolute;
  width: auto;
  max-width: calc(100% - 80px);
  height: auto;
  top: auto;
  right: auto;
  bottom: 60px;
  left: 60px;
  padding: 0;
  background-color: transparent;
  overflow: hidden;
}
.ai-project-subtitle {
  color: #494949;
  font-size: 12px;
  font-weight: 600;
  line-height: 1;
  text-transform: uppercase;
  margin-top: 5px;
  transform: translateX(-101%);
  transition: all 0.3s;
  transition-duration: 0.3s;
  transition-delay: 0s;
  transition-delay: 50ms;
  transition-duration: 0.3s;
  display: inline-block;
  background-color: var(--tp-common-white);
  padding: 13px 20px;
}
.ai-project-title {
  font-size: 22px;
  font-weight: 600;
  line-height: 1;
  letter-spacing: -0.44px;
  padding: 20px;
  transform: translateX(-101%);
  transition: all 0.3s;
  transition-duration: 0.3s;
  transition-delay: 0s;
  transition-duration: 0.3s;
  transition-delay: 0ms;
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
  margin-bottom: 0;
  margin-top: 2px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-project-title {
    font-size: 16px;
  }
}
.ai-project-thumb img {
  transition: 0.9s;
  width: 100%;
}
.ai-project-item:hover .ai-project-title {
  transform: translateX(0);
  transition: all 0.7s ease;
  transition-duration: 0.7s;
  transition-delay: 0s;
  transition-delay: 0ms;
  transition-duration: 0.5s;
}
.ai-project-item:hover .ai-project-subtitle {
  transform: translateX(0);
  transition: all 0.7s ease;
  transition-duration: 0.7s;
  transition-delay: 0s;
  transition-delay: 50ms;
  transition-duration: 0.5s;
}
.ai-project-item:hover .ai-project-thumb img {
  transform: scale(1.1);
}
.ai-project-shape-1 {
  position: absolute;
  bottom: -65px;
  left: 0;
  z-index: -1;
}

.ar-project-category {
  padding-top: 20px;
  padding-bottom: 20px;
}
.ar-project-category span {
  font-size: 20px;
  line-height: 1;
  color: #1d2132;
  letter-spacing: 1px;
  text-transform: uppercase;
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-project-category span {
    font-size: 16px;
  }
}
.ar-project-category i {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  color: #1d2132;
  font-style: normal;
  text-transform: uppercase;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-project-category i {
    font-size: 14px;
  }
}
.ar-project-thumb {
  overflow: hidden;
}
.ar-project-thumb img {
  transition: 0.9s;
}
.ar-project-item {
  border-top: 1px solid #fff;
  position: relative;
}
.ar-project-item::after {
  position: absolute;
  content: "";
  top: 0;
  right: 0;
  width: 0;
  height: 1px;
  transition: 0.4s ease-in-out;
  background-color: var(--tp-common-red-3);
}
.ar-project-item:hover::after {
  right: auto;
  left: 0;
  width: 100%;
}
.ar-project-item:hover .ar-project-thumb img {
  transform: scale(1.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-project-area {
    padding-top: 80px;
    padding-bottom: 40px;
  }
}
@media (max-width: 767px) {
  .ar-project-title-box {
    margin-bottom: 20px;
  }
}

@media (max-width: 767px) {
  .crp-project-area {
    margin-bottom: 60px;
  }
}
.crp-project-item {
  padding: 40px;
  border-radius: 30px;
  border: 4px solid #2a4c3a;
  background-color: var(--tp-common-cream-3);
}
.crp-project-meta {
  position: relative;
}
.crp-project-meta::after {
  position: absolute;
  content: "";
  top: 10px;
  left: 30px;
  height: 1px;
  width: 86%;
  background-color: rgba(42, 76, 58, 0.08);
}
.crp-project-meta span {
  font-weight: 500;
  font-size: 24px;
  line-height: 1;
  color: #2A4C3A;
  font-family: var(--tp-ff-teko);
}
.crp-project-thumb {
  padding-top: 40px;
  padding-bottom: 45px;
  background-repeat: no-repeat;
  background-position: center;
}
.crp-project-title-sm {
  font-weight: 500;
  font-size: 54px;
  line-height: 0.93;
  color: #2a4c3a;
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-project-title-sm {
    font-size: 45px;
  }
}
@media (max-width: 767px) {
  .crp-project-title-sm {
    font-size: 27px;
  }
  .crp-project-title-sm br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-project-title-box {
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-project-title-box .tp-section-title-teko.fs-150 {
    margin-bottom: 20px;
  }
}
.crp-project-content {
  padding-top: 25px;
  border-top: 1px solid rgba(42, 76, 58, 0.08);
}
.crp-project-category a {
  font-weight: 600;
  font-size: 12px;
  line-height: 1;
  color: #2a4c3a;
  padding: 7px 18px;
  border-radius: 10px;
  display: inline-block;
  text-transform: uppercase;
  border: 1px solid rgba(42, 76, 58, 0.1);
}
.crp-project-category a:hover {
  background-color: #e9edd5;
}
.crp-project-right {
  padding-left: 75px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-project-right {
    padding-left: 0;
  }
}

.crp-process-title-sm {
  font-weight: 600;
  font-size: 40px;
  line-height: 1;
  margin-bottom: 10px;
  letter-spacing: 0.3px;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-process-title-sm {
    font-size: 35px;
  }
}
.crp-process-content p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.62;
  color: #fcfede;
  margin-bottom: 0;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-process-content p {
    font-size: 15px;
  }
}
.crp-process-icon {
  margin-bottom: 50px;
}
.crp-process-item {
  margin-right: 65px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-process-item {
    margin-right: 0;
  }
}
.crp-process-shape-1 {
  position: absolute;
  bottom: 175px;
  left: 0;
  z-index: -1;
}
.crp-process-shape-2 {
  position: absolute;
  bottom: 17%;
  right: 0;
  z-index: -1;
}
.crp-process-shape-3 {
  position: absolute;
  top: 8%;
  right: 21%;
  z-index: -1;
}
@media (max-width: 767px) {
  .crp-process-area {
    padding: 0;
    font-size: 27px;
  }
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-project-ptb {
    padding-top: 65px;
  }
}
.it-project-item {
  overflow: hidden;
  padding: 8px;
  border-radius: 20px;
  background: var(--tp-common-white);
  box-shadow: 0 2px 3px 0 rgba(50, 41, 73, 0.1);
}
.it-project-item:hover .it-project-thumb img {
  transform: scale(1.1);
}
.it-project-title {
  font-weight: 500;
  font-size: 30px;
  line-height: 1.1;
  margin-bottom: 8px;
  letter-spacing: 0.03em;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-platform);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-project-title {
    font-size: 25px;
  }
}
.it-project-content {
  padding: 30px;
}
.it-project-content span {
  font-weight: 600;
  font-size: 11px;
  line-height: 1;
  color: #61616a;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  padding: 9px 12px;
  border-radius: 27px;
  display: inline-block;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  border: 1px solid rgba(50, 41, 73, 0.1);
}
.it-project-content span:hover {
  border-color: #F3F3F9;
  background: #F3F3F9;
}
.it-project-thumb {
  border-radius: 16px;
}
.it-project-thumb img {
  border-radius: 16px;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.it-project-active {
  margin: 0 -260px;
}
@media (max-width: 767px) {
  .it-project-active {
    margin: 0;
  }
}
@media (max-width: 767px) {
  .it-project-arrow {
    display: none;
  }
}
.it-project-arrow button {
  width: 50px;
  height: 50px;
  line-height: 1;
  margin: 0 138px;
  border-radius: 60px;
  display: inline-block;
  background-color: var(--tp-common-white);
  border: 1px solid rgba(33, 33, 45, 0.1);
}
.it-project-arrow button:hover {
  background-color: #7463FF;
  color: var(--tp-common-white);
}
.it-project-dots {
  margin-top: -40px;
}
@media (max-width: 767px) {
  .it-project-dots {
    margin-top: 0;
  }
}
.it-project-dots .swiper-pagination-bullet {
  border-radius: 7px;
  width: 50px;
  height: 6px;
  opacity: 1;
  margin: 0 4px;
  transition: 0.3s;
  background: rgba(33, 33, 45, 0.1);
}
.it-project-dots .swiper-pagination-bullet.swiper-pagination-bullet-active {
  opacity: 1;
  background: #7463FF;
}

.st-portfolio-ptb {
  padding-top: 130px;
  padding-bottom: 440px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-portfolio-ptb {
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-heading {
    margin-bottom: 50px;
  }
}
.st-portfolio-item:hover .st-portfolio-item-thumb img {
  transform: scale(1.1);
}
@media (max-width: 767px) {
  .st-portfolio-item {
    margin-bottom: 30px;
  }
}
.st-portfolio-item-thumb {
  overflow: hidden;
  border-radius: 10px;
  margin-bottom: 30px;
}
.st-portfolio-item-thumb img {
  width: 100%;
  border-radius: 10px;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.st-portfolio-item-content {
  padding-bottom: 15px;
  border-bottom: 1px solid rgba(69, 48, 48, 0.15);
}
.st-portfolio-item-btn a {
  font-size: 20px;
  font-weight: 500;
  color: var(--tp-common-brown);
}
.st-portfolio-item-btn a span {
  display: inline-block;
  margin-left: 4px;
}
.st-portfolio-item-title {
  font-size: 34px;
  font-weight: 600;
  line-height: 1;
  letter-spacing: -0.44px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-portfolio-item-title {
    font-size: 28px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-title {
    font-size: 24px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-title br {
    display: none;
  }
}
.st-portfolio-item-1 {
  margin-right: 48px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-1 {
    margin-right: 0;
  }
}
.st-portfolio-item-1 .st-portfolio-item-thumb img {
  height: 315px;
  object-fit: cover;
}
.st-portfolio-item-2 {
  margin-top: 430px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-2 {
    margin-top: 0;
  }
}
.st-portfolio-item-2 .st-portfolio-item-thumb img {
  height: 264px;
  object-fit: cover;
}
.st-portfolio-item-3 {
  margin-top: -90px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-3 {
    margin-top: 0;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-3 {
    width: 100%;
  }
}
.st-portfolio-item-3 .st-portfolio-item-thumb img {
  height: 306px;
  object-fit: cover;
}
.st-portfolio-item-4 {
  width: 364px;
  margin-top: -210px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-4 {
    margin-top: 0;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-4 {
    width: 100%;
  }
}
.st-portfolio-item-4 .st-portfolio-item-thumb img {
  height: 290px;
  object-fit: cover;
}
.st-portfolio-item-5 {
  margin-top: 330px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-5 {
    margin-top: 0;
  }
}
.st-portfolio-item-5 .st-portfolio-item-thumb img {
  height: 230px;
  object-fit: cover;
}
.st-portfolio-item-6 {
  width: 364px;
  margin-top: 330px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-6 {
    width: 100%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-portfolio-item-6 {
    margin-top: 0;
  }
}
.st-portfolio-item-6 .st-portfolio-item-thumb img {
  height: 430px;
  object-fit: cover;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-project-ptb {
    padding-top: 100px;
    padding-bottom: 40px;
  }
}
.pp-project-heading {
  margin-left: -65px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-project-heading {
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-project-heading {
    margin-left: 0;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .pp-project-sub-heading {
    margin-bottom: 30px;
  }
}
.pp-project-item:hover .pp-project-item-thumb img {
  transform: scale(1.1);
}
.pp-project-item-thumb {
  overflow: hidden;
  margin-bottom: 25px;
  border-radius: 20px;
}
.pp-project-item-thumb img {
  border-radius: 20px;
  -webkit-transition: 0.5s;
  -moz-transition: 0.5s;
  -ms-transition: 0.5s;
  -o-transition: 0.5s;
  transition: 0.5s;
}
.pp-project-item-title {
  font-size: 46px;
  font-weight: 500;
  line-height: 1;
  margin-bottom: 0px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
.pp-project-item-title a:hover {
  color: var(--tp-common-yellow-1);
}
.pp-project-item-meta {
  font-size: 17px;
  font-weight: 500;
  line-height: 30px;
  color: rgba(255, 255, 255, 0.6);
}
.pp-project-btn {
  height: 100%;
  display: flex;
  align-items: end;
  justify-content: end;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-project-btn {
    justify-content: start;
    padding-bottom: 40px;
  }
}

.tp-project-5-title {
  font-size: 80px;
  font-weight: 400;
  line-height: 1;
  color: #846457;
  letter-spacing: -3.2px;
  font-family: var(--tp-ff-playfair);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-project-5-title {
    font-size: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-5-title {
    font-size: 40px;
  }
}
@media (max-width: 767px) {
  .tp-project-5-title {
    font-size: 45px;
  }
}
.tp-project-5-title-box {
  position: relative;
  padding: 32px 0;
  z-index: 1;
  border-bottom: 1px solid rgba(207, 194, 146, 0.2);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-project-5-title-box {
    margin-bottom: 40px;
  }
}
.tp-project-5-title-box:last-child {
  margin-bottom: 0;
}
.tp-project-5-title-box span {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  color: #846457;
  text-transform: uppercase;
  font-family: var(--tp-ff-poppins);
  transition: 0.3s;
}
.tp-project-5-title-box.active .tp-project-5-title {
  color: var(--tp-cream-2);
}
.tp-project-5-title-box.active span {
  color: var(--tp-cream-2);
}
.tp-project-5-title-box.active .tp-project-5-thumb-box {
  top: 15%;
  opacity: 1;
  visibility: visible;
}
.tp-project-5-title-box.active .tp-project-5-title-box-bg {
  transform: scale(1);
  border-radius: 0 0 0 0;
}
.tp-project-5-title-box-bg {
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  width: 100%;
  height: 100%;
  border-radius: 50%;
  opacity: 1;
  border-radius: 0 0 50% 50%;
  transform: scaleY(0);
  transform-origin: top center;
  background-color: #552411;
  transition: transform 0.3s cubic-bezier(0.19, 1, 0.22, 1), border-radius 0.3s cubic-bezier(0.5, 0, 0, 1);
  z-index: -1;
}

.tp-project-5-thumb-box {
  position: absolute;
  top: 70%;
  left: 10%;
  right: 0;
  width: 80%;
  height: 100%;
  z-index: -1;
  text-align: center;
  object-fit: cover;
  visibility: hidden;
  opacity: 0;
  transition: all 0.3s cubic-bezier(0.785, 0.135, 0.15, 0.86);
}

#tp-project-5-thumb-wrap.tp-project-5-thumb-box-1 {
  opacity: 1;
  visibility: visible;
}
#tp-project-5-thumb-wrap.tp-project-5-thumb-box-1 .tp-project-5-thumb-box-1 {
  top: 0;
  opacity: 1;
  visibility: visible;
}
#tp-project-5-thumb-wrap.tp-project-5-thumb-box-2 {
  opacity: 1;
  visibility: visible;
}
#tp-project-5-thumb-wrap.tp-project-5-thumb-box-2 .tp-project-5-thumb-box-2 {
  top: 0;
  opacity: 1;
  visibility: visible;
}
#tp-project-5-thumb-wrap.tp-project-5-thumb-box-3 {
  opacity: 1;
  visibility: visible;
}
#tp-project-5-thumb-wrap.tp-project-5-thumb-box-3 .tp-project-5-thumb-box-3 {
  top: 0;
  opacity: 1;
  visibility: visible;
}
#tp-project-5-thumb-wrap.tp-project-5-thumb-box-4 {
  opacity: 1;
  visibility: visible;
}
#tp-project-5-thumb-wrap.tp-project-5-thumb-box-4 .tp-project-5-thumb-box-4 {
  top: 0;
  opacity: 1;
  visibility: visible;
}

.tp-project-5-thumb.thumb-1 img {
  transform: rotate(-6deg);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-project-5-thumb.thumb-1 img {
    transform: rotate(0deg);
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-5-thumb.thumb-1 img {
    transform: scale(0.7);
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-project-5-thumb.thumb-1 img {
    transform: scale(0.7);
    margin-left: -50px;
  }
}
.tp-project-5-thumb.thumb-2 img {
  transform: rotate(6deg);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-project-5-thumb.thumb-2 img {
    transform: rotate(0deg);
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-5-thumb.thumb-2 img {
    transform: scale(0.7);
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-project-5-thumb.thumb-2 img {
    transform: scale(0.7);
    margin-right: -50px;
  }
}

.tp-project-5-section-subtitle, .tp-project-5-section-title, .tp-project-5-section-link {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  color: var(--tp-cream-2);
  text-transform: uppercase;
  font-family: var(--tp-ff-poppins);
  margin-bottom: 0;
}
@media (max-width: 767px) {
  .tp-project-5-section-subtitle, .tp-project-5-section-title, .tp-project-5-section-link {
    margin-bottom: 15px;
  }
}
.tp-project-5-section-link:hover {
  color: var(--tp-cream-2);
}
.tp-project-5-section-box {
  border-top: 1px solid rgba(207, 194, 146, 0.2);
  padding-top: 15px;
}
@media (max-width: 767px) {
  .tp-project-5-section-box {
    flex-wrap: wrap;
  }
}
.tp-project-5-2-title {
  font-size: 326px;
  font-weight: 400;
  line-height: 1;
  letter-spacing: -19.56px;
  text-transform: uppercase;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-project-5-2-title {
    font-size: 280px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-project-5-2-title {
    font-size: 230px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-project-5-2-title {
    font-size: 200px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-5-2-title {
    font-size: 160px;
  }
}
@media (max-width: 767px) {
  .tp-project-5-2-title {
    font-size: 60px;
    letter-spacing: -2.56px;
  }
}
@media (max-width: 767px) {
  .tp-project-5-2-title-box {
    margin-bottom: 0;
  }
}
.tp-project-5-2-item {
  display: inline-block;
  padding: 50px;
  padding-bottom: 55px;
  border: 1px solid var(--tp-cream-2);
  background: rgba(101, 54, 36, 0.9);
  backdrop-filter: blur(10px);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-5-2-item {
    margin-bottom: 40px;
  }
}
@media (max-width: 767px) {
  .tp-project-5-2-item {
    padding: 30px;
    padding-bottom: 35px;
    margin-bottom: 40px;
  }
}
.tp-project-5-2-item.space-left {
  margin-left: 200px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-project-5-2-item.space-left {
    margin-left: 0;
  }
}
.tp-project-5-2-item-wrap {
  margin-bottom: 200px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-project-5-2-item-wrap {
    margin-bottom: 0;
  }
}
.tp-project-5-2-item-wrap:last-child {
  margin-bottom: 180px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-project-5-2-item-wrap:last-child {
    margin-bottom: 0;
  }
}
.tp-project-5-2-thumb {
  margin-bottom: 50px;
}
.tp-project-5-2-thumb img {
  max-width: inherit;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-project-5-2-thumb img {
    max-width: 100%;
  }
}
.tp-project-5-2-content span {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-poppins);
  margin-bottom: 10px;
  display: inline-block;
}
.tp-project-5-2-title-sm {
  font-size: 50px;
  font-weight: 400;
  line-height: 1;
  letter-spacing: -2px;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
  margin-bottom: 0;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-project-5-2-title-sm {
    font-size: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-project-5-2-title-sm {
    font-size: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-project-5-2-title-sm {
    font-size: 35px;
  }
}
@media (max-width: 767px) {
  .tp-project-5-2-title-sm {
    font-size: 40px;
  }
}
.tp-project-5-2-btn {
  border-top: 1px solid var(--tp-cream-2);
  border-bottom: 1px solid var(--tp-cream-2);
  padding: 15px 0;
}
.tp-project-5-2-btn a {
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-poppins);
}
.tp-project-5-2-btn a span {
  left: 10px;
  top: 0px;
  overflow: hidden;
  position: relative;
}
.tp-project-5-2-btn a span svg {
  -webkit-transform: translateY(-2px);
  -moz-transform: translateY(-2px);
  -ms-transform: translateY(-2px);
  -o-transform: translateY(-2px);
  transform: translateY(-2px);
  position: absolute;
  bottom: -1px;
  left: 1px;
  -webkit-transition: all 0.2s ease-out;
  -moz-transition: all 0.2s ease-out;
  -ms-transition: all 0.2s ease-out;
  -o-transition: all 0.2s ease-out;
  transition: all 0.2s ease-out;
}
.tp-project-5-2-btn a span svg:last-child {
  left: -12px;
  bottom: -12px;
  -webkit-transform: translate(0, 0);
  -moz-transform: translate(0, 0);
  -ms-transform: translate(0, 0);
  -o-transform: translate(0, 0);
  transform: translate(0, 0);
  opacity: 0;
}
.tp-project-5-2-btn a:hover span svg:first-child {
  -webkit-transform: translate(16px, -16px);
  -moz-transform: translate(16px, -16px);
  -ms-transform: translate(16px, -16px);
  -o-transform: translate(16px, -16px);
  transform: translate(16px, -16px);
  opacity: 0;
  visibility: hidden;
}
.tp-project-5-2-btn a:hover span svg:last-child {
  opacity: 1;
  visibility: visible;
  -webkit-transform: translate(13px, -13px);
  -moz-transform: translate(13px, -13px);
  -ms-transform: translate(13px, -13px);
  -o-transform: translate(13px, -13px);
  transform: translate(13px, -13px);
}
.tp-project-5-2-shape {
  position: absolute;
  bottom: 0;
  left: -200px;
}

.tp-portfolio-11-slider-bg {
  height: 100vh;
  width: 100%;
  background-size: cover;
  background-position: center;
}
.tp-portfolio-11-slider-bg.slick-active .tp-portfolio-11-slider-link {
  opacity: 1;
}
.tp-portfolio-11-slider-bg.slick-active .tp-portfolio-11-slider-subtitle {
  opacity: 1;
}
.tp-portfolio-11-slider-bg.slick-active .tp-portfolio-11-slider-title {
  opacity: 1;
}
.tp-portfolio-11-slider-content {
  padding-left: 180px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-11-slider-content {
    padding-left: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-11-slider-content {
    padding-left: 40px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-11-slider-content {
    padding: 0 15px;
  }
}
.tp-portfolio-11-slider-link {
  margin-bottom: 30px;
  opacity: 0;
}
.tp-portfolio-11-slider-subtitle {
  font-size: 16px;
  font-weight: 600;
  line-height: 1.6;
  margin-bottom: 50px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  opacity: 0;
}
.tp-portfolio-11-slider-title {
  font-size: 130px;
  font-weight: 700;
  line-height: 0.85;
  letter-spacing: 2px;
  margin-bottom: 0;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-mango);
  opacity: 0;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-11-slider-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-11-slider-title {
    font-size: 90px;
  }
  .tp-portfolio-11-slider-title br {
    display: none;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-11-slider-title {
    font-size: 90px;
  }
  .tp-portfolio-11-slider-title br {
    display: none;
  }
}
.tp-portfolio-11-slider-active button {
  left: 40px;
  bottom: 60px;
  width: 55px;
  height: 56px;
  line-height: 53px;
  text-align: center;
  border-radius: 50%;
  position: absolute;
  color: var(--tp-common-white);
  border: 2px solid rgba(255, 255, 255, 0.2);
  transition: 0.3s;
  z-index: 99;
}
@media only screen and (min-width: 992px) {
  .tp-portfolio-11-slider-active button {
    display: none !important;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-11-slider-active button {
    left: 15px;
  }
}
.tp-portfolio-11-slider-active button.slick-next {
  margin-left: 70px;
}
.tp-portfolio-11-slider-active button i {
  font-weight: 500;
}
.tp-portfolio-11-slider-active button:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.tp-portfolio-11-slider-nav-item {
  cursor: pointer;
}
.tp-portfolio-11-slider-nav-thumb img {
  border-radius: 14px;
  box-shadow: 0px 20px 20px 0px rgba(0, 0, 0, 0.2);
}
.tp-portfolio-11-slider-nav-wrap {
  width: 1260px;
  position: absolute;
  bottom: 110px;
  right: -65px;
  z-index: 99;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-portfolio-11-slider-nav-wrap {
    right: -280px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-portfolio-11-slider-nav-wrap {
    right: -80px;
    width: 900px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-11-slider-nav-wrap {
    right: -80px;
    width: 600px;
  }
}
.tp-portfolio-11-slider-nav-wrap .slides-number {
  position: absolute;
  right: 12%;
  bottom: -10%;
  z-index: 99;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-portfolio-11-slider-nav-wrap .slides-number {
    right: 39%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-11-slider-nav-wrap .slides-number {
    right: 16%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-11-slider-nav-wrap .slides-number {
    right: 19%;
  }
}
.tp-portfolio-11-slider-nav-wrap .slides-number span {
  font-size: 50px;
  font-weight: 500;
  line-height: 1;
  text-align: center;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-body);
  min-width: 50px;
}
.tp-portfolio-11-slider-nav-wrap .slides-number .slider-line {
  height: 1px;
  width: 850px;
  margin-right: 45px;
  background-color: rgba(255, 255, 255, 0.2);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-portfolio-11-slider-nav-wrap .slides-number .slider-line {
    width: 500px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-portfolio-11-slider-nav-wrap .slides-number .slider-line {
    width: 520px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-11-slider-nav-wrap .slides-number .slider-line {
    width: 240px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-11-slider-nav-wrap .slides-number .slider-line {
    width: 215px;
  }
}
.tp-portfolio-11-slider-nav-active button {
  left: 0;
  width: 55px;
  bottom: -45px;
  height: 56px;
  line-height: 53px;
  text-align: center;
  border-radius: 50%;
  position: absolute;
  color: var(--tp-common-white);
  border: 2px solid rgba(255, 255, 255, 0.2);
  transition: 0.3s;
}
.tp-portfolio-11-slider-nav-active button.slick-next {
  margin-left: 70px;
}
.tp-portfolio-11-slider-nav-active button i {
  font-weight: 500;
}
.tp-portfolio-11-slider-nav-active button:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.tp-portfolio-11-slider-nav-active .slick-list {
  padding: 50px 0;
}
.tp-portfolio-11-slider-nav-content-wrap {
  position: absolute;
  top: 0;
  left: 0;
  height: 100%;
}
.tp-portfolio-11-slider-nav-content {
  height: 100%;
  padding: 30px;
}
.tp-portfolio-11-slider-nav-year span {
  height: 30px;
  font-size: 16px;
  font-weight: 700;
  border-radius: 4px;
  padding: 0px 12px;
  line-height: 30px;
  display: inline-block;
  backdrop-filter: blur(5px);
  color: var(--tp-common-white);
  font-family: var(--tp-ff-body);
  background: rgba(255, 255, 255, 0.2);
}
.tp-portfolio-11-slider-nav-subtittle {
  font-size: 13px;
  font-weight: 600;
  line-height: 10px;
  margin-bottom: 10px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-portfolio-11-slider-nav-tittle {
  font-size: 40px;
  font-weight: 400;
  line-height: 1;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-mango);
  margin-bottom: 0;
  letter-spacing: 1px;
}

.tp--hover-item {
  position: relative;
}

.tp--hover-img canvas {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  position: absolute;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-project-2-style {
    padding-bottom: 0;
  }
}
.creative-project-2-top {
  margin-bottom: 70px;
}
.creative-project-2-top .tp-section-subtitle {
  margin-bottom: 100px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-project-2-top .tp-section-subtitle {
    margin-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-project-2-top .tp-section-subtitle {
    margin-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-project-2-top .tp-section-subtitle {
    margin-bottom: 20px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-project-2-top .tp-section-title.fs-64 {
    font-size: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-project-2-top .tp-section-title.fs-64 {
    font-size: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-project-2-top .tp-section-title.fs-64 {
    font-size: 40px;
    margin-bottom: 30px;
  }
}

.design-project-2-style .design-project-title-box p {
  max-width: 350px;
}

/*----------------------------------------*/
/*  7.7 Funfact Css
/*----------------------------------------*/
.tp-funfact-img img {
  height: 144px;
  width: 144px;
  border-radius: 50%;
  object-fit: contain;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-funfact-img img {
    height: 100px;
    width: 100px;
    object-fit: contain;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-funfact-img img {
    height: 100%;
    width: 100%;
  }
}
.tp-funfact-green-wrap {
  padding-top: 130px;
  padding-bottom: 70px;
  border-right: 10px solid #fff;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-funfact-green-wrap {
    border-right: 0;
    border-bottom: 10px solid #fff;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-funfact-green-wrap {
    padding-top: 70px;
  }
}
.tp-funfact-shape-1 {
  position: absolute;
  bottom: 0;
  right: 0;
}
.tp-funfact-subtitle {
  font-weight: 600;
  font-size: 16px;
  line-height: 1.5;
  margin-bottom: 20px;
  display: inline-block;
  color: var(--tp-common-black);
}
@media (max-width: 767px) {
  .tp-funfact-subtitle {
    margin-bottom: 10px;
  }
}
.tp-funfact-title {
  font-weight: 700;
  font-size: 30px;
  line-height: 1;
  letter-spacing: -0.06em;
  text-transform: uppercase;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-funfact-title {
    padding-left: 0;
  }
}
.tp-funfact-number span {
  font-weight: 700;
  font-size: 400px;
  line-height: 1;
  margin-left: -20px;
  display: inline-block;
  letter-spacing: -0.1em;
  text-transform: uppercase;
  color: var(--tp-common-red-3);
  transform: translateY(-50px);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-funfact-number span {
    font-size: 300px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-funfact-number span {
    font-size: 200px;
    margin-left: 0;
    transform: translateY(0px);
  }
}
@media (max-width: 767px) {
  .tp-funfact-number span {
    font-size: 112px;
    margin-left: 0;
    transform: translateY(0px);
  }
}
.tp-funfact-number span i {
  color: var(--tp-common-red-3);
  -webkit-text-stroke: 6px #F8F8FB;
  margin-left: -15px;
  font-style: normal;
  display: inline-block;
  transform: rotate(-8deg);
}
@media (max-width: 767px) {
  .tp-funfact-number span i {
    margin-left: 0;
    transform: rotate(0);
  }
}
.tp-funfact-number span em {
  margin-right: 45px;
}
@media (max-width: 767px) {
  .tp-funfact-number span em {
    margin-right: 20px;
  }
}
.tp-funfact-green-wrap.pink-style .tp-funfact-subtitle {
  color: var(--tp-theme-pink);
}
.tp-funfact-green-wrap.pink-style .tp-funfact-title {
  color: var(--tp-theme-pink);
}
.tp-funfact-green-wrap.pink-style .tp-funfact-number span {
  color: var(--tp-theme-pink);
}
.tp-funfact-green-wrap.pink-style .tp-funfact-number span i {
  color: var(--tp-theme-pink);
}
.tp-funfact-green-wrap.yellow-style .tp-funfact-number span {
  color: var(--tp-theme-yellow);
}
.tp-funfact-green-wrap.yellow-style .tp-funfact-subtitle {
  color: var(--tp-theme-yellow);
}
.tp-funfact-green-wrap.yellow-style .tp-funfact-title {
  color: var(--tp-theme-yellow);
}
.tp-funfact-panel {
  width: 100%;
  height: 100%;
  will-change: transform;
  opacity: 1 !important;
}
.tp-funfact-panel-wrap {
  width: 300%;
  height: 100%;
  display: -webkit-box;
  display: -ms-flexbox;
  display: flex;
  -ms-flex-wrap: no-wrap;
  flex-wrap: no-wrap;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-funfact-panel-wrap {
    width: 100%;
    height: 100%;
    flex-wrap: wrap;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-funfact-content-wrap {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-funfact-content-wrap {
    padding-left: 0;
    margin-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .tp-funfact-big-img {
    display: none;
  }
}

.ar-funfact-item h4 {
  line-height: 0.8;
  font-size: 100px;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-regular);
}
.ar-funfact-item h4 i {
  font-style: normal;
}
.ar-funfact-item span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-funfact-item span {
    font-size: 15px;
  }
}
.ar-funfact-bg {
  padding: 45px 0;
  padding-bottom: 0;
}

.st-counter-wrapper {
  border-top: 1px solid rgba(69, 48, 48, 0.15);
  border-bottom: 1px solid rgba(69, 48, 48, 0.15);
}
.st-counter-wrapper .row [class*=col-]:not(:last-child) {
  border-right: 1px solid rgba(69, 48, 48, 0.15);
}
@media (max-width: 767px) {
  .st-counter-wrapper .row [class*=col-]:not(:last-child) {
    border: none;
  }
}
.st-counter-item {
  position: relative;
  padding-top: 105px;
  padding-bottom: 110px;
  z-index: 2;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .st-counter-item {
    padding-top: 70px;
    padding-bottom: 75px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-counter-item {
    padding: 70px 0;
  }
}
@media (max-width: 767px) {
  .st-counter-item {
    padding: 50px 0;
  }
}
.st-counter-item:hover::before {
  opacity: 1;
  height: 100%;
  visibility: visible;
}
.st-counter-item::before {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 0;
  width: 100%;
  opacity: 0;
  z-index: -1;
  visibility: hidden;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  background: linear-gradient(180deg, rgba(255, 255, 255, 0) 0%, rgba(255, 255, 255, 0.9) 100%);
}
.st-counter-item h4 {
  font-size: 80px;
  font-weight: 700;
  line-height: 1;
  margin-bottom: 20px;
  letter-spacing: -3.2px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-counter-item h4 {
    font-size: 60px;
    margin-bottom: 10px;
  }
}
.st-counter-item h4 i {
  font-style: normal;
}
.st-counter-item span {
  font-size: 18px;
  font-weight: 400;
  color: #494949;
  line-height: 1.3;
  display: inline-block;
  font-family: var(--tp-ff-poppins);
}

.ar-funfact-2-style .ar-funfact-item {
  position: relative;
  padding-left: 30px;
}
.ar-funfact-2-style .ar-funfact-item::after {
  position: absolute;
  content: "";
  top: -15px;
  left: 0;
  width: 1px;
  height: 140px;
  display: inline-block;
  background-color: rgba(255, 255, 255, 0.1);
}
.ar-funfact-2-style .ar-funfact-item h4 {
  color: var(--tp-common-white);
  font-family: var(--tp-ff-inter);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .ar-funfact-2-style .ar-funfact-item h4 {
    font-size: 75px;
  }
}
.ar-funfact-2-style .ar-funfact-item span {
  font-size: 18px;
  letter-spacing: 0;
  text-transform: capitalize;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-inter);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-funfact-2-style .ar-funfact-item span {
    font-size: 14px;
  }
}
.ar-funfact-2-border {
  position: relative;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.ar-funfact-2-border::after {
  position: absolute;
  bottom: -10px;
  left: 0;
  right: 0;
  height: 1px;
  width: 95%;
  content: "";
  margin: 0 auto;
  text-align: center;
  display: inline-block;
  background-color: rgba(255, 255, 255, 0.1);
}

/*----------------------------------------*/
/*  7.8 Work Css
/*----------------------------------------*/
@media (max-width: 767px) {
  .tp-work-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.tp-work-item {
  border: 4px solid #fff;
  padding: 45px 40px 45px 50px;
  background-color: #F6F6F9;
}
@media (max-width: 767px) {
  .tp-work-item {
    padding: 45px 30px 45px 35px;
  }
}
.tp-work-item.about-us-3-bg {
  border-radius: 20px;
  border-color: #FFFFE6;
  background-color: #FFFFE6;
}
.tp-work-item.about-us-3-bg .tp-work-number span {
  background-color: #E7FF48;
}
.tp-work-item.about-us-3-bg .tp-work-number i {
  color: #2A4C3A;
}
.tp-work-item.about-us-3-bg .tp-work-title {
  color: #2A4C3A;
}
.tp-work-number {
  margin-bottom: 45px;
  display: inline-block;
}
.tp-work-number span {
  height: 80px;
  width: 60px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  transform: rotate(30deg);
  background-color: var(--tp-common-red-3);
}
.tp-work-number i {
  position: absolute;
  top: 25px;
  left: 12px;
  font-style: italic;
  font-weight: 800;
  font-size: 30px;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-besley);
}
.tp-work-title {
  font-weight: 700;
  font-size: 30px;
  line-height: 1.2;
  letter-spacing: -0.04em;
  text-transform: uppercase;
  margin-bottom: 12px;
}
@media (max-width: 767px) {
  .tp-work-title {
    font-size: 25px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-work-title-box {
    margin-bottom: 40px;
  }
}
.tp-work-content p {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.5;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-work-content p br {
    display: none;
  }
}
.tp-work-wrapper {
  margin-left: 100px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-work-wrapper {
    margin-left: 60px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-work-wrapper {
    margin-left: 0px;
  }
}

.creative-work-content p {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.5;
  margin-bottom: 0;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-work-content p br {
    display: none;
  }
}
.creative-work-icon img {
  margin-bottom: 20px;
}
.creative-work-item {
  padding: 45px;
  border-radius: 20px;
  background-color: #0E0F11;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .creative-work-item {
    padding: 30px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-work-item {
    padding: 35px;
  }
}
.creative-work-bg {
  padding: 110px 100px;
  padding-bottom: 80px;
  border-radius: 20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .creative-work-bg {
    padding: 110px 70px;
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-work-bg {
    padding: 110px 30px;
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-work-bg {
    padding: 110px 50px;
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .creative-work-bg {
    padding: 110px 20px;
    padding-bottom: 80px;
  }
}
.creative-work-square-box {
  position: absolute;
  top: 0;
  left: 0;
  height: 100px;
  width: 400px;
  display: inline-block;
  border-radius: 0 0 20px 0;
  background-color: #0E0F11;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-work-square-box {
    top: -50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-work-square-box {
    display: none;
  }
}
.creative-work-square-box::after, .creative-work-square-box::before {
  content: "";
  position: absolute;
  bottom: 60px;
  right: -20px;
  height: 40px;
  width: 20px;
  border-top-left-radius: 20px;
  background-color: transparent;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .creative-work-square-box::after {
    bottom: 10px;
  }
}
.creative-work-square-box::before {
  bottom: -40px;
  left: 0px;
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-work-area {
    text-align: center;
    padding-bottom: 80px;
  }
}
.design-work-item img {
  width: 100%;
  border-radius: 30px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .design-work-item img {
    margin-bottom: 60px;
  }
}
@media (max-width: 767px) {
  .design-work-item img {
    margin-bottom: 30px;
  }
}
.design-work-content {
  position: absolute;
  top: 50%;
  left: 0;
  right: 0;
  margin: 0 auto;
  max-width: 420px;
  text-align: center;
  display: inline-block;
  transform: translateY(-50%);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-work-content {
    position: static;
    margin-bottom: 60px;
    transform: translateY(0);
  }
}
.design-work-content p {
  font-weight: 500;
  font-size: 24px;
  line-height: 1.25;
  color: #e0eeee;
  margin-bottom: 55px;
  letter-spacing: -0.02em;
}
@media (max-width: 767px) {
  .design-work-content p {
    font-size: 20px;
  }
}
.design-work-content img {
  margin-bottom: 30px;
}

.creative-work-2-style .tp-section-title.fs-44 {
  font-weight: 500;
}

/*----------------------------------------*/
/*  7.9 Testimonail Css
/*----------------------------------------*/
.tp-testimonial-bg {
  padding-top: 160px;
  padding-bottom: 125px;
  border-radius: 50px 50px 0 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-testimonial-bg {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media (max-width: 767px) {
  .tp-testimonial-bg {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.tp-testimonial-ratting {
  display: inline-block;
  border-radius: 100px;
  padding: 11px 16px;
  padding-right: 30px;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-testimonial-ratting img {
  flex: 0 0 auto;
  margin-right: 15px;
}
.tp-testimonial-ratting-icon span {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  margin-right: 4px;
  display: inline-block;
  letter-spacing: -0.04em;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-testimonial-ratting-icon i {
  font-size: 14px;
  color: #ef2b10;
}
.tp-testimonial-ratting-icon i svg {
  transform: translateY(-3px);
}
.tp-testimonial-ratting-info p {
  font-weight: 500;
  font-size: 13px;
  line-height: 1.2;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  color: rgba(255, 255, 255, 0.6);
}
.tp-testimonial-item {
  transition: 0.3s;
  margin: 0px -25px;
  display: inline-block;
  padding: 30px 30px 45px 30px;
  background-color: var(--tp-common-red-3);
  border: 6px solid var(--tp-common-black-3);
}
@media (max-width: 767px) {
  .tp-testimonial-item {
    margin: 0;
  }
}
.tp-testimonial-item.grey-style {
  transform: rotate(-7deg);
  background-color: #E1E1E1;
}
@media (max-width: 767px) {
  .tp-testimonial-item.grey-style {
    transform: rotate(0);
  }
}
.tp-testimonial-item.green-style {
  margin-top: 70px;
  position: relative;
  z-index: 2;
  transform: rotate(2deg);
}
.tp-testimonial-item.green-style .tp-testimonial-text p {
  color: var(--tp-common-white);
}
.tp-testimonial-item.green-style .tp-testimonial-author-info span {
  color: var(--tp-common-white);
}
.tp-testimonial-item.green-style .tp-testimonial-author-info p {
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-testimonial-item.green-style {
    margin-top: 0;
    transform: rotate(0);
  }
}
.tp-testimonial-item.black-style {
  margin-top: -50px;
  transform: rotate(2deg);
  background: #2a2a2a;
}
@media (max-width: 767px) {
  .tp-testimonial-item.black-style {
    margin-top: 0;
    transform: rotate(0);
  }
}
.tp-testimonial-item.black-style .tp-testimonial-text p {
  color: var(--tp-common-white);
}
.tp-testimonial-item.black-style .tp-testimonial-author-info span {
  color: var(--tp-common-white);
}
.tp-testimonial-item.black-style .tp-testimonial-author-info p {
  color: rgba(255, 255, 255, 0.5);
}
.tp-testimonial-item.white-style {
  position: relative;
  z-index: 2;
  transform: rotate(-7deg);
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-testimonial-item.white-style {
    transform: rotate(0);
  }
}
.tp-testimonial-item:hover {
  position: relative;
  z-index: 5;
}
.tp-testimonial-text p {
  font-weight: 500;
  font-size: 22px;
  line-height: 1.27;
  margin-bottom: 65px;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
}
.tp-testimonial-avater {
  flex: 0 0 auto;
  margin-right: 12px;
}
.tp-testimonial-avater img {
  height: 50px;
  width: 50px;
  border-radius: 50%;
}
.tp-testimonial-author-info span {
  font-weight: 700;
  font-size: 18px;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.tp-testimonial-author-info p {
  font-weight: 500;
  font-size: 14px;
  line-height: 1.43;
  color: #4d5051;
  margin-bottom: 0;
}
.tp-testimonial-slider-active {
  padding-top: 180px;
  margin: 0px -100px;
}
@media (max-width: 767px) {
  .tp-testimonial-slider-active {
    padding-top: 60px;
    margin: 0;
  }
}
.tp-testimonial-global img.global-img {
  position: absolute;
  top: 25%;
  left: 0;
  right: 0;
  text-align: center;
  width: 900px;
  margin: 0 auto;
  padding-top: 100px;
  animation: animationglob 30s cubic-bezier(1, 0.99, 0.03, 0.01) infinite;
  -webkit-animation: animationglob 50s cubic-bezier(1, 0.99, 0.03, 0.01) infinite;
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-testimonial-global img.global-img {
    top: 10%;
  }
}
.tp-testimonial-global img.overlay-img {
  position: absolute;
  top: 16%;
  left: 0;
  right: 0;
  text-align: center;
  margin: 0 auto;
  z-index: 2;
}

.dgm-testimonial-quote {
  margin-bottom: 15px;
}
.dgm-testimonial-quote span {
  color: var(--tp-common-black);
}
.dgm-testimonial-text {
  margin-bottom: 35px;
}
.dgm-testimonial-text p {
  font-weight: 400;
  font-size: 22px;
  line-height: 1.56;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-testimonial-author {
  display: inline-block;
}
.dgm-testimonial-author-wrap {
  margin-bottom: 40px;
}
.dgm-testimonial-author-img {
  border-radius: 50%;
  border: 2px solid var(--tp-common-white);
}
.dgm-testimonial-author-logo {
  position: absolute;
  bottom: -5px;
  right: 0;
  border-radius: 50%;
  border: 2px solid var(--tp-common-white);
}
.dgm-testimonial-author-name {
  font-weight: 700;
  font-size: 18px;
  margin-bottom: 5px;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-testimonial-author-info {
  line-height: 1;
  margin-left: 15px;
  text-align: left;
}
.dgm-testimonial-author-info span {
  font-weight: 500;
  font-size: 14px;
  line-height: 1.43;
  color: #525356;
}
.dgm-testimonial-slider-wrap {
  padding: 0px 170px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .dgm-testimonial-slider-wrap {
    padding: 0px 80px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .dgm-testimonial-slider-wrap {
    padding: 0px 70px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-testimonial-slider-wrap {
    padding: 0px;
  }
}
.dgm-testimonial-dot .swiper-pagination-bullet {
  width: 12px;
  height: 12px;
  opacity: 1;
  transition: 0.3s;
  border-radius: 50%;
  display: inline-block;
  background: transparent;
  border: 1px solid rgba(20, 24, 32, 0.3);
}
.dgm-testimonial-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .dgm-testimonial-space {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .dgm-testimonial-space {
    padding-top: 0;
  }
}
.dgm-testimonial-bg {
  position: absolute;
  height: 100%;
  width: 100%;
  z-index: 0;
  background-repeat: no-repeat;
  background-position: right bottom;
}
.dgm-testimonial-thumb {
  position: absolute;
  top: 0;
  left: 0;
  height: 100%;
  width: 50%;
  overflow: hidden;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-testimonial-thumb {
    position: relative;
    width: 100%;
    height: 500px;
    margin-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-testimonial-thumb {
    position: relative;
    width: 100%;
    height: 400px;
    margin-bottom: 60px;
  }
}
@media (max-width: 767px) {
  .dgm-testimonial-thumb {
    position: relative;
    width: 100%;
    height: 250px;
    margin-bottom: 60px;
  }
}
.dgm-testimonial-thumb img {
  width: 100%;
  height: 100%;
  object-fit: cover;
}
.dgm-testimonial-thumb .anim-zoomin-wrap {
  height: 100%;
}
.dgm-testimonial-playbtn {
  position: absolute;
  top: 50%;
  left: 0;
  right: 0;
  width: 100px;
  height: 100px;
  margin: 0 auto;
  line-height: 100px;
  text-align: center;
  border-radius: 50%;
  transform: translateY(-50%);
  display: inline-block;
  backdrop-filter: blur(14px);
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
  animation: animate-pulse 3s linear infinite;
}
.dgm-testimonial-playbtn span {
  margin-left: 2px;
}
.dgm-testimonial-playbtn:hover {
  transform: translateY(-50%) scale(1.1);
}
.dgm-testimonial-radius {
  border-radius: 20px;
  overflow: hidden;
  background-size: cover;
  background-repeat: no-repeat;
}

.creative-testimonial-item {
  padding: 35px 35px;
  border-radius: 20px;
  background-color: #1a1b1e;
}
.creative-testimonial-avater img {
  flex: 0 0 auto;
  border-radius: 50%;
  margin-right: 13px;
  height: 54px;
  width: 54px;
}
.creative-testimonial-avater-info {
  line-height: 1;
}
.creative-testimonial-avater-info h4 {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 8px;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
}
.creative-testimonial-avater-info span {
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  letter-spacing: -0.03em;
  color: rgba(255, 255, 255, 0.6);
}
.creative-testimonial-avater-wrap {
  margin-bottom: 35px;
}
@media (max-width: 767px) {
  .creative-testimonial-avater-wrap {
    flex-wrap: wrap;
  }
}
.creative-testimonial-text p {
  font-weight: 600;
  font-size: 26px;
  line-height: 1.3;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .creative-testimonial-text p {
    font-size: 24px;
  }
}
.creative-testimonial-text p span {
  margin-right: 8px;
  display: inline-block;
}
.creative-testimonial-text p span svg {
  transform: translateY(-7px);
}
.creative-testimonial-active {
  margin-right: -370px;
}
@media (max-width: 767px) {
  .creative-testimonial-active {
    margin: 0;
  }
}
.creative-testimonial-slider-wrap .tp-scrollbar {
  margin-top: 80px;
  height: 2px;
  width: 100%;
  overflow: hidden;
  background: rgba(255, 255, 255, 0.1);
}
@media (max-width: 767px) {
  .creative-testimonial-slider-wrap .tp-scrollbar {
    margin-top: 40px;
  }
}
.creative-testimonial-slider-wrap .tp-scrollbar .swiper-scrollbar-drag {
  background: #fff;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-testimonial-arrow {
    margin-bottom: 30px;
  }
}
.creative-testimonial-arrow button {
  height: 40px;
  width: 40px;
  line-height: 1;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  transition: 0.3s;
  color: var(--tp-common-white);
  background-color: #242426;
}
.creative-testimonial-arrow button:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-light);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-testimonial-btn {
    margin-bottom: 30px;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-testimonial-area {
    padding-top: 0px;
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .design-testimonial-area {
    padding-top: 0;
    padding-bottom: 80px;
  }
}
.design-testimonial-right .tp-testimonial-ratting-box {
  transform: translateY(-45px);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-testimonial-right .tp-testimonial-ratting-box {
    transform: translateY(0);
  }
}
.design-testimonial-slide-wrap.studio-testimonial-color .design-testimonial-author h4 {
  color: var(--tp-common-cream);
}
.design-testimonial-slide-wrap.studio-testimonial-color .design-testimonial-review h4 {
  color: var(--tp-common-cream);
}
.design-testimonial-slide-wrap.studio-testimonial-color .design-testimonial-text p {
  color: var(--tp-common-cream);
}
.design-testimonial-item {
  padding: 50px 60px;
  border-radius: 30px;
  background-color: #1a1b1e;
}
@media (max-width: 767px) {
  .design-testimonial-item {
    padding: 40px 30px;
  }
}
.design-testimonial-author {
  margin-bottom: 60px;
}
.design-testimonial-author h4 {
  font-weight: 600;
  font-size: 20px;
  line-height: 1.5;
  color: #e0eeee;
  margin-bottom: 0;
  letter-spacing: -0.02em;
}
.design-testimonial-author span {
  font-weight: 400;
  font-size: 18px;
  line-height: 1.67;
  color: #999da6;
  letter-spacing: -0.02em;
}
.design-testimonial-review {
  margin-bottom: 10px;
}
.design-testimonial-review h4 {
  font-weight: 500;
  font-size: 100px;
  line-height: 1;
  color: #e0eeee;
  margin-bottom: 0;
  margin-right: 15px;
  letter-spacing: -0.08em;
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .design-testimonial-review h4 {
    font-size: 80px;
  }
}
.design-testimonial-review-icon {
  transform: translateY(-15px);
}
.design-testimonial-text p {
  font-weight: 500;
  font-size: 24px;
  color: #e0eeee;
  line-height: 1.42;
  margin-bottom: 0;
  letter-spacing: -0.02em;
}
@media (max-width: 767px) {
  .design-testimonial-text p {
    font-size: 20px;
  }
}
.design-testimonial-active {
  margin: 0px -380px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-testimonial-active {
    margin: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-testimonial-area {
    padding-top: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-testimonial-area {
    padding-bottom: 120px;
  }
}

.ar-testimonial-item p {
  font-size: 36px;
  line-height: 1.2;
  margin-bottom: 0;
  letter-spacing: 0;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-regular);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-testimonial-item p {
    font-size: 34px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-testimonial-item p {
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .ar-testimonial-item p {
    font-size: 30px;
  }
  .ar-testimonial-item p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-testimonial-arrow {
    text-align: center;
    margin-top: 70px;
  }
}
.ar-testimonial-arrow button {
  width: 50px;
  height: 50px;
  line-height: 1;
  transition: 0.3s;
  border-radius: 50%;
  display: inline-block;
  border: 1px solid rgba(25, 25, 25, 0.1);
}
.ar-testimonial-arrow button:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-red-2);
  background-color: var(--tp-common-red-2);
}
.ar-testimonial-arrow button span svg {
  margin-left: 1px;
}
.ar-testimonial-arrow button.ar-testimonial-prev, .ar-testimonial-arrow button.ar-testimonial-next {
  position: absolute;
  top: 50%;
  left: -85px;
  transform: translateY(-50%);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-testimonial-arrow button.ar-testimonial-prev, .ar-testimonial-arrow button.ar-testimonial-next {
    position: static;
  }
}
.ar-testimonial-arrow button.ar-testimonial-next {
  left: auto;
  right: -85px;
}
.ar-testimonial-shape-1 {
  position: absolute;
  top: -52%;
  left: -2%;
  right: 0;
  z-index: -1;
  text-align: center;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-testimonial-area {
    padding-bottom: 80px;
  }
}
.ar-testimonial-author span {
  font-weight: 600;
  font-size: 16px;
  text-align: center;
  color: var(--tp-common-cream-3);
}
.ar-testimonial-author span i {
  font-style: normal;
  color: rgba(255, 253, 225, 0.5);
}
.ar-testimonial-quote {
  margin-bottom: 35px;
}
.ar-testimonial-quote span {
  color: var(--tp-common-cream-3);
}

.fraction-wrapper {
  position: absolute;
  bottom: -80px;
  left: 50%;
  width: 270px;
  -webkit-transform: translateX(-50%);
  -moz-transform: translateX(-50%);
  -ms-transform: translateX(-50%);
  -o-transform: translateX(-50%);
  transform: translateX(-50%);
  z-index: 1;
  height: 12px;
}
.fraction-wrapper #paginations span {
  font-size: 16px;
  color: var(--tp-common-black);
}
.fraction-wrapper #paginations span:last-child {
  float: right;
}

#paginations {
  position: absolute;
  bottom: -7px;
  left: 50%;
  -webkit-transform: translateX(-50%);
  -moz-transform: translateX(-50%);
  -ms-transform: translateX(-50%);
  -o-transform: translateX(-50%);
  transform: translateX(-50%);
  z-index: 1;
}

.shop-slider-progress-bar {
  position: absolute;
  top: 50%;
  left: 50%;
  width: 200px;
  height: 1px;
  z-index: 11;
  background-color: #d9d9d9;
  -webkit-transform: translate(-50%, -50%);
  -moz-transform: translate(-50%, -50%);
  -ms-transform: translate(-50%, -50%);
  -o-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
}

.crp-testimonial-style .ar-testimonial-item p {
  font-weight: 400;
  font-size: 40px;
  line-height: 1.1;
  padding: 0px 20px;
  margin-bottom: 30px;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-testimonial-style .ar-testimonial-item p {
    padding: 0;
  }
  .crp-testimonial-style .ar-testimonial-item p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-testimonial-style .ar-testimonial-item p {
    padding: 0;
    font-size: 35px;
  }
  .crp-testimonial-style .ar-testimonial-item p br {
    display: none;
  }
}
@media (max-width: 767px) {
  .crp-testimonial-style .ar-testimonial-item p {
    font-size: 27px;
    padding: 0;
  }
  .crp-testimonial-style .ar-testimonial-item p br {
    display: none;
  }
}
.crp-testimonial-style .ar-testimonial-arrow button {
  color: var(--tp-common-cream-3);
  border: 1px solid rgba(255, 253, 225, 0.1);
}
.crp-testimonial-style .ar-testimonial-arrow button:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-yellow-green);
  background-color: var(--tp-common-yellow-green);
}

@media (max-width: 767px) {
  .app-testimonial-ptb {
    padding-bottom: 100px;
  }
}
.app-testimonial-shape .shape-1 {
  position: absolute;
  right: 21%;
  top: 8%;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-testimonial-shape .shape-1 {
    right: 15%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-testimonial-shape .shape-1 {
    display: none;
  }
}
.app-testimonial-shape .shape-2 {
  position: absolute;
  left: 21%;
  top: 22%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-testimonial-shape .shape-2 {
    left: 12%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-testimonial-shape .shape-2 {
    display: none;
  }
}
.app-testimonial-shape .shape-3 {
  top: 0;
  left: 50%;
  position: absolute;
  transform: translateX(-50%);
}
.app-testimonial-big-text {
  top: 80px;
  left: 50%;
  position: absolute;
  transform: translateX(-50%);
}
.app-testimonial-big-text h3 {
  margin: 0;
  font-size: 320px;
  font-weight: 700;
  text-transform: uppercase;
  font-family: var(--tp-ff-phudu);
  background: linear-gradient(180deg, rgba(33, 33, 45, 0.04) 0%, rgba(33, 33, 45, 0.02) 100%);
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .app-testimonial-big-text h3 {
    font-size: 235px;
  }
}
@media (max-width: 767px) {
  .app-testimonial-big-text h3 {
    font-size: 182px;
  }
}
.app-testimonial-review {
  width: 290px;
  display: flex;
  padding: 9px 16px;
  align-items: center;
  border-radius: 100px;
  border: 1px solid #FFF;
  background: linear-gradient(180deg, rgba(255, 255, 255, 0.6) 0.96%, rgba(224, 225, 233, 0.6) 100%);
  box-shadow: 0px 1px 2px 0px rgba(33, 33, 45, 0.1);
  backdrop-filter: blur(5px);
}
.app-testimonial-review-width {
  display: flex;
  justify-content: center;
}
.app-testimonial-review-icon {
  margin-right: 12px;
}
.app-testimonial-review-content span {
  font-size: 16px;
  font-weight: 600;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.64px;
  text-transform: uppercase;
  color: var(--tp-common-black-10);
}
.app-testimonial-review-content span i {
  font-style: normal;
  margin-right: 5px;
}
.app-testimonial-review-content p {
  font-size: 13px;
  margin-bottom: 0;
  line-height: 1;
  letter-spacing: -0.13px;
}
.app-testimonial-content {
  text-align: start;
}
.app-testimonial-content p {
  font-size: 24px;
  font-weight: 500;
  line-height: 1.5;
  margin-bottom: 0;
  color: var(--tp-common-black);
}
.app-testimonial-item {
  padding: 30px;
  border-radius: 24px;
  margin: 17px;
  min-width: 460px;
  background: var(--tp-common-white);
  box-shadow: 0px 4px 12px 0px rgba(33, 33, 45, 0.08);
}
.app-testimonial-item-icon {
  margin-right: 15px;
}
.app-testimonial-item-icon span {
  display: inline-block;
  height: 60px;
  width: 60px;
  line-height: 55px;
  text-align: center;
  border-radius: 50%;
  border: 1px solid rgba(33, 33, 45, 0.08);
}
.app-testimonial-item-icon-title {
  font-size: 16px;
  font-weight: 600;
  margin-bottom: 0;
  color: var(--tp-common-black-10);
}
.app-testimonial-item-icon-content p {
  margin: 0;
  color: #494954;
  font-size: 14px;
  font-weight: 400;
  line-height: 28px;
}
.app-testimonial-item-content p {
  color: #494954;
  letter-spacing: -0.18px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-testimonial-item-content p br {
    display: none;
  }
}
.app-testimonial-item-star {
  line-height: 1;
}
.app-testimonial-wrapper {
  display: flex;
  align-items: flex-start;
  justify-content: flex-start;
  animation: marquee-horizontal 30s linear infinite;
}
@media (max-width: 767px) {
  .app-testimonial-wrapper {
    animation: marquee-horizontal 10s linear infinite;
  }
}
.app-testimonial-wrapper:hover {
  animation-play-state: paused;
}
.app-testimonial-slider {
  margin-left: -250px;
}
@media (max-width: 767px) {
  .app-testimonial-slider {
    margin-left: 0;
  }
}

@media (max-width: 767px) {
  .it-testimonial-ptb {
    padding-top: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-testimonial-thumb {
    margin-bottom: 30px;
  }
}
.it-testimonial-thumb img {
  border-radius: 50%;
}
.it-testimonial-content {
  margin-left: 30px;
  margin-top: 10px;
}
.it-testimonial-content img {
  margin-bottom: 23px;
}
.it-testimonial-content p {
  font-weight: 300;
  font-size: 24px;
  line-height: 1.3;
  color: #61616a;
  margin-bottom: 25px;
  letter-spacing: 0.02em;
  font-family: var(--tp-ff-platform);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-testimonial-content p br {
    display: none;
  }
}
.it-testimonial-content span {
  font-weight: 500;
  font-size: 24px;
  line-height: 1.1;
  letter-spacing: 0.04em;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-platform);
}
@media (max-width: 767px) {
  .it-testimonial-arrow {
    display: none;
  }
}
.it-testimonial-arrow button {
  width: 50px;
  height: 50px;
  line-height: 1;
  border-radius: 60px;
  background-color: var(--tp-common-white);
  border: 1px solid rgba(33, 33, 45, 0.1);
}
.it-testimonial-arrow button:hover {
  background-color: #7463FF;
  color: var(--tp-common-white);
}
.it-testimonial-prev {
  position: absolute;
  top: 50%;
  left: -15%;
  transform: translateY(-50%);
}
.it-testimonial-next {
  position: absolute;
  top: 50%;
  right: -12%;
  transform: translateY(-50%);
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-testimonial-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
.st-testimonial-shape-1 {
  position: absolute;
  left: 0;
  right: 0;
  top: 20%;
  z-index: -1;
  margin: 0 auto;
  text-align: center;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-testimonial-shape-1 {
    display: none;
  }
}
.st-testimonial-shape-2 {
  position: absolute;
  right: 20%;
  top: 20%;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-testimonial-shape-2 {
    display: none;
  }
}
.st-testimonial-box {
  padding: 45px 55px 50px;
  border-radius: 15px;
  background: var(--tp-common-white);
  box-shadow: -10px 10px 60px 0px #EBE4DB;
}
.st-testimonial-box-top {
  padding-bottom: 40px;
  margin-bottom: 40px;
  border-bottom: 1px solid rgba(69, 48, 48, 0.15);
}
.st-testimonial-box-top i {
  display: block;
  color: #494949;
  font-size: 18px;
  font-style: normal;
  font-weight: 400;
  text-transform: uppercase;
}
.st-testimonial-box-rating {
  font-size: 80px;
  font-weight: 700;
  letter-spacing: -3.2px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
.st-testimonial-box-star {
  margin-bottom: 15px;
  display: inline-block;
}
.st-testimonial-box-star svg {
  margin-right: 2px;
}
.st-testimonial-box-content p {
  margin: 0;
  font-size: 20px;
  font-weight: 500;
  letter-spacing: -0.4px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .st-testimonial-box-content p {
    font-size: 18px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-testimonial-box-content p {
    font-size: 16px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-testimonial-box-content p br {
    display: none;
  }
}
.st-testimonial-wrapper {
  margin-right: -300px;
}
@media (max-width: 767px) {
  .st-testimonial-wrapper {
    margin-right: 0;
  }
}
.st-testimonial-item {
  position: relative;
  padding: 60px 40px;
  border-radius: 15px;
  background: var(--tp-common-brown);
}
@media (max-width: 767px) {
  .st-testimonial-item {
    padding: 45px 30px;
  }
}
.st-testimonial-item-user {
  position: absolute;
  bottom: 60px;
  left: 40px;
  height: calc(100% - 120px);
  display: inline-block;
  padding-right: 30px;
  margin-right: 30px;
  writing-mode: sideways-lr;
  border-right: 1px solid rgba(255, 255, 255, 0.2);
}
@media (max-width: 767px) {
  .st-testimonial-item-user {
    position: static;
    writing-mode: unset;
    padding-right: 0;
    margin-right: 0;
    border-right: none;
  }
}
.st-testimonial-item-user span {
  font-size: 24px;
  font-weight: 500;
  margin-right: 10px;
  display: inline-block;
  letter-spacing: -0.48px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-poppins);
}
.st-testimonial-item-user p {
  font-size: 17px;
  font-weight: 400;
  margin-bottom: 0;
  line-height: 1;
  color: rgba(255, 255, 255, 0.6);
}
.st-testimonial-item-content {
  margin-left: 120px;
}
@media (max-width: 767px) {
  .st-testimonial-item-content {
    margin-left: 0;
    margin-top: 30px;
  }
}
.st-testimonial-item-content p {
  font-size: 24px;
  font-weight: 400;
  margin-bottom: 20px;
  letter-spacing: -0.48px;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-testimonial-item-content p {
    font-size: 20px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-testimonial-item-content p br {
    display: none;
  }
}
.st-testimonial-item-content p i {
  font-style: normal;
  color: var(--tp-common-white);
}
.st-testimonial-item-quote {
  margin-bottom: 25px;
}
.st-testimonial-bottom {
  margin-top: 55px;
}
.st-testimonial-bottom span {
  font-size: 18px;
  font-weight: 600;
  color: #494949;
  display: inline-block;
  letter-spacing: -0.36px;
  text-transform: uppercase;
}
.st-testimonial-bottom span a {
  color: var(--tp-common-brown);
  text-decoration: underline;
}
.cr-testimonial-ptb {
  border-bottom: 1px solid rgba(255, 255, 255, 0.07);
}
.cr-testimonial-box {
  padding: 24px 24px 24px 0;
  border-left: 1px solid rgba(255, 255, 255, 0.07);
  border-right: 1px solid rgba(255, 255, 255, 0.07);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-testimonial-box {
    padding: 20px;
  }
}
.cr-testimonial-title {
  font-size: 30px;
  font-weight: 500;
  letter-spacing: -0.6px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
.cr-testimonial-content {
  padding-bottom: 70px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-testimonial-content {
    padding-bottom: 30px;
  }
}
.cr-testimonial-content span {
  font-size: 36px;
  font-weight: 700;
  margin-bottom: 5px;
  display: inline-block;
  letter-spacing: -1.08px;
  color: var(--tp-common-white);
}
.cr-testimonial-content span svg {
  display: inline-block;
  transform: translateY(-10px);
}
.cr-testimonial-content p {
  color: #AAAAB2;
  font-size: 15px;
  font-weight: 500;
  margin: 0;
}
.cr-testimonial-wrapper {
  border-radius: 6px;
  background: #131416;
  box-shadow: 0px 0px 4px 0px rgba(255, 255, 255, 0.12) inset, 0px 0px 2px 2px rgba(0, 0, 0, 0.4);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-testimonial-wrap {
    padding-bottom: 50px;
    padding-left: 0;
  }
}
.cr-testimonial-item {
  margin: 60px 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cr-testimonial-item {
    margin: 60px 70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cr-testimonial-item {
    margin: 60px 85px;
  }
}
@media (max-width: 767px) {
  .cr-testimonial-item {
    margin: 30px;
  }
}
.cr-testimonial-item-shape {
  top: -5px;
  left: 50%;
  line-height: 1;
  position: absolute;
  transform: translateX(-50%);
}
.cr-testimonial-item-subtitle {
  color: #AAAAB2;
  font-size: 11px;
  font-weight: 600;
  margin-bottom: 5px;
  text-transform: uppercase;
}
.cr-testimonial-item-title {
  font-size: 24px;
  font-weight: 400;
  line-height: 1.4;
  margin-bottom: 40px;
  letter-spacing: -0.48px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
@media (max-width: 767px) {
  .cr-testimonial-item-title {
    font-size: 20px;
  }
}
.cr-testimonial-item-user span {
  font-size: 18px;
  font-weight: 700;
  letter-spacing: -0.18px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
.cr-testimonial-item-user p {
  margin: 0;
  font-size: 14px;
  font-weight: 500;
  color: rgba(255, 255, 255, 0.5);
}
.cr-testimonial-nav {
  display: flex;
  gap: 10px;
  padding-top: 55px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-testimonial-nav {
    padding-top: 20px;
  }
}
.cr-testimonial-nav button {
  display: grid;
  height: 50px;
  width: 50px;
  place-content: center;
  display: inline-block;
  border-radius: 40px;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.06);
  background: rgba(255, 255, 255, 0.06);
  backdrop-filter: blur(10px);
}
.cr-testimonial-nav button svg {
  display: inline-block;
  transform: translateY(-2px);
}
.cr-testimonial-nav button:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}

@media (max-width: 767px) {
  .pp-testimonial-ptb {
    padding-bottom: 100px;
  }
}

@media (max-width: 767px) {
  .tp-testimonial-15-area {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
.tp-testimonial-15-bg {
  position: absolute;
  top: 0;
  right: 0;
  width: 100%;
  height: 100%;
  mix-blend-mode: luminosity;
}
.tp-testimonial-15-bg img {
  width: 100%;
  height: 100%;
  object-fit: cover;
}
.tp-testimonial-15-content p {
  font-size: 50px;
  font-weight: 400;
  line-height: 1.2;
  letter-spacing: -2px;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
  margin-bottom: 55px;
}
@media (max-width: 767px) {
  .tp-testimonial-15-content p {
    font-size: 36px;
  }
}
.tp-testimonial-15-content span {
  font-size: 20px;
  font-weight: 500;
  line-height: 1;
  color: var(--tp-cream-2);
  font-family: var(--tp-ff-playfair);
}
.tp-testimonial-15-content span::before {
  content: "";
  display: inline-block;
  height: 2px;
  width: 30px;
  background-color: var(--tp-cream-2);
  transform: translateY(-5px);
  margin-right: 15px;
}
.tp-testimonial-15-content .quote-shape {
  position: absolute;
  top: -37px;
  left: -70px;
  z-index: -1;
  font-style: normal;
  color: #6F402E;
  stroke-width: 0.5px;
  stroke: rgba(207, 194, 146, 0.2);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-testimonial-15-content .quote-shape {
    top: -38px;
    left: -10px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-testimonial-15-content .quote-shape {
    left: 0px;
  }
}
@media (max-width: 767px) {
  .tp-testimonial-15-content .quote-shape {
    top: -50px;
    left: 0;
  }
}

/*----------------------------------------*/
/*  8.0 Award Css
/*----------------------------------------*/
.tp-award-area {
  position: relative;
  z-index: 5;
  margin-top: -1px;
}
.tp-award-top-wrap {
  padding: 30px 30px;
  padding-bottom: 0;
  border-top: 1px solid rgba(255, 255, 255, 0.1);
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-award-top-wrap {
    margin-bottom: 100px;
  }
}
@media (max-width: 767px) {
  .tp-award-top-wrap {
    margin-bottom: 80px;
  }
}
.tp-award-subtitle {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-red-3);
}
.tp-award-item {
  padding: 37px 30px;
  padding-bottom: 31px;
  transition: 0.3s;
  position: relative;
  background-color: var(--tp-common-black-2);
}
@media (max-width: 767px) {
  .tp-award-item {
    padding: 37px 20px;
    padding-bottom: 31px;
  }
}
.tp-award-item::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 0;
  width: 100%;
  transition: 0.3s ease-in-out;
  background-color: var(--tp-common-red-3);
}
.tp-award-item:hover .tp-award-year, .tp-award-item:hover .tp-award-text, .tp-award-item:hover .tp-award-position, .tp-award-item:hover .tp-award-icon {
  color: var(--tp-common-white);
}
.tp-award-item:hover::after {
  height: 100%;
}
.tp-award-year {
  font-weight: 400;
  font-size: 20px;
  line-height: 1;
  min-width: 170px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
  transition: 0.3s;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-award-year {
    font-size: 14px;
    min-width: 70px;
  }
}
@media (max-width: 767px) {
  .tp-award-year {
    font-size: 14px;
    min-width: 70px;
    display: block;
    margin-bottom: 10px;
  }
}
.tp-award-text {
  font-weight: 600;
  font-size: 20px;
  line-height: 1;
  transition: 0.3s;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-award-text {
    font-size: 17px;
  }
}
@media (max-width: 767px) {
  .tp-award-text {
    font-size: 14px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-award-text {
    font-size: 20px;
  }
}
.tp-award-position {
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  transition: 0.3s;
  color: rgba(255, 255, 255, 0.6);
}
@media (max-width: 767px) {
  .tp-award-position {
    font-size: 14px;
  }
}
.tp-award-icon {
  transition: 0.3s;
  color: var(--tp-common-white);
}
.tp-award-bg {
  padding-bottom: 165px;
  border-radius: 0 0 50px 50px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-award-bg {
    padding-bottom: 110px;
  }
}
@media (max-width: 767px) {
  .tp-award-bg {
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .tp-award-box-left {
    margin-bottom: 10px;
  }
}

.hover-reveal-item .tp-award-reveal-img {
  position: absolute;
  top: 0;
  left: 0;
  width: 210px;
  height: 250px;
  opacity: 0;
  z-index: 9;
  overflow: hidden;
  pointer-events: none;
  border-radius: 10px;
  margin: -150px 0 0 -150px;
  -webkit-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -moz-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -ms-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -o-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transform: scale(0.4);
  background-repeat: no-repeat;
  background-size: cover;
}
.hover-reveal-item:hover .tp-award-reveal-img {
  opacity: 1;
}
.hover-reveal-item .des-team-reveal-img {
  position: absolute;
  top: 0;
  left: 0;
  width: 300px;
  height: 400px;
  opacity: 0;
  z-index: 9;
  overflow: hidden;
  pointer-events: none;
  border-radius: 10px;
  margin: -150px 0 0 -150px;
  -webkit-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -moz-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -ms-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -o-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transform: scale(0.4);
}
.hover-reveal-item:hover .des-team-reveal-img {
  opacity: 1;
}
.hover-reveal-item .des-text-reveal-img {
  position: absolute;
  top: 0;
  left: 0;
  width: 300px;
  height: 320px;
  opacity: 0;
  z-index: 9;
  overflow: hidden;
  pointer-events: none;
  border-radius: 10px;
  margin: -150px 0 0 -150px;
  -webkit-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -moz-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -ms-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -o-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transform: scale(0.4);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .hover-reveal-item .des-text-reveal-img {
    width: 200px;
    height: 220px;
    margin: -120px 0 0 -120px;
  }
}
@media (max-width: 767px) {
  .hover-reveal-item .des-text-reveal-img {
    width: 120px;
    height: 140px;
    margin: -80px 0 0 -100px;
  }
}
.hover-reveal-item .des-text-reveal-img img {
  max-width: 100%;
}
.hover-reveal-item:hover .des-text-reveal-img {
  opacity: 1;
}
.hover-reveal-item .design-award-reveal-img {
  position: absolute;
  top: 0;
  left: 0;
  width: 250px;
  height: 250px;
  opacity: 0;
  z-index: 9;
  overflow: hidden;
  pointer-events: none;
  background-size: cover;
  border-radius: 20px;
  margin: -150px 0 0 -150px;
  -webkit-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -moz-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -ms-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -o-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transform: scale(0.4);
}
.hover-reveal-item:hover .design-award-reveal-img {
  opacity: 1;
}
.hover-reveal-item .studio-service-reveal-img {
  position: absolute;
  top: 0;
  left: 0;
  width: 360px;
  height: 360px;
  opacity: 0;
  z-index: 9;
  overflow: hidden;
  pointer-events: none;
  margin: -150px 0 0 -150px;
  -webkit-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -moz-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -ms-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  -o-transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transition: opacity 0.3s, transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1), -webkit-transform 0.5s cubic-bezier(0.215, 0.61, 0.355, 1);
  transform: scale(0.4);
  object-fit: cover;
}
@media (max-width: 767px) {
  .hover-reveal-item .studio-service-reveal-img {
    height: 200px;
    width: 200px;
  }
}
.hover-reveal-item:hover .studio-service-reveal-img {
  opacity: 1;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-award-area {
    padding-bottom: 0;
  }
}
.design-award-title-box p {
  font-weight: 500;
  font-size: 24px;
  line-height: 1.25;
  color: #e0eeee;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  max-width: 470px;
  margin: 0 auto;
}
@media (max-width: 767px) {
  .design-award-title-box p {
    font-size: 20px;
  }
}
.design-award-content h4 {
  font-weight: 500;
  font-size: 24px;
  line-height: 1.2;
  margin-bottom: 0;
  padding-right: 60px;
  letter-spacing: -0.02em;
  color: rgba(224, 238, 238, 0.3);
}
.design-award-content span {
  flex: 0 0 auto;
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: rgba(224, 238, 238, 0.3);
}
.design-award-content img {
  opacity: 0.3;
  will-change: transform;
  transition: all linear 1s;
}
@media (max-width: 767px) {
  .design-award-content-xs {
    flex-direction: column;
  }
}
@media (max-width: 767px) {
  .design-award-content-xs.design-award-content h4 {
    font-size: 16px;
    padding-right: 0;
    margin-bottom: 10px;
  }
}
.design-award-item {
  position: relative;
  width: 70%;
  margin: 0 auto;
  padding-bottom: 35px;
  transition-duration: 0.3s;
  transition-property: opacity;
  transition-timing-function: cubic-bezier(0.4, 0, 1, 1);
  border-bottom: 1px solid rgba(224, 238, 238, 0.3);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-award-item {
    width: 690px;
  }
}
@media (max-width: 767px) {
  .design-award-item {
    width: 100%;
  }
}
.design-award-item::after {
  position: absolute;
  content: "";
  bottom: 2px;
  right: 0;
  height: 1px;
  width: 8px;
  transform: rotate(40deg);
  background: rgba(224, 238, 238, 0.3);
}
.design-award-item::before {
  position: absolute;
  content: "";
  bottom: -4px;
  right: 0;
  height: 1px;
  width: 8px;
  transform: rotate(-40deg);
  background: rgba(224, 238, 238, 0.3);
}
.design-award-item:hover {
  border-color: var(--tp-common-white);
}
.design-award-item:hover::after, .design-award-item:hover::before {
  background-color: var(--tp-common-white);
}
.design-award-item:hover .design-award-content h4, .design-award-item:hover .design-award-content span {
  color: var(--tp-common-white);
}
.design-award-item:hover .design-award-content img {
  transform: rotate(360deg);
}
.design-award-item.active .design-award-content h4 {
  color: var(--tp-common-white);
}
.design-award-item.active .design-award-content img {
  opacity: 1;
}
.design-award-item.active .design-award-content span {
  color: var(--tp-common-white);
}
.design-award-wrap .row [class*=col]:not(:first-child) .design-award-item {
  padding-top: 40px;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-social-area {
    padding-top: 0;
    padding-bottom: 0;
  }
}

@media (max-width: 767px) {
  .studio-award-area {
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .studio-award-title-box {
    margin-bottom: 30px;
  }
}
.studio-award-content p {
  font-size: 32px;
  line-height: 1.19;
  margin-bottom: 75px;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-award-content p {
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .studio-award-content p {
    font-size: 25px;
  }
  .studio-award-content p br {
    display: none;
  }
}
.studio-award-content-wrap {
  padding-left: 55px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-award-content-wrap {
    padding-left: 0;
  }
}
.studio-award-content-wrap.black-style .studio-award-content p {
  color: var(--tp-common-black-10);
}
.studio-award-item span {
  font-size: 16px;
  display: block;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-semibold);
}
.studio-award-item.black-style .studio-award-icon {
  border-color: rgba(33, 33, 45, 0.1);
}
.studio-award-item.black-style span {
  color: var(--tp-common-black-10);
}
.studio-award-icon {
  width: 100%;
  display: block;
  padding-bottom: 30px;
  margin-bottom: 30px;
  border-bottom: 1px solid rgba(249, 244, 232, 0.1);
}

.ar-award-wrap {
  padding-left: 100px;
  padding-right: 100px;
  border-left: 1px solid rgba(29, 33, 50, 0.08);
  border-right: 1px solid rgba(29, 33, 50, 0.08);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-award-wrap {
    padding-left: 0;
    padding-right: 0;
    border-left: 0;
    border-right: 0;
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.ar-award-item {
  padding: 26px 0;
  position: relative;
  border-bottom: 1px solid rgba(29, 33, 50, 0.08);
}
@media (max-width: 767px) {
  .ar-award-item {
    padding: 26px 10px;
  }
}
.ar-award-item:first-child {
  border-top: 1px solid rgba(29, 33, 50, 0.08);
}
.ar-award-item::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 0;
  width: 100%;
  transition: 0.3s ease-in-out;
  background-color: var(--tp-common-red-2);
}
.ar-award-item:hover::after {
  height: 100%;
}
.ar-award-item:hover span {
  color: var(--tp-common-white);
}
.ar-award-item:hover span svg {
  color: var(--tp-common-white);
}
.ar-award-item:hover .ar-award-box-left {
  transform: translateX(20px);
}
@media (max-width: 767px) {
  .ar-award-item:hover .ar-award-box-left {
    transform: translateX(0);
  }
}
.ar-award-item:hover .ar-award-box-right {
  transform: translateX(-20px);
}
@media (max-width: 767px) {
  .ar-award-item:hover .ar-award-box-right {
    transform: translateX(0);
  }
}
.ar-award-year {
  font-size: 16px;
  line-height: 1;
  min-width: 130px;
  transition: all 0.3s;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-style: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-award-year {
    min-width: 80px;
  }
}
@media (max-width: 767px) {
  .ar-award-year {
    min-width: 50px;
    display: block;
  }
}
.ar-award-title {
  font-size: 20px;
  line-height: 1;
  font-weight: 500;
  transition: all 0.3s;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-award-title {
    font-size: 18px;
  }
}
.ar-award-category {
  font-size: 16px;
  line-height: 1;
  transition: all 0.3s;
  color: rgba(25, 25, 25, 0.6);
}
.ar-award-icon svg {
  transition: all 0.3s;
  color: var(--tp-common-black);
}
.ar-award-box-left, .ar-award-box-right {
  transition: 0.4s;
  display: inline-block;
}
.ar-award-box-left {
  display: flex;
}
@media (max-width: 767px) {
  .ar-award-box-left {
    display: inline-block;
  }
}
.ar-award-shape-1 {
  position: absolute;
  top: 0;
  left: 0;
  z-index: -1;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-award-ptb {
    margin-bottom: 100px;
  }
}
.st-award-title {
  font-size: 36px;
  font-weight: 600;
  letter-spacing: -0.36px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-award-title br {
    display: none;
  }
}
.st-award-title span {
  color: rgba(69, 48, 48, 0.4);
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item {
  padding: 29px 0;
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item::after {
  border-radius: 15px;
  background-color: var(--tp-common-brown);
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item:first-child:hover {
  border-color: transparent;
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item:hover {
  border-color: transparent;
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item:hover .ar-award-box-left {
  transform: translateX(40px);
}
@media (max-width: 767px) {
  .st-award-wrapper .ar-award-right-wrap .ar-award-item:hover .ar-award-box-left {
    transform: translateX(0);
  }
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item:hover .ar-award-box-left .ar-award-year {
  color: rgba(255, 255, 255, 0.7);
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item:hover .ar-award-box-left .ar-award-title {
  color: var(--tp-common-white);
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item:hover .ar-award-box-right {
  transform: translateX(-40px);
}
@media (max-width: 767px) {
  .st-award-wrapper .ar-award-right-wrap .ar-award-item:hover .ar-award-box-right {
    transform: translateX(0);
  }
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item:hover .ar-award-box-right .ar-award-category {
  color: rgba(255, 255, 255, 0.7);
}
@media (max-width: 767px) {
  .st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-left {
    margin-left: 20px;
    margin-bottom: 15px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-left {
    margin-bottom: 0;
  }
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-left .ar-award-year {
  font-size: 18px;
  min-width: 75px;
  color: #494949;
  font-family: var(--tp-ff-poppins);
}
@media (max-width: 767px) {
  .st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-left .ar-award-year {
    margin-bottom: 15px;
  }
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-left .ar-award-title {
  font-size: 22px;
  letter-spacing: -0.44px;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media (max-width: 767px) {
  .st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-right {
    margin-left: 20px;
  }
}
.st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-right .ar-award-category {
  color: #494949;
  font-size: 18px;
  font-family: var(--tp-ff-poppins);
}
.st-award-list-thumb-wrap {
  width: 50%;
  height: 78%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-award-list-thumb-wrap {
    width: 62%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-award-list-thumb-wrap {
    display: none;
  }
}
.st-award-list-thumb-1, .st-award-list-thumb-2, .st-award-list-thumb-3, .st-award-list-thumb-4, .st-award-list-thumb-5 {
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  object-fit: cover;
  visibility: hidden;
  position: absolute;
  border-radius: 10px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-award-list-thumb-1, .st-award-list-thumb-2, .st-award-list-thumb-3, .st-award-list-thumb-4, .st-award-list-thumb-5 {
    position: static;
    width: inherit;
    height: inherit;
  }
}
.st-award-thumb-shape {
  position: absolute;
  width: 175px;
  height: 70px;
  bottom: 0;
  left: 0;
  border-radius: 5px;
  background-color: #FFCF27;
  -webkit-transform: rotate(-55deg) translate(-100%, 150%);
  transform: rotate(-55deg) translate(-100%, 150%);
  -webkit-transition: all 0.5s;
  transition: all 0.5s;
  z-index: 1;
  opacity: 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-award-thumb-shape {
    display: none;
  }
}

#st-award-thumb img {
  transform-origin: bottom left;
}
#st-award-thumb.st-award-list-thumb-1 .st-award-list-thumb-1 {
  opacity: 1;
  visibility: visible;
  transition: all 0.5s;
  transform: rotate(15deg) translateX(30px) translateY(0px);
}
#st-award-thumb.st-award-list-thumb-1 .current {
  visibility: visible;
  -webkit-transform: rotate(-55deg) translate(30px, 150%);
  transform: rotate(-55deg) translate(30px, 150%);
  opacity: 1;
}
#st-award-thumb.st-award-list-thumb-2 .st-award-list-thumb-2 {
  opacity: 1;
  visibility: visible;
  transition: all 0.5s;
  transform: rotate(15deg) translateX(30px) translateY(0px);
}
#st-award-thumb.st-award-list-thumb-2 .current {
  visibility: visible;
  -webkit-transform: rotate(-55deg) translate(30px, 150%);
  transform: rotate(-55deg) translate(30px, 150%);
  opacity: 1;
}
#st-award-thumb.st-award-list-thumb-3 .st-award-list-thumb-3 {
  opacity: 1;
  visibility: visible;
  transition: all 0.5s;
  transform: rotate(15deg) translateX(30px) translateY(0px);
}
#st-award-thumb.st-award-list-thumb-3 .current {
  visibility: visible;
  -webkit-transform: rotate(-55deg) translate(30px, 150%);
  transform: rotate(-55deg) translate(30px, 150%);
  opacity: 1;
}
#st-award-thumb.st-award-list-thumb-4 .st-award-list-thumb-4 {
  opacity: 1;
  visibility: visible;
  transition: all 0.5s;
  transform: rotate(15deg) translateX(30px) translateY(0px);
}
#st-award-thumb.st-award-list-thumb-4 .current {
  visibility: visible;
  -webkit-transform: rotate(-55deg) translate(30px, 150%);
  transform: rotate(-55deg) translate(30px, 150%);
  opacity: 1;
}
#st-award-thumb.st-award-list-thumb-5 .st-award-list-thumb-5 {
  opacity: 1;
  visibility: visible;
  transition: all 0.5s;
  transform: rotate(15deg) translateX(30px) translateY(0px);
}
#st-award-thumb.st-award-list-thumb-5 .current {
  visibility: visible;
  -webkit-transform: rotate(-55deg) translate(30px, 150%);
  transform: rotate(-55deg) translate(30px, 150%);
  opacity: 1;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-award-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-award-left {
    margin-bottom: 30px;
  }
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item {
  padding: 25px 30px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
  background-color: transparent;
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item::after {
  background: rgba(255, 255, 255, 0.07);
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item.pp-award-header {
  padding: 15px 30px;
  border: none;
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item.pp-award-header::after {
  content: none;
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-text {
  min-width: 350px;
  display: inline-block;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-text {
    min-width: 250px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-text {
    min-width: 210px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-text {
    margin-bottom: 15px;
  }
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-text-2 {
  font-size: 14px;
  line-height: 1;
  font-weight: 600;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.4);
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-position {
  line-height: 1.3;
  font-weight: 600;
  color: var(--tp-common-white);
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-year {
  font-size: 18px;
  font-weight: 500;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-year {
    min-width: 130px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-year {
    margin-bottom: 15px;
  }
}
@media (max-width: 767px) {
  .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-year {
    font-size: 16px;
    margin-bottom: 15px;
  }
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-year.tp-award-text-2 {
  font-size: 14px;
  font-weight: 600;
}
.pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-link {
  text-align: end;
  font-size: 18px;
  font-weight: 500;
  line-height: 1;
  min-width: 170px;
  display: inline-block;
  text-transform: capitalize;
  color: var(--tp-common-white);
}

/*----------------------------------------*/
/*  8.1 Video Css
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-video-area.video-inner-style {
    margin-bottom: 80px;
  }
}
.tp-video-thumb {
  width: 32.5%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-video-thumb {
    width: 100%;
    margin-bottom: 0;
  }
}
.tp-video-thumb-wrap {
  transform-origin: top center;
  display: flex;
  flex-wrap: wrap;
  justify-content: space-between;
}
.tp-video-thumb video {
  height: 100%;
  width: 100%;
  background-position: center center;
  background-size: cover;
  object-fit: cover;
}
.tp-video-thumb img {
  width: 100%;
}

.design-video-thumb {
  height: 850px;
  overflow: hidden;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-video-thumb {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .design-video-thumb {
    height: 450px;
  }
}
.design-video-thumb img {
  margin-top: -150px;
}
@media (max-width: 767px) {
  .design-video-thumb img {
    margin-top: 100px;
  }
}

.st-video-item .creative-choose-text {
  top: 50px;
  left: 12%;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .st-video-item .creative-choose-text {
    top: 10px;
    left: 0%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-video-item .creative-choose-text {
    display: none;
  }
}
.st-video-item .creative-choose-text p {
  color: var(--tp-common-brown);
}
.st-video-item .creative-choose-text p span {
  background-color: #F7F1EC;
}
.st-video-item .creative-choose-text-bottom::after {
  box-shadow: 0px -18px 0 0 #F7F1EC;
}
.st-video-item .creative-choose-avater-box {
  background-color: #F7F1EC;
}
.st-video-item .creative-choose-avater-box::after {
  bottom: 34px;
  box-shadow: 0px -18px 0 0 #F7F1EC;
}
.st-video-item .creative-choose-avater-info h4 {
  color: var(--tp-common-brown);
}
.st-video-item .creative-choose-avater-info span {
  color: var(--tp-common-brown);
}
.st-video-img {
  height: 900px;
  overflow: hidden;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .st-video-img {
    height: 750px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .st-video-img {
    height: 600px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-video-img {
    height: 470px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px) {
  .st-video-img {
    height: 400px;
  }
}
@media (max-width: 767px) {
  .st-video-img {
    height: 240px;
  }
}
.st-video-img .dgm-testimonial-playbtn {
  width: 80px;
  height: 80px;
  line-height: 80px;
  animation: none;
}
.st-video-img .dgm-testimonial-playbtn::after {
  position: absolute;
  content: "";
  left: 50%;
  top: 50%;
  width: 90%;
  height: 90%;
  z-index: -1;
  border-radius: 50%;
  transform: scale(1);
  border: 1px solid var(--tp-common-white);
  animation: video-border 1.5s linear infinite;
}
.st-video-text-slider {
  position: absolute;
  bottom: 30px;
  left: 0;
  right: 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-video-text-slider {
    bottom: 0;
  }
}
.st-video-text-wrapper .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.st-video-text-title {
  font-size: 120px;
  font-weight: 700;
  line-height: 1;
  display: inline-block;
  letter-spacing: -3.6px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .st-video-text-title {
    font-size: 85px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .st-video-text-title {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .st-video-text-title {
    font-size: 35px;
  }
}
.st-video-text-title i {
  font-style: normal;
  color: rgba(255, 255, 255, 0.4);
}

.tp-video-15-wrap {
  line-height: 0;
}
.tp-video-15-wrap video {
  height: 800px;
  width: 100%;
  object-fit: cover;
}

/*----------------------------------------*/
/*  8.2 Brand Css
/*----------------------------------------*/
@media (max-width: 767px) {
  .des-brand-area {
    padding-bottom: 100px;
  }
}
.des-brand-item.black-style .des-brand-item-inner {
  background-color: #1B1B1D;
}
.des-brand-item.black-style .des-brand-item-inner img {
  filter: invert(1);
}
.des-brand-item-inner {
  height: 220px;
  min-width: 380px;
  display: grid;
  padding: 40px;
  margin: 0px 5px;
  border-radius: 20px;
  place-content: center;
  background-color: #F6F6F9;
}
@media (max-width: 767px) {
  .des-brand-item-inner {
    height: 120px;
    min-width: 250px;
  }
}

.tp-brand-title {
  font-weight: 500;
  font-size: 30px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.tp-brand-title::after {
  content: "";
  height: 8px;
  width: 8px;
  margin-left: 30px;
  border-radius: 50%;
  display: inline-block;
  transform: translateY(-4px);
  background-color: var(--tp-common-black);
}
.tp-brand-item.text-color .tp-brand-title {
  color: var(--tp-common-black);
}
.tp-brand-item.text-color .tp-brand-title::after {
  background-color: var(--tp-common-black);
}
.tp-brand-wrapper {
  padding: 30px 0 26px 0;
  transform: rotate(2deg);
}
@media (max-width: 767px) {
  .tp-brand-wrapper {
    transform: rotate(0);
  }
}
.tp-brand-wrapper .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.tp-brand-active .swiper-slide {
  width: auto;
}
.tp-brand-style-2 {
  margin-top: -89px;
  transform: rotate(-4deg);
}
@media (max-width: 767px) {
  .tp-brand-style-2 {
    margin-top: 0;
    transform: rotate(0);
  }
}
.tp-brand-style-2 .tp-brand-title {
  color: var(--tp-common-white);
}
.tp-brand-style-2 .tp-brand-title::after {
  margin-left: 0;
  margin-right: 30px;
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-brand-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .tp-brand-inner-item {
    margin-bottom: 20px;
  }
}
.tp-brand-inner-item img {
  width: 100%;
}

.dgm-brand-item {
  height: 140px;
  display: flex;
  align-items: center;
  justify-content: center;
  margin: 0 -1px 0 0px;
  border: 1px solid #E8E8E8;
  border-bottom: 0;
}
.dgm-brand-active {
  margin: 0px -20px;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-brand-area {
    padding-bottom: 80px;
  }
}
.creative-brand-active .slider-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.creative-brand-top-text {
  font-style: italic;
  font-weight: 500;
  font-size: 22px;
  line-height: 1;
  display: inline-block;
  margin-bottom: 70px;
  letter-spacing: 0.04em;
  color: var(--tp-common-white);
}

.ai-brand-item {
  padding: 14px 20px;
  border-radius: 10px;
  display: inline-block;
  background-color: #201C35;
}
.ai-brand-slider-active .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.ai-brand-slider-active .swiper-slide {
  width: auto;
}

.ar-brand-active .slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.ar-brand-active .swiper-slide {
  width: auto;
}
.ar-brand-active .swiper-wrapper {
  align-items: center;
}
.ar-brand-bg {
  padding: 42px 0;
  border-top: 1px solid rgba(25, 25, 25, 0.06);
  border-bottom: 1px solid rgba(25, 25, 25, 0.06);
}

.ar-brand-style .tp-brand-wrapper {
  margin-top: -1px;
  transform: rotate(0);
  padding: 30px 0 26px 0;
}
.ar-brand-style .tp-brand-wrapper.pp-about-me-brand-wrap {
  z-index: -1;
  padding: 26px 0 13px 0;
}
.ar-brand-style .tp-brand-title {
  font-size: 20px;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-medium);
}
.ar-brand-style .tp-brand-title::after {
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .ar-brand-area {
    margin-bottom: 80px;
  }
}

.app-brand-active .slider-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.app-brand-active .swiper-slide {
  width: auto;
}
.app-brand-heading .tp-section-subtitle {
  color: #21212D;
}
.app-brand-item {
  text-align: center;
  border-right: 1px solid rgba(33, 33, 45, 0.1);
}
@media (max-width: 767px) {
  .app-brand-item {
    border: none;
  }
}

.it-brand-style {
  margin-top: -2px;
}
.it-brand-style .creative-brand-shape {
  position: absolute;
  top: 100%;
  left: 0;
  margin-top: -2px;
}
.it-brand-style .creative-brand-shape-2 {
  position: absolute;
  bottom: -50%;
  right: 0;
}
.it-brand-style .tp-brand-wrapper {
  padding: 35px 0 32px 0;
  transform: rotate(3deg);
}
.it-brand-style .tp-brand-style-2 {
  transform: rotate(-5deg);
}
.it-brand-style .tp-brand-style-2 .tp-brand-title {
  color: var(--tp-common-black);
  margin-right: 0;
  margin-left: 30px;
}
.it-brand-style .tp-brand-style-2 .tp-brand-title::after {
  display: none;
}
.it-brand-style .tp-brand-title::after {
  display: none;
}
.it-brand-style .tp-brand-title {
  margin-right: 30px;
  font-weight: 500;
  font-size: 26px;
  line-height: 1;
  color: #21212d;
  text-transform: uppercase;
  font-family: var(--tp-ff-inter);
}
.it-brand-style .tp-brand-item {
  display: flex;
  align-items: center;
}

.st-brand-ptb {
  padding-top: 130px;
  padding-bottom: 60px;
}
@media (max-width: 767px) {
  .st-brand-ptb {
    padding-top: 85px;
  }
}
.st-brand-border {
  border-bottom: 1px solid rgba(69, 48, 48, 0.15);
}
.st-brand-border::after {
  position: absolute;
  top: 0;
  left: 32%;
  height: 100%;
  width: 1px;
  content: "";
  background-color: rgba(69, 48, 48, 0.15);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-brand-border::after {
    content: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-brand-heading {
    margin-bottom: 50px;
  }
}
.st-brand-heading span {
  font-size: 24px;
  font-weight: 600;
  color: var(--tp-common-brown);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-brand-heading span br {
    display: none;
  }
}
.st-brand-active {
  margin-right: -90px;
  margin-left: 80px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-brand-active {
    margin-right: 0;
    margin-left: 0;
  }
}
.st-brand-active .slider-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}
.st-brand-active .swiper-slide {
  width: auto;
}

.it-comparison-bg {
  border-radius: 20px;
  background: var(--tp-common-white);
  box-shadow: 0 2px 3px 0 rgba(50, 41, 73, 0.1);
}

.it-comparison-bg .row [class*=col-]:last-child .it-comparison-item {
  border-right: none;
}

.it-comparison-item {
  padding: 0 30px;
  padding-top: 35px;
  padding-bottom: 20px;
  border-right: 3px solid #fdf7f4;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-comparison-item {
    border: none;
  }
}

.it-comparison-logo {
  padding-bottom: 30px;
  margin-bottom: 25px;
  border-bottom: 1px solid rgba(36, 46, 69, 0.06);
}

.it-comparison-content span {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  color: #61616a;
  letter-spacing: -0.02em;
}

.it-comparison-content span i {
  font-weight: 500;
  color: #242e45;
  font-style: normal;
}

.slide-transtion {
  -webkit-transition-timing-function: linear;
  transition-timing-function: linear;
}

.cr-brand-heading p {
  font-size: 17px;
  font-weight: 500;
  line-height: 26px;
  font-family: var(--tp-ff-onest);
  color: rgba(255, 255, 255, 0.5);
}
.cr-brand-wrapper .app-brand-item {
  border-color: rgba(255, 255, 255, 0.1);
}

.cr-multi-border {
  position: relative;
  border-right: 1px solid rgba(255, 255, 255, 0.06);
  border-left: 1px solid rgba(255, 255, 255, 0.06);
}
.cr-multi-border::after, .cr-multi-border::before {
  position: absolute;
  top: 0;
  width: 1px;
  height: 100px;
  opacity: 0.5;
  content: "";
  background: linear-gradient(180deg, rgba(255, 255, 255, 0) 0%, #fff 100%);
}
.cr-multi-border::after {
  right: 0;
  animation: scroll1 15s ease-out infinite;
}
.cr-multi-border::before {
  left: 0;
  animation: scroll1 20s ease-out infinite;
}
.cr-multi-border-bottom {
  border-bottom: 1px solid rgba(255, 255, 255, 0.06);
}

.tp-border-line {
  position: absolute;
  top: 0;
  left: 0;
  bottom: 0;
  width: 18.8%;
  z-index: -1;
  border-right: 1px solid rgba(255, 255, 255, 0.06);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-border-line {
    width: 12.5%;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-border-line {
    width: 7.2%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-border-line {
    width: 3.8%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-border-line {
    width: 3%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-border-line {
    display: none;
  }
}
.tp-border-line::after {
  position: absolute;
  top: 300px;
  right: -1px;
  width: 1px;
  opacity: 0.5;
  height: 100px;
  content: "";
  animation: scroll1 15s ease-out infinite;
  background: linear-gradient(180deg, rgba(255, 255, 255, 0) 0%, #fff 100%);
}
.tp-border-line.line-2 {
  width: 81.2%;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-border-line.line-2 {
    width: 87.5%;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-border-line.line-2 {
    width: 93%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-border-line.line-2 {
    width: 96.2%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-border-line.line-2 {
    width: 97%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-border-line.line-2 {
    display: none;
  }
}
.tp-border-line.line-2::after {
  animation: scroll2 20s ease-out infinite;
}

.pp-brand-area {
  border-bottom: 1px solid rgba(236, 227, 206, 0.1);
}
.pp-brand-title {
  font-size: 34px;
  font-weight: 500;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
  padding-right: 52px;
}
.pp-brand-title i {
  font-style: normal;
  margin-right: 5px;
  color: var(--tp-common-yellow-1);
}
.pp-brand-item.pp-about-me-brand .pp-brand-title {
  color: #852A1B;
  padding-right: 50px;
}
@media (max-width: 767px) {
  .pp-brand-item.pp-about-me-brand .pp-brand-title {
    padding-right: 20px;
  }
}
.pp-brand-item.pp-about-me-brand .pp-brand-title i {
  color: #852A1B;
}
.pp-brand-icon {
  padding-right: 30px;
  display: inline-block;
  transform: translateY(-6px);
}
@media (max-width: 767px) {
  .pp-brand-icon {
    padding-right: 20px;
  }
}

/*----------------------------------------*/
/*  8.3 Team Css
/*----------------------------------------*/
.des-team-title {
  font-size: 160px;
  font-weight: 400;
  line-height: 1;
  text-align: center;
  transition: 0.3s;
  margin-bottom: 0;
  font-family: var(--tp-ff-mango);
  color: rgba(249, 244, 232, 0.1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .des-team-title {
    font-size: 110px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .des-team-title {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .des-team-title {
    font-size: 75px;
    display: block;
    padding: 10px 0;
  }
}
.des-team-item-box {
  padding: 0 120px;
  padding-top: 40px;
  padding-bottom: 15px;
  border-bottom: 1px solid rgba(159, 156, 149, 0.2);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .des-team-item-box {
    padding: 30px 40px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .des-team-item-box {
    padding: 0;
    padding-top: 40px;
    padding-bottom: 15px;
  }
}
@media (max-width: 767px) {
  .des-team-item-box {
    padding: 0;
    padding-top: 40px;
    padding-bottom: 40px;
  }
}
.des-team-item-box span {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  transition: 0.3s;
  color: rgba(249, 244, 232, 0.1);
}
.des-team-item-box.active span {
  color: var(--tp-common-cream);
}
@media (max-width: 767px) {
  .des-team-item-box.active span {
    display: block;
  }
}
.des-team-item-box.active .des-team-title {
  color: var(--tp-common-cream);
}
.des-team-item-box.active .des-team-item {
  position: relative;
  z-index: 999;
}
.des-team-item-box.team-inner-color {
  padding-top: 26px;
  padding-bottom: 28px;
}
.des-team-item-box.team-inner-color span {
  color: #ECECEC;
}
.des-team-item-box.team-inner-color .des-team-title {
  color: #ECECEC;
  font-size: 100px;
  font-weight: 700;
  letter-spacing: -3.8px;
  font-family: var(--tp-ff-body);
}
.des-team-item-box.team-inner-color.active span {
  color: #111013;
}
.des-team-item-box.team-inner-color.active .des-team-title {
  color: #111013;
}
@media (max-width: 767px) {
  .des-team-item {
    flex-direction: column;
  }
}
@media (max-width: 767px) {
  .des-team-area {
    padding-bottom: 100px;
  }
}
.des-team-wrap.des-team-inner-style .des-team-title {
  letter-spacing: -4.8px;
  font-family: var(--tp-ff-teko);
  color: rgba(249, 244, 232, 0.1);
}
.des-team-wrap.des-team-inner-style .des-team-item-box.active .des-team-title {
  color: #FFFFE6;
}

.dgm-team-title-sm {
  font-weight: 700;
  font-size: 20px;
  line-height: 1.1;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-team-content span {
  font-weight: 400;
  font-size: 14px;
  line-height: 1;
  color: #4d5051;
  display: inline-block;
  margin-bottom: 15px;
  letter-spacing: -0.01em;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.dgm-team-thumb {
  margin-bottom: 15px;
}
.dgm-team-thumb img {
  width: 100%;
}
.dgm-team-social a {
  height: 30px;
  width: 30px;
  line-height: 25px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  border: 1px solid rgba(20, 20, 20, 0.1);
}
.dgm-team-social a:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-green-regular);
  background-color: var(--tp-common-green-regular);
}
@media (max-width: 767px) {
  .dgm-team-title-box {
    margin-bottom: 30px;
  }
}

.studio-team-title-box p {
  font-weight: 500;
  font-size: 20px;
  margin-bottom: 0;
  line-height: 1.4;
  letter-spacing: -0.02em;
  color: rgba(249, 244, 232, 0.8);
}
@media (max-width: 767px) {
  .studio-team-title-box p {
    font-size: 18px;
  }
  .studio-team-title-box p br {
    display: none;
  }
}
.studio-team-thumb {
  overflow: hidden;
  display: inline-block;
  transition: 0.4s ease-in-out;
}
@media (max-width: 767px) {
  .studio-team-thumb {
    width: 100%;
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-team-thumb-wrap {
    margin-top: 0;
  }
}
.studio-team-thumb::after {
  position: absolute;
  content: "";
  bottom: 0;
  left: 0;
  right: 0;
  width: 100%;
  height: 50%;
  opacity: 0;
  transition: 0.4s;
  visibility: hidden;
  background: linear-gradient(180deg, rgba(14, 15, 17, 0) 0%, #0e0f11 100%);
}
.studio-team-thumb img {
  transition: 0.6s;
}
@media (max-width: 767px) {
  .studio-team-thumb img {
    width: 100%;
  }
}
.studio-team-thumb-2 {
  margin-left: 240px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-team-thumb-2 {
    margin-left: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-team-thumb-2 {
    margin-left: 0px;
  }
}
.studio-team-thumb-4 {
  margin-right: 200px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .studio-team-thumb-4 {
    margin-right: 90px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-team-thumb-4 {
    margin-right: 0;
    margin-left: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-team-thumb-4 {
    margin-right: 0;
    margin-left: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .studio-team-thumb-4 {
    margin-right: 0;
    margin-left: 0;
  }
}
.studio-team-thumb:hover {
  transform: rotate(2deg);
  border-radius: 300px;
}
.studio-team-thumb:hover img {
  border-radius: 300px;
}
.studio-team-thumb:hover::after {
  opacity: 1;
  visibility: visible;
}
.studio-team-thumb:hover .studio-team-content {
  opacity: 1;
  visibility: visible;
}
.studio-team-title-sm {
  font-size: 34px;
  line-height: 0.95;
  margin-bottom: 0;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-semibold);
}
.studio-team-content {
  position: absolute;
  bottom: 0;
  left: 0;
  right: 0;
  bottom: 0;
  z-index: 22;
  opacity: 0;
  margin: 30px;
  transition: 0.5s ease-in-out;
  visibility: hidden;
  text-align: center;
}
.studio-team-content span {
  font-size: 14px;
  line-height: 1;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: var(--tp-common-cream);
  font-family: var(--tp-ff-clash-semibold);
}

.dgm-team-thumb .tp--hover-img canvas {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
}

.tp-team-bg {
  padding-top: 160px;
  padding-bottom: 200px;
  border-radius: 50px 50px 0 0;
}
.tp-team-item-thumb {
  transition: 0.6s;
  border-radius: 300px;
}
.tp-team-item-thumb::after {
  position: absolute;
  content: "";
  bottom: 0;
  left: 0;
  right: 0;
  width: 100%;
  height: 100%;
  opacity: 0;
  transition: 0.4s;
  visibility: hidden;
  pointer-events: none;
  background: linear-gradient(180deg, rgba(14, 15, 17, 0) 0%, #0e0f11 150%);
}
.tp-team-item-thumb:hover .studio-team-content {
  opacity: 1;
  visibility: visible;
}
.tp-team-item-thumb:hover::after {
  opacity: 1;
  border-radius: 300px;
  visibility: visible;
}
.tp-team-item-thumb:hover img {
  border-radius: 300px;
}
.tp-team-item-thumb img {
  height: 500px;
  transition: 0.6s;
  object-fit: cover;
  border-radius: 20px;
}
@media (max-width: 767px) {
  .tp-team-item-thumb img {
    width: 100%;
  }
}
.tp-team-slider-active {
  margin: 0 -65px;
}
@media (max-width: 767px) {
  .tp-team-slider-active {
    margin: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-hero-subtitle {
    margin-bottom: 20px;
  }
}
.tp-team-hero-subtitle span {
  display: inline-block;
  color: #111013;
  font-size: 16px;
  font-weight: 400;
  line-height: 22px;
  letter-spacing: -0.32px;
  text-transform: uppercase;
}
.tp-team-hero-text p {
  font-size: 18px;
  font-weight: 400;
  line-height: 28px;
  color: #111013;
  letter-spacing: -0.36px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-hero-text p br {
    display: none;
  }
}
.tp-team-inner-ptb .tp-career-shape-1 {
  position: absolute;
  top: 30%;
  right: 18%;
}
.tp-team-inner-thumb {
  width: 100%;
  height: 760px;
  overflow: hidden;
  border-radius: 40px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-team-inner-thumb {
    height: 600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-team-inner-thumb {
    height: 380px;
  }
}
.tp-team-inner-thumb img {
  width: 100%;
  margin-top: -100px;
}
@media (max-width: 767px) {
  .tp-team-inner-thumb img {
    margin-top: 0px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-team-inner-thumb-box {
    margin-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-inner-thumb-box {
    margin-bottom: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-part-shape {
    padding-bottom: 30px;
  }
}
.tp-team-part-shape img {
  animation: rotate2 8s linear infinite;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-part-top {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-part-heading p br {
    display: none;
  }
}
.tp-team-part-item {
  display: grid;
  height: 380px;
  width: 380px;
  margin: 0 -33px;
  text-align: center;
  place-content: center;
  border-radius: 380px;
  border: 1px solid #EEE;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-team-part-item {
    height: 330px;
    width: 330px;
    margin: 0 0;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-team-part-item {
    height: 270px;
    width: 270px;
    margin: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-team-part-item {
    height: 230px;
    width: 230px;
    margin: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-team-part-item {
    height: 350px;
    width: 100%;
    margin: 0;
    margin-bottom: 20px;
  }
}
@media (max-width: 767px) {
  .tp-team-part-item {
    height: 250px;
    width: 250px;
    margin: 0 auto;
    margin-bottom: 0px;
    text-align: center;
    margin-bottom: 20px;
  }
}
.tp-team-part-item-title h4 {
  font-size: 70px;
  font-weight: 500;
  color: #030303;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-team-part-item-title h4 {
    font-size: 55px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-team-part-item-title h4 {
    font-size: 50px;
  }
}
.tp-team-part-item-title h4 i {
  font-style: normal;
}
.tp-team-part-item-content p {
  color: #525252;
  font-size: 18px;
  font-weight: 500;
  margin-bottom: 20px;
}

.tp-team-details-thumb img {
  width: 100%;
  border-radius: 14px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-details-info {
    flex-wrap: wrap;
  }
}
.tp-team-details-info-contact {
  padding: 10px 0;
  border-top: 1px solid rgba(17, 16, 19, 0.1);
  border-bottom: 1px solid rgba(17, 16, 19, 0.1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-details-info-contact {
    margin-bottom: 20px;
  }
}
.tp-team-details-info-contact a {
  font-size: 14px;
  font-weight: 500;
  color: #111013;
  display: inline-block;
  letter-spacing: -0.28px;
}
.tp-team-details-info-contact a:not(:last-of-type) {
  margin-right: 20px;
  padding-right: 20px;
  border-right: 1px solid rgba(17, 16, 19, 0.1);
}
.tp-team-details-info-contact a svg {
  margin-right: 5px;
}
.tp-team-details-info-social .tp-footer-widget-social a {
  background-color: transparent;
  border: 1px solid rgba(17, 16, 19, 0.08);
}
.tp-team-details-info-social .tp-footer-widget-social a:hover {
  border-color: var(--tp-common-red-3);
  background-color: var(--tp-common-red-3);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-details-wrap {
    margin-bottom: 30px;
  }
}
.tp-team-details-wrapper {
  padding-left: 70px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-team-details-wrapper {
    padding-left: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-team-details-wrapper {
    padding-left: 0;
  }
}
.tp-team-details-text {
  margin-bottom: 30px;
}
.tp-team-details-text p {
  color: #4D5051;
}
.tp-team-details-text-sub {
  color: #525356;
  font-size: 16px;
  font-weight: 400;
  display: inline-block;
}
.tp-team-details-text-title {
  color: #111013;
  font-size: 40px;
  font-weight: 700;
  margin-bottom: 25px;
  letter-spacing: -0.8px;
}
.tp-team-details-more-title {
  color: #111013;
  font-size: 24px;
  font-weight: 600;
  margin-bottom: 18px;
  letter-spacing: -0.48px;
}
.tp-team-details-more ul li {
  list-style: none;
  color: #111013;
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 12px;
}
.tp-team-details-more ul li span {
  color: #525356;
  font-size: 16px;
  font-weight: 400;
  min-width: 100px;
  margin-right: 40px;
  display: inline-block;
}
.tp-team-details-progress-title {
  color: #111013;
  font-size: 16px;
  font-weight: 500;
}
.tp-team-details-progress-inner {
  position: relative;
  width: 100%;
  height: 5px;
  background: #d9d9d9;
}
.tp-team-details-progress-bar {
  overflow: visible;
  display: flex;
  height: 5px;
  text-align: center;
  white-space: nowrap;
  transition: 0.6s ease;
  position: relative;
  background-color: var(--tp-common-red-3);
}
.tp-team-details-progress-bar::before {
  position: absolute;
  content: "";
  height: 20px;
  width: 1px;
  right: 0px;
  top: -8px;
  margin: auto;
  background-color: var(--tp-common-red-3);
}
.tp-team-details-progress-counter {
  margin-top: -29px;
  font-weight: 500;
  font-size: 14px;
  position: absolute;
  top: 0;
  right: -15px;
  text-transform: uppercase;
}
.tp-team-details-input-content input, .tp-team-details-input-content textarea {
  border-radius: 6px;
  margin-bottom: 20px;
  background-color: #F8F8FB;
  color: var(--tp-common-black);
  border: 1px solid rgba(17, 16, 19, 0.08);
}
.tp-team-details-input-content input:focus, .tp-team-details-input-content textarea:focus {
  background-color: transparent;
  border-color: var(--tp-common-red-3);
  box-shadow: 0px 0px 0px 3px rgba(255, 87, 34, 0.1);
}
.tp-team-details-input-content input::placeholder, .tp-team-details-input-content textarea::placeholder {
  color: #848788;
}
.tp-team-details-input-content textarea {
  resize: none;
  height: 160px;
}
.tp-team-details-input-btn button {
  font-size: 16px;
  font-weight: 700;
  padding: 15px 35px;
  border-radius: 6px;
  letter-spacing: 0;
  border: 1px solid transparent;
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.tp-team-details-input-btn button:hover {
  color: var(--tp-common-black);
  background-color: transparent;
  border-color: var(--tp-common-red-3);
}

/*----------------------------------------*/
/*  8.4 Step Css
/*----------------------------------------*/
.dgm-step-title {
  font-weight: 700;
  font-size: 30px;
  line-height: 1;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-step-title-sm {
  font-weight: 700;
  font-size: 24px;
  line-height: 1;
  margin-bottom: 15px;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-grotesk);
}
.dgm-step-item p {
  font-weight: 400;
  font-size: 15px;
  line-height: 1.6;
  color: #4d5051;
  margin-bottom: 0;
}
.dgm-step-number {
  font-weight: 700;
  font-size: 70px;
  position: absolute;
  top: -8px;
  left: -30px;
  z-index: -1;
  color: transparent;
  -webkit-text-stroke: 1px rgba(193, 237, 0, 0.6);
}
@media (max-width: 767px) {
  .dgm-step-number {
    left: 0;
  }
}
.dgm-step-space-2 {
  margin-left: 55px;
  margin-right: 20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .dgm-step-space-2 {
    margin-left: 0;
  }
}
@media (max-width: 767px) {
  .dgm-step-space-2 {
    margin-left: 0;
    margin-right: 0;
  }
}
.dgm-step-space-3 {
  margin-left: 50px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .dgm-step-space-3 {
    margin-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-step-space-3 {
    margin-left: 30px;
  }
}
@media (max-width: 767px) {
  .dgm-step-space-3 {
    margin-left: 0;
  }
}
.dgm-step-space-4 {
  margin-left: 75px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .dgm-step-space-4 {
    margin-left: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .dgm-step-space-4 {
    margin-left: 55px;
  }
}
@media (max-width: 767px) {
  .dgm-step-space-4 {
    margin-left: 0;
  }
}

@media (max-width: 767px) {
  .studio-step-area {
    padding-top: 0;
    padding-bottom: 80px;
  }
}
.studio-step-item {
  padding: 55px 80px;
  background-color: var(--tp-common-cream);
  box-shadow: -40px 0 80px 0 rgba(79, 67, 38, 0.1);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .studio-step-item {
    padding: 55px 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-step-item {
    padding: 55px 40px;
  }
}
@media (max-width: 767px) {
  .studio-step-item {
    padding: 30px 20px;
  }
}
.studio-step-item span {
  font-size: 14px;
  line-height: 1;
  margin-bottom: 25px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-red);
  font-family: var(--tp-ff-clash-medium);
}
.studio-step-item p {
  margin-bottom: 0;
  font-weight: 400;
  font-size: 14px;
  line-height: 1.43;
  color: #101114;
  max-width: 500px;
  margin: 0 auto;
}
.studio-step-title {
  font-size: 60px;
  line-height: 0.83;
  margin-bottom: 60px;
  letter-spacing: -0.04em;
  text-transform: uppercase;
  color: var(--tp-common-red);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .studio-step-title {
    font-size: 57px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .studio-step-title {
    font-size: 45px;
  }
}
@media (max-width: 767px) {
  .studio-step-title {
    font-size: 35px;
    margin-bottom: 30px;
  }
}
.studio-step-slider-active {
  margin: 0 -200px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .studio-step-slider-active {
    margin: 0;
  }
}

.ar-category-ptb {
  padding: 27px 0;
  padding-bottom: 17px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-category-wrap {
    flex-wrap: wrap;
  }
}
.ar-category-item {
  margin-bottom: 10px;
}
.ar-category-item:not(:last-child) {
  position: relative;
}
.ar-category-item:not(:last-child)::after {
  position: absolute;
  content: "";
  top: -4px;
  right: -80px;
  width: 1px;
  height: 30px;
  border-radius: 16px;
  background-color: rgba(25, 25, 25, 0.1);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-category-item:not(:last-child)::after {
    right: -50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-category-item:not(:last-child)::after {
    display: none;
  }
}
.ar-category-item span {
  font-size: 18px;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ar-category-item span {
    font-size: 16px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ar-category-item span {
    font-size: 15px;
  }
}
.ar-category-item i svg {
  margin-right: 12px;
  transform: translateY(-3px);
}

.ar-step-bg {
  background-size: cover;
  background-position: center;
  background-repeat: no-repeat;
  position: relative;
}
.ar-step-bg::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  z-index: -1;
  width: 100%;
  height: 100%;
  background-color: rgba(20, 20, 20, 0.5);
}
.ar-step-title-box {
  padding-top: 165px;
  padding-left: 90px;
  padding-bottom: 50px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ar-step-title-box {
    padding-top: 120px;
    padding-left: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-step-title-box {
    padding-top: 80px;
    padding-left: 60px;
  }
}
@media (max-width: 767px) {
  .ar-step-title-box {
    padding-top: 40px;
    padding-left: 40px;
    padding-bottom: 40px;
  }
}
.ar-step-icon {
  height: 60px;
  width: 60px;
  line-height: 56px;
  margin-bottom: 25px;
  text-align: center;
  border-radius: 30px;
  display: inline-block;
  border: 1px solid rgba(255, 255, 255, 0.2);
}
.ar-step-icon svg {
  margin-left: 1px;
}
.ar-step-number {
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
}
.ar-step-title-sm {
  font-size: 20px;
  line-height: 1;
  letter-spacing: 1px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
.ar-step-content span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1.5;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ar-step-content span {
    font-size: 14px;
  }
}
.ar-step-item {
  height: 100%;
  padding: 100px 40px 60px 40px;
  border-left: 1px solid rgba(255, 255, 255, 0.1);
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.ar-step-right-wrap {
  border-top: 1px solid rgba(255, 255, 255, 0.1);
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}

.it-step-bg {
  margin-top: -5px;
}
.it-step-title-box p {
  font-weight: 500;
  font-size: 18px;
  margin-bottom: 0;
  line-height: 1.56;
  color: rgba(254, 255, 249, 0.7);
}
@media (max-width: 767px) {
  .it-step-title-box p br {
    display: none;
  }
}
.it-step-thumb {
  margin-left: -115px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-step-thumb {
    margin-left: 0;
  }
}
.it-step-thumb img {
  border-radius: 30px;
  max-width: inherit;
}
@media (max-width: 767px) {
  .it-step-thumb img {
    width: 100%;
  }
}
.it-step-thumb-shape-1 {
  position: absolute;
  top: 27%;
  right: -8%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .it-step-thumb-shape-1 {
    right: 0;
  }
}
@media (max-width: 767px) {
  .it-step-thumb-shape-1 {
    display: none;
  }
}
.it-step-thumb-shape-2 {
  position: absolute;
  bottom: 4%;
  left: -18%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .it-step-thumb-shape-2 {
    left: 7%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px) {
  .it-step-thumb-shape-2 {
    left: 6%;
  }
}
@media (max-width: 767px) {
  .it-step-thumb-shape-2 {
    display: none;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .it-step-thumb-shape-2 {
    display: block;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-step-thumb-wrap {
    margin-bottom: 80px;
  }
}
.it-step-shape-1 {
  position: absolute;
  left: 0%;
  top: 13%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .it-step-shape-1 {
    left: -8%;
  }
}
.it-step-shape-2 {
  position: absolute;
  right: 0;
  bottom: -47%;
  z-index: 1;
}

/*----------------------------------------*/
/*  8.5 Choose Css
/*----------------------------------------*/
.creative-choose-thumb {
  height: 550px;
  overflow: hidden;
  border-radius: 20px;
}
@media (max-width: 767px) {
  .creative-choose-thumb {
    margin-bottom: 30px;
    height: 400px;
  }
}
.creative-choose-thumb > img {
  border-radius: 20px;
  object-fit: cover;
}
.creative-choose-text {
  position: absolute;
  top: 0;
  left: 0;
  display: inline-block;
  margin: 50px;
}
@media (max-width: 767px) {
  .creative-choose-text {
    position: static;
    margin: 0;
  }
}
.creative-choose-text p {
  font-weight: 600;
  font-size: 44px;
  line-height: 1.18;
  margin-bottom: 0;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-choose-text p {
    font-size: 35px;
  }
}
@media (max-width: 767px) {
  .creative-choose-text p {
    font-size: 30px;
    margin-bottom: 30px;
  }
  .creative-choose-text p br {
    display: none;
  }
}
.creative-choose-text p span {
  display: inline-block;
  background-color: #0e0f11;
}
@media (max-width: 767px) {
  .creative-choose-text p span {
    display: initial;
    background-color: transparent;
  }
}
.creative-choose-text p span svg {
  margin-right: 20px;
}
.creative-choose-text-top {
  padding: 0px 20px;
  padding-top: 10px;
  border-radius: 20px 20px 0 0;
}
@media (max-width: 767px) {
  .creative-choose-text-top {
    padding: 0;
  }
}
.creative-choose-text-middle {
  padding: 3px 20px;
  padding-bottom: 5px;
  border-radius: 0 20px 20px 0;
  position: relative;
}
@media (max-width: 767px) {
  .creative-choose-text-middle {
    padding: 0;
  }
}
.creative-choose-text-middle::before {
  content: "";
  position: absolute;
  bottom: 60px;
  right: 170px;
  height: 40px;
  width: 20px;
  z-index: -1;
  background-color: transparent;
  border-bottom-left-radius: 20px;
  box-shadow: 0px 18px 0 0 #0e0f11;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-choose-text-middle::before {
    bottom: 56px;
    right: 140px;
  }
}
@media (max-width: 767px) {
  .creative-choose-text-middle::before {
    display: none;
  }
}
.creative-choose-text-bottom {
  padding: 0px 20px;
  padding-bottom: 20px;
  border-radius: 0 0 20px 0;
  position: relative;
}
@media (max-width: 767px) {
  .creative-choose-text-bottom {
    padding: 0;
  }
}
.creative-choose-text-bottom::after {
  content: "";
  position: absolute;
  bottom: 32px;
  right: -20px;
  height: 40px;
  width: 20px;
  z-index: -1;
  border-top-left-radius: 20px;
  background-color: transparent;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-choose-text-bottom::after {
    bottom: 22px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .creative-choose-text-bottom::after {
    display: none;
  }
}
.creative-choose-avater img {
  flex: 0 0 auto;
  border-radius: 50%;
  margin-right: 13px;
  height: 54px;
  width: 54px;
}
.creative-choose-avater-box {
  position: relative;
  border-radius: 0 0 20px 20px;
  background-color: #0e0f11;
  padding: 0 70px 20px 20px;
}
@media (max-width: 767px) {
  .creative-choose-avater-box {
    padding-left: 0;
    padding-right: 0;
    background-color: transparent;
  }
}
.creative-choose-avater-box::after {
  content: "";
  position: absolute;
  bottom: 32px;
  right: -20px;
  height: 40px;
  width: 20px;
  border-top-left-radius: 20px;
  background-color: transparent;
  box-shadow: 0px -18px 0 0 #0e0f11;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .creative-choose-avater-box::after {
    bottom: 34px;
  }
}
@media (max-width: 767px) {
  .creative-choose-avater-box::after {
    display: none;
  }
}
.creative-choose-avater-info {
  line-height: 1;
}
.creative-choose-avater-info h4 {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 8px;
  letter-spacing: -0.03em;
  color: var(--tp-common-white);
}
.creative-choose-avater-info span {
  font-weight: 400;
  font-size: 15px;
  line-height: 1;
  letter-spacing: -0.03em;
  color: rgba(255, 255, 255, 0.6);
}
.creative-choose-customer {
  position: absolute;
  bottom: 0;
  right: 0;
  padding: 15px 25px;
  padding-bottom: 0;
  background-color: #0e0f11;
  border-radius: 20px 0 0 0;
}
@media (max-width: 767px) {
  .creative-choose-customer {
    position: static;
    padding-left: 0;
    padding-right: 0;
  }
}
.creative-choose-customer::after {
  content: "";
  position: absolute;
  bottom: 63px;
  right: -1px;
  height: 40px;
  width: 20px;
  border-bottom-right-radius: 20px;
  background-color: transparent;
  box-shadow: 0px 13px 0 0 #0e0f11;
}
@media (max-width: 767px) {
  .creative-choose-customer::after {
    display: none;
  }
}
.creative-choose-customer::before {
  content: "";
  position: absolute;
  bottom: -1px;
  left: -19px;
  height: 40px;
  width: 20px;
  border-bottom-right-radius: 20px;
  background-color: transparent;
  box-shadow: 0px 13px 0 0 #0e0f11;
}
@media (max-width: 767px) {
  .creative-choose-customer::before {
    display: none;
  }
}
.creative-choose-customer img {
  flex: 0 0 auto;
  margin-right: 12px;
}
.creative-choose-customer-info h4 {
  font-weight: 700;
  font-size: 15px;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: -0.01em;
  color: var(--tp-common-white);
}
.creative-choose-customer-info span {
  font-weight: 500;
  font-size: 14px;
  color: rgba(255, 255, 255, 0.7);
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-choose-area {
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .design-choose-area {
    padding-bottom: 60px;
  }
}
@media (max-width: 767px) {
  .design-choose-area {
    padding-bottom: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .design-choose-title-box {
    margin-bottom: 30px;
  }
}
.design-choose-title-box p {
  font-weight: 500;
  font-size: 44px;
  line-height: 1.18;
  color: #e0eeee;
  margin-bottom: 0;
  max-width: 715px;
  letter-spacing: -0.04em;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .design-choose-title-box p {
    font-size: 35px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-choose-title-box p {
    max-width: 100%;
    font-size: 35px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .design-choose-title-box p {
    max-width: 100%;
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .design-choose-title-box p {
    max-width: 100%;
    font-size: 28px;
  }
  .design-choose-title-box p br {
    display: none;
  }
}
.design-choose-content {
  max-width: 440px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .design-choose-content {
    max-width: 100%;
  }
}
@media (max-width: 767px) {
  .design-choose-content {
    max-width: 100%;
    margin-bottom: 30px;
  }
}
.design-choose-content p {
  font-weight: 500;
  font-size: 20px;
  line-height: 1.5;
  color: #e0eeee;
  margin-bottom: 40px;
  letter-spacing: -0.02em;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .design-choose-content-wrap {
    margin-bottom: 50px;
  }
}
.design-choose-item {
  padding: 65px 70px;
  border-radius: 30px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .design-choose-item {
    margin-top: 0;
  }
}
@media (max-width: 767px) {
  .design-choose-item {
    margin-top: 0;
    padding: 60px 30px;
  }
}
.design-choose-item span {
  font-weight: 500;
  font-size: 124px;
  line-height: 1;
  margin-bottom: 125px;
  display: inline-block;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
}
.design-choose-item span i {
  font-style: normal;
}
.design-choose-item p {
  font-weight: 400;
  font-size: 40px;
  line-height: 0.9;
  text-align: end;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-dirtyline);
}
.design-choose-item-3 {
  transform: translateY(-170px);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-choose-item-3 {
    transform: translateY(0px);
  }
}

@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-choose-area {
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-choose-area {
    padding-top: 100px;
    padding-bottom: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-choose-area {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .ai-choose-title-box {
    margin-bottom: 45px;
  }
}
.ai-choose-icon {
  margin-right: 20px;
}
.ai-choose-icon span {
  height: 60px;
  width: 60px;
  line-height: 56px;
  border-radius: 50%;
  text-align: center;
  display: inline-block;
  backdrop-filter: blur(10px);
  mix-blend-mode: luminosity;
  color: var(--tp-common-cream-2);
  background: rgba(255, 246, 191, 0.08);
}
.ai-choose-text p {
  font-weight: 700;
  font-size: 18px;
  line-height: 1.4;
  margin-bottom: 0;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-choose-text p {
    font-size: 16px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-choose-text p {
    font-size: 14px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ai-choose-text p {
    font-size: 16px;
  }
}
@media (max-width: 767px) {
  .ai-choose-text p {
    font-size: 15px;
  }
}
.ai-choose-bottom-text {
  border-radius: 20px;
  padding: 5px 20px;
  display: inline-block;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.ai-choose-bottom-text p {
  font-weight: 500;
  font-size: 15px;
  line-height: 1.73;
  margin-bottom: 0;
  color: rgba(255, 255, 255, 0.7);
}
.ai-choose-bottom-text p a {
  font-weight: 600;
  text-decoration: underline;
  color: var(--tp-common-white);
}
.ai-choose-shape {
  position: absolute;
  top: -14%;
  left: 0;
  right: 0;
  text-align: center;
  z-index: -1;
}
@media (max-width: 767px) {
  .ai-choose-item {
    margin-bottom: 45px;
  }
}

.st-choose-bg::after {
  position: absolute;
  content: "";
  right: 0;
  bottom: 7%;
  height: 340px;
  width: 945px;
  z-index: -1;
  background-color: #FFFBF6;
  border-radius: 10px 0px 0px 10px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-choose-bg::after {
    width: 100%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-choose-shape {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-choose-heading {
    margin-bottom: 20px;
  }
}
.st-choose-list {
  padding-left: 75px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-choose-list {
    padding-left: 0;
  }
}
.st-choose-list ul li {
  font-size: 18px;
  font-weight: 500;
  line-height: 1;
  list-style: none;
  letter-spacing: -0.18px;
  color: var(--tp-common-brown);
}
.st-choose-list ul li:not(:last-child) {
  margin-bottom: 15px;
}
.st-choose-text-wrap p {
  color: #494949;
  letter-spacing: 0;
  line-height: 30px;
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-choose-text-wrap p br {
    display: none;
  }
}
.st-choose-thumb {
  height: 416px;
  overflow: hidden;
}
@media (max-width: 767px) {
  .st-choose-thumb {
    height: inherit;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .design-choose-2-style.design-choose-area {
    padding-top: 60px;
  }
}
.design-choose-2-style .design-choose-item {
  padding: 65px 70px;
  border-radius: 30px;
  background-color: #0E0F11;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-choose-2-style .design-choose-item {
    padding: 65px 35px;
  }
}
@media (max-width: 767px) {
  .design-choose-2-style .design-choose-item {
    padding: 50px 30px;
  }
}
.design-choose-2-style .design-choose-item p {
  font-weight: 500;
  font-size: 18px;
  line-height: 1.5;
  text-align: left;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-inter);
  color: rgba(224, 238, 238, 0.6);
}
.design-choose-2-style .design-choose-item span {
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .design-choose-2-style .design-choose-title-box p {
    font-size: 36px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .design-choose-2-style .design-choose-title-box p {
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .design-choose-2-style .design-choose-title-box p {
    font-size: 25px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .design-choose-2-style .tp-section-title-dirtyline {
    font-size: 160px;
  }
  .design-choose-2-style .tp-section-title-dirtyline br {
    display: none;
  }
}

/*----------------------------------------*/
/*  8.6 Price Css
/*----------------------------------------*/
@media (max-width: 767px) {
  .ai-price-area {
    padding-top: 0;
  }
}
.ai-price-shape-1 {
  position: absolute;
  top: -10%;
  right: -3%;
  z-index: -1;
}
.ai-price-shape-2 {
  position: absolute;
  bottom: 0;
  left: 5%;
  z-index: -1;
}
.ai-price-head span {
  font-weight: 500;
  font-size: 20px;
  line-height: 1;
  margin-bottom: 15px;
  display: inline-block;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.ai-price-head h4 {
  font-weight: 600;
  font-size: 54px;
  line-height: 1;
  margin-bottom: 30px;
  letter-spacing: -0.04em;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-price-head h4 {
    font-size: 42px;
  }
}
.ai-price-head h4 i {
  font-style: normal;
  font-weight: 500;
  font-size: 18px;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.6);
}
.ai-price-item {
  padding: 50px;
  border-radius: 60px;
  background-color: rgb(23, 19, 42);
}
.ai-price-list-item:not(:last-child) {
  margin-bottom: 20px;
}
.ai-price-list-item i {
  flex: 0 0 auto;
  height: 24px;
  width: 24px;
  line-height: 16px;
  border-radius: 50%;
  text-align: center;
  margin-right: 14px;
  display: inline-block;
  transform: translateY(-3px);
  color: var(--tp-common-white);
  border: 2px solid rgba(255, 255, 255, 0.2);
}
.ai-price-list-item span {
  font-size: 16px;
  font-style: normal;
  font-weight: 500;
  line-height: 1;
  letter-spacing: -0.32px;
  color: var(--tp-common-white);
}
.ai-price-btn {
  margin-bottom: 40px;
}
.ai-price-wrap.active {
  position: relative;
}
.ai-price-wrap.active::after {
  position: absolute;
  content: "";
  left: 0;
  top: 0;
  z-index: -1;
  margin: -2px;
  border-radius: 60px;
  height: calc(100% + 4px);
  width: calc(100% + 4px);
  transition: all 0.3s ease-out 0s;
  background: linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
  background: -moz-linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
  background: -webkit-linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
  background: -ms-linear-gradient(304deg, #FF994B 23.79%, #D34BE9 47%, #3188FF 85.86%);
}
.ai-price-badge {
  padding: 12px;
}
.ai-price-badge span {
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.ai-price-badge span svg {
  margin-right: 12px;
  transform: translateY(-2px);
}
.ai-price-title-box p {
  font-weight: 400;
  font-size: 20px;
  line-height: 1.2;
  margin-bottom: 0;
  letter-spacing: -0.02em;
  color: rgba(255, 255, 255, 0.6);
}
@media (max-width: 767px) {
  .ai-price-title-box p {
    font-size: 16px;
  }
}
.ai-price-tab ul {
  padding: 4px;
  border-radius: 12px;
  border: 1px solid rgba(255, 246, 191, 0.1);
}
.ai-price-tab ul li button {
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  padding: 10px 20px;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
}
.ai-price-tab ul li button.active {
  color: var(--tp-common-black);
}
.ai-price-bottom-text span {
  display: inline-block;
  border-radius: 20px;
  padding: 10px 20px;
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  color: rgba(255, 255, 255, 0.7);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.ai-price-bottom-text span a {
  font-weight: 600;
  text-decoration: underline;
  color: var(--tp-common-white);
}

#lineMarker {
  position: absolute;
  top: 5px;
  height: 36px;
  z-index: -1;
  transition: 0.4s;
  border-radius: 6px;
  display: inline-block;
  background: var(--tp-common-white);
}

.crp-price-item {
  padding: 45px 40px;
  border-radius: 20px;
  background: rgba(255, 255, 255, 0.08);
  border: 1px solid rgba(255, 253, 225, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-price-item {
    padding: 45px 30px;
  }
}
.crp-price-item.active .tp-btn-yellow-border.sm {
  color: var(--tp-common-black);
  background-color: var(--tp-common-yellow-green);
}
.crp-price-head {
  padding-bottom: 30px;
  margin-bottom: 40px;
  border-bottom: 1px solid rgba(255, 253, 225, 0.1);
}
.crp-price-head span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 20px;
  display: inline-flex;
  color: var(--tp-common-cream-3);
}
.crp-price-head h4 {
  font-weight: 600;
  font-size: 66px;
  line-height: 1;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
.crp-price-head h4 i {
  font-weight: 500;
  font-size: 15px;
  line-height: 1;
  font-style: normal;
  font-family: var(--tp-ff-inter);
  color: var(--tp-common-cream-3);
}
.crp-price-head p {
  font-weight: 500;
  font-size: 15px;
  line-height: 1.4;
  letter-spacing: 0.3px;
  color: var(--tp-common-cream-3);
}
.crp-price-list {
  margin-bottom: 50px;
}
.crp-price-list ul li {
  font-weight: 600;
  font-size: 15px;
  line-height: 1;
  letter-spacing: 0.3px;
  list-style-type: none;
  color: var(--tp-common-cream-3);
}
.crp-price-list ul li::before {
  content: "";
  height: 4px;
  width: 4px;
  border-radius: 50%;
  margin-right: 9px;
  display: inline-block;
  transform: translateY(-3px);
  background-color: var(--tp-common-cream-3);
}
.crp-price-list ul li:not(:last-child) {
  margin-bottom: 20px;
}
.crp-price-bg {
  background-color: #335341;
}
.crp-price-shape {
  position: absolute;
  top: 140px;
  left: 95px;
  z-index: -1;
}
.crp-price-shape-2 {
  position: absolute;
  top: 0;
  right: 0;
  z-index: -1;
}

.app-price-bg-shape {
  position: absolute;
  top: -140px;
  right: 70px;
  z-index: -1;
}
.app-price-box {
  padding: 15px;
  border-radius: 30px;
  background: var(--tp-common-white);
}
@media (max-width: 767px) {
  .app-price-box {
    padding: 0;
  }
}
@media (max-width: 767px) {
  .app-price-box .crp-price-item {
    padding: 45px 30px;
  }
}
.app-price-box .crp-price-item.active {
  border-radius: 24px;
  background: linear-gradient(126deg, #F6F5FF 3.33%, #EBF9FF 85.8%);
}
.app-price-box .crp-price-item.active .app-price-btn-box .animated-border-box.radius-style-2 {
  padding: 0;
  border-radius: 12px;
}
.app-price-box .crp-price-item.active .app-price-btn-box .animated-border-box.radius-style-2 .tp-btn-gradient.sm {
  border-radius: 12px;
}
.app-price-box .crp-price-head {
  padding-bottom: 10px;
  margin-bottom: 30px;
  border-color: rgba(34, 34, 49, 0.06);
}
.app-price-box .crp-price-head span {
  font-size: 14px;
  font-weight: 600;
  padding: 4px 15px;
  border-radius: 40px;
  display: inline-block;
  color: var(--tp-common-black-10);
  border: 1px solid rgba(33, 33, 45, 0.06);
  box-shadow: 0px 0px 2px 0px rgba(39, 39, 46, 0.04);
}
.app-price-box .crp-price-head h4 {
  font-size: 70px;
  font-weight: 500;
  margin-bottom: 16px;
  text-transform: uppercase;
  font-family: var(--tp-ff-phudu);
  color: var(--tp-common-black-10);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .app-price-box .crp-price-head h4 {
    font-size: 55px;
  }
}
@media (max-width: 767px) {
  .app-price-box .crp-price-head h4 {
    font-size: 50px;
  }
}
.app-price-box .crp-price-head h4 i {
  font-size: 16px;
  display: inline-block;
  text-transform: lowercase;
  color: var(--tp-common-black-10);
  transform: translate(-14px, -2px);
}
.app-price-box .crp-price-head p {
  color: #61616A;
}
.app-price-box .crp-price-list {
  margin-bottom: 40px;
}
.app-price-box .crp-price-list ul li {
  font-size: 16px;
  font-weight: 500;
  letter-spacing: -0.32px;
  color: var(--tp-common-black-10);
}
.app-price-box .crp-price-list ul li::before {
  content: none;
}
.app-price-box .crp-price-list ul li span {
  width: 20px;
  height: 20px;
  line-height: 16px;
  text-align: center;
  border-radius: 50%;
  margin-right: 10px;
  display: inline-block;
  border: 1px solid rgba(33, 33, 45, 0.06);
}
.app-price-box .row [class*=col-]:not(:last-child) {
  border-right: 1px solid rgba(34, 34, 49, 0.06);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-price-box .row [class*=col-]:not(:last-child) {
    border: none;
  }
}
.app-price-box.app-price-service {
  border-radius: 0;
}
.app-price-box.app-price-service .crp-price-item.active {
  border-radius: 0;
  background: none;
  background-color: #F6F8EF;
}
.app-price-box.app-price-service .crp-price-item.active .animated-border-box {
  border-radius: 0;
}
.app-price-box.app-price-service .crp-price-item.active .animated-border-box.radius-style-2 {
  border-radius: 0;
}
.app-price-box.app-price-service .crp-price-item.active .animated-border-box.radius-style-2 .tp-btn-gradient {
  background: none;
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-regular);
}
.app-price-box.app-price-service .crp-price-item.active .animated-border-box.radius-style-2 .tp-btn-gradient.sm {
  border-radius: 0;
}
.app-price-box.app-price-service .animated-border-box {
  line-height: 1;
  border-radius: 0;
}
.app-price-box.app-price-service .animated-border-box:hover {
  transform: scale(1);
}
.app-price-box.app-price-service .animated-border-box::before {
  content: none;
}
.app-price-box.app-price-service .animated-border-box .tp-btn-black-border {
  border-radius: 0;
}
.app-price-box.app-price-service .animated-border-box .tp-btn-black-border:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.app-price-box.app-price-service .crp-price-head h4 {
  font-family: var(--tp-ff-grotesk);
}
.app-price-box.app-price-inner-style {
  background-color: transparent;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.app-price-box.app-price-inner-style .app-price-btn-box .animated-border-box .tp-btn-black-border {
  background: #f6f6f9;
  border: 1px solid transparent;
}
.app-price-heading p {
  color: #61616A;
}
@media (max-width: 767px) {
  .app-price-heading p br {
    display: none;
  }
}
.app-price-tab-wrap .ai-price-tab ul {
  padding: 6px;
  border-radius: 40px;
  background: var(--tp-common-white);
  border: 1px solid rgba(33, 33, 45, 0.08);
}
.app-price-tab-wrap .ai-price-tab ul li {
  display: inline-block;
}
.app-price-tab-wrap .ai-price-tab ul li button {
  padding: 9px 37px;
  color: #61616A;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.app-price-tab-wrap .ai-price-tab ul li button.active {
  position: relative;
  z-index: 1;
  color: var(--tp-common-white);
}
.app-price-tab-wrap .ai-price-tab #lineMarker {
  top: 6px;
  left: 6px;
  z-index: 0;
  border-radius: 40px;
  border: 1px solid rgba(33, 33, 45, 0.06);
  background: #21212D;
  box-shadow: 0px 0px 2px 0px rgba(39, 39, 46, 0.04);
}
.app-price-store {
  gap: 14px;
}
.app-price-store p {
  font-size: 16px;
  color: #61616A;
  margin: 0;
}
.app-price-store p b {
  font-weight: 600;
  color: var(--tp-common-black-10);
}
.app-price-store p span {
  margin-right: 8px;
}
.app-price-btn-box .animated-border-box {
  padding: 1px;
}
.app-price-btn-box .animated-border-box .tp-btn-black-border {
  margin: 0;
  font-size: 16px;
  border-radius: 12px;
  letter-spacing: -0.16px;
  background: white;
  color: var(--tp-common-black-10);
  border: 1px solid rgba(33, 33, 46, 0.1);
  box-shadow: 0px 0px 1px 0px rgba(34, 34, 48, 0.2);
}
.app-price-btn-box .animated-border-box::before {
  background-image: conic-gradient(rgba(0, 0, 0, 0), #646363, rgba(0, 0, 0, 0) 25%);
}

/*----------------------------------------*/
/*  8.7 Faq Css
/*----------------------------------------*/
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-faq-area {
    margin-bottom: 120px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-faq-area {
    margin-bottom: 80px;
  }
}
.ai-faq-video {
  margin-bottom: 25px;
}
.ai-faq-video a {
  height: 70px;
  width: 70px;
  line-height: 75px;
  text-align: center;
  border-radius: 50%;
  display: inline-block;
  backdrop-filter: blur(40px);
  background: rgba(255, 255, 255, 0.06);
  animation: animate-pulse 3s linear infinite;
  border: 1px solid rgba(255, 255, 255, 0.1);
  box-shadow: 0 2px 10px 0 rgba(27, 27, 27, 0.1);
}
.ai-faq-video a span {
  margin-left: 6px;
}
.ai-faq-bg {
  border: 1px solid rgba(255, 246, 191, 0.08);
}
.ai-faq-thumb {
  position: absolute;
  top: 0;
  left: 0;
  width: 50%;
  height: 100%;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ai-faq-thumb {
    position: static;
    width: 100%;
    margin-bottom: 40px;
  }
}
.ai-faq-thumb img {
  width: 100%;
  height: 100%;
}
@media (max-width: 767px) {
  .ai-faq-thumb img {
    margin-bottom: 20px;
  }
}
.ai-faq-thumb .anim-zoomin-wrap, .ai-faq-thumb .anim-zoomin {
  height: 100%;
}
.ai-faq-content-wrap {
  padding-left: 50px;
  padding-top: 120px;
  padding-bottom: 120px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ai-faq-content-wrap {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-faq-content-wrap {
    padding-top: 50px;
    padding-bottom: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ai-faq-content-wrap {
    padding-left: 0;
    padding-bottom: 60px;
  }
}
@media (max-width: 767px) {
  .ai-faq-content-wrap {
    padding-left: 0;
    padding-top: 0;
    padding-bottom: 60px;
  }
}
.ai-faq-user-box {
  margin-top: -300px;
  margin-right: -60px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ai-faq-user-box {
    margin-right: -20px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ai-faq-user-box {
    margin-right: 20px;
  }
}
@media (max-width: 767px) {
  .ai-faq-user-box {
    margin-top: 0;
    margin-right: 0;
    flex-wrap: wrap;
  }
}
.ai-faq-user-item {
  padding: 29px 39px;
  display: inline-block;
  backdrop-filter: blur(40px);
  box-shadow: 0 2px 10px 0 rgba(27, 27, 27, 0.1);
}
@media (max-width: 767px) {
  .ai-faq-user-item {
    width: 100%;
    margin-right: 0;
  }
}
.ai-faq-user-item span {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 10px;
  display: inline-block;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.ai-faq-user-item h4 {
  font-weight: 700;
  font-size: 54px;
  line-height: 1;
  letter-spacing: -0.04em;
  color: var(--tp-common-black);
}

.app-faq-shape {
  position: absolute;
  top: 100px;
  left: 0;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-faq-shape {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-faq-wrap {
    padding-left: 0;
  }
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion {
  border-radius: 12px;
  background-color: var(--tp-common-white);
  box-shadow: 0px 1px 2px 0px rgba(39, 39, 46, 0.04);
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items {
  padding-left: 0;
  padding-bottom: 0;
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items:not(:last-child) {
  border-bottom: 2px solid rgb(247, 247, 253);
  box-shadow: 0px 1px 2px 0px rgba(39, 39, 46, 0.04);
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons {
  padding: 26px 60px 28px 30px;
  color: var(--tp-common-black);
}
@media (max-width: 767px) {
  .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons {
    font-size: 18px;
  }
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon {
  top: 18px;
  right: 20px;
  left: auto;
  width: 36px;
  height: 36px;
  margin: 0;
  line-height: 36px;
  border-radius: 50%;
  background-color: #F3F3F9;
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::before, .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::after {
  background-color: var(--tp-common-black-10);
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::before {
  height: 12px;
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::after {
  width: 12px;
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body {
  padding-left: 30px;
  padding-bottom: 20px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body {
    padding-right: 30px;
  }
}
.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body p {
  font-weight: 400;
  color: #66666C;
}
.app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion {
  border-radius: 12px;
  background-color: var(--tp-common-white);
  box-shadow: none;
}
.app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items {
  padding-left: 0;
  padding-bottom: 0;
  border-bottom: 1px solid rgba(17, 16, 19, 0.1);
}
.app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items:not(:last-child) {
  box-shadow: none;
}
.app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons {
  font-size: 26px;
  font-weight: 500;
  letter-spacing: -0.52px;
  padding: 26px 0px 28px 0px;
  color: var(--tp-common-black);
}
@media (max-width: 767px) {
  .app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons {
    font-size: 18px;
  }
}
.app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body {
  padding-left: 0px;
  padding-bottom: 20px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body {
    padding-right: 30px;
  }
}
.app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body p {
  font-size: 16px;
  font-weight: 400;
  color: #66666C;
  letter-spacing: -0.16px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-faq-wrap.faq-inner-style .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body p br {
    display: none;
  }
}

.it-faq-shape-1 {
  position: absolute;
  left: 0;
  bottom: -30px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .it-faq-shape-1 {
    left: -10%;
  }
}
.it-faq-shape-2 {
  margin-left: 75px;
}
@media (max-width: 767px), only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .it-faq-shape-2 {
    margin-left: 0;
  }
}
.it-faq-accordion .faq-active {
  position: relative;
}
.it-faq-accordion .faq-active::before {
  content: "";
  position: absolute;
  top: 0;
  left: 0;
  width: 8px;
  height: 0;
  transition: 0.5s;
  background: #ffd743;
  border-radius: 20px;
}
.it-faq-accordion .accordion-items.faq-active::before {
  top: auto;
  bottom: 0;
  height: 100%;
  transition: 0.5s;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-faq-text p br {
    display: none;
  }
}

.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items {
  box-shadow: none;
  border: 0;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion {
  border-radius: 0;
  background-color: transparent;
  box-shadow: none;
}
.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons {
  font-size: 26px;
  font-weight: 500;
  padding: 36px 60px 38px 30px;
  color: var(--tp-common-white);
}
.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body p {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.62;
  letter-spacing: -0.01em;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body p br {
    display: none;
  }
}
.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon {
  border: 1px solid rgb(34, 34, 34);
  background-color: rgba(255, 255, 255, 0.1);
}
.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::before,
.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::after {
  background-color: rgba(255, 255, 255, 0.6);
}
.service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon {
  top: 30px;
}

/*----------------------------------------*/
/*  8.8 Success Css
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-success-area {
    margin-bottom: 0;
  }
}
.crp-success-big-img {
  position: absolute;
  top: 0;
  left: 0;
  height: calc(100% - 10px);
  width: 58.1%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-success-big-img {
    width: 49.5%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-success-big-img {
    position: static;
    height: 400px;
    width: 100%;
    margin-bottom: 10px;
  }
}
.crp-success-big-img img {
  height: 100%;
  object-fit: cover;
}
.crp-success-big-img .anim-zoomin-wrap {
  height: 100%;
}
.crp-success-item {
  height: 100%;
  overflow: hidden;
}
.crp-success-item-shape-1 {
  position: absolute;
  top: -25px;
  right: 0;
  transform-origin: top right;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .crp-success-item-shape-1 {
    transform: scale(0.5);
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .crp-success-item-shape-1 {
    transform: scale(0.3);
  }
}
.crp-success-item-shape-2 {
  position: absolute;
  bottom: -1px;
  right: 0;
  transform-origin: right bottom;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .crp-success-item-shape-2 {
    transform: scale(0.6);
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .crp-success-item-shape-2 {
    transform: scale(0.4);
  }
}
.crp-success-item.about-us {
  background-size: cover;
  background-position: 0px 30px;
}
.crp-success-item.about-us .crp-about-us-item-wrap {
  padding-top: 160px;
  text-align: center;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-success-item.about-us .crp-about-us-item-wrap {
    padding-top: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .crp-success-item.about-us .crp-about-us-item-wrap {
    padding-top: 185px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .crp-success-item.about-us .crp-about-us-item-wrap {
    padding-top: 110px;
  }
}
@media (max-width: 767px) {
  .crp-success-item.about-us .crp-about-us-item-wrap {
    padding-top: 100px;
    padding-bottom: 45px;
  }
}
.crp-success-item.about-us .crp-about-us-item-title {
  font-size: 46px;
  font-weight: 500;
  line-height: 46px;
  color: #F9F4E8;
  font-family: var(--tp-ff-mango-light);
}
.crp-success-item.about-us .crp-about-us-item-icon {
  display: inline-block;
  margin-bottom: 14px;
}
.crp-success-item.about-us .crp-about-us-item-icon span {
  height: 40px;
  width: 40px;
  border-radius: 50%;
  display: grid;
  place-content: center;
  background-color: #323234;
}
.crp-success-item.about-us .crp-about-us-item-btn-box {
  display: flex;
  padding: 80px 30px 0;
  justify-content: space-between;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-success-item.about-us .crp-about-us-item-btn-box {
    padding: 25px 10px 0;
  }
}
.crp-success-item.about-us .crp-about-us-item-btn-box span {
  color: #F9F4E8;
  font-size: 14px;
  font-weight: 400;
  padding: 7px 26px;
  border-radius: 70px;
  display: inline-block;
  text-shadow: 0px 14px 14px rgba(8, 29, 49, 0.03);
  background: rgba(255, 255, 255, 0.1);
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.crp-success-item.about-us .crp-about-us-item-btn-box span svg {
  margin-left: 4px;
}
.crp-success-item.about-us .crp-about-us-item-btn-box a:hover span {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.crp-success-item.about-us-img {
  display: flex;
  justify-content: center;
  align-items: center;
}
@media (max-width: 767px) {
  .crp-success-item.about-us-img .crp-about-us-item-img {
    padding: 50px 0;
  }
}
.crp-success-item.about-us .crp-success-video {
  line-height: 1;
}
.crp-success-item.about-us .crp-success-video video {
  width: 475px;
  height: 475px;
  object-fit: cover;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-success-item.about-us .crp-success-video video {
    height: 302px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-success-item.about-us .crp-success-video video {
    width: 100%;
  }
}
.crp-success-content {
  height: 100%;
}
.crp-success-content-wrap {
  height: 100%;
  padding: 50px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-success-content-wrap {
    padding: 30px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .crp-success-content-wrap {
    padding: 30px;
  }
}
.crp-success-content p {
  font-weight: 500;
  font-size: 34px;
  line-height: 1;
  margin-bottom: 40px;
  letter-spacing: 0.05px;
  display: inline-block;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
.crp-success-content > span {
  font-weight: 500;
  font-size: 120px;
  line-height: 0.7;
  display: inline-block;
  font-family: var(--tp-ff-teko);
  color: var(--tp-common-cream-3);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-success-content > span {
    font-size: 100px;
  }
}
.crp-success-content > span i {
  font-style: normal;
}
.crp-success-yellow-box .crp-success-content p {
  font-weight: 600;
  font-size: 54px;
  line-height: 1;
  color: #2a4c3a;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .crp-success-yellow-box .crp-success-content p {
    font-size: 45px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .crp-success-yellow-box .crp-success-content p {
    font-size: 40px;
  }
}
.crp-success-img {
  height: 100%;
}
.crp-success-img .anim-zoomin-wrap {
  height: 100%;
}
.crp-success-img img {
  height: 100%;
}

.crp-success-about-us-big-img {
  position: absolute;
  top: 0;
  right: 0;
  width: 49.7%;
  height: calc(100% - 10px);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .crp-success-about-us-big-img {
    position: static;
    height: 400px;
    width: 100%;
    margin-bottom: 10px;
  }
}
.crp-success-about-us-big-img .anim-zoomin-wrap {
  height: 100%;
}
.crp-success-about-us-big-img img {
  height: 100%;
  object-fit: cover;
}

/*----------------------------------------*/
/*  8.9 Instagram Css
/*----------------------------------------*/
.ai-instagram-img {
  overflow: hidden;
}
.ai-instagram-img img {
  width: 100%;
  transition: 0.9s;
}
.ai-instagram-img:hover img {
  transform: scale(1.1);
}
.ai-instagram-shape-1 {
  position: absolute;
  left: -2%;
  z-index: -1;
  top: -125%;
}

.pp-social-item {
  display: block;
  text-align: center;
  padding: 45px 0 20px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.08);
}
.pp-social-item:last-child {
  border: none;
}
.pp-social-item.active .pp-social-item-wrap .pp-social-item-title {
  color: var(--tp-common-white);
}
.pp-social-item.active .pp-social-item-wrap p {
  color: var(--tp-common-white);
}
.pp-social-item.img-pos-1:hover .pp-social-item-thumb .thumb-1, .pp-social-item.img-pos-1.active .pp-social-item-thumb .thumb-1, .pp-social-item.img-pos-2:hover .pp-social-item-thumb .thumb-1, .pp-social-item.img-pos-2.active .pp-social-item-thumb .thumb-1, .pp-social-item.img-pos-3:hover .pp-social-item-thumb .thumb-1, .pp-social-item.img-pos-3.active .pp-social-item-thumb .thumb-1, .pp-social-item.img-pos-4:hover .pp-social-item-thumb .thumb-1, .pp-social-item.img-pos-4.active .pp-social-item-thumb .thumb-1 {
  opacity: 1;
  transform: translateX(0);
  transform: scale(1);
  transition-delay: 0.2s;
}
.pp-social-item.img-pos-1:hover .pp-social-item-thumb .thumb-2, .pp-social-item.img-pos-1.active .pp-social-item-thumb .thumb-2, .pp-social-item.img-pos-2:hover .pp-social-item-thumb .thumb-2, .pp-social-item.img-pos-2.active .pp-social-item-thumb .thumb-2, .pp-social-item.img-pos-3:hover .pp-social-item-thumb .thumb-2, .pp-social-item.img-pos-3.active .pp-social-item-thumb .thumb-2, .pp-social-item.img-pos-4:hover .pp-social-item-thumb .thumb-2, .pp-social-item.img-pos-4.active .pp-social-item-thumb .thumb-2 {
  opacity: 1;
  transform: scale(1);
  transition-delay: 0.3s;
}
.pp-social-item.img-pos-1:hover .pp-social-item-thumb .thumb-3, .pp-social-item.img-pos-1.active .pp-social-item-thumb .thumb-3, .pp-social-item.img-pos-2:hover .pp-social-item-thumb .thumb-3, .pp-social-item.img-pos-2.active .pp-social-item-thumb .thumb-3, .pp-social-item.img-pos-3:hover .pp-social-item-thumb .thumb-3, .pp-social-item.img-pos-3.active .pp-social-item-thumb .thumb-3, .pp-social-item.img-pos-4:hover .pp-social-item-thumb .thumb-3, .pp-social-item.img-pos-4.active .pp-social-item-thumb .thumb-3 {
  opacity: 1;
  transform: scale(1);
  transition-delay: 0.2s;
}
.pp-social-item.img-pos-1:hover .pp-social-item-thumb .thumb-4, .pp-social-item.img-pos-1.active .pp-social-item-thumb .thumb-4, .pp-social-item.img-pos-2:hover .pp-social-item-thumb .thumb-4, .pp-social-item.img-pos-2.active .pp-social-item-thumb .thumb-4, .pp-social-item.img-pos-3:hover .pp-social-item-thumb .thumb-4, .pp-social-item.img-pos-3.active .pp-social-item-thumb .thumb-4, .pp-social-item.img-pos-4:hover .pp-social-item-thumb .thumb-4, .pp-social-item.img-pos-4.active .pp-social-item-thumb .thumb-4 {
  opacity: 1;
  transform: scale(1);
  transform: translateY(0);
  transition-delay: 0.3s;
}
.pp-social-item.img-pos-1 .pp-social-item-thumb .thumb-1 {
  position: absolute;
  opacity: 0;
  top: 0;
  left: 12%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-1 .pp-social-item-thumb .thumb-1 {
    display: none;
  }
}
.pp-social-item.img-pos-1 .pp-social-item-thumb .thumb-2 {
  position: absolute;
  opacity: 0;
  top: 0;
  right: 20%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translateX(100px);
}
.pp-social-item.img-pos-1 .pp-social-item-thumb .thumb-3 {
  position: absolute;
  opacity: 0;
  bottom: 20%;
  left: 19%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translateY(100px);
}
.pp-social-item.img-pos-1 .pp-social-item-thumb .thumb-4 {
  position: absolute;
  opacity: 0;
  bottom: 25%;
  right: 15%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-1 .pp-social-item-thumb .thumb-4 {
    display: none;
  }
}
.pp-social-item.img-pos-2 .pp-social-item-thumb .thumb-1 {
  position: absolute;
  opacity: 0;
  top: 0;
  left: 17%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translateX(-100px);
}
.pp-social-item.img-pos-2 .pp-social-item-thumb .thumb-2 {
  position: absolute;
  opacity: 0;
  top: 0;
  right: 16%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-2 .pp-social-item-thumb .thumb-2 {
    display: none;
  }
}
.pp-social-item.img-pos-2 .pp-social-item-thumb .thumb-3 {
  position: absolute;
  opacity: 0;
  bottom: 20%;
  left: 24%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-2 .pp-social-item-thumb .thumb-3 {
    display: none;
  }
}
.pp-social-item.img-pos-2 .pp-social-item-thumb .thumb-4 {
  position: absolute;
  opacity: 0;
  bottom: 8%;
  right: 18%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
.pp-social-item.img-pos-3 .pp-social-item-thumb .thumb-1 {
  position: absolute;
  opacity: 0;
  top: 0;
  left: 12%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-3 .pp-social-item-thumb .thumb-1 {
    display: none;
  }
}
.pp-social-item.img-pos-3 .pp-social-item-thumb .thumb-2 {
  position: absolute;
  opacity: 0;
  top: 0;
  right: 20%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translateX(100px);
}
.pp-social-item.img-pos-3 .pp-social-item-thumb .thumb-3 {
  position: absolute;
  opacity: 0;
  bottom: 20%;
  left: 19%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translateY(100px);
}
.pp-social-item.img-pos-3 .pp-social-item-thumb .thumb-4 {
  position: absolute;
  opacity: 0;
  bottom: 25%;
  right: 15%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translateY(100px);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-3 .pp-social-item-thumb .thumb-4 {
    display: none;
  }
}
.pp-social-item.img-pos-4 .pp-social-item-thumb .thumb-1 {
  position: absolute;
  opacity: 0;
  top: 0;
  left: 17%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translateX(-100px);
}
.pp-social-item.img-pos-4 .pp-social-item-thumb .thumb-2 {
  position: absolute;
  opacity: 0;
  top: 0;
  right: 16%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-4 .pp-social-item-thumb .thumb-2 {
    display: none;
  }
}
.pp-social-item.img-pos-4 .pp-social-item-thumb .thumb-3 {
  position: absolute;
  opacity: 0;
  bottom: 20%;
  left: 24%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
@media (max-width: 767px) {
  .pp-social-item.img-pos-4 .pp-social-item-thumb .thumb-3 {
    display: none;
  }
}
.pp-social-item.img-pos-4 .pp-social-item-thumb .thumb-4 {
  position: absolute;
  opacity: 0;
  bottom: 8%;
  right: 18%;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: scale(0.7);
}
.pp-social-item-title {
  margin: 0;
  font-size: 180px;
  font-weight: 400;
  line-height: 0.6;
  letter-spacing: -5.4px;
  font-family: var(--tp-ff-teko);
  color: rgba(255, 255, 255, 0.1);
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-social-item-title {
    font-size: 120px;
  }
}
@media (max-width: 767px) {
  .pp-social-item-title {
    font-size: 70px;
    letter-spacing: 0;
  }
}
.pp-social-item-wrap {
  display: inline-block;
}
.pp-social-item-wrap p {
  margin: 0;
  line-height: 20px;
}
.pp-social-item-wrap .text-left {
  top: 15%;
  right: 104%;
  position: absolute;
  text-align: end;
  white-space: nowrap;
}
@media (max-width: 767px) {
  .pp-social-item-wrap .text-left {
    display: none;
  }
}
.pp-social-item-wrap .text-right {
  top: 15%;
  left: 106%;
  position: absolute;
  text-align: start;
  white-space: nowrap;
}
@media (max-width: 767px) {
  .pp-social-item-wrap .text-right {
    display: none;
  }
}

/*----------------------------------------*/
/*  9.0 Feature Css
/*----------------------------------------*/
.app-feature-border-style .row [class*=col-]:first-child .app-feature-item {
  border-radius: 24px 0 0 24px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .app-feature-border-style .row [class*=col-]:first-child .app-feature-item {
    border-radius: 0;
  }
}
.app-feature-border-style .row [class*=col-]:last-child .app-feature-item {
  border-radius: 0px 24px 24px 0px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .app-feature-border-style .row [class*=col-]:last-child .app-feature-item {
    border-radius: 0;
  }
}
.app-feature-heading p {
  color: #61616A;
}
.app-feature-item {
  padding: 50px 40px 30px;
  background-color: #EEEFF8;
}
@media (max-width: 767px) {
  .app-feature-item {
    padding: 50px 30px 30px;
  }
}
.app-feature-item-icon {
  margin-bottom: 35px;
}
.app-feature-item-content p {
  font-size: 15px;
  color: #61616A;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .app-feature-item-content p br {
    display: none;
  }
}
.app-feature-title {
  font-size: 24px;
  font-weight: 600;
  margin-bottom: 10px;
  text-transform: uppercase;
  font-family: var(--tp-ff-phudu);
  color: var(--tp-common-black-10);
}
.app-feature-bottom p {
  margin: 0;
  font-size: 16px;
  color: #61616A;
  display: inline-block;
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .app-feature-bottom p {
    font-size: 16px;
  }
}
@media (max-width: 767px) {
  .app-feature-bottom p {
    font-size: 14px;
  }
}
.app-feature-bottom p span {
  font-weight: 600;
  padding: 4px 17px;
  margin-right: 10px;
  border-radius: 30px;
  color: var(--tp-common-black-10);
  border: 1px solid rgba(0, 0, 0, 0.1);
  background-color: var(--tp-common-white);
  box-shadow: 0px 20px 40px 0px rgba(33, 33, 45, 0.1);
}
.app-feature-bottom p a {
  font-weight: 500;
  text-decoration: underline;
  color: var(--tp-common-black-10);
}

@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-feature-2-ptb {
    padding-bottom: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-feature-2-ptb {
    padding-top: 120px;
    padding-bottom: 60px;
  }
}
.app-feature-2-bg {
  position: absolute;
  top: 0%;
  left: 22%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .app-feature-2-bg {
    left: 17%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-feature-2-bg {
    left: 18%;
    top: 11%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-feature-2-bg {
    display: none;
  }
}
.app-feature-2-bg .shape-1 {
  position: absolute;
  top: 37%;
  left: 23%;
}
.app-feature-2-bg .shape-2 {
  position: absolute;
  top: 46%;
  left: 31%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-feature-2-bg .shape-2 {
    left: 40%;
    top: 47%;
  }
}
.app-feature-2-bg .shape-3 {
  position: absolute;
  top: 56%;
  right: 13%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-feature-2-bg .shape-3 {
    right: 0;
    top: 60%;
  }
}
.app-feature-2-thumb {
  padding-top: 75px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-feature-2-thumb {
    padding-top: 0;
  }
}
@media (max-width: 767px) {
  .app-feature-2-thumb {
    padding-top: 45px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-feature-2-thumb img {
    transform: scale(0.7);
  }
}
.app-feature-2-content {
  padding-left: 40px;
}
@media (max-width: 767px) {
  .app-feature-2-content {
    padding-left: 0;
  }
}
.app-feature-2-content .tp-section-subtitle.border-bg {
  position: relative;
  font-size: 17px;
  font-weight: 400;
  letter-spacing: -0.17px;
  padding: 11px 26px;
  margin-bottom: 25px;
  border-radius: 30px;
  border: 1px solid #FFF;
  background: rgba(255, 255, 255, 0.5);
  box-shadow: 0px 20px 40px 0px rgba(33, 33, 45, 0.1);
  backdrop-filter: blur(10px);
}
.app-feature-2-content-icon {
  margin-left: 25px;
}
.app-feature-2-content-icon span {
  display: inline-block;
  margin-right: 15px;
  transform: translateY(5px);
}
.app-feature-2-content-icon p {
  color: #61616A;
  font-size: 15px;
  margin: 0;
}
.app-feature-2-brd {
  height: 30px;
  width: 2px;
  margin-left: 35px;
  margin-bottom: 18px;
  background: rgba(34, 34, 46, 0.08);
}

.it-feature-ptb {
  padding-top: 150px;
}
@media (max-width: 767px) {
  .it-feature-ptb {
    padding-top: 100px;
  }
}
.it-feature-brand-shape {
  position: absolute;
  top: -5.5%;
  left: 0;
  right: 0;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .it-feature-brand-shape {
    top: -4.3%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .it-feature-brand-shape {
    top: -3%;
  }
}
@media (max-width: 767px) {
  .it-feature-brand-shape {
    display: none;
  }
}
.it-feature-item {
  position: relative;
  height: 100%;
  border-radius: 20px;
  padding: 60px 30px 55px;
  z-index: 1;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.it-feature-item::before {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  z-index: -1;
  border-radius: 20px;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  background: var(--tp-common-white);
  box-shadow: 0 2px 3px 0 rgba(50, 41, 73, 0.1);
}
.it-feature-item:hover::before {
  top: 15px;
  left: 15px;
  height: calc(100% - 30px);
  width: calc(100% - 30px);
}
.it-feature-item:hover .it-feature-icon::before {
  transform: translate(-50%, -50%) scale(1.25);
}
.it-feature-item-style-bg {
  padding: 50px 40px;
  background-size: cover;
  background-position: center;
  background-repeat: no-repeat;
}
.it-feature-item-style-bg::before {
  content: none;
}
.it-feature-item-style-bg .it-feature-title {
  font-size: 34px;
  line-height: 1.18;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-feature-item-style-bg .it-feature-title {
    font-size: 30px;
  }
}
.it-feature-title {
  font-weight: 500;
  font-size: 30px;
  line-height: 1;
  margin-bottom: 55px;
  letter-spacing: 0.02em;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-platform);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-feature-title {
    margin-bottom: 15px;
  }
}
.it-feature-icon {
  position: relative;
  width: 200px;
  height: 200px;
  line-height: 200px;
  text-align: center;
  border-radius: 50%;
  margin-bottom: 55px;
  display: inline-block;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-feature-icon {
    margin-bottom: 15px;
  }
}
.it-feature-icon.color-1::before {
  background-color: #FFE9FD;
}
.it-feature-icon.color-2::before {
  background-color: #E9EDFF;
}
.it-feature-icon.color-3::before {
  background-color: #FFF0FA;
}
.it-feature-icon.color-4::before {
  background-color: #E4EEFF;
}
.it-feature-icon.color-5::before {
  background-color: #FFE9FD;
}
.it-feature-icon::before {
  position: absolute;
  content: "";
  top: 50%;
  left: 50%;
  height: 160px;
  width: 160px;
  z-index: -1;
  border-radius: 50%;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  transform: translate(-50%, -50%);
}
.it-feature-icon img {
  min-width: 110px;
}
.it-feature-content p {
  font-weight: 400;
  font-size: 17px;
  color: #61616a;
  margin-bottom: 25px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-feature-content p br {
    display: none;
  }
}
.it-feature-category span {
  font-weight: 500;
  font-size: 11px;
  line-height: 1;
  color: #61616a;
  padding: 7px 12px;
  border-radius: 27px;
  display: inline-block;
  letter-spacing: 0.02em;
  text-transform: uppercase;
  margin-bottom: 5px;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  border: 1px solid rgba(50, 41, 73, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-feature-category span {
    margin-bottom: 5px;
  }
}
.it-feature-category span:hover {
  background: #F3F3F9;
  border-color: #F3F3F9;
}
.it-feature-shape-1 {
  position: absolute;
  bottom: 0;
  left: 0;
  z-index: -1;
}

.cr-feature-heading {
  border-bottom: 1px solid rgba(255, 255, 255, 0.07);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-feature-heading {
    padding-bottom: 50px;
  }
}
.cr-feature-heading p {
  font-size: 17px;
  font-weight: 500;
  line-height: 26px;
  color: rgba(255, 255, 255, 0.5);
}
.cr-feature-item {
  position: relative;
  margin: 15px;
  border-radius: 6px;
  background: #131416;
  box-shadow: 0px 0px 4px 0px rgba(255, 255, 255, 0.12) inset, 0px 0px 2px 2px rgba(0, 0, 0, 0.4);
}
.cr-feature-item-content {
  padding: 35px;
}
.cr-feature-item-content p {
  font-size: 17px;
  font-weight: 500;
  line-height: 26px;
  color: rgba(255, 255, 255, 0.5);
}
@media (max-width: 767px) {
  .cr-feature-item-content p br {
    display: none;
  }
}
.cr-feature-item-icon {
  margin-bottom: 30px;
  align-items: end;
}
.cr-feature-item-icon-title {
  margin: 0;
  font-size: 28px;
  font-weight: 600;
  letter-spacing: -0.56px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-feature-item-icon-title {
    font-size: 20px;
  }
}
.cr-feature-item-icon span {
  margin-right: 14px;
  flex: 0 0 auto;
}
.cr-feature-item.hight {
  height: 600px;
}
@media (max-width: 767px) {
  .cr-feature-item.hight {
    height: 440px;
  }
}
.cr-feature-item-box .row [class*=col-]:first-child {
  border-right: 1px solid rgba(255, 255, 255, 0.07);
}
@media (max-width: 767px) {
  .cr-feature-item-box .row [class*=col-]:first-child {
    border: none;
  }
}
.cr-feature-item-box .row [class*=col-]:last-child {
  border-top: 1px solid rgba(255, 255, 255, 0.07);
}
.cr-feature-thumb.big {
  position: absolute;
  right: 0;
  bottom: 0;
}

.cr-feature-2-ptb {
  padding-top: 185px;
  padding-bottom: 185px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.07);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-feature-2-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
.cr-feature-2-bg {
  position: absolute;
  top: 120px;
  left: 0;
  right: 0;
  z-index: -1;
  margin: 0 auto;
  text-align: center;
}
@media (max-width: 767px) {
  .cr-feature-2-heading {
    margin-bottom: 40px;
  }
}
.cr-feature-2-heading p {
  font-size: 17px;
  font-weight: 500;
  line-height: 26px;
  margin-bottom: 35px;
  color: rgba(255, 255, 255, 0.5);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), (max-width: 767px) {
  .cr-feature-2-heading p br {
    display: none;
  }
}
.cr-feature-2-left {
  margin-left: -6px;
}
.cr-feature-2-right {
  margin-right: -6px;
}
@media (max-width: 767px) {
  .cr-feature-2-right {
    display: none;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .cr-feature-2-right {
    display: block;
  }
}
.cr-feature-2-item {
  position: relative;
  width: 100%;
  height: 122px;
  display: grid;
  padding: 0;
  place-items: center;
  margin: -1px -1px 0px -1px;
  border: 1px solid #1B1C1C;
}
.cr-feature-2-item span {
  position: absolute;
  width: 10px;
  height: 10px;
  z-index: 1;
  display: inline-block;
  border-radius: 50%;
  background-color: #212222;
}
.cr-feature-2-item span.bullet-top-right {
  top: -4px;
  right: -6px;
}
.cr-feature-2-item span.bullet-top-left {
  top: -4px;
  left: -6px;
}
.cr-feature-2-item span.bullet-bottom-right {
  bottom: -6px;
  right: -6px;
}
.cr-feature-2-item span.bullet-bottom-left {
  bottom: -6px;
  left: -6px;
}
.cr-feature-2-item-icon {
  position: relative;
}
.cr-feature-2-item-icon img {
  max-height: 54px;
  max-width: 50px;
  animation: transform 8s infinite linear;
}
.cr-feature-2-item-icon.animation-2 img {
  animation: transform 5s infinite linear;
}

.cr-feature-3-border {
  border-bottom: 1px solid rgba(255, 255, 255, 0.07);
}
.cr-feature-3-border-box {
  padding: 15px 0;
  position: relative;
  border-left: 1px solid rgba(255, 255, 255, 0.07);
  border-right: 1px solid rgba(255, 255, 255, 0.07);
}
.cr-feature-3-border-box::after, .cr-feature-3-border-box::before {
  position: absolute;
  top: 0;
  width: 1px;
  height: 100px;
  opacity: 0.5;
  content: "";
  background: linear-gradient(180deg, rgba(255, 255, 255, 0) 0%, #fff 100%);
}
.cr-feature-3-border-box::after {
  right: 0;
  animation: scroll1 20s ease-out infinite;
}
.cr-feature-3-border-box::before {
  left: 0;
  animation: scroll1 15s ease-out infinite;
}
.cr-feature-3-box {
  padding: 55px;
  margin: 0 15px;
  border-radius: 6px;
  background: #131416;
  box-shadow: 0px 0px 4px 0px rgba(255, 255, 255, 0.12) inset, 0px 0px 2px 2px rgba(0, 0, 0, 0.4);
}
@media (max-width: 767px) {
  .cr-feature-3-box {
    padding: 30px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .cr-feature-3-box {
    padding: 45px;
  }
}
.cr-feature-3-heading {
  padding: 90px 0 0 28px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cr-feature-3-heading {
    padding: 30px 0 0 28px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-feature-3-heading {
    padding: 0;
  }
}
.cr-feature-3-heading p {
  font-size: 17px;
  font-weight: 500;
  line-height: 26px;
  margin-bottom: 35px;
  color: rgba(255, 255, 255, 0.5);
}
@media (max-width: 767px) {
  .cr-feature-3-heading p {
    font-size: 16px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cr-feature-3-heading p br {
    display: none;
  }
}

/*----------------------------------------*/
/*  9.1 Review Css
/*----------------------------------------*/
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .app-review-ptb {
    padding-bottom: 120px;
  }
}
.app-review-bg {
  padding: 40px;
  border-radius: 30px;
  background: linear-gradient(265deg, rgba(208, 242, 240, 0.8) 16.29%, rgba(197, 224, 252, 0.8) 84.71%);
}
.app-review-img {
  position: absolute;
  bottom: 0;
  left: 20%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-review-img {
    bottom: -54px;
    left: 22%;
    transform: scale(0.6);
  }
}
@media (max-width: 767px) {
  .app-review-img {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px) {
  .app-review-img {
    bottom: -26px;
    left: auto;
    transform: scale(0.8);
    right: 0;
    display: block;
  }
}
.app-review-title {
  font-size: 30px;
  font-weight: 600;
  text-transform: uppercase;
  font-family: var(--tp-ff-phudu);
  line-height: 1;
  margin-bottom: 10px;
  background: linear-gradient(293deg, #3188FF -3.2%, #D34BE9 48.62%, #FF994B 102.56%);
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .app-review-heading {
    margin-bottom: 50px;
  }
}
@media (max-width: 767px) {
  .app-review-heading {
    margin-bottom: 30px;
  }
}
.app-review-heading p {
  color: #61616A;
  font-size: 14px;
}
.app-review-heading p span {
  font-weight: 700;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .app-review-item {
    margin-bottom: 50px;
  }
}
@media (max-width: 767px) {
  .app-review-item {
    margin-bottom: 30px;
  }
}
.app-review-item.ml {
  margin-left: -5px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-review-item.ml {
    margin-left: 0;
  }
}
.app-review-item.mr {
  margin-left: 10px;
  margin-right: -12px;
}
.app-review-item-icon {
  margin-bottom: 18px;
}
.app-review-item-content p {
  color: #61616A;
  font-size: 14px;
  margin: 0;
}
.app-review-item-title {
  font-size: 44px;
  font-weight: 500;
  line-height: 1;
  margin-bottom: 10px;
  letter-spacing: -0.44px;
  font-family: var(--tp-ff-phudu);
  color: var(--tp-common-black-10);
}

/*----------------------------------------*/
/*  9.2 Stack Css
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-stack-ptb {
    margin-top: 60px;
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-stack-heading {
    padding-bottom: 50px;
  }
}
.app-stack-subtitle {
  font-size: 15px;
  font-weight: 600;
  padding: 2px 16px;
  display: inline-block;
  border-radius: 40px;
  margin-bottom: 25px;
  color: var(--tp-common-black-10);
  border: 1px solid rgba(33, 33, 45, 0.06);
  box-shadow: 0px 0px 2px 0px rgba(39, 39, 46, 0.04);
  background: var(--tp-common-white);
}
.app-stack-number {
  font-size: 220px;
  font-weight: 700;
  line-height: 0.6;
  margin-bottom: 30px;
  text-transform: uppercase;
  font-family: var(--tp-ff-phudu);
  background: linear-gradient(180deg, rgba(33, 33, 45, 0.1) 13.2%, rgba(247, 247, 253, 0.1) 94.29%);
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
}
@media (max-width: 767px) {
  .app-stack-number {
    font-size: 130px;
  }
}
.app-stack-title {
  font-size: 44px;
  font-weight: 700;
  margin-bottom: 15px;
  text-transform: uppercase;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-phudu);
}
@media (max-width: 767px) {
  .app-stack-title {
    font-size: 38px;
  }
}
@media (max-width: 767px) {
  .app-stack-title br {
    display: none;
  }
}
.app-stack-content {
  position: relative;
  margin-left: 38px;
}
@media (max-width: 767px) {
  .app-stack-content {
    margin-left: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .app-stack-content {
    margin-left: 30px;
  }
}
.app-stack-content::before {
  position: absolute;
  content: "";
  top: 8px;
  left: -38px;
  height: 80px;
  width: 1px;
  background-color: rgba(33, 33, 45, 0.1);
}
@media (max-width: 767px) {
  .app-stack-content::before {
    display: none;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .app-stack-content::before {
    display: block;
  }
}
.app-stack-content::after {
  position: absolute;
  content: "";
  top: 8px;
  left: -38px;
  height: 20px;
  width: 1px;
  background-color: var(--tp-common-black-10);
}
@media (max-width: 767px) {
  .app-stack-content::after {
    display: none;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .app-stack-content::after {
    display: block;
  }
}
.app-stack-content p {
  font-size: 15px;
  color: #61616A;
  margin-bottom: 35px;
}
@media (max-width: 767px) {
  .app-stack-content p br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .app-stack-item {
    padding-top: 120px;
    padding-bottom: 120px;
  }
}
@media (max-width: 767px) {
  .app-stack-item {
    padding-top: 50px;
    padding-bottom: 50px;
  }
}
.app-stack-item-02 {
  background: linear-gradient(265deg, rgb(208, 242, 240) 16.29%, rgb(197, 224, 252) 84.71%);
}
.app-stack-btn a {
  display: inline-block;
  font-size: 15px;
  font-weight: 600;
  border-radius: 42px;
  padding: 8px 24px;
  color: var(--tp-common-white);
  border: 1px solid rgba(33, 33, 45, 0.06);
  background: var(--tp-common-black-10);
  box-shadow: 0px 0px 2px 0px rgba(39, 39, 46, 0.04);
  backdrop-filter: blur(10px);
}
.app-stack-btn a:hover {
  transform: scale(1.1);
}
@media (max-width: 767px) {
  .app-stack-thumb-box {
    padding-bottom: 100px;
  }
}
.app-stack-thumb-box .shape-1 {
  position: absolute;
  top: 90px;
  left: -25px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .app-stack-thumb-box .shape-1 {
    left: -70px;
  }
}
@media (max-width: 767px) {
  .app-stack-thumb-box .shape-1 {
    top: -25px;
    left: -30px;
    transform: scale(0.8);
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .app-stack-thumb-box .shape-1 {
    top: 50px;
    transform: scale(1);
  }
}
.app-stack-thumb-box .shape-2 {
  position: absolute;
  top: -80px;
  right: 0;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-stack-thumb-box .shape-2 {
    top: -70px;
    right: -40px;
    transform: scale(0.8);
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .app-stack-thumb-box .shape-2 {
    top: -70px;
  }
}
@media (max-width: 767px) {
  .app-stack-thumb-box .shape-2 {
    top: -60px;
    right: -33px;
    transform: scale(0.8);
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .app-stack-thumb-box .shape-2 {
    top: -100px;
    right: -40px;
    transform: scale(0.8);
  }
}
.app-stack-thumb-box .shape-3 {
  position: absolute;
  top: 140px;
  right: -25px;
}
@media (max-width: 767px) {
  .app-stack-thumb-box .shape-3 {
    top: 0;
  }
}
.app-stack-thumb-box .shape-4 {
  position: absolute;
  bottom: 100px;
  right: 15px;
}
@media (max-width: 767px) {
  .app-stack-thumb-box .shape-4 {
    bottom: 0;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-skill-ptb {
    padding-bottom: 120px;
  }
}
@media (max-width: 767px) {
  .pp-skill-ptb {
    padding-bottom: 100px;
  }
}
.pp-skill-big-text {
  padding-bottom: 90px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-skill-big-text {
    padding-bottom: 65px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-skill-big-text {
    padding-bottom: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-skill-big-text {
    padding-bottom: 30px;
  }
}
.pp-skill-big-text-title {
  font-size: 380px;
  font-weight: 600;
  line-height: 0.7;
  margin: 0;
  color: #0e0f11;
  letter-spacing: -12px;
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .pp-skill-big-text-title {
    font-size: 330px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .pp-skill-big-text-title {
    font-size: 300px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .pp-skill-big-text-title {
    font-size: 265px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .pp-skill-big-text-title {
    font-size: 200px;
    letter-spacing: -5px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-skill-big-text-title {
    font-size: 165px;
    letter-spacing: -5px;
  }
}
@media (max-width: 767px) {
  .pp-skill-big-text-title {
    font-size: 75px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .pp-skill-big-text-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-skill-heading {
    margin-bottom: 30px;
  }
}
.pp-skill-subtitle {
  font-size: 18px;
  font-weight: 500;
  margin-right: 20px;
  letter-spacing: -0.36px;
  display: inline-block;
  color: var(--tp-common-black);
}
.pp-skill-title {
  font-size: 80px;
  font-weight: 600;
  line-height: 0.9;
  letter-spacing: -0.8px;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-teko);
}
@media (max-width: 767px) {
  .pp-skill-title {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .pp-skill-title br {
    display: none;
  }
}
@media (max-width: 767px) {
  .pp-skill-list {
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-skill-list-wrapper {
    padding-bottom: 0;
  }
}
.pp-skill-list-wrap {
  padding-left: 60px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-skill-list-wrap {
    padding-left: 0;
  }
}
.pp-skill-list-wrap .row [class*=col-]:nth-child(even) {
  padding-left: 30px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .pp-skill-list-wrap .row [class*=col-]:nth-child(even) {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .pp-skill-list-wrap .row [class*=col-]:nth-child(even) {
    padding-left: 15px;
  }
}
.pp-skill-list-title {
  font-size: 46px;
  font-weight: 500;
  line-height: 1;
  letter-spacing: -0.46px;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-teko);
}
@media (max-width: 767px) {
  .pp-skill-list-title {
    font-size: 40px;
  }
}
.pp-skill-list ul {
  padding-left: 15px;
  display: inline-block;
}
.pp-skill-list ul li {
  font-size: 18px;
  font-weight: 500;
  margin-bottom: 6px;
  letter-spacing: -0.18px;
  color: var(--tp-common-black);
}
.pp-skill-tools .row [class*=col-] {
  display: grid;
  justify-content: center;
}
.pp-skill-tools-item {
  display: grid;
  width: 330px;
  height: 330px;
  border-radius: 50%;
  place-content: center;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-skill-tools-item {
    height: 285px;
    width: 285px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .pp-skill-tools-item {
    margin-bottom: 30px;
  }
}
.pp-skill-tools-item-icon {
  margin-bottom: 15px;
}
.pp-skill-tools-item-title {
  font-size: 20px;
  font-weight: 600;
  margin-bottom: 25px;
  letter-spacing: -0.2px;
  color: var(--tp-common-black);
}
.pp-skill-tools-item-persent {
  font-size: 34px;
  font-weight: 500;
  border-radius: 14px;
  padding: 8px 48px 6px;
  display: inline-block;
  letter-spacing: 0.34px;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-teko);
  background: rgba(0, 0, 0, 0.1);
}

/*----------------------------------------*/
/*  9.3 Benefits Css
/*----------------------------------------*/
.app-benefits-wrapper {
  border-radius: 60px;
  padding: 110px 200px 90px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .app-benefits-wrapper {
    padding: 110px 100px 90px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .app-benefits-wrapper {
    padding: 110px 100px 90px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .app-benefits-wrapper {
    padding: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-benefits-wrapper {
    padding: 30px;
  }
}
.app-benefits-item {
  width: 100%;
  height: 308px;
  overflow: hidden;
  border-radius: 24px;
  background: #141416;
  border: 2px solid rgba(255, 255, 255, 0.1);
}
.app-benefits-item:hover .app-benefits-item-thumb img {
  transform: scale(1.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .app-benefits-item {
    height: 360px;
  }
}
@media (max-width: 767px) {
  .app-benefits-item {
    padding: 0 20px;
  }
}
.app-benefits-item-thumb {
  position: absolute;
  left: 0;
  bottom: 0;
  width: 100%;
  border-radius: 24px;
}
.app-benefits-item-thumb img {
  width: 100%;
  transition: 0.9s;
  border-radius: 24px;
}
.app-benefits-item-content {
  padding-top: 40px;
}
.app-benefits-item-title {
  font-size: 30px;
  font-weight: 600;
  margin: 0;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-phudu);
}
@media (max-width: 767px) {
  .app-benefits-item-title {
    font-size: 25px;
  }
}
@media (max-width: 767px) {
  .app-benefits-item-title br {
    display: none;
  }
}
.app-benefits-item-2-star {
  margin-bottom: 5px;
}
.app-benefits-item-2-content {
  padding-top: 40px;
}
.app-benefits-item-2-content p {
  font-size: 20px;
  font-weight: 500;
  margin: 0;
  color: rgba(255, 255, 255, 0.66);
}
@media (max-width: 767px) {
  .app-benefits-item-2-content p {
    font-size: 16px;
  }
}
.app-benefits-item-2-title {
  font-size: 70px;
  font-weight: 500;
  margin-bottom: 15px;
  line-height: 0.8;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-phudu);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-benefits-item-2-title {
    font-size: 62px;
  }
}
@media (max-width: 767px) {
  .app-benefits-item-2-title {
    font-size: 55px;
  }
}
.app-benefits-item-3 {
  height: 642px;
  width: 100%;
  overflow: hidden;
  border-radius: 30px;
  border: 2px solid rgba(255, 255, 255, 0.1);
  background: radial-gradient(371.89% 134.33% at 3.21% 1.26%, rgba(255, 255, 255, 0.07) 0%, rgba(217, 217, 217, 0) 100%);
}
.app-benefits-item-3:hover .app-benefits-item-thumb img {
  transform: scale(1.1);
}
@media (max-width: 767px) {
  .app-benefits-item-3 {
    height: 460px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .app-benefits-item-3 {
    height: 600px;
  }
}
.app-benefits-item-3-bg {
  position: absolute;
  left: 0;
  top: 0;
  width: 100%;
  height: 100%;
}
.app-benefits-item-3-bg img {
  width: 100%;
  height: 100%;
  transition: 0.9s;
  border-radius: 30px;
}
.app-benefits-item-3-content {
  padding-top: 35px;
}
.app-benefits-item-3-content span {
  font-size: 18px;
  font-weight: 500;
  margin-bottom: 2px;
  display: inline-block;
  color: var(--tp-common-white);
}
.app-benefits-item-3-content p {
  font-size: 20px;
  font-weight: 500;
  margin: 0;
  color: rgba(255, 255, 255, 0.66);
}
@media (max-width: 767px) {
  .app-benefits-item-3-content p {
    font-size: 16px;
  }
}
.app-benefits-item-3-title {
  font-size: 100px;
  font-weight: 500;
  margin-bottom: 15px;
  line-height: 0.8;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-phudu);
}

.it-benifit-bg {
  padding: 70px;
  border-radius: 30px;
}
@media (max-width: 767px) {
  .it-benifit-bg {
    padding: 30px;
  }
}
.it-benifit-shape {
  position: absolute;
  top: 50px;
  right: 20px;
}
@media (max-width: 767px), only screen and (min-width: 768px) and (max-width: 991px) {
  .it-benifit-shape {
    display: none;
  }
}
.it-benifit-icon {
  height: 46px;
  width: 46px;
  line-height: 42px;
  text-align: center;
  position: relative;
  margin-bottom: 30px;
}
.it-benifit-icon::after {
  position: absolute;
  top: 0;
  left: 0;
  z-index: -1;
  content: "";
  height: 100%;
  width: 100%;
  border-radius: 12px;
  display: inline-block;
  transform: rotate(45deg);
  background-color: #FFC4C0;
}
.it-benifit-icon svg {
  margin-left: 2px;
}
.it-benifit-title {
  font-weight: 500;
  font-size: 24px;
  line-height: 1;
  margin-bottom: 12px;
  letter-spacing: 0.02em;
  color: var(--tp-common-black-10);
  font-family: var(--tp-ff-platform);
  position: relative;
}
.it-benifit-title::before {
  position: absolute;
  top: -6px;
  left: -25px;
  content: "";
  height: 36px;
  width: 1px;
  display: inline-block;
  background-color: var(--tp-common-black-10);
}
.it-benifit-content p {
  font-weight: 400;
  font-size: 16px;
  line-height: 1.5;
  margin-bottom: 0;
  color: var(--tp-common-black-10);
}
.it-benifit-item {
  padding: 20px 0;
  padding-left: 24px;
  border-left: 1px solid rgba(33, 33, 45, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .it-benifit-item {
    margin-bottom: 30px;
  }
}

.tp-gsap-bg {
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  width: 100%;
  margin: 0 auto;
  height: 100%;
  text-align: center;
  background-color: var(--tp-common-black);
  z-index: -1;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-benefits-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-benefits-ptb {
    padding-bottom: 65px;
  }
}
.tp-benefits-heading p {
  font-size: 16px;
  color: rgba(17, 16, 19, 0.7);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-benefits-heading p br {
    display: none;
  }
}

@media (max-width: 767px) {
  .tp-benefit-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media (max-width: 767px) {
  .tp-benefit-heading {
    margin-bottom: 50px;
  }
}
.tp-benefit-box .row [class*=col]:nth-child(4n) .tp-benefit-item {
  border-right: none;
}
.tp-benefit-item {
  padding: 40px;
  border-right: 1px solid #F1F1F4;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-benefit-item {
    margin-left: -1px;
    margin-top: -1px;
    border: 1px solid #f1f1f4 !important;
  }
}
.tp-benefit-item.tp-benefit-borber-bottom {
  border-bottom: 1px solid #F1F1F4;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-benefit-item.tp-benefit-borber-bottom {
    border: none;
  }
}
.tp-benefit-item-icon {
  height: 74px;
}
.tp-benefit-item-title {
  font-size: 20px;
  font-weight: 600;
  color: #111013;
  letter-spacing: -0.4px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-benefit-item-title {
    font-size: 18px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-benefit-item-title br {
    display: none;
  }
}

/*----------------------------------------*/
/*  9.4 Cta Css
/*----------------------------------------*/
.app-cta-wrap {
  border-radius: 30px;
  background: linear-gradient(265deg, #D0F2F0 16.29%, #C5E0FC 84.71%);
}
.app-cta-wrapper {
  padding-left: 170px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .app-cta-wrapper {
    padding-left: 135px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .app-cta-wrapper {
    padding-left: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .app-cta-wrapper {
    padding-left: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-cta-wrapper {
    padding-left: 30px;
    padding-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .app-cta-wrapper {
    padding-top: 45px;
    padding-right: 30px;
  }
}
.app-cta-heading p {
  color: #61616A;
  letter-spacing: -0.18px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .app-cta-heading p br {
    display: none;
  }
}
.app-cta-store {
  display: flex;
  width: 184px;
  align-items: center;
  border-radius: 12px;
  padding: 9px 20px;
  transition: 0.4s;
  background: var(--tp-common-white);
  box-shadow: 0px 14px 24px 0px rgba(3, 46, 65, 0.2);
}
@media (max-width: 767px) {
  .app-cta-store {
    margin-bottom: 20px;
  }
}
.app-cta-store:hover {
  transform: scale(1.1);
}
.app-cta-store-icon {
  margin-right: 10px;
}
.app-cta-store-content p {
  margin: 0;
  font-size: 12px;
  color: var(--tp-common-black-10);
}
.app-cta-store-content span {
  font-size: 21px;
  font-weight: 600;
}
@media (max-width: 767px) {
  .app-cta-store-box {
    flex-wrap: wrap;
  }
}
.app-cta-thumb-2 {
  position: absolute;
  bottom: 0;
  right: 12%;
}

.st-cta-ptb {
  overflow: hidden;
  padding-top: 180px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-cta-ptb {
    padding-top: 120px;
    padding-bottom: 100px;
  }
}
.st-cta-bg-circle {
  position: absolute;
  top: 0;
  left: -3.5%;
  height: 1000px;
  width: 107%;
  display: inline-block;
  right: 0;
  margin: 0 auto;
  text-align: center;
}
.st-cta-wrapper .tp-section-title-playfair {
  font-size: 120px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .st-cta-wrapper .tp-section-title-playfair {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .st-cta-wrapper .tp-section-title-playfair {
    font-size: 62px;
  }
}
.st-cta-wrapper .tp-section-title-playfair span {
  color: var(--tp-common-white);
}
.st-cta-wrapper p {
  margin-bottom: 45px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-poppins);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .st-cta-wrapper p br {
    display: none;
  }
}
.st-cta-wrapper .tp-btn-border-2.st {
  background-color: var(--tp-common-white);
}
.st-cta-wrapper .tp-btn-border-2.st:hover {
  background-color: transparent;
  color: var(--tp-common-white);
  border-color: var(--tp-common-white);
}

@media (max-width: 767px) {
  .cr-cta-ptb {
    padding-top: 100px;
  }
}
.cr-cta-bg {
  position: absolute;
  bottom: -30%;
  left: 0;
  right: 0;
  z-index: -1;
  margin: 0 auto;
  text-align: center;
}
@media (max-width: 767px) {
  .cr-cta-shape {
    display: none;
  }
}
.cr-cta-shape span {
  height: 5px;
  width: 5px;
  border-radius: 50%;
  background: #D9D9D9;
  display: inline-block;
}
.cr-cta-shape .shape-1 {
  position: absolute;
  animation: bannerAnimationTwo 8s infinite linear;
}
.cr-cta-shape .shape-2 {
  position: absolute;
  animation: bannerAnimationTwo 9s infinite linear;
}
.cr-cta-shape .shape-3 {
  position: absolute;
  animation: bannerAnimationTwo 10s infinite linear;
}
.cr-cta-shape .shape-4 {
  position: absolute;
  animation: bannerAnimationTwo 11s infinite linear;
}
.cr-cta-shape .shape-5 {
  position: absolute;
  animation: bannerAnimationTwo 7s infinite linear;
}
.cr-cta-shape .shape-6 {
  position: absolute;
  animation: bannerAnimationTwo 8s infinite linear;
}
.cr-cta-shape .shape-7 {
  position: absolute;
  animation: bannerAnimationTwo 9s infinite linear;
}
.cr-cta-shape .shape-8 {
  position: absolute;
  animation: bannerAnimationTwo 10s infinite linear;
}
.cr-cta-shape .shape-9 {
  position: absolute;
  animation: bannerAnimationTwo 11s infinite linear;
}
.cr-cta-shape .shape-10 {
  position: absolute;
  animation: bannerAnimationTwo 7s infinite linear;
}
.cr-cta-shape .shape-11 {
  position: absolute;
  animation: bannerAnimationTwo 8s infinite linear;
}
.cr-cta-shape .shape-12 {
  position: absolute;
  animation: bannerAnimationTwo 9s infinite linear;
}
.cr-cta-shape .shape-13 {
  position: absolute;
  animation: bannerAnimationTwo 10s infinite linear;
}
.cr-cta-shape .shape-14 {
  position: absolute;
  animation: bannerAnimationTwo 11s infinite linear;
}
.cr-cta-shape .shape-15 {
  position: absolute;
  animation: bannerAnimationTwo 7s infinite linear;
}
.cr-cta-shape .shape-1 {
  bottom: 15%;
  left: 35%;
}
.cr-cta-shape .shape-2 {
  bottom: 8%;
  right: 45%;
}
.cr-cta-shape .shape-3 {
  bottom: 20%;
  left: 40%;
}
.cr-cta-shape .shape-4 {
  bottom: 16%;
  right: 37%;
}
.cr-cta-shape .shape-5 {
  bottom: 10%;
  left: 40%;
}
.cr-cta-shape .shape-6 {
  bottom: 20%;
  left: 45%;
}
.cr-cta-shape .shape-7 {
  bottom: 9%;
  right: 35%;
}
.cr-cta-shape .shape-8 {
  bottom: 30%;
  left: 50%;
}
.cr-cta-shape .shape-9 {
  bottom: 22%;
  right: 31%;
}
.cr-cta-shape .shape-10 {
  bottom: 15%;
  left: 24%;
}
.cr-cta-shape .shape-11, .cr-cta-shape .shape-12, .cr-cta-shape .shape-13, .cr-cta-shape .shape-14, .cr-cta-shape .shape-15 {
  width: 1px;
  height: 1px;
}
.cr-cta-shape .shape-11 {
  bottom: 10%;
  left: 35%;
}
.cr-cta-shape .shape-12 {
  bottom: 15%;
  right: 35%;
}
.cr-cta-shape .shape-13 {
  bottom: 20%;
  left: 50%;
}
.cr-cta-shape .shape-14 {
  bottom: 26%;
  right: 27%;
}
.cr-cta-shape .shape-15 {
  bottom: 10%;
  left: 30%;
}
.cr-cta-text {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 35px;
  color: rgba(255, 255, 255, 0.5);
}

/*----------------------------------------*/
/*  9.5 Intaractive Css
/*----------------------------------------*/
.tp-porfolio-10-title-wrap ul li {
  list-style-type: none;
  display: inline-block;
  padding-right: 30px;
  padding-bottom: 25px;
  transition: 0.4s;
}
@media (max-width: 767px) {
  .tp-porfolio-10-title-wrap ul li {
    padding: 16px;
  }
}
.tp-porfolio-10-title-wrap ul li.active {
  transition: 0.4s;
}
.tp-porfolio-10-title-wrap ul li.active a .tp-porfolio-10-title {
  color: var(--tp-common-white);
  opacity: 1;
}
.tp-porfolio-10-title-wrap ul li.active a .tp-porfolio-10-category {
  color: var(--tp-common-white);
  opacity: 1;
}
.tp-porfolio-10-title {
  font-size: 120px;
  font-weight: 800;
  line-height: 1;
  opacity: 0.06;
  transition: 0.4s;
  margin-bottom: 0;
  letter-spacing: -2.6px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-porfolio-10-title {
    font-size: 100px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-porfolio-10-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-porfolio-10-title {
    font-size: 85px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-porfolio-10-title {
    font-size: 61px;
  }
}
@media (max-width: 767px) {
  .tp-porfolio-10-title {
    font-size: 45px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-porfolio-10-title {
    font-size: 58px;
  }
}
.tp-porfolio-10-title-box {
  transition: 0.4s;
}
.tp-porfolio-10-category {
  font-size: 30px;
  font-weight: 500;
  line-height: 1;
  margin-left: 15px;
  transform: translateY(-12px);
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
  transition: 0.4s;
  opacity: 0.06;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-porfolio-10-category {
    font-size: 23px;
  }
}
@media (max-width: 767px) {
  .tp-porfolio-10-category {
    font-size: 18px;
  }
}
.tp-porfolio-10-height {
  height: 100vh;
  padding-top: 190px;
  padding-bottom: 100px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-porfolio-10-height {
    padding-top: 140px;
  }
}
@media (max-width: 767px) {
  .tp-porfolio-10-height {
    padding-top: 120px;
  }
}

.tp-porfolio-10-bg-1, .tp-porfolio-10-bg-2, .tp-porfolio-10-bg-3, .tp-porfolio-10-bg-4, .tp-porfolio-10-bg-5, .tp-porfolio-10-bg-6, .tp-porfolio-10-bg-7, .tp-porfolio-10-bg-8 {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  opacity: 0;
  object-fit: cover;
  visibility: hidden;
  transition: all 0.9s;
  transform: scale(1.04, 1.04);
}

#tp-porfolio-10-bg-box.tp-porfolio-10-bg-1 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-1 .tp-porfolio-10-bg-1 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-2 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-2 .tp-porfolio-10-bg-2 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-3 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-3 .tp-porfolio-10-bg-3 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-4 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-4 .tp-porfolio-10-bg-4 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-5 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-5 .tp-porfolio-10-bg-5 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-6 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-6 .tp-porfolio-10-bg-6 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-7 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-7 .tp-porfolio-10-bg-7 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-8 {
  opacity: 1;
}
#tp-porfolio-10-bg-box.tp-porfolio-10-bg-8 .tp-porfolio-10-bg-8 {
  opacity: 1;
  visibility: visible;
  transform: scale(1);
}

.tp-port-slider-main {
  height: 100vh;
  overflow: hidden;
}

.tp-port-slider-content-wrap {
  position: absolute;
  top: 0;
  left: 170px;
  height: 100%;
  width: 50%;
  overflow-y: scroll;
  scrollbar-width: none;
  padding-top: 150px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-port-slider-content-wrap {
    left: 120px;
  }
}
@media (max-width: 767px) {
  .tp-port-slider-content-wrap {
    left: 20px;
    width: 100%;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-port-slider-content-wrap {
    left: 120px;
    width: 100%;
  }
}

.tp-port-slider-title {
  font-size: 180px;
  font-weight: 600;
  line-height: 1;
  letter-spacing: 5px;
  text-transform: uppercase;
  color: transparent;
  color: transparent;
  transition: 0.3s;
  cursor: pointer;
  display: block;
  background-size: 0% 100%;
  background-repeat: no-repeat;
  -webkit-background-clip: text;
  font-family: var(--tp-ff-mango-bold);
  -webkit-text-fill-color: transparent;
  -webkit-text-stroke: 2px rgba(255, 255, 255, 0.4);
  transition: background-size 0.6s cubic-bezier(0.32, 0.55, 0.58, 0.76) 0s, 0.6s -webkit-clip-path cubic-bezier(0.32, 0.55, 0.58, 0.76) 0s;
  background-image: linear-gradient(90deg, #fff 0%, #fff 50%, transparent 50.1%);
  mix-blend-mode: luminosity;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-port-slider-title {
    font-size: 120px;
  }
}
@media (max-width: 767px) {
  .tp-port-slider-title {
    font-size: 70px;
  }
}
.tp-port-slider-title:hover {
  background-size: 200% 100%;
  color: var(--tp-common-white);
}

.tp-port-1, .tp-port-2, .tp-port-3, .tp-port-4, .tp-port-5, .tp-port-6, .tp-port-7, .tp-port-8, .tp-port-9 {
  position: absolute;
  top: 0;
  left: 0;
  height: 100vh;
  width: 100%;
  opacity: 0;
  object-fit: cover;
  transform: scale(1.04, 1.04);
  transform-origin: 50% 50%;
  transition: all 0.9s;
}
.tp-port-1 img, .tp-port-2 img, .tp-port-3 img, .tp-port-4 img, .tp-port-5 img, .tp-port-6 img, .tp-port-7 img, .tp-port-8 img, .tp-port-9 img {
  height: 100vh;
  width: 100%;
  object-fit: cover;
  transition: none;
}

#tp-port-slider-wrap.tp-port-1 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-1 .tp-port-1 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-2 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-2 .tp-port-2 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-3 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-3 .tp-port-3 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-4 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-4 .tp-port-4 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-5 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-5 .tp-port-5 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-6 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-6 .tp-port-6 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-7 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-7 .tp-port-7 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-8 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-8 .tp-port-8 {
  opacity: 1;
  transform: scale(1);
}
#tp-port-slider-wrap.tp-port-9 {
  opacity: 1;
}
#tp-port-slider-wrap.tp-port-9 .tp-port-9 {
  opacity: 1;
  transform: scale(1);
}

/*----------------------------------------*/
/*  9.6 Project Slider Css
/*----------------------------------------*/
/* ============ creative Slider ================= */
.tp-portfolio-slider__wrap {
  grid-area: main;
  position: relative;
  overflow: hidden;
  display: grid;
  place-items: center;
  width: 100%;
  height: 100vh;
}
.tp-portfolio-slider__item {
  grid-area: 1/1/-1/-1;
  position: relative;
  width: 100%;
  height: 100%;
  overflow: hidden;
  display: grid;
  place-items: center;
  opacity: 0;
  pointer-events: none;
}
.tp-portfolio-slider__item.current {
  opacity: 1;
  z-index: 50;
  pointer-events: auto;
}
.tp-portfolio-slider__item-inner {
  position: relative;
  width: 120%;
  height: 120%;
  display: grid;
  place-items: center;
  grid-area: 1/1/-1/-1;
  background-size: cover;
  background-position: 50% 50%;
}
.tp-portfolio-slider-type {
  grid-area: main;
  display: grid;
  place-items: center;
  z-index: 9;
  position: absolute;
  bottom: 6%;
  left: 50%;
  transform: translateX(-50%);
}
@media (max-width: 767px) {
  .tp-portfolio-slider-type {
    bottom: 20%;
    width: 100%;
  }
}
.tp-portfolio-slider-type-title {
  font-weight: 600;
  font-size: 120px;
  line-height: 0.9;
  margin-bottom: 0;
  text-align: center;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-mango);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slider-type-title {
    font-size: 90px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slider-type-title {
    font-size: 60px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-portfolio-slider-type-title {
    font-size: 80px;
  }
}
.tp-portfolio-slider__mail {
  position: absolute;
  top: 50%;
  right: 5%;
  z-index: 55;
  transform: translateY(-50%);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slider__mail {
    right: 45px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slider__mail {
    right: 30px;
  }
}
.tp-portfolio-slider__mail a {
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  letter-spacing: 0.6px;
  writing-mode: vertical-lr;
  color: var(--tp-common-white);
}
.tp-portfolio-slider__social {
  position: absolute;
  top: 50%;
  left: 5%;
  z-index: 55;
  writing-mode: vertical-rl;
  transform: translateY(-50%) rotate(180deg);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slider__social {
    left: 45px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slider__social {
    left: 30px;
    display: none;
  }
}
.tp-portfolio-slider__social a {
  font-weight: 700;
  font-size: 14px;
  line-height: 1;
  margin: 14px 0;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-portfolio-slider__copyright {
  position: absolute;
  top: 45px;
  left: 50%;
  z-index: 55;
  transform: translateX(-50%);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-slider__copyright {
    top: 65px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slider__copyright {
    display: none;
  }
}
.tp-portfolio-slider__copyright p {
  font-weight: 700;
  font-size: 14px;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: 0.8px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-portfolio-slider__copyright p a {
  position: relative;
}
.tp-portfolio-slider__copyright p a::after {
  position: absolute;
  content: "";
  bottom: -1px;
  left: 0;
  width: 0;
  height: 1px;
  transition: 0.3s;
  display: inline-block;
  opacity: 0;
  visibility: hidden;
  background-color: var(--tp-common-white);
}
.tp-portfolio-slider__copyright p:hover a::after {
  right: auto;
  width: 100%;
  opacity: 1;
  visibility: visible;
}
.tp-portfolio-slider__style-2 .tp-portfolio-slider__copyright {
  position: absolute;
  top: auto;
  bottom: 80px;
  left: 50%;
  z-index: 55;
  transform: translateX(-50%);
}
@media (max-width: 767px) {
  .tp-portfolio-slider__style-2 .tp-portfolio-slider__copyright {
    bottom: 140px;
    text-align: center;
  }
}
.tp-portfolio-slider__style-2 .tp-portfolio-slider-type-title {
  font-size: 180px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-slider__style-2 .tp-portfolio-slider-type-title {
    font-size: 140px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-slider__style-2 .tp-portfolio-slider-type-title {
    font-size: 120px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slider__style-2 .tp-portfolio-slider-type-title {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slider__style-2 .tp-portfolio-slider-type-title {
    font-size: 70px;
  }
}
.tp-portfolio-slider__style-2 .tp-portfolio-slider-type {
  top: 65%;
}

.type__item {
  grid-area: 1/1/-1/-1;
  opacity: 0;
}

.type__item--current {
  opacity: 1;
}

.char-wrap {
  display: inline-block;
  position: relative;
  overflow: hidden;
  display: inline-flex;
}

.slider--bg {
  z-index: 1;
}
.slider--bg .tp-portfolio-slider__item-inner {
  position: relative;
}
.slider--bg .tp-portfolio-slider__item-inner::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background: rgba(2, 2, 1, 0.2);
}

.slider--fg {
  position: absolute;
  width: 20vw;
  min-width: 200px;
  aspect-ratio: 0.75;
  height: auto;
  z-index: 2;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
}

.slider-nav {
  position: fixed;
  width: 100%;
  line-height: 1;
  bottom: 0;
  right: 0;
  z-index: 2;
  display: flex;
  justify-content: space-between;
}
.slider-nav__item .icon-1, .slider-nav__item .icon-2 {
  transition: 0.3s;
  transform: translateY(-1px);
}
.slider-nav__item:hover .icon-1 {
  transform: translateX(-5px);
}
.slider-nav__item:hover .icon-2 {
  transform: translateX(5px);
}

.slider-nav__item--prev {
  grid-area: prev;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .slider-nav__item--prev {
    margin-left: 45px;
  }
}
@media (max-width: 767px) {
  .slider-nav__item--prev {
    margin-left: 30px;
  }
}

.slider-nav__item--next {
  grid-area: next;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .slider-nav__item--next {
    margin-right: 45px;
  }
}
@media (max-width: 767px) {
  .slider-nav__item--next {
    margin-right: 30px;
  }
}

.tp-portfolio-slider-small__wrap {
  border-radius: 200px;
}

.slider-nav-text {
  font-weight: 700;
  font-size: 14px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
}

/* ============ creative Slider ================= */
/* ============ Showcase Slider ================= */
.tp-showcase-slider .swiper-slide {
  position: relative;
  overflow: hidden;
  width: 100%;
  min-height: 100vh;
  padding: 80px 0;
}
.tp-showcase-slider-bg {
  display: flex;
  align-items: center;
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  background-size: cover;
  background-position: center;
  background-repeat: no-repeat;
}
.tp-showcase-slider-bg::after {
  opacity: 0.3;
  background: #1d1d1d;
  content: "";
  position: absolute;
  width: 100%;
  height: 100%;
  top: 0;
  left: 0;
  z-index: 1;
  pointer-events: none;
}
.tp-showcase-slider-subtitle {
  font-weight: 600;
  font-size: 24px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-inter);
}
@media (max-width: 767px) {
  .tp-showcase-slider-subtitle {
    font-size: 20px;
  }
}
.tp-showcase-slider-title {
  font-size: 200px;
  font-weight: 600;
  line-height: 1;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-mango-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-showcase-slider-title {
    font-size: 170px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-showcase-slider-title {
    font-size: 160px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-showcase-slider-title {
    font-size: 140px;
  }
}
@media (max-width: 767px) {
  .tp-showcase-slider-title {
    font-size: 90px;
  }
}
.tp-showcase-slider-button-wrap .swiper-button-prev, .tp-showcase-slider-button-wrap .swiper-button-next {
  position: absolute;
  display: flex;
  align-items: center;
  top: auto;
  color: #fff;
  z-index: 9;
  cursor: pointer;
  width: auto;
  bottom: 30px;
  font-weight: 700;
  font-size: 14px;
  line-height: 1;
  letter-spacing: 0.5px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-showcase-slider-button-wrap .swiper-button-prev i, .tp-showcase-slider-button-wrap .swiper-button-next i {
  transform: translateY(1px);
}
.tp-showcase-slider-button-wrap .swiper-button-prev::after, .tp-showcase-slider-button-wrap .swiper-button-next::after {
  display: none;
}
.tp-showcase-slider-button-wrap .swiper-button-prev {
  left: 5%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-showcase-slider-button-wrap .swiper-button-prev {
    left: 4%;
  }
}
.tp-showcase-slider-button-wrap .swiper-button-prev i {
  transition: 0.3s;
  margin-right: 7px;
}
.tp-showcase-slider-button-wrap .swiper-button-prev:hover i {
  transform: translate(-3px, 1px);
}
.tp-showcase-slider-button-wrap .swiper-button-next {
  right: 5%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-showcase-slider-button-wrap .swiper-button-next {
    right: 4%;
  }
}
.tp-showcase-slider-button-wrap .swiper-button-next i {
  transition: 0.3s;
  margin-left: 7px;
}
.tp-showcase-slider-button-wrap .swiper-button-next:hover i {
  transform: translate(3px, 1px);
}
.tp-showcase-slider-main .swiper-pagination {
  bottom: 40px;
  left: 50%;
  -webkit-transform: translateX(-50%);
  -ms-transform: translateX(-50%);
  transform: translateX(-50%);
  width: auto;
}
@media (max-width: 767px) {
  .tp-showcase-slider-main .swiper-pagination {
    display: none;
  }
}
.tp-showcase-slider-main .swiper-pagination-bullet {
  background: transparent;
  margin: 0 10px !important;
}
.tp-showcase-slider-main .path {
  display: none;
}
.tp-showcase-slider-main .swiper-pagination-bullet-active .path {
  display: inline-block !important;
  stroke-dasharray: 1000;
  stroke-dashoffset: 0;
  -webkit-animation: dash linear 10s;
  animation: dash linear 10s;
  -webkit-animation-iteration-count: unset;
  animation-iteration-count: unset;
}

/* ============ Showcase Slider ================= */
/* ============ parallax Slider ================= */
.parallax-slider-wrapper {
  position: fixed;
  top: 0;
  left: 0;
  width: 100%;
  height: 100vh;
}

.parallax-sliders {
  position: absolute;
  top: 0;
  left: 0;
  width: 3800px;
  height: 100%;
}

.parallax-slider-inner {
  position: absolute;
  top: 50%;
  transform: translateY(-50%);
  height: 80%;
  width: 100%;
  display: flex;
  gap: 30px;
  left: 70px;
  margin-top: 15px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .parallax-slider-inner {
    left: 40px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .parallax-slider-inner {
    left: 25px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .parallax-slider-inner {
    left: 35px;
  }
}
@media (max-width: 767px) {
  .parallax-slider-inner {
    left: 0px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .parallax-slider-inner {
    left: 30px;
  }
}

.parallax-item {
  position: relative;
  width: 500px;
  height: 100%;
  overflow: hidden;
}
.parallax-item:hover .parallax-content {
  bottom: 0;
  opacity: 1;
  visibility: visible;
}
.parallax-item:hover .parallax-img::after {
  opacity: 1;
  height: 100%;
  visibility: visible;
}

.parallax-content {
  position: absolute;
  bottom: -100px;
  left: 0;
  z-index: 55;
  overflow: hidden;
  opacity: 0;
  visibility: hidden;
  margin: 40px 40px 30px 35px;
  transition: 0.4s;
}
.parallax-content span {
  font-size: 24px;
  line-height: 1;
  display: block;
  font-size: 20px;
  margin-bottom: 10px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-marcellus);
  text-transform: capitalize;
}
.parallax-content h4 {
  font-size: 50px;
  line-height: 1;
  padding-bottom: 7px;
  display: inline-block;
  letter-spacing: -3px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-marcellus);
}

.parallax-img {
  position: absolute;
  height: 100%;
  width: 800px;
  background-size: cover;
  background-position: center;
  margin-left: -100px;
}
.parallax-img::after {
  position: absolute;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  content: "";
  opacity: 0;
  visibility: hidden;
  transition: 0.4s;
  background-color: rgba(0, 0, 0, 0.3);
}

/* ============ parallax Slider ================= */
/* ============ showcase Slider ================= */
#canvas-slider {
  width: 100%;
  height: 100%;
  position: fixed;
  top: 0;
  right: 0;
  overflow: hidden;
  -webkit-transition: width 0.5s ease-in-out 0;
  transition: width 0.5s ease-in-out 0s;
  z-index: 1;
}

#showcase-slider-holder {
  width: 100%;
  height: 100vh;
  position: relative;
  overflow: hidden;
  opacity: 1;
  z-index: 2;
}

#canvas-slider .slider-img {
  position: absolute;
  height: 100%;
  width: 100%;
  background-size: cover;
  background-position: center center;
  background-color: #222;
  visibility: hidden;
  top: 0;
  left: 0;
  z-index: 0;
  opacity: 0;
  -webkit-transform: scale(1.01);
  transform: scale(1.01);
  -webkit-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}

.port-showcase-slider-item {
  height: 100vh;
}

.parallax-slider-active .swiper-slide {
  position: relative;
  overflow: hidden;
  width: 100%;
  height: 100vh;
}

.parallax-slider-active .swiper-container {
  width: 100%;
  height: 100vh;
}

.port-showcase-slider-space {
  padding: 100px;
}
.port-showcase-slider-content {
  position: absolute;
  top: 50%;
  left: 50%;
  vertical-align: middle;
  transform: translate(-50%, -50%);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .port-showcase-slider-content {
    left: 40%;
  }
}
.port-showcase-slider-subtitle {
  font-size: 16px;
  font-weight: 500;
  line-height: 1;
  margin-bottom: 30px;
  display: inline-block;
  color: var(--tp-common-white);
}
.port-showcase-slider-title {
  font-size: 215px;
  font-weight: 500;
  line-height: 0.8;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
  letter-spacing: -6px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .port-showcase-slider-title {
    font-size: 145px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .port-showcase-slider-title {
    font-size: 120px;
  }
}
@media (max-width: 767px) {
  .port-showcase-slider-title {
    font-size: 90px;
  }
}
.port-showcase-slider-social {
  position: absolute;
  bottom: 75px;
  z-index: 99;
  left: 50%;
  text-align: center;
}
.port-showcase-slider-social a {
  font-size: 16px;
  font-weight: 600;
  line-height: 1;
  margin: 0 12px;
  color: var(--tp-common-white);
}

.tp-showcase-arrow-box {
  position: absolute;
  bottom: 80px;
  left: 0;
  z-index: 99;
  width: 100%;
  padding: 0 100px;
}
.tp-showcase-arrow-box button {
  font-weight: 700;
  font-size: 14px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-showcase-arrow-box button i {
  transform: translateY(1px);
}
.tp-showcase-arrow-box button.swiper-next i {
  transition: 0.3s;
  margin-left: 5px;
}
.tp-showcase-arrow-box button.swiper-next:hover i {
  transform: translateX(4px);
}
.tp-showcase-arrow-box button.swiper-prev i {
  transition: 0.3s;
  margin-right: 5px;
}
.tp-showcase-arrow-box button.swiper-prev:hover i {
  transform: translateX(-4px);
}

/* ============ showcase Slider ================= */
.slide {
  width: 100%;
  height: 100%;
  grid-area: 1/1/-1/-1;
  pointer-events: none;
  opacity: 0;
  overflow: hidden;
  position: relative;
  display: grid;
  place-items: center;
  will-change: transform, opacity;
}

.slide--current {
  pointer-events: auto;
  opacity: 1;
}
.slide--current .skew-slider-content {
  opacity: 1;
  visibility: visible;
}

.slide__img {
  width: 100%;
  height: 100%;
  background-size: cover;
  background-position: 50% 50%;
  background-repeat: no-repeat;
  will-change: transform, opacity, filter;
}

.skew-slider-wrap {
  width: 100%;
  height: 100vh;
  display: grid;
  overflow: hidden;
  place-items: center;
  grid-template-rows: 100%;
  grid-template-columns: 100%;
}
.skew-slider-arrow {
  position: absolute;
  bottom: 80px;
  gap: 10px;
  width: 100%;
  display: flex;
  padding: 0 100px;
  align-items: center;
  justify-content: space-between;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .skew-slider-arrow {
    padding: 0 45px;
  }
}
@media (max-width: 767px) {
  .skew-slider-arrow {
    padding: 0 20px;
  }
}
.skew-slider-arrow button {
  font-weight: 700;
  font-size: 14px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.skew-slider-arrow button .icon-1, .skew-slider-arrow button .icon-2 {
  transition: 0.3s;
  margin-right: 7px;
  transform: translate(0px, -1px);
}
.skew-slider-arrow button .icon-2 {
  margin-left: 7px;
}
.skew-slider-arrow button:hover .icon-1 {
  transform: translate(-3px, -1px);
}
.skew-slider-arrow button:hover .icon-2 {
  transform: translate(3px, -1px);
}
.skew-slider-content {
  position: absolute;
  top: 50%;
  opacity: 0;
  left: 0;
  padding-left: 320px;
  visibility: hidden;
  transform: translateY(-50%);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .skew-slider-content {
    padding-left: 200px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .skew-slider-content {
    padding-left: 150px;
  }
}
@media (max-width: 767px) {
  .skew-slider-content {
    padding-left: 50px;
  }
}
.skew-slider-content h4 {
  font-size: 140px;
  line-height: 0.9;
  letter-spacing: -0.03em;
  text-transform: uppercase;
  color: var(--tp-ff-clash);
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .skew-slider-content h4 {
    font-size: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .skew-slider-content h4 {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .skew-slider-content h4 {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .skew-slider-content h4 {
    font-size: 60px;
  }
}
.skew-slider-content > span {
  margin-bottom: 15px;
  display: inline-block;
  font-weight: 600;
  font-size: 16px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
}

.slides-numbers {
  position: absolute;
  top: 50%;
  right: 100px;
  transform: translateY(-50%);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .slides-numbers-wrap {
    display: none;
  }
}
.slides-numbers span {
  font-size: 14px;
  font-weight: 600;
  display: block;
  line-height: 1;
  color: var(--tp-common-white);
}
.slides-numbers span.text-1 {
  transform: translateX(-5px);
}
.slides-numbers span.text-2 {
  margin-left: 10px;
  transform: rotate(25deg);
  transform-origin: left bottom;
}
.slides-numbers span.text-3 {
  margin-left: 27px;
}
.slides-numbers::after, .slides-numbers::before {
  content: "";
  width: 2px;
  height: 130px;
  display: inline-block;
  transform: translateX(13px);
  background-color: var(--tp-common-white);
}
.slides-numbers::before {
  margin-bottom: 30px;
}
.slides-numbers::after {
  margin-top: 40px;
}

.coverflow-slider-wrap {
  display: flex;
  align-items: center;
  height: 100vh;
}
.coverflow-slider-active {
  padding: 100px 0;
}
.coverflow-slider-text-active {
  height: 100px;
}
.coverflow-slider-text-wrap {
  position: absolute;
  bottom: 60px;
  left: 50%;
  transform: translateX(-50%);
}
@media (max-width: 767px) {
  .coverflow-slider-text-wrap {
    bottom: 40px;
  }
}
.coverflow-slider-title-sm {
  font-size: 100px;
  line-height: 1;
  font-weight: 600;
  letter-spacing: 2px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-mango);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .coverflow-slider-title-sm {
    font-size: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .coverflow-slider-title-sm {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .coverflow-slider-title-sm {
    font-size: 50px;
  }
}
.coverflow-slider-item {
  height: 500px;
  overflow: hidden;
}
.coverflow-slider-arrow {
  position: absolute;
  left: 0;
  bottom: 65px;
  width: 100%;
  display: flex;
  align-items: center;
  justify-content: space-between;
}
.coverflow-slider-arrow button {
  font-weight: 700;
  font-size: 14px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.coverflow-slider-arrow button svg {
  transition: 0.3s;
  transform: translateY(-1px);
}
.coverflow-slider-arrow button:hover svg {
  transform: translate(4px, -1px);
}
.coverflow-slider-arrow button.coverflow-slider-prev:hover svg {
  transform: translate(-4px, -1px);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .coverflow-slider-arrow .coverflow-slider-prev {
    padding-left: 40px;
  }
}
@media (max-width: 767px) {
  .coverflow-slider-arrow .coverflow-slider-prev {
    padding-left: 20px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .coverflow-slider-arrow .coverflow-slider-next {
    padding-right: 40px;
  }
}
@media (max-width: 767px) {
  .coverflow-slider-arrow .coverflow-slider-next {
    padding-right: 20px;
  }
}
.coverflow-slider-prev svg {
  margin-right: 8px;
}
.coverflow-slider-next svg {
  margin-left: 8px;
}

.tp-slider-elegant-area {
  height: 100vh;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-slider-elegant-area {
    height: auto;
    padding-bottom: 40px;
  }
}
.tp-slider-elegant-wrapper {
  height: 100%;
}
.tp-slider-elegant-title {
  font-size: 16px;
  font-weight: 500;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-slider-elegant-inner-wrap {
  height: 100%;
  width: 100%;
  display: flex;
  grid-area: list;
  box-sizing: border-box;
}
@media (max-width: 767px) {
  .tp-slider-elegant-inner-wrap {
    flex-wrap: wrap;
  }
}
.tp-slider-elegant-item {
  width: 30%;
  height: 100%;
  display: block;
  position: relative !important;
  left: 0 !important;
  top: 0 !important;
  margin: 0px 15px;
  transition: width 0.6s cubic-bezier(0.38, 0.005, 0.215, 1);
}
@media (max-width: 767px) {
  .tp-slider-elegant-item {
    width: 100%;
    margin-bottom: 30px;
  }
}
.tp-slider-elegant-item:hover {
  width: 80%;
}
@media (max-width: 767px) {
  .tp-slider-elegant-item:hover {
    width: 100%;
  }
}
.tp-slider-elegant-thumb {
  height: 100%;
  width: 100%;
  margin-bottom: 30px;
}
.tp-slider-elegant-thumb img {
  width: 100%;
  height: 100%;
  object-fit: cover;
}

.tp-portfolio-slicer-wrap {
  margin-bottom: 220px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slicer-wrap {
    margin-bottom: 130px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slicer-wrap {
    margin-bottom: 100px;
  }
}
.tp-portfolio-slicer-thumb img {
  border-radius: 20px;
  width: 100%;
}
@media (max-width: 767px) {
  .tp-portfolio-slicer-thumb.pro-img-1 {
    margin-bottom: 30px;
  }
}
.tp-portfolio-slicer-thumb.pro-img-1 img {
  transform-origin: bottom left;
  transform: rotate(-2deg);
  position: relative;
  z-index: 2;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-slicer-thumb.pro-img-1 img {
    transform: rotate(0);
  }
}
.tp-portfolio-slicer-thumb.pro-img-2 img {
  transform-origin: bottom right;
  transform: rotate(2deg);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-slicer-thumb.pro-img-2 img {
    transform: rotate(0);
  }
}
.tp-portfolio-slicer-meta {
  font-size: 16px;
  font-weight: 400;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-body);
  margin-bottom: 65px;
  display: inline-block;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-slicer-meta {
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slicer-meta {
    margin-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slicer-meta {
    margin-bottom: 25px;
  }
}
.tp-portfolio-slicer-meta-box .tp-portfolio-slicer-meta {
  position: relative;
}
.tp-portfolio-slicer-meta-box .tp-portfolio-slicer-meta:not(:last-of-type) {
  margin-right: 14px;
  padding-right: 14px;
}
.tp-portfolio-slicer-meta-box .tp-portfolio-slicer-meta:not(:last-of-type)::after {
  position: absolute;
  right: -3px;
  top: 8px;
  content: "";
  height: 4px;
  width: 4px;
  border-radius: 50%;
  display: inline-block;
  background-color: var(--tp-common-white);
}
.tp-portfolio-slicer-title-sm {
  font-size: 100px;
  font-weight: 500;
  line-height: 0.9;
  margin-bottom: 30px;
  letter-spacing: -0.9px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-slicer-title-sm {
    font-size: 70px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-slicer-title-sm {
    font-size: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slicer-title-sm {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slicer-title-sm {
    font-size: 40px;
  }
}
.tp-portfolio-slicer-content {
  margin-top: 50px;
  margin-bottom: 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-slicer-content {
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-slicer-content {
    margin-bottom: 55px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-slicer-content {
    margin-bottom: 60px;
  }
}
.tp-portfolio-slicer-border span {
  width: 240px;
  height: 20px;
  border-radius: 100px;
  display: inline-block;
  background: linear-gradient(90deg, rgba(76, 73, 104, 0.7) 0%, rgba(115, 3, 192, 0.7) 33.33%, rgba(236, 56, 188, 0.7) 66.67%, rgba(253, 239, 249, 0.7) 100%);
}
.tp-portfolio-slicer-border.color-2 span {
  background: linear-gradient(90deg, rgba(26, 42, 108, 0.7) 0%, rgba(178, 31, 31, 0.7) 50%, rgba(253, 187, 45, 0.7) 100%);
}
.tp-portfolio-slicer-border.color-3 span {
  background: linear-gradient(90deg, rgba(255, 75, 31, 0.7) 0%, rgba(31, 221, 255, 0.7) 100%);
}

/* SLIDER */
.tp-perspective-slider {
  width: 100%;
  overflow: hidden;
  padding: 2vw 3vw 0;
  box-sizing: border-box;
  margin-bottom: 80px;
}
.tp-perspective-slider .tp-perspective-inner {
  width: 100%;
  height: 90vh;
  position: relative;
  display: inline-block;
}
.tp-perspective-slider .tp-perspective-inner .tp-perspective-content {
  position: absolute;
  text-align: center;
  width: 100%;
  top: 50%;
  z-index: 10;
  transform: translateY(-50%);
  -webkit-transform: translateY(-50%);
  -moz-transform: translateY(-50%);
  -ms-transform: translateY(-50%);
  -o-transform: translateY(-50%);
}
.tp-perspective-slider .tp-perspective-inner .tp-perspective-image {
  width: 100%;
  height: 100%;
  background-size: cover;
  position: relative;
  display: inline-block;
}
.tp-perspective-slider .tp-perspective-inner .tp-perspective-image:before {
  content: "";
  width: 40px;
  height: 103%;
  position: absolute;
  left: -20px;
  top: -1.5%;
  z-index: 10;
  border-radius: 100%;
  -webkit-border-radius: 100%;
  -moz-border-radius: 100%;
  -ms-border-radius: 100%;
  -o-border-radius: 100%;
  background: #000;
}
@media (max-width: 767px) {
  .tp-perspective-slider .tp-perspective-inner .tp-perspective-image:before {
    content: none;
  }
}
.tp-perspective-slider .tp-perspective-inner .tp-perspective-image:after {
  content: "";
  width: 40px;
  height: 103%;
  position: absolute;
  right: -20px;
  top: -1.5%;
  z-index: 10;
  border-radius: 100%;
  -webkit-border-radius: 100%;
  -moz-border-radius: 100%;
  -ms-border-radius: 100%;
  -o-border-radius: 100%;
  background: #000;
}
@media (max-width: 767px) {
  .tp-perspective-slider .tp-perspective-inner .tp-perspective-image:after {
    content: none;
  }
}
.tp-perspective-slider .tp-perspective-category {
  font-weight: 400;
  font-size: 40px;
  line-height: 1;
  margin-bottom: 0px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
.tp-perspective-slider .tp-perspective-title {
  font-weight: 400;
  font-size: 180px;
  line-height: 1;
  display: inline-block;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-perspective-slider .tp-perspective-title {
    font-size: 130px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-perspective-slider .tp-perspective-title {
    font-size: 110px;
  }
}
@media (max-width: 767px) {
  .tp-perspective-slider .tp-perspective-title {
    font-size: 70px;
  }
}
.tp-perspective-social-wrap {
  position: fixed;
  bottom: 0;
  left: 0;
  right: 0;
}
.tp-perspective-social-info span {
  font-size: 17px;
  font-weight: 400;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
.tp-perspective-social-info span svg {
  display: inline-block;
}
.tp-perspective-scroll a {
  font-size: 17px;
  font-weight: 400;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}

@media (max-width: 767px) {
  .tp-pd-3-hero-area {
    padding-top: 80px;
  }
}
.tp-pd-3-hero-style {
  padding-top: 20px;
}
.tp-pd-3-hero-style .des-portfolio-category {
  top: auto;
  left: 60px;
  bottom: 60px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-3-hero-style .des-portfolio-category {
    left: 20px;
  }
}
.tp-pd-3-hero-style .des-portfolio-category.portfolio-meta {
  left: auto;
  right: 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-3-hero-style .des-portfolio-category.portfolio-meta {
    right: 20px;
  }
}
.tp-pd-3-hero-style .des-portfolio-content {
  bottom: 20px;
}
@media (max-width: 767px) {
  .tp-pd-3-hero-style .des-portfolio-content {
    bottom: 10px;
  }
}
.tp-pd-3-subtitle {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  margin-bottom: 20px;
  display: inline-block;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
}
.tp-pd-3-title {
  font-size: 80px;
  line-height: 0.9;
  color: #f9f4e8;
  margin-bottom: 25px;
  font-family: var(--tp-ff-mango-semibold);
}
@media (max-width: 767px) {
  .tp-pd-3-title {
    font-size: 55px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-overview-area {
    padding-top: 80px;
    padding-bottom: 55px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-overview-left {
    margin-bottom: 40px;
  }
}
.tp-pd-3-overview-info span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  color: rgba(249, 244, 232, 0.5);
}
.tp-pd-3-overview-info h4 {
  font-size: 40px;
  line-height: 1.4;
  color: #f9f4e8;
  margin-bottom: 0;
  letter-spacing: 0.02em;
  font-family: var(--tp-ff-mango);
}
.tp-pd-3-overview-text p {
  font-weight: 500;
  font-size: 20px;
  line-height: 1.5;
  margin-bottom: 55px;
  margin-right: 20px;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-overview-text p br {
    display: none;
  }
}
.tp-pd-3-gallery-img img {
  width: 100%;
  border-radius: 20px;
}
.tp-pd-3-gallery-img.height {
  height: 880px;
  overflow: hidden;
  border-radius: 20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-3-gallery-img.height {
    height: 800px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-3-gallery-img.height {
    height: 650px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-3-gallery-img.height {
    height: 480px;
  }
}
@media (max-width: 767px) {
  .tp-pd-3-gallery-img.height {
    height: 260px;
  }
}
@media (max-width: 767px) {
  .tp-pd-3-gallery-img.height img {
    margin-top: -50px;
  }
}
.tp-pd-3-gallery-img.medium-img {
  height: 720px;
  border-radius: 20px;
  overflow: hidden;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-3-gallery-img.medium-img {
    height: 630px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-3-gallery-img.medium-img {
    height: 550px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-3-gallery-img.medium-img {
    height: 480px;
  }
}
@media (max-width: 767px) {
  .tp-pd-3-gallery-img.medium-img {
    height: 260px;
  }
}
.tp-pd-3-gallery-img.medium-img img {
  margin-top: -80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-3-gallery-img.medium-img img {
    margin-top: -40px;
  }
}
.tp-pd-3-gallery-img.small-img {
  height: 400px;
  overflow: hidden;
  border-radius: 20px;
}
.tp-pd-3-gallery-img.small-img img {
  margin-top: -150px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-3-gallery-img.small-img img {
    margin-top: -100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-3-gallery-img.small-img img {
    margin-top: -20px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-3-portfolio-area {
    padding-top: 160px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-3-portfolio-area {
    padding-top: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-portfolio-area {
    padding-top: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-portfolio-thumb {
    padding-bottom: 40px;
  }
}
.tp-pd-3-portfolio-thumb img {
  border-radius: 20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-portfolio-item {
    margin-bottom: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-portfolio-item-wrap {
    padding-top: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-portfolio-content {
    margin-left: 0;
  }
}
.tp-pd-3-navigation-title {
  font-size: 160px;
  font-weight: 700;
  line-height: 0.69;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-mango-bold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-3-navigation-title {
    font-size: 145px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-3-navigation-title {
    font-size: 125px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-3-navigation-title {
    font-size: 115px;
  }
}
@media (max-width: 767px) {
  .tp-pd-3-navigation-title {
    font-size: 70px;
  }
}
.tp-pd-3-navigation-title-sm {
  font-size: 120px;
  line-height: 0.62;
  position: relative;
  display: inline-block;
  padding: 15px 0;
  transition: 0.4s ease-in-out;
  transform: translateY(120px);
  color: var(--tp-common-white);
  font-family: var(--tp-ff-mango-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-3-navigation-title-sm {
    font-size: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-3-navigation-title-sm {
    font-size: 90px;
  }
}
@media (max-width: 767px) {
  .tp-pd-3-navigation-title-sm {
    font-size: 60px;
  }
}
.tp-pd-3-navigation-title-sm::after {
  position: absolute;
  content: "";
  bottom: 7px;
  left: 0;
  height: 6px;
  width: 0;
  transition: 0.4s;
  background-color: var(--tp-common-white);
}
.tp-pd-3-navigation-title-sm:hover::after {
  width: 100%;
}
.tp-pd-3-navigation-thumb {
  border-radius: 20px;
}
.tp-pd-3-navigation-thumb img {
  transition: 0.5s;
  border-radius: 20px;
}
.tp-pd-3-navigation-thumb-overlay {
  position: relative;
  overflow: hidden;
}
.tp-pd-3-navigation-thumb-overlay::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  opacity: 0;
  border-radius: 20px;
  visibility: hidden;
  pointer-events: none;
  transition: 0.3s ease-in-out;
  background: linear-gradient(180deg, rgba(0, 0, 0, 0.1) 0%, rgba(0, 0, 0, 0.4) 100%);
}
.tp-pd-3-navigation-thumb-wrap {
  border-radius: 20px;
}
.tp-pd-3-navigation-thumb-wrap .des-portfolio-category span {
  transition: 0.4s ease-in-out;
  transform: translateY(30px);
}
.tp-pd-3-navigation-thumb-wrap:hover .tp-pd-3-navigation-title-sm {
  transform: translateY(0);
}
.tp-pd-3-navigation-thumb-wrap:hover .des-portfolio-category span {
  transform: translateY(0);
}
.tp-pd-3-navigation-thumb-wrap:hover.tp-pd-3-navigation-thumb-overlay::after {
  opacity: 1;
  visibility: visible;
}
.tp-pd-3-navigation-thumb-wrap:hover .tp-pd-3-navigation-thumb img {
  transform: scale(1.1) rotate(-2deg);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-3-navigation-top {
    padding-bottom: 50px;
  }
}
.tp-pd-3-navigation-content {
  position: absolute;
  bottom: 70px;
  left: 0;
  right: 0;
  z-index: 3;
  text-align: center;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-3-navigation-content {
    bottom: 40px;
  }
}
@media (max-width: 767px) {
  .tp-pd-3-navigation-content {
    bottom: 20px;
  }
}

.tp-pd-6-hero-ptb {
  height: 100vh;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-ptb {
    height: 100%;
  }
}
.tp-pd-6-hero-wrapper {
  margin: 0 60px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-wrapper {
    margin: 0;
  }
}
.tp-pd-6-hero-title {
  font-size: 70px;
  line-height: 0.9;
  font-weight: 500;
  color: #1D1D1F;
  margin-bottom: 25px;
  letter-spacing: -1.4px;
  text-transform: uppercase;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-pd-6-hero-title {
    font-size: 60px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-6-hero-title {
    font-size: 55px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-title {
    font-size: 45px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-6-hero-heading {
    padding-top: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-6-hero-heading {
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-6-hero-heading {
    padding-top: 40px;
    padding-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .tp-pd-6-hero-heading {
    padding-top: 30px;
    padding-bottom: 30px;
  }
}
.tp-pd-6-hero-heading p {
  color: #1D1D1F;
  margin-bottom: 32px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-heading p br {
    display: none;
  }
}
.tp-pd-6-hero-wrap {
  padding-top: 40px;
  padding-left: 135px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-pd-6-hero-wrap {
    padding-left: 45px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-pd-6-hero-wrap {
    padding-left: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-6-hero-wrap {
    padding-top: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-6-hero-content {
    padding-bottom: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-content {
    padding-bottom: 40px;
  }
}
.tp-pd-6-hero-btn .tp-portfolio-details-btn {
  color: #1D1D1F;
  border: 1px solid rgba(29, 29, 31, 0.1);
}
.tp-pd-6-hero-btn .tp-portfolio-details-btn:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.tp-pd-6-hero-info-item span {
  font-size: 16px;
  font-weight: 400;
  margin-bottom: 2px;
  display: inline-block;
  color: rgba(29, 29, 31, 0.6);
}
.tp-pd-6-hero-info-item h5 {
  color: #1D1D1F;
  font-size: 18px;
  font-weight: 500;
  font-family: var(--tp-ff-clash-medium);
}
.tp-pd-6-hero-thumb img {
  width: 100%;
  border-radius: 50%;
}
.tp-pd-6-hero-thumb-text span {
  font-size: 16px;
  font-weight: 400;
  line-height: 1;
  display: inline-block;
  color: rgba(29, 29, 31, 0.6);
}
.tp-pd-6-hero-thumb-text .text-1 {
  position: absolute;
  top: 0;
  left: 0;
}
.tp-pd-6-hero-thumb-text .text-2 {
  position: absolute;
  bottom: 0;
  right: 0;
}
.tp-pd-6-hero-slider-wrapper {
  margin: 0 45px;
  overflow: hidden;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-slider-wrapper {
    margin: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-slider-wrapper {
    margin-bottom: 30px;
  }
}
.tp-pd-6-hero-slider-active .slick-dots {
  text-align: center;
}
.tp-pd-6-hero-slider-active .slick-dots li {
  font-size: 0;
  height: 12px;
  width: 12px;
  margin: 0 5px;
  border-radius: 50%;
  cursor: pointer;
  display: inline-block;
  border: 2px solid rgba(20, 24, 32, 0.3);
}
.tp-pd-6-hero-slider-active .slick-dots li.slick-active {
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
.tp-pd-6-hero-slider-thumb {
  margin-bottom: 20px;
  border-radius: 20px;
}
.tp-pd-6-hero-slider-thumb img {
  width: 100%;
  border-radius: 20px;
}
.tp-pd-6-hero-progress .progress-circle {
  width: 290px;
  height: 290px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-6-hero-progress .progress-circle {
    height: 250px;
    width: 250px;
  }
}
.tp-pd-6-hero-progress .progress-circle svg {
  width: 100%;
  height: 100%;
}
.tp-pd-6-hero-progress .circle {
  fill: none;
  stroke: #000;
  stroke-width: 0.3;
  stroke-linecap: round;
  transition: stroke-dasharray 0.3s ease;
}
.tp-pd-6-hero-progress .circle-bg {
  fill: none;
  stroke: rgba(29, 29, 31, 0.1);
  stroke-width: 0.2;
}
.tp-pd-6-hero-progress .percentage-text {
  fill: #1D1D1F;
  font-size: 10px;
  transform: translateY(0.7px);
  font-family: var(--tp-ff-clash-medium);
}
.tp-pd-6-hero-fraction {
  padding-bottom: 20px;
}
.tp-pd-6-hero-fraction span {
  width: 40px;
  line-height: 1;
  font-size: 70px;
  color: #1D1D1F;
  display: inline-block;
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-6-hero-fraction span {
    font-size: 50px;
  }
}
@media (max-width: 767px) {
  .tp-pd-6-hero-fraction span {
    font-size: 45px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-fraction span.ml-10 {
    margin-left: 0;
  }
}
.tp-pd-6-hero-fraction #total-slides {
  transform: translateX(-5px);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-6-hero-fraction #total-slides {
    transform: translateX(-12px);
  }
}

/*----------------------------------------*/
/*  9.7 Career Css
/*----------------------------------------*/
.tp-career-title {
  font-size: 120px;
  font-weight: 700;
  line-height: 1;
  color: #111013;
  letter-spacing: -4.8px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-career-title {
    font-size: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-career-title {
    font-size: 90px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-career-title {
    font-size: 70px;
    letter-spacing: -1.8px;
  }
}
@media (max-width: 767px) {
  .tp-career-title {
    font-size: 52px;
    letter-spacing: -1.8px;
  }
}
@media (max-width: 767px) {
  .tp-career-title br {
    display: none;
  }
}
.tp-career-title .shape-1 {
  margin-left: 4px;
  display: inline-block;
}
@media (max-width: 767px) {
  .tp-career-title .shape-1 {
    display: none;
  }
}
.tp-career-title .shape-2 {
  margin-right: 10px;
}
@media (max-width: 767px) {
  .tp-career-title .shape-2 {
    display: none;
  }
}
.tp-career-title.fs-100 {
  font-size: 100px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-career-title.fs-100 {
    font-size: 85px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-career-title.fs-100 {
    font-size: 75px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-career-title.fs-100 {
    font-size: 65px;
  }
}
@media (max-width: 767px) {
  .tp-career-title.fs-100 {
    font-size: 55px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-career-title.fs-100 br {
    display: none;
  }
}
.tp-career-title.fs-70 {
  font-size: 70px;
  letter-spacing: -2.8px;
}
@media (max-width: 767px) {
  .tp-career-title.fs-70 {
    font-size: 60px;
  }
}
.tp-career-title.fs-60 {
  font-size: 60px;
  letter-spacing: -2.4px;
}
@media (max-width: 767px) {
  .tp-career-title.fs-60 {
    font-size: 50px;
  }
}
.tp-career-shape-1 {
  position: absolute;
  top: 37%;
  right: 22%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-career-shape-1 {
    display: none;
  }
}
.tp-career-btn {
  position: absolute;
  bottom: 70px;
  right: 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-career-btn {
    right: 50px;
    bottom: 35px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-career-btn {
    padding-left: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-career-btn {
    position: static;
    padding-left: 30px;
  }
}
.tp-career-btn .st-hero-btn a {
  width: 160px;
  height: 160px;
  border: 1px solid #EEE;
}
.tp-career-btn .st-hero-btn a .st-hero-btn-text {
  font-weight: 500;
  color: #030303;
  line-height: 20px;
  text-transform: uppercase;
}
.tp-career-btn .st-hero-btn a .st-hero-btn-svg {
  padding-bottom: 10px;
}
.tp-career-btn .st-hero-btn a:hover {
  background-color: var(--tp-common-red-3);
}
.tp-career-btn .st-hero-btn a:hover .st-hero-btn-text {
  color: var(--tp-common-white);
}
.tp-career-opening-item {
  border-bottom: 1px solid rgba(17, 16, 19, 0.08);
}
.tp-career-opening-item.ptb {
  padding-top: 40px;
  padding-bottom: 40px;
}
.tp-career-opening-heading {
  padding-bottom: 20px;
}
.tp-career-opening-heading span {
  display: inline-block;
  color: #111013;
  font-size: 18px;
  font-weight: 400;
  letter-spacing: -0.18px;
}
.tp-career-opening-title-name {
  font-size: 30px;
  font-weight: 600;
  color: #111013;
  letter-spacing: -0.3px;
}
.tp-career-opening-role span {
  color: #111013;
  font-size: 18px;
  font-weight: 400;
  display: inline-block;
  letter-spacing: -0.18px;
}
.tp-career-opening-type span {
  font-size: 18px;
  color: #111013;
  font-weight: 400;
  display: inline-block;
  letter-spacing: -0.18px;
}
@media (max-width: 767px) {
  .tp-career-slider-ptb {
    padding-bottom: 100px;
  }
}
@media (max-width: 767px) {
  .tp-career-details-ptb {
    padding-top: 100px;
  }
}
.tp-career-details-wrapper {
  padding-right: 105px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-career-details-wrapper {
    padding-right: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-career-details-wrapper {
    padding-right: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-career-details-top {
    padding-bottom: 50px;
  }
}
.tp-career-details-subtitle {
  position: relative;
  color: #111013;
  font-size: 18px;
  font-weight: 400;
  padding-left: 12px;
  display: inline-block;
  margin-bottom: 10px;
  letter-spacing: -0.18px;
  text-transform: uppercase;
}
.tp-career-details-subtitle::before {
  position: absolute;
  content: "";
  top: 8px;
  left: -5px;
  height: 8px;
  width: 8px;
  border-radius: 4px;
  background: #FF5722;
}
.tp-career-details-title {
  font-size: 80px;
  font-weight: 700;
  line-height: 1;
  color: #111013;
  margin-bottom: 30px;
  letter-spacing: -2.4px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-career-details-title {
    font-size: 60px;
  }
}
.tp-career-details-title-2 {
  color: #111013;
  font-size: 34px;
  font-weight: 700;
  margin-bottom: 15px;
  letter-spacing: -0.68px;
}
@media (max-width: 767px) {
  .tp-career-details-info {
    flex-wrap: wrap;
  }
}
.tp-career-details-info-item:not(:last-of-type) {
  margin-right: 50px;
}
.tp-career-details-info-item span {
  font-size: 14px;
  font-weight: 400;
  color: #6B6C74;
  display: inline-block;
  margin-bottom: 5px;
}
.tp-career-details-info-item h5 {
  font-size: 16px;
  font-weight: 500;
  color: #111013;
  letter-spacing: -0.16px;
}
.tp-career-details-wrap p {
  font-size: 16px;
  color: #111013;
  line-height: 26px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-career-details-wrap p br {
    display: none;
  }
}
.tp-career-details-list ul {
  display: inline-block;
  padding-left: 30px;
}
.tp-career-details-list ul li {
  font-size: 16px;
  line-height: 1.2;
  color: #111013;
  margin-bottom: 20px;
}
.tp-career-details-sidebar-box {
  border-radius: 20px;
  border: 1px solid #F2F2F5;
  background: #F8F8FB;
  padding: 50px 40px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-career-details-sidebar-box {
    padding: 50px 25px;
  }
}
.tp-career-details-sidebar-title {
  margin: 0;
  font-size: 26px;
  font-weight: 500;
  color: #111013;
  letter-spacing: -0.52px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-career-details-sidebar-title {
    font-size: 24px;
  }
}
.tp-career-details-sidebar-heading {
  margin-bottom: 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-career-details-sidebar-heading {
    margin-bottom: 40px;
  }
}
.tp-career-details-sidebar-heading span {
  font-size: 16px;
  font-weight: 400;
  color: #6B6C74;
  margin-bottom: 10px;
  display: inline-block;
}
.tp-career-details-sidebar-thumb img {
  width: 100%;
}
.tp-career-details-sidebar-item {
  margin-bottom: 30px;
}
.tp-career-details-sidebar-item-icon {
  margin-right: 12px;
}
.tp-career-details-sidebar-item-icon span {
  display: grid;
  height: 50px;
  width: 50px;
  place-content: center;
  border-radius: 50%;
  background: var(--tp-common-white);
  border: 1px solid rgba(17, 16, 19, 0.1);
}
.tp-career-details-sidebar-item-content span {
  font-size: 15px;
  font-weight: 400;
  color: #6B6C74;
  display: inline-block;
}
.tp-career-details-sidebar-item-content h5 {
  margin: 0;
  font-size: 18px;
  font-weight: 500;
  color: #111013;
  letter-spacing: -0.36px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-career-details-sidebar-item-content h5 {
    font-size: 16px;
  }
}
.tp-career-details-sidebar-btn a {
  width: 100%;
  font-size: 20px;
  font-weight: 500;
  text-align: center;
  padding: 17px 30px;
  border-radius: 200px;
  display: inline-block;
  letter-spacing: -0.2px;
  background: #FF5722;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-career-details-sidebar-btn a {
    font-size: 17px;
    padding: 14px 27px;
  }
}
.tp-career-details-sidebar-btn a:hover {
  background-color: #111013;
}

.tp-application-subtitle {
  font-weight: 600;
  font-size: 16px;
  text-transform: uppercase;
  color: var(--tp-common-black);
  line-height: 1;
  position: relative;
  display: inline-block;
  font-family: var(--tp-ff-clash-semibold);
  border: 1px solid rgba(1, 1, 3, 0.1);
  border-radius: 20px;
  padding: 10px 22px;
  padding-left: 40px;
}
.tp-application-subtitle::before {
  position: absolute;
  content: "";
  width: 6px;
  height: 6px;
  background: #010103;
  border-radius: 40px;
  top: 50%;
  transform: translateY(-50%);
  left: 20px;
}
.tp-application-title {
  font-weight: 600;
  font-size: 42px;
  line-height: 1;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
}
.tp-application-form-wrap .tp-contact-form-input textarea {
  height: 133px;
}
.tp-application-form-btn .tp-btn-yellow-green {
  background: #FF5722;
  color: var(--tp-common-white);
}
.tp-application-form-btn .tp-btn-yellow-green.btn-60:hover {
  color: var(--tp-common-white);
}
.tp-application-upload span {
  font-weight: 500;
  font-size: 16px;
  letter-spacing: -0.02em;
  color: var(--tp-common-black);
  display: block;
  margin-bottom: 10px;
}
.tp-application-btn a {
  border-radius: 0;
  text-transform: uppercase;
}

/*----------------------------------------*/
/*  9.8 Contact Css
/*----------------------------------------*/
.tp-contact-main-ptb {
  padding-top: 195px;
}
@media (max-width: 767px) {
  .tp-contact-main-ptb {
    padding-top: 150px;
  }
}
.tp-contact-main-ptb .tp-career-shape-1 {
  top: 25%;
  right: 33%;
}
.tp-contact-main-bottom {
  margin-top: -200px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-main-bottom {
    margin-top: 0px;
  }
}
.tp-contact-map-ptb {
  margin-top: -200px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-map-ptb {
    margin-top: 0;
  }
}
@media (max-width: 767px) {
  .tp-contact-map-ptb {
    padding-bottom: 100px;
  }
}
.tp-contact-map-wrapper {
  width: 100%;
  height: 760px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-contact-map-wrapper {
    height: 600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-map-wrapper {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .tp-contact-map-wrapper {
    height: 450px;
  }
}
.tp-contact-map-wrapper iframe {
  width: 100%;
  height: 100%;
}
.tp-contact-map-icon {
  position: relative;
}
.tp-contact-map-icon::after {
  position: absolute;
  content: "";
  top: -5px;
  left: -5px;
  margin: 0 auto;
  height: 120px;
  width: 120px;
  z-index: -1;
  border-radius: 140px;
  backdrop-filter: blur(7px);
  transform: translate(-20%, -20%);
  background: rgba(255, 255, 255, 0.04);
  border: 1px solid var(--tp-common-white);
  animation: animate-pulse 3s linear infinite;
  box-shadow: 0px 20px 50px 0px rgba(17, 16, 19, 0.14);
}
.tp-contact-map-icon span {
  display: grid;
  height: 60px;
  width: 60px;
  z-index: 2;
  text-align: center;
  border-radius: 50%;
  place-content: center;
  background-color: var(--tp-common-red-3);
}
.tp-contact-map-icon-box {
  position: absolute;
  top: 50%;
  left: 50%;
  transform: translate(-50%, -50%);
}
@media (max-width: 767px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-form-ptb {
    padding-bottom: 100px;
  }
}
.tp-contact-form-input label {
  font-size: 16px;
  font-weight: 500;
  color: #111013;
  line-height: 1;
  margin-bottom: 12px;
}
.tp-contact-form-input input, .tp-contact-form-input textarea {
  border-radius: 8px;
  background: #F8F8FB;
  border-color: #F8F8FB;
}
.tp-contact-form-input input:focus, .tp-contact-form-input textarea:focus {
  background: var(--tp-common-white);
  border-color: var(--tp-common-red-3);
}
.tp-contact-form-input textarea {
  resize: none;
  height: 160px;
}
.tp-contact-form-btn button {
  font-size: 18px;
  font-weight: 600;
  line-height: 1;
  border-radius: 30px;
  padding: 20px 54px;
  letter-spacing: -0.18px;
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.tp-contact-form-btn button span {
  position: relative;
  z-index: 1;
  line-height: 1;
  overflow: hidden;
  display: inline-block;
}
.tp-contact-form-btn button span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.tp-contact-form-btn button span span.text-2 {
  position: absolute;
  top: 100%;
  display: block;
  transition: 0.3s;
}
.tp-contact-form-btn button:hover span span.text-1 {
  -webkit-transform: translateY(-150%);
  transform: translateY(-150%);
}
.tp-contact-form-btn button:hover span span.text-2 {
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-contact-category-btn {
  font-size: 18px;
  font-weight: 600;
  line-height: 1;
  cursor: pointer;
  border-radius: 12px;
  padding: 20px 43px;
  margin-bottom: 10px;
  margin-right: 10px;
  display: inline-block;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.tp-contact-category-btn:hover, .tp-contact-category-btn.active {
  background-color: #FFF669;
  color: var(--tp-common-black-7);
}
@media (max-width: 767px) {
  .tp-contact-category-btn {
    font-size: 16px;
    padding: 16px 36px;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-location-ptb {
    padding-bottom: 120px;
  }
}
@media (max-width: 767px) {
  .tp-contact-location-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-contact-location-wrapper {
    padding: 0 80px;
  }
}
.tp-contact-location-wrapper .tp-contact-location-item:first-child {
  padding-top: 0;
}
.tp-contact-location-wrapper .tp-contact-location-item:last-child {
  padding-bottom: 0;
  border-bottom: none;
}
.tp-contact-location-item {
  padding-top: 100px;
  padding-bottom: 100px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.2);
}
@media (max-width: 767px) {
  .tp-contact-location-item {
    padding-top: 50px;
    padding-bottom: 50px;
  }
}
.tp-contact-location-item:hover .tp-contact-location-info-thumb img {
  transform: scale(1.1);
}
.tp-contact-location-info-thumb {
  overflow: hidden;
  margin-right: 85px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-contact-location-info-thumb {
    margin-right: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-location-info-thumb {
    margin-right: 50px;
  }
}
@media (max-width: 767px) {
  .tp-contact-location-info-thumb {
    margin-right: 0px;
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-contact-location-info-thumb {
    margin-right: 20px;
    margin-bottom: 30px;
  }
}
.tp-contact-location-info-thumb img {
  width: 320px;
  transition: 0.9s;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-location-left {
    margin-bottom: 90px;
  }
}
.tp-contact-location-left-title {
  font-size: 40px;
  font-weight: 500;
  line-height: 1;
  letter-spacing: -0.8px;
  color: var(--tp-common-white);
  margin-bottom: 160px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-contact-location-left-title {
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .tp-contact-location-left-title {
    margin-bottom: 10px;
  }
}
@media (max-width: 767px) {
  .tp-contact-location-left-info {
    margin-bottom: 30px;
  }
}
.tp-contact-location-left-info span {
  font-size: 18px;
  font-weight: 500;
  line-height: 26px;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
}
.tp-contact-location-left-info span i {
  padding-right: 5px;
}
.tp-contact-location-loc {
  margin-bottom: 115px;
}
@media (max-width: 767px) {
  .tp-contact-location-loc {
    margin-bottom: 50px;
  }
}
.tp-contact-location-loc-title {
  font-size: 20px;
  font-weight: 600;
  line-height: 1;
  color: var(--tp-common-white);
  display: block;
  margin-bottom: 15px;
}
.tp-contact-location-loc a {
  font-size: 18px;
  font-weight: 500;
  line-height: 26px;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-contact-location-loc a {
    font-size: 16px;
  }
}
.tp-contact-location-loc a:hover {
  color: var(--tp-common-white);
}
.tp-contact-location-map a {
  font-size: 20px;
  font-weight: 500;
  line-height: 1;
  color: var(--tp-common-white);
  position: relative;
}
@media (max-width: 767px) {
  .tp-contact-location-map a {
    margin-bottom: 20px;
    display: inline-block;
  }
}
.tp-contact-location-map a::after {
  position: absolute;
  bottom: 0;
  left: 0;
  height: 1px;
  width: 100%;
  content: "";
  background: rgba(255, 255, 255, 0.3);
}
.tp-contact-location-map a::before {
  position: absolute;
  bottom: 0;
  right: 0;
  height: 1px;
  width: 0;
  content: "";
  background: var(--tp-common-white);
  transition: 0.4s;
}
.tp-contact-location-map a:hover::before {
  right: auto;
  left: 0;
  width: 100%;
}
.tp-contact-location-right {
  padding-left: 20px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-location-right {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-contact-location-right-wrap {
    flex-wrap: wrap;
  }
}
.tp-contact-location-right-info a {
  font-size: 20px;
  font-weight: 500;
  line-height: 1;
  color: var(--tp-common-white);
  margin-bottom: 40px;
  position: relative;
  display: inline-block;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-contact-location-right-info a {
    font-size: 18px;
  }
}
@media (max-width: 767px) {
  .tp-contact-location-right-info a {
    margin-bottom: 15px;
  }
}
.tp-contact-location-right-info a::after {
  position: absolute;
  bottom: 0;
  left: 0;
  height: 1px;
  width: 100%;
  content: "";
  background: rgba(255, 255, 255, 0.3);
}
.tp-contact-location-right-info a::before {
  position: absolute;
  bottom: 0;
  right: 0;
  height: 1px;
  width: 0;
  content: "";
  background: var(--tp-common-white);
  transition: 0.4s;
}
.tp-contact-location-right-info a:hover::before {
  right: auto;
  left: 0;
  width: 100%;
}

.tp-contact-us-text p {
  font-size: 18px;
  font-weight: 400;
  color: rgba(245, 247, 245, 0.5);
}
.tp-contact-us-text a {
  display: inline-block;
}
.tp-contact-us-text a:hover p {
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-contact-us-form-ptb {
    padding-top: 30px;
  }
}
.tp-contact-us-form-wrapper {
  padding: 10px;
  border-radius: 14px;
  background: #1B1B1D;
}
.tp-contact-us-map {
  width: 100%;
  height: 100%;
  border-radius: 8px;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-us-map {
    height: 500px;
    margin-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .tp-contact-us-map {
    height: 450px;
    margin-bottom: 30px;
  }
}
.tp-contact-us-map iframe {
  width: 100%;
  height: 100%;
  border-radius: 8px;
}
@media (max-width: 767px) {
  .tp-contact-us-heading .tp-career-title {
    padding-bottom: 20px;
  }
}
.tp-contact-us-title {
  font-size: 30px;
  font-weight: 600;
  letter-spacing: -0.6px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-us-title {
    margin-bottom: 30px;
  }
}
.tp-contact-us-wrap {
  padding: 110px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-contact-us-wrap {
    padding: 70px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-contact-us-wrap {
    padding: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-us-wrap {
    padding: 30px;
  }
}
@media (max-width: 767px) {
  .tp-contact-us-wrap {
    padding: 20px;
  }
}
.tp-contact-us-wrap .tp-contact-form-input label {
  color: var(--tp-common-white);
}
.tp-contact-us-wrap .tp-contact-form-input input, .tp-contact-us-wrap .tp-contact-form-input textarea {
  background: #302F32;
  border-color: #302F32;
  color: var(--tp-common-white);
}
.tp-contact-us-wrap .tp-contact-form-input input:focus, .tp-contact-us-wrap .tp-contact-form-input textarea:focus {
  background-color: #1B1B1D;
  border-color: var(--tp-common-red-3);
}
.tp-contact-us-thumb {
  overflow: hidden;
  border-radius: 10px;
  margin-bottom: 40px;
}
.tp-contact-us-thumb img {
  width: 100%;
  transition: 0.9s;
  border-radius: 10px;
}
.tp-contact-us-content {
  padding: 15px;
  border-radius: 14px;
  background: #1B1B1D;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-us-content {
    margin-top: 0;
  }
}
.tp-contact-us-content:hover .tp-contact-us-thumb img {
  transform: scale(1.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-us-info-area {
    padding-bottom: 90px;
  }
}
.tp-contact-us-info-title {
  font-size: 26px;
  font-weight: 700;
  color: #F5F7F5;
  letter-spacing: -0.52px;
  margin-bottom: 25px;
  padding-bottom: 20px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-contact-us-info-details {
  margin-bottom: 45px;
}
.tp-contact-us-info-details a {
  font-size: 18px;
  font-weight: 400;
  display: block;
  margin-bottom: 15px;
  color: rgba(255, 255, 255, 0.7);
}
.tp-contact-us-info-details a:hover {
  color: var(--tp-common-white);
}
.tp-contact-us-bottom {
  padding: 0 22px 28px;
}
.tp-contact-us-btn .tp-btn-yellow-green {
  font-size: 16px;
  font-weight: 600;
  padding: 15px 10px;
  border-radius: 30px;
  display: inline-block;
  text-transform: capitalize;
  color: var(--tp-common-white);
  background-color: transparent;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-contact-us-btn .tp-btn-yellow-green.active {
  background-color: var(--tp-common-red-3);
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cn-contactform-support-area {
    margin-bottom: 80px;
  }
}
.cn-contactform-support-bg {
  background-repeat: no-repeat;
  background-size: cover;
  object-fit: cover;
  height: 385px;
}
.cn-contactform-support-text span {
  font-size: 44px;
  font-weight: 500;
  line-height: 52px;
  max-width: 755px;
  margin: 0 auto;
  display: inline-block;
  letter-spacing: -0.88px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .cn-contactform-support-text span {
    font-size: 40px;
  }
}

.tp-contact-me-ptb {
  padding-top: 190px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-contact-me-ptb {
    padding-bottom: 85px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-me-ptb {
    padding-top: 160px;
    padding-bottom: 70px;
  }
}
@media (max-width: 767px) {
  .tp-contact-me-ptb {
    padding-top: 150px;
    padding-bottom: 60px;
  }
}
.tp-contact-me-ptb .tp-career-shape-1 {
  top: 25%;
  right: 28%;
}
.tp-contact-me-ptb .pp-service-shape {
  top: auto;
  bottom: -30%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-me-ptb .pp-service-shape {
    display: none;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-contact-me-heading {
    padding-bottom: 50px;
  }
}
@media (max-width: 767px) {
  .tp-contact-me-heading {
    padding-bottom: 30px;
  }
}
.tp-contact-me-heading .tp-section-subtitle-clash.clash-subtitle-pos.body-ff {
  position: relative;
  padding-left: 20px;
  text-transform: uppercase;
}
.tp-contact-me-heading .tp-section-subtitle-clash.clash-subtitle-pos.body-ff::before {
  position: absolute;
  content: "";
  top: 7px;
  left: 0px;
  width: 8px;
  height: 8px;
  border-radius: 8px;
  background-color: #FFF669;
}
.tp-contact-me-heading .pp-service-details-title img {
  margin-right: 15px;
  border-radius: 50px;
  transform: translateY(7px);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-contact-me-heading .pp-service-details-title img {
    transform: translateY(10px);
  }
}
@media (max-width: 767px) {
  .tp-contact-me-heading .pp-service-details-title img {
    display: none;
  }
}
.tp-contact-me-wrap {
  padding-left: 350px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-contact-me-wrap {
    padding-left: 300px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-me-wrap {
    padding-left: 0;
  }
}
@media (max-width: 767px) {
  .tp-contact-me-wrap p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-contact-me-interest-ptb {
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .tp-contact-me-interest-wrapper {
    padding-bottom: 80px;
  }
}
.tp-contact-me-interest-title {
  font-size: 46px;
  line-height: 1;
  font-weight: 500;
  margin-bottom: 15px;
  letter-spacing: -0.46px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-teko);
}
.tp-contact-me-interest-form-wrap .tp-contact-form-input label {
  color: var(--tp-common-white);
}
.tp-contact-me-interest-form-wrap .tp-contact-form-input input, .tp-contact-me-interest-form-wrap .tp-contact-form-input textarea {
  background: #1D1D1F;
  border-color: #1D1D1F;
  color: var(--tp-common-white);
}
.tp-contact-me-interest-form-wrap .tp-contact-form-input input:focus, .tp-contact-me-interest-form-wrap .tp-contact-form-input textarea:focus {
  border-color: #FFF669;
  background-color: var(--tp-common-black-7);
}
.tp-contact-me-interest-form-wrap .tp-contact-form-btn button {
  background-color: #FFF669;
  color: var(--tp-common-black-7);
}

/*----------------------------------------*/
/*  9.9 Portfolio css
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-heading {
    flex-wrap: wrap;
  }
}
.tp-portfolio-heading .tp-section-subtitle {
  transform: translateY(20px);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-heading .tp-section-subtitle {
    transform: translateY(-15px);
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-heading .tp-blog-title img {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-inner-box {
    padding-bottom: 50px;
  }
}
.tp-portfolio-inner-item:hover .tp-portfolio-inner-thumb img {
  transform: scale(1.1);
}
.tp-portfolio-inner-thumb {
  overflow: hidden;
  margin-bottom: 26px;
  border-radius: 20px;
}
.tp-portfolio-inner-thumb img {
  width: 100%;
  transition: 0.9s;
  border-radius: 20px;
}
.tp-portfolio-inner-content span {
  font-size: 16px;
  font-weight: 500;
  display: inline-block;
  color: rgba(255, 255, 255, 0.6);
}
.tp-portfolio-inner-title {
  font-size: 34px;
  font-weight: 600;
  line-height: 1;
  letter-spacing: -1.36px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-inner-title {
    font-size: 30px;
  }
}
.tp-portfolio-inner-title.fs-30 {
  font-size: 30px;
}
.tp-portfolio-inner-tab-wrap {
  padding-left: 22%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-inner-tab-wrap {
    padding-left: 0;
  }
}
.tp-portfolio-inner-tab-wrap nav .nav-tabs {
  border-bottom: none;
}
.tp-portfolio-inner-tab-wrap nav .nav-tabs .nav-link {
  font-size: 15px;
  font-weight: 600;
  padding: 6px 25px;
  margin-right: 10px;
  margin-bottom: 20px;
  border-radius: 30px;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-portfolio-inner-tab-wrap nav .nav-tabs .nav-link.active, .tp-portfolio-inner-tab-wrap nav .nav-tabs .nav-link:hover {
  color: #020202;
}
.tp-portfolio-inner-tab-wrap nav .nav-tabs .nav-link:hover {
  background-color: var(--tp-common-white);
}
.tp-portfolio-metro-shape {
  position: absolute;
  bottom: 26%;
  left: 40%;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-metro-shape {
    display: none;
  }
}
.tp-portfolio-metro-shape span {
  font-size: 12px;
  font-weight: 600;
  text-transform: uppercase;
  color: rgba(224, 238, 238, 0.8);
}
.tp-portfolio-metro-shape span svg {
  margin-right: 7px;
}
.tp-portfolio-metro-sub .tp-section-subtitle-clash {
  color: #c5fcfc;
}
@media (max-width: 767px) {
  .tp-portfolio-metro-social {
    padding-bottom: 0;
  }
}
.tp-portfolio-metro-social a {
  font-size: 14px;
  font-weight: 600;
  color: #E0EEEE;
  padding: 1px 18px;
  margin-bottom: 10px;
  border-radius: 30px;
  display: inline-block;
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-portfolio-metro-social a:hover {
  color: #020202;
  background-color: #c5fcfc;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-metro-footer {
    padding-top: 70px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-metro-footer {
    padding-top: 0;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-masonry-heading {
    padding-bottom: 40px;
  }
}
.tp-portfolio-masonry-big-text {
  font-size: 305px;
  font-weight: 800;
  line-height: 0.8;
  text-align: center;
  letter-spacing: -11.5px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1801px) and (max-width: 1850px) {
  .tp-portfolio-masonry-big-text {
    font-size: 300px;
    letter-spacing: -10.5px;
  }
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .tp-portfolio-masonry-big-text {
    font-size: 285px;
    letter-spacing: -10.5px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-portfolio-masonry-big-text {
    font-size: 268px;
    letter-spacing: -10.5px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-portfolio-masonry-big-text {
    font-size: 235px;
    letter-spacing: -10.5px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-masonry-big-text {
    font-size: 190px;
    letter-spacing: -8.5px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-masonry-big-text {
    font-size: 140px;
    letter-spacing: -5.5px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-masonry-big-text {
    font-size: 100px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-masonry-big-text {
    font-size: 50px;
    letter-spacing: 0;
  }
}
.tp-portfolio-masonry-wrap {
  padding-bottom: 125px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-masonry-wrap {
    padding-bottom: 60px;
  }
}
.tp-portfolio-masonry-top-left {
  height: 100%;
  display: flex;
  flex-direction: column;
  justify-content: space-between;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-masonry-top-left {
    display: none;
  }
}
.tp-portfolio-masonry-top-left span {
  font-size: 14px;
  font-weight: 600;
  line-height: 1;
  display: inline-block;
  letter-spacing: -0.14px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-portfolio-masonry-top-right p {
  font-size: 26px;
  font-weight: 600;
  line-height: 1.4;
  margin-bottom: 30px;
  letter-spacing: -0.52px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-portfolio-masonry-top-right p {
    font-size: 17px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-masonry-top-right p br {
    display: none;
  }
}
.tp-portfolio-masonry-top-right span {
  position: relative;
  font-size: 14px;
  font-weight: 700;
  padding-left: 18px;
  margin-bottom: 50px;
  display: inline-block;
  letter-spacing: -0.14px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-portfolio-masonry-top-right span::after {
  position: absolute;
  content: "";
  left: 0;
  top: 8px;
  width: 8px;
  height: 8px;
  border-radius: 50%;
  background-color: var(--tp-common-red-3);
}
.tp-portfolio-masonry-social a {
  font-size: 15px;
  font-weight: 600;
  padding: 3px 13px;
  margin-right: 10px;
  border-radius: 30px;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media (max-width: 767px) {
  .tp-portfolio-masonry-social a {
    margin-bottom: 15px;
  }
}
.tp-portfolio-masonry-social a:hover {
  color: #020202;
  background-color: var(--tp-common-white);
}
.tp-portfolio-masonry-grid-heading span {
  position: relative;
  font-size: 14px;
  font-weight: 700;
  padding-left: 18px;
  display: inline-block;
  letter-spacing: -0.14px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-portfolio-masonry-grid-heading span::after {
  position: absolute;
  content: "";
  left: 0;
  top: 8px;
  width: 8px;
  height: 8px;
  border-radius: 50%;
  background-color: var(--tp-common-white);
}
.tp-portfolio-masonry-grid-item:hover .tp-portfolio-masonry-grid-thumb img {
  transform: scale(1.1);
}
.tp-portfolio-masonry-grid-thumb {
  overflow: hidden;
  border-radius: 14px;
}
.tp-portfolio-masonry-grid-thumb img {
  width: 100%;
  transition: 0.9s;
  border-radius: 14px;
}
.tp-portfolio-masonry-grid-content {
  padding: 20px 0 0;
}
.tp-portfolio-masonry-grid-title {
  font-size: 26px;
  font-weight: 600;
  line-height: 1;
  letter-spacing: -1.04px;
  color: var(--tp-common-white);
}
.tp-portfolio-masonry-grid-categories span {
  font-size: 14px;
  font-weight: 600;
  padding: 4px 26px;
  position: relative;
  border-radius: 30px;
  margin-bottom: 10px;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-portfolio-masonry-grid-categories span:not(:last-of-type) {
  margin-right: 8px;
}
.tp-portfolio-masonry-grid-categories span::after {
  content: "";
  left: 10px;
  top: 14px;
  width: 8px;
  height: 8px;
  position: absolute;
  border-radius: 50%;
  background-color: var(--tp-common-red-3);
}
.tp-portfolio-masonry-grid-bottom {
  width: 340px;
  overflow: hidden;
  border-radius: 30px;
  text-align: center;
  margin: 0 auto;
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-details-1-area {
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-details-1-ptb {
    padding-bottom: 80px;
  }
}
.tp-portfolio-details-1-banner {
  height: 760px;
  overflow: hidden;
  border-radius: 14px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-details-1-banner {
    height: 680px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-banner {
    height: 600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-details-1-banner {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-details-1-banner {
    height: 250px;
  }
}
.tp-portfolio-details-1-banner img {
  width: 100%;
  margin-top: -150px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-banner img {
    margin-top: -100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-details-1-banner img {
    margin-top: -20px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-details-1-banner img {
    margin-top: -50px;
  }
}
.tp-portfolio-details-1-banner.hight {
  height: 1040px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-details-1-banner.hight {
    height: 680px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-banner.hight {
    height: 600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-details-1-banner.hight {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-details-1-banner.hight {
    height: 250px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-details-1-heading {
    padding-bottom: 40px;
  }
}
.tp-portfolio-details-1-sub {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 10px;
  display: inline-block;
  letter-spacing: -0.32px;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
}
.tp-portfolio-details-1-title {
  font-size: 80px;
  font-weight: 600;
  line-height: 1;
  margin-bottom: 25px;
  letter-spacing: -1.6px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-details-1-title {
    font-size: 72px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-details-1-title {
    font-size: 60px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-details-1-title {
    font-size: 52px;
  }
}
.tp-portfolio-details-1-content {
  padding-left: 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-details-1-content {
    padding-left: 0;
  }
}
.tp-portfolio-details-1-content p {
  font-size: 18px;
  font-weight: 500;
  line-height: 26px;
  margin-bottom: 45px;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-details-1-content p br {
    display: none;
  }
}
.tp-portfolio-details-1-list ul li {
  font-size: 16px;
  font-weight: 600;
  list-style: none;
  margin-bottom: 16px;
  padding-bottom: 16px;
  letter-spacing: -0.32px;
  text-transform: uppercase;
  color: var(--tp-common-white);
}
.tp-portfolio-details-1-list ul li:not(:last-of-type) {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-portfolio-details-1-list ul li span {
  width: 120px;
  font-weight: 500;
  display: inline-block;
  color: rgba(249, 244, 232, 0.6);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-thumb-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-details-1-thumb-ptb {
    padding-bottom: 80px;
  }
}
.tp-portfolio-details-1-thumb-1, .tp-portfolio-details-1-thumb-2, .tp-portfolio-details-1-thumb-3, .tp-portfolio-details-1-thumb-4, .tp-portfolio-details-1-thumb-5 {
  overflow: hidden;
  border-radius: 14px;
}
.tp-portfolio-details-1-thumb-1 img, .tp-portfolio-details-1-thumb-2 img, .tp-portfolio-details-1-thumb-3 img, .tp-portfolio-details-1-thumb-4 img, .tp-portfolio-details-1-thumb-5 img {
  width: 100%;
  border-radius: 14px;
}
.tp-portfolio-details-1-thumb-1 {
  height: 950px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-details-1-thumb-1 {
    height: 680px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-thumb-1 {
    height: 600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-details-1-thumb-1 {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-details-1-thumb-1 {
    height: 250px;
  }
}
.tp-portfolio-details-1-thumb-2, .tp-portfolio-details-1-thumb-3 {
  height: 800px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-details-1-thumb-2, .tp-portfolio-details-1-thumb-3 {
    height: 580px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-thumb-2, .tp-portfolio-details-1-thumb-3 {
    height: 470px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-details-1-thumb-2, .tp-portfolio-details-1-thumb-3 {
    height: 450px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-details-1-thumb-2, .tp-portfolio-details-1-thumb-3 {
    height: 250px;
  }
}
.tp-portfolio-details-1-thumb-2 img, .tp-portfolio-details-1-thumb-3 img {
  margin-top: -100px;
}
.tp-portfolio-details-1-thumb-4, .tp-portfolio-details-1-thumb-5 {
  height: 680px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-portfolio-details-1-thumb-4, .tp-portfolio-details-1-thumb-5 {
    height: 550px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-thumb-4, .tp-portfolio-details-1-thumb-5 {
    height: 420px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-portfolio-details-1-thumb-4, .tp-portfolio-details-1-thumb-5 {
    height: 450px;
  }
}
@media (max-width: 767px) {
  .tp-portfolio-details-1-thumb-4, .tp-portfolio-details-1-thumb-5 {
    height: 250px;
  }
}
.tp-portfolio-details-1-thumb-4 img, .tp-portfolio-details-1-thumb-5 img {
  margin-top: -100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-thumb-4 img, .tp-portfolio-details-1-thumb-5 img {
    margin-top: -60px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-portfolio-details-1-about-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-portfolio-details-1-about-ptb {
    padding-bottom: 80px;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-1-about-heading {
    padding-bottom: 30px;
  }
}
.tp-pd-1-about-title {
  font-size: 16px;
  font-weight: 500;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-medium);
}
.tp-pd-1-about-title svg {
  margin-left: 5px;
}
.tp-pd-1-about-text {
  font-size: 32px;
  font-weight: 600;
  line-height: 1.2;
  margin-bottom: 65px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-1-about-text {
    font-size: 30px;
    margin-bottom: 40px;
  }
}
.tp-pd-1-about-text.color-cng {
  color: #E0EEEE;
  font-family: var(--tp-ff-inter);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-1-about-text.color-cng br {
    display: none;
  }
}
.tp-pd-1-about-list {
  display: inline-block;
}
.tp-pd-1-about-list ul li {
  position: relative;
  font-size: 18px;
  font-weight: 500;
  list-style: none;
  float: left;
  width: 50%;
  padding-left: 18px;
  margin-bottom: 14px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-pd-1-about-list ul li {
    width: 100%;
    float: none;
  }
}
.tp-pd-1-about-list ul li::before {
  position: absolute;
  content: "";
  width: 6px;
  height: 6px;
  top: 10px;
  left: 0;
  border-radius: 50%;
  background-color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-1-work-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-1-work-ptb {
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-1-work-heading {
    padding-bottom: 30px;
  }
}
.tp-pd-1-work-title {
  font-size: 140px;
  font-weight: 700;
  line-height: 0.8;
  letter-spacing: -4.2px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-1-work-title {
    font-size: 110px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-1-work-title {
    font-size: 100px;
  }
}
@media (max-width: 767px) {
  .tp-pd-1-work-title {
    font-size: 60px;
    letter-spacing: 0;
  }
}
.tp-pd-1-work-title.ff-clash {
  color: #e0eeee;
  text-transform: lowercase;
  font-family: var(--tp-ff-dirtyline);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-1-work-content {
    padding-left: 0;
  }
}
.tp-pd-1-work-content p {
  font-size: 20px;
  font-weight: 400;
  letter-spacing: -0.4px;
  color: rgba(255, 255, 255, 0.6);
}
@media (max-width: 767px) {
  .tp-pd-1-work-content p br {
    display: none;
  }
}
.tp-pd-1-work-item {
  display: flex;
  align-items: center;
  padding-bottom: 10px;
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-pd-1-work-item-title {
  width: 130px;
  font-size: 50px;
  font-weight: 500;
  margin-right: 52px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
@media (max-width: 767px) {
  .tp-pd-1-work-item-title {
    font-size: 45px;
    margin-right: 35px;
  }
}
.tp-pd-1-work-item-title i {
  font-style: normal;
}
.tp-pd-1-work-item-text span {
  font-size: 20px;
  font-weight: 400;
  letter-spacing: -0.4px;
  color: rgba(255, 255, 255, 0.6);
}
.tp-pd-1-np-ptb {
  padding-bottom: 240px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-1-np-ptb {
    padding-bottom: 170px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-1-np-ptb {
    padding-bottom: 150px;
  }
}
@media (max-width: 767px) {
  .tp-pd-1-np-ptb {
    padding-bottom: 120px;
  }
}
.tp-pd-1-np-title {
  font-size: 100px;
  font-weight: 600;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-semibold);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-1-np-title {
    font-size: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-1-np-title {
    font-size: 70px;
  }
}
@media (max-width: 767px) {
  .tp-pd-1-np-title {
    font-size: 45px;
  }
}
.tp-pd-1-np-box {
  padding: 20px 0;
}
.tp-pd-1-np-box.hover-reveal-item .tp-award-reveal-img {
  width: 520px;
  height: 360px;
  object-fit: cover;
  mix-blend-mode: difference;
}
@media (max-width: 767px) {
  .tp-pd-1-np-box.hover-reveal-item .tp-award-reveal-img {
    height: 260px;
    width: 220px;
    background-position: center;
  }
}
.tp-pd-1-np-content span {
  font-size: 30px;
  font-weight: 500;
  display: block;
  margin-bottom: 30px;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.2);
  font-family: var(--tp-ff-clash-semibold);
}
.tp-pd-1-np-content p {
  font-size: 20px;
  font-weight: 500;
  line-height: 30px;
  letter-spacing: -0.4px;
  color: rgba(255, 255, 255, 0.2);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-ptb {
    padding-top: 150px;
  }
}
@media (max-width: 767px) {
  .tp-pd-2-ptb {
    padding-bottom: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-area {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-area {
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-top {
    padding-bottom: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-top {
    padding-bottom: 40px;
  }
}
.tp-pd-2-title {
  font-size: 140px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -7px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-2-title {
    font-size: 110px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-2-title {
    font-size: 100px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-pd-2-title {
    font-size: 60px;
    letter-spacing: 0;
  }
}
.tp-pd-2-categories span {
  font-size: 14px;
  font-weight: 600;
  padding: 4px 24px;
  position: relative;
  border-radius: 30px;
  margin-right: 10px;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-pd-2-categories span::before {
  position: absolute;
  top: 15px;
  left: 12px;
  content: "";
  height: 5px;
  width: 5px;
  border-radius: 50%;
  background-color: var(--tp-common-red-3);
}
@media (max-width: 767px) {
  .tp-pd-2-bottom {
    flex-wrap: wrap;
  }
}
.tp-pd-2-bottom .tp-pd-2-bottom-item:not(:last-of-type) {
  margin-right: 20px;
}
@media (max-width: 767px) {
  .tp-pd-2-bottom-item {
    padding-bottom: 20px;
  }
}
.tp-pd-2-bottom-item span {
  font-size: 16px;
  font-weight: 600;
  line-height: 1;
  margin-bottom: 10px;
  display: inline-block;
  color: rgba(255, 255, 255, 0.7);
}
.tp-pd-2-bottom-item h6 {
  font-size: 20px;
  font-weight: 600;
  color: var(--tp-common-white);
}
.tp-pd-2-banner {
  height: 950px;
  overflow: hidden;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-2-banner {
    height: 680px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-banner {
    height: 600px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-2-banner {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .tp-pd-2-banner {
    height: 250px;
  }
}
.tp-pd-2-banner img {
  width: 100%;
  margin-top: -150px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-banner img {
    margin-top: -100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-2-banner img {
    margin-top: -20px;
  }
}
@media (max-width: 767px) {
  .tp-pd-2-banner img {
    margin-top: -50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-overview-heading {
    padding-bottom: 30px;
  }
}
.tp-pd-2-overview-title {
  font-size: 50px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -1.5px;
  color: var(--tp-common-white);
}
.tp-pd-2-overview-wrap p {
  font-size: 16px;
  font-weight: 500;
  line-height: 26px;
  margin-bottom: 24px;
  color: rgba(255, 255, 255, 0.6);
}
.tp-pd-2-overview-wrap ul {
  padding-top: 20px;
  display: inline-block;
}
.tp-pd-2-overview-wrap ul li {
  font-size: 20px;
  font-weight: 600;
  margin-bottom: 20px;
  padding-bottom: 20px;
  margin-left: 16px;
  color: var(--tp-common-white);
}
.tp-pd-2-overview-wrap ul li:not(:last-of-type) {
  border-bottom: 1px solid rgba(255, 255, 255, 0.08);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-slider-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-slider-ptb {
    padding-bottom: 80px;
  }
}
.tp-pd-2-slider-wrapper {
  margin: 0 -200px;
}
@media (max-width: 767px) {
  .tp-pd-2-slider-wrapper {
    margin: 0;
  }
}
.tp-pd-2-slider-wrapper .swiper-wrapper {
  padding-bottom: 40px;
}
.tp-pd-2-slider-thumb {
  overflow: hidden;
}
.tp-pd-2-slider-thumb:hover img {
  transform: scale(1.2);
}
.tp-pd-2-slider-thumb img {
  transition: 0.9s ease-in-out;
}
.tp-pd-2-dot .swiper-pagination-bullet {
  width: 6px;
  height: 6px;
  opacity: 1;
  transition: 0.3s;
  border-radius: 50%;
  display: inline-block;
  background: rgba(255, 255, 255, 0.3);
}
.tp-pd-2-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {
  width: 24px;
  border-radius: 10px;
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-pd-2-step-heading {
    padding-bottom: 40px;
  }
}
.tp-pd-2-step-title {
  font-size: 40px;
  font-weight: 700;
  line-height: 1.2;
  letter-spacing: -1.2px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-pd-2-step-title {
    font-size: 35px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-step-title br {
    display: none;
  }
}
.tp-pd-2-step-item-title {
  font-size: 22px;
  font-weight: 600;
  margin-bottom: 10px;
  color: var(--tp-common-white);
}
.tp-pd-2-step-item span {
  font-size: 15px;
  font-weight: 500;
  line-height: 24px;
  display: inline-block;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-step-item span br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-thumb-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-thumb-ptb {
    padding-bottom: 80px;
  }
}
.tp-pd-2-thumb-item {
  overflow: hidden;
  height: 600px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-2-thumb-item {
    height: 500px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-thumb-item {
    height: 400px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-2-thumb-item {
    height: 450px;
  }
}
@media (max-width: 767px) {
  .tp-pd-2-thumb-item {
    height: 250px;
  }
}
.tp-pd-2-thumb-item img {
  margin-top: -100px;
  width: 100%;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-2-thumb-item img {
    margin-top: -60px;
  }
}
@media (max-width: 767px) {
  .tp-pd-2-thumb-item img {
    margin-top: -40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-2-np-ptb {
    padding-bottom: 80px;
  }
}
.tp-pd-2-np-content a {
  width: 180px;
  height: 180px;
  font-size: 16px;
  font-weight: 600;
  margin: 0 -14px;
  text-align: center;
  line-height: 180px;
  border-radius: 50%;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.tp-pd-2-np-content a:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.tp-pd-2-np-content a svg {
  margin: 0 4px;
}
.tp-pd-4-ptb {
  padding-top: 220px;
  padding-bottom: 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-ptb {
    padding-top: 150px;
  }
}
.tp-pd-4-title {
  font-size: 100px;
  font-weight: 400;
  line-height: 1;
  color: #E0EEEE;
  letter-spacing: -2px;
  font-family: var(--tp-ff-dirtyline);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-4-title {
    font-size: 80px;
    letter-spacing: 0;
  }
}
@media (max-width: 767px) {
  .tp-pd-4-title {
    font-size: 65px;
    letter-spacing: 0;
  }
}
.tp-pd-4-bottom-btn .tp-portfolio-details-btn {
  color: #C5FCFC;
  border-color: #C5FCFC;
}
.tp-pd-4-bottom-btn .tp-portfolio-details-btn:hover {
  background-color: #C5FCFC;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-banner-ptb {
    padding-top: 80px;
  }
}
.tp-pd-4-banner-thumb {
  margin-bottom: -275px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-4-banner-thumb {
    margin-bottom: -100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-banner-thumb {
    margin-bottom: 0;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-4-heading {
    margin-bottom: 60px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-heading {
    margin-bottom: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-heading-bottom {
    flex-wrap: wrap;
  }
  .tp-pd-4-heading-bottom .tp-pd-2-bottom-item {
    margin-right: 20px;
    padding-bottom: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-4-about-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-about-ptb {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.tp-pd-4-about-sub {
  font-size: 20px;
  font-weight: 400;
  color: #E0EEEE;
  letter-spacing: -0.4px;
  font-family: var(--tp-ff-dirtyline);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-about-sub {
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-color-ptb {
    margin-bottom: 80px;
  }
}
.tp-pd-4-color-shape {
  position: absolute;
  top: 18%;
  left: 20%;
  z-index: -1;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-pd-4-color-shape {
    left: -3%;
    top: 6%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-4-color-shape {
    top: 10%;
    left: -2%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-4-color-shape {
    left: 3%;
    top: 10%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-color-shape {
    display: none;
  }
}
.tp-pd-4-color-picker {
  bottom: 0;
  z-index: 2;
  right: 38.5%;
  position: absolute;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-pd-4-color-picker {
    right: 33%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-color-picker {
    display: none;
  }
}
.tp-pd-4-color-heading {
  z-index: 1;
  height: 100%;
  position: relative;
  padding: 300px 120px;
  background: #85291A;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-pd-4-color-heading {
    padding: 200px 60px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-4-color-heading {
    padding: 130px 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-4-color-heading {
    padding: 170px 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-4-color-heading {
    padding: 100px;
  }
}
@media (max-width: 767px) {
  .tp-pd-4-color-heading {
    padding: 60px 40px;
  }
}
.tp-pd-4-color-heading p {
  font-size: 16px;
  font-weight: 500;
  line-height: 26px;
  letter-spacing: -0.16px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1801px) and (max-width: 1850px), only screen and (min-width: 1701px) and (max-width: 1800px), only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-color-heading p br {
    display: none;
  }
}
.tp-pd-4-color-title {
  font-size: 30px;
  font-weight: 700;
  color: #FFF669;
  line-height: 1;
  margin-bottom: 14px;
  letter-spacing: -0.6px;
}
.tp-pd-4-color-content {
  padding: 78px 0 56px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-4-color-content {
    padding: 60px 22px 50px 0px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-4-color-content {
    padding: 50px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-color-content {
    padding: 40px;
  }
}
.tp-pd-4-color-content span {
  font-size: 30px;
  font-weight: 700;
  line-height: 1;
  margin-bottom: 14px;
  display: inline-block;
  letter-spacing: -0.6px;
  color: var(--tp-common-white);
}
.tp-pd-4-color-content p {
  font-size: 16px;
  font-weight: 500;
  line-height: 26px;
  letter-spacing: -0.16px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-color-content p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-thumb-ptb {
    padding-bottom: 80px;
  }
}
.tp-pd-4-thumb-wrap {
  height: 950px;
  border-radius: 20px;
  background-color: #FFF669;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-4-thumb-wrap {
    height: 750px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-4-thumb-wrap {
    height: 650px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-4-thumb-wrap {
    height: 500px;
  }
}
@media (max-width: 767px) {
  .tp-pd-4-thumb-wrap {
    height: 300px;
  }
}
.tp-pd-4-thumb-item {
  margin-bottom: -100%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-thumb-item {
    margin-bottom: 0;
  }
}
.tp-pd-4-thumb-box {
  height: 800px;
  border-radius: 20px;
  overflow: hidden;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-pd-4-thumb-box {
    height: 520px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-4-thumb-box {
    height: 420px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-4-thumb-box {
    height: 450px;
  }
}
@media (max-width: 767px) {
  .tp-pd-4-thumb-box {
    height: 250px;
  }
}
.tp-pd-4-thumb-box img {
  width: 100%;
  margin-top: -40px;
  object-fit: cover;
  border-radius: 20px;
}
.tp-pd-4-slider-wrapper {
  margin: 0 -220px;
}
@media (max-width: 767px) {
  .tp-pd-4-slider-wrapper {
    margin: 0;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-4-slider-heading {
    margin-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-4-slider-heading {
    margin-bottom: 80px;
  }
}
.tp-pd-4-slider-thumb img {
  border-radius: 20px;
  border: 1px solid rgba(255, 255, 255, 0.0784313725);
}
.tp-pd-5-hero-black-overlay {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  opacity: 1;
  z-index: 1;
  background-color: #000;
  transition: opacity 0.2s ease;
}
.tp-pd-5-hero-white-overlay {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  opacity: 1;
  z-index: 1;
  background-color: #fff;
  transition: opacity 0.4s ease;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-hero-ptb {
    padding-top: 150px;
    padding-bottom: 120px;
  }
}
.tp-pd-5-hero-title {
  font-size: 80px;
  font-weight: 700;
  line-height: 1;
  margin-bottom: 24px;
  letter-spacing: -4px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-pd-5-hero-title {
    font-size: 75px;
  }
}
@media (max-width: 767px) {
  .tp-pd-5-hero-title {
    font-size: 60px;
    letter-spacing: 0;
  }
}
.tp-pd-5-hero-heading p {
  font-size: 16px;
  font-weight: 500;
  line-height: 26px;
  margin-bottom: 50px;
  color: rgba(255, 255, 255, 0.7);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-pd-5-hero-heading p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-hero-top {
    padding-bottom: 40px;
  }
}
.tp-pd-5-hero-info-ptb {
  transition: 0.3s;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-hero-info-ptb {
    padding-bottom: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-hero-info-item {
    padding-bottom: 30px;
  }
}
.tp-pd-5-hero-info-item-title {
  font-size: 30px;
  font-weight: 700;
  line-height: 1;
  letter-spacing: -0.9px;
  color: var(--tp-common-black);
}
.tp-pd-5-hero-info-item-title span {
  font-size: 12px;
  display: inline-block;
  transform: translate(-9px, -13px);
}
.tp-pd-5-hero-info-item-content {
  padding-left: 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-hero-info-item-content {
    padding-left: 0;
  }
}
.tp-pd-5-hero-info-item-content p {
  font-size: 18px;
  font-weight: 500;
  line-height: 26px;
  color: rgba(0, 0, 0, 0.6);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-hero-info-item-content p br {
    display: none;
  }
}
.tp-pd-5-light-ptb {
  padding-top: 120px;
  padding-bottom: 200px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-5-light-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-light-ptb {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-light-heading {
    padding-bottom: 35px;
  }
}
.tp-pd-5-light-title {
  font-size: 50px;
  font-weight: 700;
  color: #0E0F11;
  line-height: 1;
  letter-spacing: -1.5px;
}
.tp-pd-5-light-slider-thumb img {
  width: 100%;
  border-radius: 30px;
  border: 1px solid rgba(0, 0, 0, 0.0705882353);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-pd-5-mockup-ptb {
    padding-top: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-mockup-ptb {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.tp-pd-5-mockup-title {
  font-size: 50px;
  font-weight: 700;
  line-height: 1;
  margin-bottom: 20px;
  letter-spacing: -1.5px;
  color: var(--tp-common-white);
}
.tp-pd-5-mockup-heading {
  padding-bottom: 30px;
}
.tp-pd-5-mockup-heading p {
  font-size: 18px;
  font-weight: 500;
  line-height: 26px;
  color: rgba(255, 255, 255, 0.6);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-mockup-heading p br {
    display: none;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-pd-5-slider-ptb {
    padding-bottom: 80px;
  }
}

.project-details-1-pt {
  padding-top: 107px;
}
.project-details-1-left .project-details-1-thumb:last-child {
  margin-bottom: 0;
}
.project-details-1-subtitle {
  font-size: 18px;
  font-weight: 500;
  line-height: 1;
  margin-bottom: 10px;
  display: inline-block;
  color: var(--tp-common-white);
}
.project-details-1-subtitle i {
  font-style: normal;
}
.project-details-1-subtitle i::after {
  content: "";
  height: 1px;
  width: 40px;
  margin: 0px 10px;
  display: inline-block;
  transform: translateY(-4px);
  background-color: rgba(255, 255, 255, 0.14);
}
.project-details-1-title {
  font-size: 80px;
  font-weight: 600;
  line-height: 1;
  margin-bottom: 24px;
  letter-spacing: -3.2px;
  color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .project-details-1-title {
    font-size: 50px;
  }
}
.project-details-1-title-box {
  margin-bottom: 40px;
}
@media (max-width: 767px) {
  .project-details-1-title-box {
    margin-bottom: 0;
  }
}
.project-details-1-title-box p {
  font-size: 18px;
  font-weight: 400;
  line-height: 28px;
  color: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .project-details-1-title-box p br {
    display: none;
  }
}
.project-details-1-info {
  margin-bottom: 32px;
}
.project-details-1-info span {
  font-size: 20px;
  font-weight: 600;
  line-height: 1;
  color: #FCF6F4;
  margin-bottom: 10px;
  display: inline-block;
}
.project-details-1-info h4 {
  font-size: 17px;
  font-weight: 600;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: -0.4px;
  color: rgba(252, 246, 244, 0.7);
}
@media (max-width: 767px) {
  .project-details-1-info-wrap {
    flex-wrap: wrap;
    margin-bottom: 50px;
  }
  .project-details-1-info-wrap .project-details-1-info {
    margin-right: 20px;
  }
}
.project-details-1-navigation {
  border-top: 1px solid rgba(255, 255, 255, 0.1);
  padding: 33px 60px;
  padding-top: 20px;
}
@media (max-width: 767px) {
  .project-details-1-navigation {
    padding: 33px 0px;
  }
}
.project-details-1-navigation a i {
  height: 44px;
  width: 44px;
  line-height: 44px;
  border-radius: 50%;
  text-align: center;
  margin-top: 10px;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.14);
}
.project-details-1-navigation a span {
  font-size: 17px;
  font-weight: 600;
  line-height: 1;
  color: var(--tp-common-white);
}
.project-details-1-navigation a span svg {
  transform: translateY(5px);
}
.project-details-1-prev {
  line-height: 0;
}
.project-details-1-prev i {
  margin-right: 10px;
  transition: 0.3s;
}
.project-details-1-prev:hover i {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.project-details-1-next {
  line-height: 0;
}
.project-details-1-next i {
  margin-left: 10px;
  transition: 0.3s;
}
.project-details-1-next:hover i {
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}

.project-details-video {
  margin-bottom: 60px;
}
.project-details-video video {
  height: 800px;
  width: 100% !important;
  object-fit: cover;
  overflow: hidden;
}
@media (max-width: 767px) {
  .project-details-video video {
    height: 400px;
  }
}
.project-details-video figcaption {
  align-items: center;
  display: grid;
  grid-gap: 1rem;
  grid-template-columns: 50px auto 115px;
  padding: 0.5rem;
}
.project-details-video button {
  border: 0;
  display: inline;
  color: white;
  order: 1;
  padding: 0.5rem;
  transition: opacity 0.25s ease-out;
  width: 100%;
  font-size: 24px;
}
.project-details-video button:hover {
  cursor: pointer;
  opacity: 0.8;
}
.project-details-video label {
  font-size: 20px;
  text-align: center;
  color: var(--tp-common-white);
  transform: translateY(35px);
}
.project-details-video {
  /* Fallback stuff */
}
.project-details-video progress[value] {
  position: relative;
  appearance: none;
  border: none;
  display: inline;
  height: 3px;
  order: 1;
  width: 100%;
  background: rgba(255, 255, 255, 0.2);
}
.project-details-video {
  /* WebKit styles */
}
.project-details-video progress[value]::-webkit-progress-bar {
  background-color: whiteSmoke;
  box-shadow: 0 2px 3px rgba(0, 0, 0, 0.25) inset;
}
.project-details-video progress[value]::-webkit-progress-value {
  background-color: var(--tp-common-white);
  position: relative;
  transition: width 1s linear;
}
.project-details-video {
  /* Firefox styles */
}
.project-details-video progress[value]::-moz-progress-bar {
  background-color: var(--tp-common-white);
  position: relative;
  transition: width 1s linear;
}

.video-progress-btn-wrap {
  position: absolute;
  left: 40px;
  right: 40px;
  bottom: 80px;
}

.project-details-video-overlay {
  position: relative;
  z-index: 1;
}
.project-details-video-overlay::after {
  position: absolute;
  left: 0;
  width: 100%;
  height: 106%;
  content: "";
  z-index: -1;
  bottom: 0;
  background: linear-gradient(180deg, rgba(18, 18, 18, 0) 1.63%, #0e0f11 26.67%);
}

/*----------------------------------------*/
/*  10.0 Shop Css
/*----------------------------------------*/
.tp-hero-shop-title {
  font-weight: 700;
  font-size: 350px;
  line-height: 0.8;
  color: #4d3d30;
  margin-bottom: 0;
  text-align: center;
  letter-spacing: -0.03em;
  text-transform: uppercase;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 1801px) and (max-width: 1850px) {
  .tp-hero-shop-title {
    font-size: 320px;
  }
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .tp-hero-shop-title {
    font-size: 310px;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-hero-shop-title {
    font-size: 290px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .tp-hero-shop-title {
    font-size: 250px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-shop-title {
    font-size: 215px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-shop-title {
    font-size: 175px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-hero-shop-title {
    font-size: 135px;
  }
}
@media (max-width: 767px) {
  .tp-hero-shop-title {
    font-size: 65px;
    letter-spacing: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-hero-shop-title {
    font-size: 100px;
  }
}
.tp-hero-shop-slider-content {
  padding-bottom: 170px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-hero-shop-slider-content {
    padding-bottom: 70px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-shop-slider-content {
    padding-bottom: 0;
    padding-top: 50px;
  }
}
@media (max-width: 767px) {
  .tp-hero-shop-slider-content {
    padding-top: 30px;
  }
}
.tp-hero-shop-slider-subtitle {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  color: #4d3d30;
  margin-bottom: 12px;
  display: inline-block;
  font-family: var(--tp-ff-onest);
}
.tp-hero-shop-slider-title {
  font-weight: 500;
  font-size: 70px;
  line-height: 1;
  color: #4d3d30;
  margin-bottom: 40px;
  letter-spacing: -0.04em;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-hero-shop-slider-title {
    font-size: 55px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-shop-slider-title {
    font-size: 50px;
  }
}
.tp-hero-shop-slider-nav {
  position: absolute;
  right: 50px;
  width: 120px;
  bottom: 60px;
}
@media (max-width: 767px) {
  .tp-hero-shop-slider-nav {
    right: 15px;
    bottom: 20px;
  }
}
.tp-hero-shop-slider-nav-thumb {
  padding: 5px;
  cursor: pointer;
}
.tp-hero-shop-slider-nav-thumb img {
  transition: 0.3s;
  border-radius: 4px;
  border: 1px solid rgba(77, 61, 48, 0.1);
  background-color: #e8e0d4;
}
.tp-hero-shop-slider-nav-thumb.slick-current img {
  border-color: #4d3d30;
}
.tp-hero-shop-slider-main {
  margin-top: -50px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-shop-slider-main {
    margin-top: 0;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-hero-shop-slider-thumb img {
    width: 80%;
  }
}
.tp-hero-shop-dot {
  position: absolute;
  bottom: 60px !important;
}
.tp-hero-shop-dot .swiper-pagination-bullet {
  width: 16px;
  height: 16px;
  opacity: 1;
  transition: 0.3s;
  border-radius: 50%;
  display: inline-block;
  background: transparent;
  border: 1px solid #F4F0EA;
}
.tp-hero-shop-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.tp-hero-shop-arrow button {
  top: 50%;
  z-index: 99;
  left: 60px;
  position: absolute;
  transform: translateY(-50%);
  color: var(--tp-common-white);
}
.tp-hero-shop-arrow button.tp-hero-shop-next {
  left: auto;
  right: 60px;
}
.tp-hero-shop-2-slider-item {
  position: relative;
  padding-top: 260px;
  padding-bottom: 320px;
  z-index: 99;
}
.tp-hero-shop-2-slider-bg {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  z-index: -1;
  background-position: center;
  background-size: cover;
  background-repeat: no-repeat;
  -webkit-transform: scale(1.15);
  transform: scale(1.15);
  transition: transform 6000ms ease, opacity 1000ms ease-in, -webkit-transform 6000ms ease;
}
.tp-hero-shop-2-slider-bg::before {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  z-index: 1;
  background: rgba(0, 0, 0, 0.2);
}
.tp-hero-shop-2-slider-sub {
  font-size: 14px;
  font-weight: 500;
  margin-bottom: 2px;
  display: inline-block;
  text-transform: uppercase;
  color: rgba(255, 255, 255, 0.6);
  opacity: 0;
  transform: translateY(-70px);
}
.tp-hero-shop-2-slider-title {
  font-size: 80px;
  font-weight: 250;
  line-height: 1.1;
  margin-bottom: 32px;
  letter-spacing: -2.4px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
  opacity: 0;
  transform: translateY(-70px);
}
@media (max-width: 767px) {
  .tp-hero-shop-2-slider-title {
    font-size: 50px;
  }
}
.tp-hero-shop-2-slider-title span {
  font-weight: 700;
}
.tp-hero-shop-2-slider-btn {
  opacity: 0;
  transform: translateY(70px);
}
.tp-hero-shop-2-slider-btn a {
  font-size: 16px;
  font-weight: 600;
  color: #4D3D30;
  padding: 14px 40px;
  display: inline-block;
  background: #F4F0EA;
  border: 1px solid #FFF;
}
.tp-hero-shop-2-slider-btn a:hover {
  color: var(--tp-common-white);
  background-color: transparent;
}
.tp-hero-shop-2-active .swiper-slide-active .tp-hero-shop-2-slider-bg {
  -webkit-transform: scale(1);
  transform: scale(1);
}
.tp-hero-shop-2-active .swiper-slide-active .tp-hero-shop-2-slider-sub, .tp-hero-shop-2-active .swiper-slide-active .tp-hero-shop-2-slider-title {
  opacity: 1;
  transform: translatey(0px);
  transition: all 1500ms ease;
}
.tp-hero-shop-2-active .swiper-slide-active .tp-hero-shop-2-slider-btn {
  opacity: 1;
  transform: translatey(0px);
  transition: all 1500ms ease;
}

.shop-text-slider-active {
  border-bottom: 1px solid rgba(77, 61, 48, 0.12);
}
.shop-text-slider-active .swiper-slide {
  width: 100%;
}
.shop-text-slider-item {
  padding: 15px 0;
}
.shop-text-slider-item span {
  text-align: center;
  font-weight: 500;
  font-size: 18px;
  line-height: 1;
  color: #4d3d30;
  letter-spacing: -0.01em;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 576px) and (max-width: 767px) {
  .shop-text-slider-item span {
    font-size: 16px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .shop-text-slider-item span {
    font-size: 15px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .shop-text-slider-item span {
    font-size: 14px;
  }
}
.shop-text-slider-style .shop-text-slider-active {
  border-bottom: 0;
}
.shop-text-slider-style .shop-text-slider-item {
  padding: 25px 0;
}

.tp-shop-popup-wrap {
  height: 500px;
  width: 800px;
  margin: 0 auto;
  background-color: #fff;
  position: absolute;
  left: 50%;
  top: 50%;
  transform: translate(-50%, -50%);
  transition: all 0.3s;
  display: flex;
  align-items: center;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-shop-popup-wrap {
    width: 700px;
  }
}
@media (max-width: 767px) {
  .tp-shop-popup-wrap {
    width: 360px;
  }
}
.tp-shop-popup-content {
  padding: 40px;
}
.tp-shop-popup-img {
  position: relative;
  height: 100%;
  flex: 0 0 auto;
}
.tp-shop-popup-img img {
  height: 100%;
}
.tp-shop-popup-logo {
  margin-bottom: 60px;
}
.tp-shop-popup-text h4 {
  font-size: 46px;
  font-weight: 600;
  line-height: 1;
  margin-bottom: 13px;
  color: #4D3D30;
  text-transform: uppercase;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-popup-text h4 {
    font-size: 40px;
  }
}
.tp-shop-popup-text p {
  font-size: 28px;
  color: #4D3D30;
  font-weight: 400;
  margin-bottom: 40px;
  text-transform: uppercase;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-popup-text p {
    font-size: 20px;
  }
}
.tp-shop-popup-text span {
  font-weight: 400;
  font-size: 16px;
  line-height: 1;
  color: #4D3D30;
  letter-spacing: 0.04em;
  text-transform: uppercase;
  font-family: var(--tp-ff-onest);
  margin-bottom: 55px;
  display: inline-block;
}
.tp-shop-popup-inputbox input {
  height: 50px;
  font-weight: 400;
  font-size: 17px;
  letter-spacing: 0.04em;
  color: var(--tp-common-black);
  border: 1px solid rgba(25, 25, 26, 0.1);
  font-family: var(--tp-ff-onest);
  margin-bottom: 10px;
}
.tp-shop-popup-inputbox input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-weight: 400;
  font-size: 17px;
  letter-spacing: 0.04em;
  color: var(--tp-common-black);
}
.tp-shop-popup-inputbox input::-moz-placeholder { /* Firefox 19+ */
  font-weight: 400;
  font-size: 17px;
  letter-spacing: 0.04em;
  color: var(--tp-common-black);
}
.tp-shop-popup-inputbox input:-moz-placeholder { /* Firefox 4-18 */
  font-weight: 400;
  font-size: 17px;
  letter-spacing: 0.04em;
  color: var(--tp-common-black);
}
.tp-shop-popup-inputbox input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-weight: 400;
  font-size: 17px;
  letter-spacing: 0.04em;
  color: var(--tp-common-black);
}
.tp-shop-popup-inputbox input::placeholder { /* MODERN BROWSER */
  font-weight: 400;
  font-size: 17px;
  letter-spacing: 0.04em;
  color: var(--tp-common-black);
}
.tp-shop-popup-inputbox .tp-btn-black-square {
  font-size: 18px;
  font-weight: 400;
  padding: 14px 34px;
  border-radius: 8px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
  background-color: #4D3D30;
  border: 2px solid transparent;
}
.tp-shop-popup-inputbox .tp-btn-black-square:hover {
  background-color: transparent;
  border-color: var(--tp-common-black);
  color: var(--tp-common-black);
}

.subscribe-popup {
  position: fixed;
  left: 0;
  top: 0;
  right: 0;
  width: 100%;
  height: 100%;
  z-index: 1099;
  background-color: rgba(0, 0, 0, 0.5);
  visibility: hidden;
  opacity: 0;
  transition: all 0.3s;
  margin: 0 auto;
  text-align: center;
}

.subscribe-popup.show {
  visibility: visible;
  opacity: 1;
}

.subscribe-popup .close i {
  position: absolute;
  right: 20px;
  top: 20px;
  font-size: 20px;
  cursor: pointer;
  font-weight: 400;
  color: var(--tp-common-black);
  transition: 0.3s;
}
.subscribe-popup .close:hover i {
  transform: rotate(180deg);
}

@keyframes zoomInOut {
  0%, 100% {
    transform: scale(1);
  }
  50% {
    transform: scale(1.1);
  }
}
.tp-shop-section-subtitle {
  font-weight: 500;
  font-size: 14px;
  line-height: 1;
  display: inline-block;
  text-transform: uppercase;
  color: rgba(77, 61, 48, 0.6);
  font-family: var(--tp-ff-onest);
}
.tp-shop-section-title {
  font-weight: 600;
  font-size: 46px;
  line-height: 1;
  color: #4d3d30;
  letter-spacing: -0.02em;
  font-family: var(--tp-ff-onest);
}
.tp-shop-section-title.fs-100 {
  font-weight: 700;
  font-size: 100px;
  color: #322820;
  text-transform: uppercase;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-shop-section-title.fs-100 {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .tp-shop-section-title.fs-100 {
    font-size: 50px;
  }
}
.tp-shop-category-bdr {
  border-bottom: 1px solid rgba(77, 61, 48, 0.12);
}
.tp-shop-category-item {
  width: 100%;
  padding: 40px 10px;
  display: inline-block;
  border: 1px solid rgba(77, 61, 48, 0.12);
}
.tp-shop-category-item:hover {
  background-color: #E8E0D4;
}
.tp-shop-category-item:hover span {
  color: #4D3D30;
}
.tp-shop-category-item i {
  margin-bottom: 22px;
  display: inline-block;
  min-height: 58px;
  color: #4d3d30;
  transition: 0.3s;
}
.tp-shop-category-item span {
  font-weight: 500;
  font-size: 16px;
  line-height: 1;
  display: block;
  text-align: center;
  transition: 0.3s ease-in-out;
  color: rgba(77, 61, 48, 0.6);
  font-family: var(--tp-ff-onest);
}
.tp-shop-category-2-content {
  position: absolute;
  bottom: 0;
  left: 0;
  z-index: 2;
  margin: 40px;
  overflow: hidden;
}
.tp-shop-category-2-content-wrap {
  transition: 0.4s;
  transform: translateY(28px);
}
.tp-shop-category-2-content span {
  color: #FFF;
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
  font-family: var(--tp-ff-onest);
}
.tp-shop-category-2-title {
  font-size: 46px;
  font-weight: 700;
  line-height: 1;
  margin-bottom: 0;
  letter-spacing: -0.46px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
}
.tp-shop-category-2-title.sm {
  font-size: 26px;
}
.tp-shop-category-2-item::after {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  width: 100%;
  height: 100%;
  transition: 0.3s;
  pointer-events: none;
  display: inline-block;
  background: rgba(9, 6, 1, 0.2);
}
.tp-shop-category-2-item:hover .tp-shop-category-2-thumb img {
  transform: scale(1.1) rotate(-2deg);
}
.tp-shop-category-2-item:hover .tp-shop-category-2-content-wrap {
  transform: translateY(0);
}
.tp-shop-category-2-item:hover::after {
  opacity: 1;
  visibility: visible;
}
.tp-shop-category-2-thumb img {
  transition: 0.9s;
}
.tp-shop-banner-wrap {
  position: relative;
  height: 900px;
  overflow: hidden;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-shop-banner-wrap {
    height: 800px;
  }
}
@media (max-width: 767px) {
  .tp-shop-banner-wrap {
    height: 700px;
  }
}
.tp-shop-banner-img {
  position: absolute;
  top: -50px;
  left: 0;
  width: 100%;
  height: 100%;
}
.tp-shop-banner-sm-img {
  position: absolute;
  height: 300px;
  top: 50%;
  left: 0;
  right: 0;
  overflow: hidden;
  text-align: center;
  transform: translateY(-50%);
}
.tp-shop-banner-sm-img img {
  margin-top: -50px;
}
.tp-shop-instagram-item {
  position: relative;
  overflow: hidden;
  z-index: 1;
}
.tp-shop-instagram-item:hover::before {
  opacity: 1;
  visibility: visible;
}
.tp-shop-instagram-item:hover .tp-shop-instagram-icon {
  opacity: 1;
  margin-top: 0;
}
.tp-shop-instagram-item:hover img {
  transform: scale(1.1);
}
.tp-shop-instagram-item::before {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  opacity: 0;
  visibility: hidden;
  pointer-events: none;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  z-index: 2;
  background-color: rgba(0, 0, 0, 0.4);
}
.tp-shop-instagram-item img {
  width: 100%;
  transition: all 0.5s cubic-bezier(0.5, 1, 0.89, 1);
}
.tp-shop-instagram-icon {
  position: absolute;
  left: 50%;
  top: 50%;
  opacity: 0;
  cursor: pointer;
  margin-top: 15px;
  z-index: 3;
  pointer-events: none;
  -webkit-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
  transition: all 0.5s cubic-bezier(0.5, 1, 0.89, 1);
  -webkit-transition: all 0.5s cubic-bezier(0.5, 1, 0.89, 1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-newsletter-ptb {
    padding-top: 60px;
  }
}
.tp-shop-newsletter-content {
  margin-top: -185px;
}
.tp-shop-newsletter-content span {
  font-weight: 400;
  font-size: 30px;
  line-height: 0.87;
  color: #322820;
  margin-bottom: 55px;
  display: inline-block;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-newsletter-content span {
    margin-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .tp-shop-newsletter-content span {
    font-size: 25px;
  }
}
.tp-shop-newsletter-content p {
  font-weight: 400;
  font-size: 14px;
  line-height: 1.5;
  color: #322820;
  max-width: 400px;
  margin: 0 auto;
  margin-bottom: 110px;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-newsletter-content p {
    margin-bottom: 30px;
  }
}
.tp-shop-newsletter-thumb .img-left {
  margin-left: -15px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-newsletter-thumb .img-left {
    margin-left: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-shop-newsletter-thumb .img-left {
    margin-bottom: 0;
  }
}
.tp-shop-newsletter-thumb .img-1 {
  margin-left: 100px;
  margin-bottom: 150px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-newsletter-thumb .img-1 {
    display: none;
  }
}
.tp-shop-newsletter-btn {
  margin-bottom: 200px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-newsletter-btn {
    margin-bottom: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-about-ptb {
    padding-top: 0;
  }
}
.tp-shop-about-thumb .img-1 {
  margin-left: 100px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-about-thumb .img-1 {
    text-align: end;
  }
}
.tp-shop-about-thumb .img-2 {
  margin-top: -60px;
}
.tp-shop-about-thumb .img-3 {
  margin-left: 25px;
}
@media (max-width: 767px) {
  .tp-shop-about-thumb .img-3 {
    display: none;
  }
}
.tp-shop-about-thumb .img-4 {
  margin-right: 30px;
}
.tp-shop-about-thumb .img-5 {
  margin-top: -75px;
  margin-bottom: 60px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-shop-about-thumb .img-5 {
    text-align: start;
  }
}
@media (max-width: 767px) {
  .tp-shop-about-thumb .img-5 {
    display: none;
  }
}
.tp-shop-about-thumb .img-6 {
  margin-right: 160px;
}
.tp-shop-about-content p {
  font-weight: 500;
  font-size: 40px;
  line-height: 1.25;
  color: #322820;
  margin-bottom: 50px;
  letter-spacing: -0.02em;
  text-transform: uppercase;
  font-family: var(--tp-ff-onest);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-shop-about-content p {
    font-size: 37px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-shop-about-content p {
    font-size: 35px;
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-shop-about-content p {
    font-size: 30px;
    margin-bottom: 30px;
  }
}
@media (max-width: 767px) {
  .tp-shop-about-content p {
    font-size: 26px;
    margin-bottom: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-about-content p br {
    display: none;
  }
}
.tp-shop-about-circle-text {
  margin-bottom: 35px;
  animation: rotate2 5s linear infinite;
}
.tp-shop-about-btn {
  margin-bottom: 140px;
}
@media (max-width: 767px) {
  .tp-shop-about-btn {
    margin-bottom: 50px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-shop-feature-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-feature-ptb {
    padding-bottom: 80px;
  }
}
.tp-shop-feature-item span {
  display: inline-block;
  margin-bottom: 20px;
}
.tp-shop-feature-item h4 {
  font-weight: 600;
  font-size: 20px;
  line-height: 1;
  color: #4d3d30;
  margin-bottom: 15px;
  letter-spacing: -0.01em;
  font-family: var(--tp-ff-onest);
}
.tp-shop-feature-item p {
  font-weight: 400;
  font-size: 15px;
  line-height: 1.6;
  color: #4d3d30;
  margin-bottom: 0;
  font-family: var(--tp-ff-onest);
}
.tp-shop-feature-wrap {
  padding-bottom: 60px;
  border-bottom: 1px solid rgba(77, 61, 48, 0.1);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-shop-product-banner {
    margin-bottom: 15px;
  }
}
.tp-shop-popup-logo img {
  width: 120px;
  height: 100%;
}

.slick-active .tp-hero-shop-slider-subtitle,
.slick-active .tp-hero-shop-slider-title,
.slick-active .tp-hero-shop-btn a {
  -webkit-animation-name: fadeInUp;
  animation-name: fadeInUp;
  -webkit-animation-fill-mode: both;
  animation-fill-mode: both;
}

.slick-active .tp-hero-shop-slider-subtitle {
  -webkit-animation-delay: 0.3s;
  animation-delay: 0.3s;
  -webkit-animation-duration: 0.3s;
  animation-duration: 0.3s;
}

.slick-active .tp-hero-shop-slider-title {
  -webkit-animation-delay: 0.5s;
  animation-delay: 0.5s;
  -webkit-animation-duration: 0.5s;
  animation-duration: 0.5s;
}

.slick-active .tp-hero-shop-btn a {
  -webkit-animation-delay: 0.7s;
  animation-delay: 0.7s;
  -webkit-animation-duration: 0.7s;
  animation-duration: 0.7s;
}

/*----------------------------------------*/
/*  10.1 Shop Details Css
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-product-details-wrapper {
    margin-top: 50px;
  }
}
.tp-product-details-sort-desc p {
  font-size: 15px;
  line-height: 1.7;
  color: rgba(77, 61, 48, 0.6);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-product-details-sort-desc p br {
    display: none;
  }
}
.tp-product-details-sort-desc p span {
  font-weight: 500;
  color: #4D3D30;
}
.tp-product-details-nav-main-thumb {
  position: relative;
  background-color: #ded5c9;
}
@media (max-width: 767px) {
  .tp-product-details-nav-main-thumb {
    margin-bottom: 20px;
  }
}
.tp-product-details-thumb-wrapper .tab-content {
  margin-right: 24px;
}
@media (max-width: 767px) {
  .tp-product-details-thumb-wrapper .tab-content {
    margin-right: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-product-details-thumb-wrapper .tab-content {
    margin-right: 15px;
  }
}
.tp-product-details-thumb-wrapper .nav-tab .nav-links {
  padding: 0;
  width: 100px;
  height: 120px;
  border-radius: 0;
  position: relative;
  transition: 0.3s;
  background-color: #ded5c9;
  border: 1px solid transparent;
}
.tp-product-details-thumb-wrapper .nav-tab .nav-links.active {
  border: 1px solid #453528;
}
@media (max-width: 767px) {
  .tp-product-details-thumb-wrapper .nav-tab .nav-links {
    margin-right: 10px;
    margin-bottom: 10px;
  }
}
.tp-product-details-thumb-wrapper .nav-tab .nav-links:not(:last-child) {
  margin-bottom: 10px;
}
.tp-product-details-thumb-wrapper .nav-tab .nav-links:hover {
  border-color: #453528;
}
.tp-product-details-thumb-wrapper .nav-tab .nav-links img {
  width: 100%;
  height: 100%;
  object-fit: cover;
}
.tp-product-details-thumb-wrapper nav {
  padding-top: 140px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-product-details-thumb-wrapper nav {
    padding-top: 0;
  }
}
.tp-product-details-category span {
  font-size: 15px;
  line-height: 1;
  color: rgba(77, 61, 48, 0.6);
}
.tp-product-details-title {
  font-size: 32px;
  font-weight: 600;
  line-height: 1;
  color: #4D3D30;
  margin-bottom: 15px;
}
.tp-product-details-stock {
  margin-right: 12px;
}
.tp-product-details-stock span {
  font-size: 15px;
  line-height: 1;
  padding: 4px 12px;
  display: inline-block;
  color: #4D3D30;
  background-color: rgba(77, 61, 48, 0.06);
}
.tp-product-details-rating {
  margin-right: 11px;
  display: -webkit-box;
  display: -moz-box;
  display: -ms-flexbox;
  display: -webkit-flex;
  display: flex;
  align-items: center;
}
.tp-product-details-rating span {
  font-size: 12px;
  color: #FFB21D;
}
.tp-product-details-rating span:not(:last-child) {
  margin-right: 3px;
}
.tp-product-details-price {
  font-size: 24px;
  font-weight: 600;
  color: #4D3D30;
  letter-spacing: -0.02em;
}
.tp-product-details-price.new-price {
  color: #4D3D30;
}
.tp-product-details-price.old-price {
  font-weight: 400;
  font-size: 16px;
  color: rgba(77, 61, 48, 0.6);
  text-decoration-line: line-through;
}
.tp-product-details-variation {
  margin-bottom: 30px;
}
.tp-product-details-variation-title {
  font-size: 15px;
  font-weight: 400;
  color: #010F1C;
  margin-bottom: 4px;
}
.tp-product-details-variation-item:not(:last-child) {
  margin-bottom: 15px;
}
.tp-product-details-variation-list button {
  display: inline-block;
  width: 26px;
  height: 26px;
  border-radius: 50%;
  position: relative;
  -webkit-transition: box-shadow 0.2s linear;
  -moz-transition: box-shadow 0.2s linear;
  -ms-transition: box-shadow 0.2s linear;
  -o-transition: box-shadow 0.2s linear;
  transition: box-shadow 0.2s linear;
}
.tp-product-details-variation-list button span[data-bg-color] {
  position: absolute;
  top: 50%;
  left: 50%;
  width: 100%;
  height: 100%;
  background-color: var(--tp-common-white);
  border-radius: 50%;
  -webkit-transition: all 0.2s linear;
  -moz-transition: all 0.2s linear;
  -ms-transition: all 0.2s linear;
  -o-transition: all 0.2s linear;
  transition: all 0.2s linear;
  -webkit-transform: translate(-50%, -50%);
  -moz-transform: translate(-50%, -50%);
  -ms-transform: translate(-50%, -50%);
  -o-transform: translate(-50%, -50%);
  transform: translate(-50%, -50%);
}
.tp-product-details-variation-list button .tp-color-variation-tootltip {
  position: absolute;
  bottom: 100%;
  left: 50%;
  -webkit-transform: translateX(-50%) translateY(2px);
  -moz-transform: translateX(-50%) translateY(2px);
  -ms-transform: translateX(-50%) translateY(2px);
  -o-transform: translateX(-50%) translateY(2px);
  transform: translateX(-50%) translateY(2px);
  width: max-content;
  background-color: var(--tp-common-black);
  color: var(--tp-common-white);
  text-align: center;
  font-size: 12px;
  font-weight: 500;
  line-height: 1;
  padding: 4px 6px;
  border-radius: 4px;
  visibility: hidden;
  opacity: 0;
  -webkit-transition: opacity 0.3s ease, visibility 0.3s ease, transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24), -webkit-transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24);
  -moz-transition: opacity 0.3s ease, visibility 0.3s ease, transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24), -webkit-transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24);
  -ms-transition: opacity 0.3s ease, visibility 0.3s ease, transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24), -webkit-transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24);
  -o-transition: opacity 0.3s ease, visibility 0.3s ease, transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24), -webkit-transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24);
  transition: opacity 0.3s ease, visibility 0.3s ease, transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24), -webkit-transform 0.3s cubic-bezier(0.71, 1.7, 0.77, 1.24);
}
.tp-product-details-variation-list button .tp-color-variation-tootltip::before {
  position: absolute;
  content: "";
  bottom: -6px;
  left: 50%;
  -webkit-transform: translateX(-50%);
  -moz-transform: translateX(-50%);
  -ms-transform: translateX(-50%);
  -o-transform: translateX(-50%);
  transform: translateX(-50%);
  width: 0;
  height: 0;
  border-top: 6px solid var(--tp-common-black);
  border-left: 6px solid transparent;
  border-right: 6px solid transparent;
}
.tp-product-details-variation-list button.tp-size-variation-btn {
  width: 40px;
  height: 40px;
  border-radius: 0;
  -webkit-transition: all 0.2s linear;
  -moz-transition: all 0.2s linear;
  -ms-transition: all 0.2s linear;
  -o-transition: all 0.2s linear;
  transition: all 0.2s linear;
  border: 1px solid rgba(0, 0, 0, 0.2);
}
.tp-product-details-variation-list button.tp-size-variation-btn:hover, .tp-product-details-variation-list button.tp-size-variation-btn.active {
  box-shadow: none;
  border-color: var(--tp-common-black);
  box-shadow: none;
  color: var(--tp-common-black);
}
.tp-product-details-variation-list button:hover, .tp-product-details-variation-list button.active {
  box-shadow: 0px 1px 2px rgba(1, 15, 28, 0.2);
}
.tp-product-details-variation-list button:hover span[data-bg-color], .tp-product-details-variation-list button.active span[data-bg-color] {
  -webkit-transform: translate(-50%, -50%) scale(0.7);
  -moz-transform: translate(-50%, -50%) scale(0.7);
  -ms-transform: translate(-50%, -50%) scale(0.7);
  -o-transform: translate(-50%, -50%) scale(0.7);
  transform: translate(-50%, -50%) scale(0.7);
}
.tp-product-details-variation-list button:hover .tp-color-variation-tootltip {
  visibility: visible;
  opacity: 1;
  -webkit-transform: translateX(-50%) translateY(-6px);
  -moz-transform: translateX(-50%) translateY(-6px);
  -ms-transform: translateX(-50%) translateY(-6px);
  -o-transform: translateX(-50%) translateY(-6px);
  transform: translateX(-50%) translateY(-6px);
}
.tp-product-details-action-title {
  font-size: 16px;
  font-weight: 400;
  color: #010F1C;
  margin-bottom: 13px;
}
.tp-product-details-quantity .tp-product-quantity {
  width: 122px;
  border-radius: 0;
  position: relative;
}
.tp-product-details-quantity .tp-cart-plus, .tp-product-details-quantity .tp-cart-minus {
  width: 24px;
  height: 24px;
  line-height: 21px;
  text-align: center;
  border-radius: 50%;
  left: 14px;
  top: 11px;
  cursor: pointer;
  position: absolute;
  display: inline-block;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
}
.tp-product-details-quantity .tp-cart-plus:hover, .tp-product-details-quantity .tp-cart-minus:hover {
  background-color: var(--tp-common-white);
  color: var(--tp-theme-primary);
}
.tp-product-details-quantity .tp-cart-plus {
  left: auto;
  right: 14px;
}
.tp-product-details-quantity .tp-cart-input[type=text] {
  height: 46px;
  line-height: 46px;
  border: 0;
  padding: 0 45px;
  border-radius: 0;
  font-size: 16px;
  background-color: #EAE5DF;
  color: var(--tp-common-black);
  text-align: center;
}
.tp-product-details-add-to-cart-btn {
  font-size: 15px;
  font-weight: 500;
  text-align: center;
  padding: 9px 30px;
  color: var(--tp-common-black);
  border: 1px solid rgba(1, 15, 28, 0.08);
}
.tp-product-details-add-to-cart-btn:hover {
  background-color: #e8e0d4;
  border-color: #e8e0d4;
  color: #4D3D30;
}
.tp-product-details-buy-now-btn {
  display: inline-block;
  font-size: 15px;
  font-weight: 600;
  padding: 10px 30px;
  color: #F4F0EA;
  background-color: #4D3D30;
  border: 1px solid transparent;
}
.tp-product-details-buy-now-btn:hover {
  color: #4D3D30;
  border-color: #4D3D30;
  background-color: transparent;
}
.tp-product-details-action-wrapper {
  margin-bottom: 17px;
}
.tp-product-details-action-sm {
  padding-bottom: 9px;
  margin-bottom: 25px;
  border-bottom: 1px solid rgba(77, 61, 48, 0.1);
}
.tp-product-details-action-sm-btn {
  font-size: 16px;
  margin-bottom: 10px;
  color: rgba(77, 61, 48, 0.6);
}
.tp-product-details-action-sm-btn:not(:last-child) {
  margin-right: 10px;
}
.tp-product-details-action-sm-btn i, .tp-product-details-action-sm-btn svg {
  margin-right: 2px;
  color: #4D3D30;
}
.tp-product-details-action-sm-btn:hover {
  color: var(--tp-theme-primary);
}
.tp-product-details-query {
  margin-bottom: 22px;
}
.tp-product-details-query-item:not(:last-child) {
  margin-bottom: 3px;
}
.tp-product-details-query-item > span {
  font-size: 15px;
  line-height: 1.4;
  margin-right: 6px;
  color: #4D3D30;
}
.tp-product-details-query-item p {
  font-size: 15px;
  margin-bottom: 0;
  line-height: 1.4;
  color: rgba(77, 61, 48, 0.6);
}
.tp-product-details-social {
  margin-bottom: 22px;
}
.tp-product-details-social span {
  font-size: 15px;
  margin-right: 2px;
  color: var(--tp-common-black);
}
.tp-product-details-social a {
  display: inline-block;
  width: 38px;
  height: 38px;
  line-height: 36px;
  text-align: center;
  color: #4d3d30;
  border-radius: 50%;
  border: 1px solid #E6E7E8;
  background: var(--tp-common-white);
}
.tp-product-details-social a:hover {
  border-color: #4D3D30;
  background-color: #4D3D30;
  color: var(--tp-common-white);
}
.tp-product-details-msg ul li {
  font-size: 15px;
  list-style: none;
  padding-left: 25px;
  position: relative;
  color: rgba(77, 61, 48, 0.6);
}
.tp-product-details-msg ul li::after {
  position: absolute;
  content: url("../img/product/product-details-main/product-icon.svg");
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  color: var(--tp-common-white);
  -webkit-transition: all 0.2s linear;
  -moz-transition: all 0.2s linear;
  -ms-transition: all 0.2s linear;
  -o-transition: all 0.2s linear;
  transition: all 0.2s linear;
}
.tp-product-details-payment {
  padding: 18px 30px;
  background: rgba(77, 61, 48, 0.06);
}
.tp-product-details-payment p {
  font-size: 16px;
  line-height: 1;
  margin-bottom: 0;
  margin-right: 46px;
  flex: 0 0 auto;
  color: #4D3D30;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-product-details-payment p {
    margin-right: 25px;
  }
}
@media (max-width: 767px) {
  .tp-product-details-payment p {
    margin-right: 0;
    margin-bottom: 15px;
  }
  .tp-product-details-payment p br {
    display: none;
  }
}
.tp-product-details-desc-title {
  font-size: 34px;
  font-weight: 700;
  margin-bottom: 20px;
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-product-details-desc-title {
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .tp-product-details-desc-title {
    font-size: 26px;
  }
}
.tp-product-details-desc-title-2 {
  font-size: 34px;
  font-weight: 400;
  margin-bottom: 14px;
}
@media only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-product-details-desc-title-2 {
    font-size: 25px;
  }
}
.tp-product-details-desc-content {
  margin-bottom: 25px;
  padding-right: 45px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .tp-product-details-desc-content {
    padding-right: 0;
  }
}
@media (max-width: 767px) {
  .tp-product-details-desc-content {
    padding-left: 0;
  }
}
.tp-product-details-desc-content span {
  font-size: 20px;
  color: var(--tp-common-black);
}
.tp-product-details-desc-content p {
  font-size: 17px;
  line-height: 1.8;
  color: #55585B;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-product-details-desc-content-2 {
    padding-right: 0;
    padding-left: 0;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-product-details-desc-content-2.pt-75 {
    padding-top: 25px;
  }
}
.tp-product-details-desc-content-2 p {
  font-size: 16px;
  line-height: 1.6;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-product-details-desc-thumb img {
    max-width: 100%;
  }
}
.tp-product-details-desc-list {
  padding-top: 13px;
}
.tp-product-details-desc-list ul li {
  list-style: none;
  font-size: 16px;
  color: var(--tp-common-black);
  position: relative;
  padding-left: 17px;
}
.tp-product-details-desc-list ul li:not(:last-child) {
  margin-bottom: 3px;
}
.tp-product-details-desc-list ul li::after {
  position: absolute;
  content: "";
  left: 0;
  top: 11px;
  width: 4px;
  height: 4px;
  background-color: #A8ACB0;
  border-radius: 50%;
}
.tp-product-details-desc-fact-thumb img {
  margin-bottom: 16px;
}
.tp-product-details-desc-fact-content span {
  display: inline-block;
  font-size: 50px;
  line-height: 1.2;
  color: var(--tp-common-black);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .tp-product-details-desc-fact-content span {
    font-size: 35px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-product-details-desc-fact-content span {
    font-size: 30px;
  }
}
@media (max-width: 767px) {
  .tp-product-details-desc-fact-content span {
    font-size: 25px;
  }
}
.tp-product-details-desc-fact-content p {
  font-size: 22px;
}
@media (max-width: 767px) {
  .tp-product-details-desc-fact-content p {
    font-size: 20px;
  }
}
.tp-product-details-additional-info {
  padding-top: 60px;
}
@media (max-width: 767px) {
  .tp-product-details-additional-info {
    overflow-x: scroll;
  }
}
.tp-product-details-additional-info-title {
  font-size: 24px;
  font-weight: 400;
  margin-bottom: 16px;
  display: none;
}
.tp-product-details-additional-info.tp-table-style-2 {
  padding-top: 50px;
}
.tp-product-details-additional-info.tp-table-style-2 .tp-product-details-additional-info-title {
  display: block;
}
.tp-product-details-additional-info.tp-table-style-2 table {
  border: 0;
  border-collapse: separate;
  border-spacing: 0 7px;
}
.tp-product-details-additional-info.tp-table-style-2 table tr {
  border: 0;
}
.tp-product-details-additional-info.tp-table-style-2 table tr:not(:last-child) {
  border: 0;
  margin-bottom: 6px;
}
.tp-product-details-additional-info.tp-table-style-2 table tr td {
  padding: 7px 24px;
  border: 1px solid #E6E7E8;
}
.tp-product-details-additional-info.tp-table-style-2 table tr td:first-child {
  padding-left: 24px;
  border-right: 0;
}
.tp-product-details-additional-info.tp-table-style-2 table tr td:last-child {
  padding-left: 34px;
}
.tp-product-details-additional-info table {
  width: 100%;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.tp-product-details-additional-info table tr:not(:last-child) {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.tp-product-details-additional-info table tr td {
  padding: 12px 34px;
}
.tp-product-details-additional-info table tr td:first-child {
  width: 306px;
  font-size: 16px;
  background-color: #EAE5DF;
  color: var(--tp-common-black);
}
.tp-product-details-additional-info table tr td:last-child {
  font-size: 16px;
  color: var(--tp-text-body);
}
.tp-product-details-review-number {
  border: 1px solid #E0E2E3;
  padding: 35px 43px 33px 40px;
  background-color: #eae5df;
}
@media (max-width: 767px) {
  .tp-product-details-review-number {
    padding: 35px 25px 33px 25px;
  }
}
.tp-product-details-review-number-title {
  font-size: 20px;
  font-weight: 500;
  margin-bottom: 14px;
}
.tp-product-details-review-summery {
  margin-bottom: 12px;
}
.tp-product-details-review-summery-value span {
  font-size: 40px;
  font-weight: 500;
  color: var(--tp-common-black);
  margin-right: 8px;
}
.tp-product-details-review-summery-rating {
  margin-right: 3px;
}
.tp-product-details-review-summery-rating span {
  color: #FFB21D;
}
.tp-product-details-review-summery-rating p {
  margin-left: 4px;
  font-size: 14px;
  margin-bottom: 0;
}
.tp-product-details-review-rating-item > span {
  color: #A0A2A4;
  font-size: 15px;
  margin-right: 10px;
}
.tp-product-details-review-rating-bar {
  width: 260px;
  height: 10px;
  position: relative;
  margin-right: 12px;
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-product-details-review-rating-bar {
    width: 130px;
  }
}
.tp-product-details-review-rating-bar-inner {
  height: 100%;
  background-color: #FFB21D;
  display: inline-block;
  position: absolute;
  top: 0;
  left: 0;
}
.tp-product-details-review-rating-percent span {
  font-size: 14px;
}
.tp-product-details-review-title {
  font-size: 24px;
  font-weight: 500;
  margin-bottom: 22px;
}
@media (max-width: 767px) {
  .tp-product-details-review-list {
    padding-right: 0;
  }
}
.tp-product-details-review-avater:not(:last-child) {
  margin-bottom: 32px;
}
.tp-product-details-review-avater-thumb {
  flex: 0 0 auto;
}
.tp-product-details-review-avater-thumb img {
  width: 60px;
  height: 60px;
  border-radius: 50%;
  margin-right: 20px;
}
.tp-product-details-review-avater-rating {
  line-height: 1;
  margin-bottom: 3px;
}
.tp-product-details-review-avater-rating span {
  font-size: 10px;
  margin-right: 2px;
  color: #FFB21D;
}
.tp-product-details-review-avater-title {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 9px;
  display: inline-block;
}
.tp-product-details-review-avater-meta {
  font-size: 14px;
  position: relative;
  padding-left: 11px;
  margin-left: 3px;
}
.tp-product-details-review-avater-meta::after {
  position: absolute;
  content: "";
  left: 0;
  top: 8px;
  width: 4px;
  height: 4px;
  border-radius: 50%;
  background-color: #A8ACB0;
}
.tp-product-details-review-avater-comment p {
  font-size: 14px;
  margin-bottom: 0;
  line-height: 1.4;
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-product-details-review-form {
    margin-top: 50px;
  }
}
.tp-product-details-review-form > p {
  font-size: 16px;
  margin-bottom: 8px;
}
.tp-product-details-review-form-title {
  font-size: 24px;
  font-weight: 500;
  margin-bottom: 4px;
}
.tp-product-details-review-form-rating {
  margin-bottom: 28px;
}
.tp-product-details-review-form-rating p {
  margin-bottom: 0;
  font-size: 14px;
  margin-right: 8px;
}
.tp-product-details-review-form-rating-icon span {
  font-size: 12px;
  color: #FFB21D;
}
.tp-product-details-review-input-wrapper {
  margin-bottom: 11px;
}
.tp-product-details-review-input-box {
  position: relative;
  margin-bottom: 29px;
}
.tp-product-details-review-input label {
  font-size: 16px;
  font-weight: 500;
  color: #111013;
  line-height: 1;
  margin-bottom: 12px;
}
.tp-product-details-review-input input, .tp-product-details-review-input textarea {
  border-radius: 0px;
  border-color: #E0E2E3;
  background: #eae5df;
}
.tp-product-details-review-input input:focus, .tp-product-details-review-input textarea:focus {
  background: transparent;
  border-color: #4d3d30;
}
.tp-product-details-review-input textarea {
  resize: none;
  height: 160px;
}
.tp-product-details-review-input-title label {
  font-size: 16px;
  font-weight: 500;
  color: #111013;
  line-height: 1;
  margin-bottom: 12px;
}
.tp-product-details-review-remeber input {
  display: none;
}
.tp-product-details-review-remeber input:checked ~ label::after {
  background-color: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.tp-product-details-review-remeber input:checked ~ label::before {
  visibility: visible;
  opacity: 1;
}
.tp-product-details-review-remeber label {
  font-size: 15px;
  color: #55585B;
  position: relative;
  padding-left: 26px;
  z-index: 1;
}
.tp-product-details-review-remeber label::after {
  position: absolute;
  content: "";
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  border: 1px solid #C3C7C9;
  z-index: -1;
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -ms-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out;
}
.tp-product-details-review-remeber label::before {
  position: absolute;
  content: url("../img/product/product-details-main/check.svg");
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  visibility: hidden;
  opacity: 0;
  color: var(--tp-common-white);
  -webkit-transition: all 0.2s ease-in-out;
  -moz-transition: all 0.2s ease-in-out;
  -ms-transition: all 0.2s ease-in-out;
  -o-transition: all 0.2s ease-in-out;
  transition: all 0.2s ease-in-out;
}
.tp-product-details-review-remeber label a:hover {
  color: var(--tp-theme-primary);
}
.tp-product-details-review-remeber label:hover {
  cursor: pointer;
}
.tp-product-details-review-btn {
  font-size: 16px;
  font-weight: 500;
  padding: 9px 45px;
  color: var(--tp-common-white);
  border: 1px solid rgba(1, 15, 28, 0.08);
  background-color: #4d3d30;
}
.tp-product-details-review-btn:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.tp-product-details-bottom {
  border-bottom: 1px solid #E0E2E3;
}
.tp-product-details-tab-nav .nav-tabs {
  padding-bottom: 12px;
  border-bottom: 1px solid #E0E2E3;
}
@media (max-width: 767px) {
  .tp-product-details-tab-nav .nav-tabs {
    padding-bottom: 0;
  }
}
.tp-product-details-tab-nav .nav-tabs .nav-link {
  font-size: 20px;
  color: rgba(0, 0, 0, 0.6);
  border: none;
  padding: 0;
  padding-left: 9px;
  padding-right: 7px;
  position: relative;
  background-color: transparent;
}
.tp-product-details-tab-nav .nav-tabs .nav-link:not(:first-child) {
  margin-left: 40px;
}
.tp-product-details-tab-nav .nav-tabs .nav-link.active, .tp-product-details-tab-nav .nav-tabs .nav-link:hover {
  color: var(--tp-common-black);
}
.tp-product-details-tab-nav .nav-tabs .nav-link.active::after, .tp-product-details-tab-nav .nav-tabs .nav-link:hover::after {
  width: 100%;
  left: 0;
  right: auto;
}
@media (max-width: 767px) {
  .tp-product-details-tab-nav .nav-tabs .nav-link::after {
    position: absolute;
    content: "";
    left: auto;
    right: 0;
    bottom: -1px;
    width: 0%;
    height: 2px;
    background-color: var(--tp-common-black);
    -webkit-transition: all 0.3s ease-in-out;
    -moz-transition: all 0.3s ease-in-out;
    -ms-transition: all 0.3s ease-in-out;
    -o-transition: all 0.3s ease-in-out;
    transition: all 0.3s ease-in-out;
  }
}
@media (max-width: 767px) {
  .tp-product-details-tab-nav .nav-tabs span#productTabMarker {
    display: none !important;
  }
}
.tp-product-details-tab-line {
  bottom: 0;
  height: 1px;
  position: absolute;
  background-color: var(--tp-common-black);
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  display: block;
}
.tp-product-details-views {
  margin-bottom: 10px;
}
.tp-product-details-views > span {
  color: var(--tp-common-black);
  font-size: 16px;
  margin-right: 8px;
}
.tp-product-details-views p {
  font-size: 16px;
  margin-bottom: 0;
}
.tp-product-details-views p span {
  color: var(--tp-common-black);
  font-weight: 500;
}
.tp-product-details-stock-bar p {
  font-size: 15px;
  margin-bottom: 5px;
}
.tp-product-details-stock-bar p span {
  font-weight: 500;
  color: var(--tp-common-black);
}
.tp-product-details-stock-bar-line {
  height: 4px;
  position: relative;
}
.tp-product-details-stock-bar-line-inner {
  position: absolute;
  top: 0;
  left: 0;
  background-color: var(--tp-theme-primary);
  height: 100%;
  display: inline-block;
}
.tp-product-details-wishlist-btn {
  width: 46px;
  height: 46px;
  line-height: 46px;
  text-align: center;
  display: inline-block;
  background-color: var(--tp-common-white);
  box-shadow: 0px 1px 3px rgba(1, 15, 28, 0.1);
}
.tp-product-details-wishlist-btn:hover {
  background-color: var(--tp-common-black);
  color: var(--tp-common-white);
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-product-ptb {
    padding-top: 150px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-product-cats {
    padding-bottom: 20px;
  }
}
.tp-product-cats a {
  font-size: 15px;
  font-weight: 500;
  padding: 6px 20px;
  margin-right: 5px;
  margin-bottom: 20px;
  border-radius: 30px;
  color: #4D3D30;
  display: inline-block;
  text-transform: uppercase;
  border: 1px solid #4D3D30;
  font-family: var(--tp-ff-onest);
}
.tp-product-cats a.active, .tp-product-cats a:hover {
  background: #4D3D30;
  border-color: #4D3D30;
  color: var(--tp-common-white);
}
.tp-product-filter-select .custom-select {
  width: 225px;
  border-radius: 60px;
  border: 1px solid #4D3D30;
}
.tp-product-filter-select .custom-select .selected {
  font-size: 15px;
  font-weight: 500;
  color: #4d3d30;
  padding: 8px 20px 7px;
  text-transform: uppercase;
  background-color: transparent;
  font-family: var(--tp-ff-onest);
}
.tp-product-related-title {
  color: #4D3D30;
  font-size: 24px;
  font-weight: 600;
  letter-spacing: -0.24px;
  text-transform: uppercase;
  font-family: var(--tp-ff-onest);
}
.tp-product-item:hover .tp-product-item-thumb img {
  transform: scale(1.2) rotate(-2deg);
}
.tp-product-item:hover .tp-product-item-btn {
  opacity: 1;
  visibility: visible;
}
.tp-product-item:hover .tp-product-item-btn .tp-action-btn {
  transform: translateY(0);
  transition-delay: 0ms;
  transition-duration: 0.5s;
}
.tp-product-item:hover .tp-product-quick-view-wrapper {
  opacity: 1;
  visibility: visible;
}
.tp-product-item:hover .tp-product-quick-view-wrapper .tp-quick-view-btn {
  transform: translateX(0);
  transition-delay: 0ms;
  transition-duration: 0.5s;
}
.tp-product-item-thumb {
  position: relative;
  overflow: hidden;
  margin-bottom: 16px;
}
.tp-product-item-thumb img {
  width: 100%;
  transition: 0.9s;
}
.tp-product-item-btn {
  position: absolute;
  left: 0;
  right: 0;
  bottom: 10px;
  opacity: 0;
  margin: 0 10px;
  visibility: hidden;
  transition: 0.4s;
  overflow: hidden;
}
.tp-product-item-title {
  padding-right: 30px;
}
.tp-product-item-title, .tp-product-item-price {
  font-size: 20px;
  font-weight: 400;
  color: #4D3D30;
  letter-spacing: -0.4px;
  font-family: var(--tp-ff-onest);
}
@media (max-width: 767px) {
  .tp-product-item-title, .tp-product-item-price {
    font-size: 18px;
  }
}
.tp-product-quick-view-wrapper {
  position: absolute;
  right: 20px;
  top: 20px;
  left: auto;
  bottom: auto;
  z-index: 1;
  overflow: hidden;
  transition: 0.4s;
  visibility: hidden;
  opacity: 0;
}
.tp-product-instagram-heading p {
  font-size: 16px;
  color: #4D3D30;
  letter-spacing: -0.32px;
}
.tp-product-testimonial-title {
  color: #4D3D30;
  font-size: 24px;
  font-weight: 600;
  letter-spacing: -0.24px;
  font-family: var(--tp-ff-onest);
}
.tp-product-testimonial-item {
  border-radius: 0;
  box-shadow: none;
  padding: 40px 35px;
  background: #EDE6DD;
}
.tp-product-testimonial-item .app-testimonial-item-star {
  margin-bottom: 25px;
}
.tp-product-testimonial-item .app-testimonial-item-content {
  margin-bottom: 70px;
}
.tp-product-testimonial-item .app-testimonial-item-content p {
  font-size: 20px;
  color: #4D3D30;
  letter-spacing: -0.2px;
  font-family: var(--tp-ff-onest);
}
.tp-product-testimonial-user {
  padding: 4px;
  padding-right: 25px;
  display: inline-flex;
  border-radius: 30px;
  align-items: center;
  border: 1px solid rgba(77, 61, 48, 0.1);
}
.tp-product-testimonial-user-thumb {
  margin-right: 10px;
}
.tp-product-testimonial-user-thumb img {
  width: 34px;
  border-radius: 50%;
}
.tp-product-testimonial-user-name {
  font-size: 15px;
  font-weight: 500;
  margin: 0;
  color: #4D3D30;
  letter-spacing: -0.15px;
}

.modal .modal-dialog {
  width: 100%;
  max-width: 100%;
  margin-top: 0;
  margin-bottom: 0;
}

.modal-wrapper {
  position: relative;
  z-index: 999999999;
}

.modal {
  overflow-y: scroll;
  overflow-x: hidden;
  --bs-modal-border-width: 0;
  --bs-modal-border-radius: 0;
}

.btn-close {
  position: absolute;
  top: 35px;
  right: 35px;
  z-index: 99999999999;
  padding: 0;
  margin: 0;
  height: 50px;
  width: 50px;
  border-radius: 50%;
  color: var(--tp-common-black);
  background-color: #fff !important;
  border: 1px solid rgba(25, 25, 26, 0.2);
  opacity: 1;
  transition: 0.3s;
}
.btn-close:hover {
  border-color: var(--tp-common-black) !important;
  transform: rotate(180deg);
}

.btn-close:focus {
  outline: 0;
  box-shadow: none;
  opacity: 1;
}

.modal-body {
  padding: 0;
}

.modal-header {
  padding: 0;
  border-bottom: 0;
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}

.tp-product-modal .modal-dialog {
  width: 1200px;
}
.tp-product-modal .modal-content {
  padding: 50px;
}
@media (max-width: 767px) {
  .tp-product-modal .modal-content {
    padding: 30px;
  }
}
.tp-product-modal .tp-product-modal-close-btn {
  position: absolute;
  right: 30px;
  top: 30px;
  font-size: 20px;
}
@media (max-width: 767px) {
  .tp-product-modal .tp-product-modal-close-btn {
    top: 6px;
    right: 20px;
  }
}
.tp-product-modal .tp-product-details-thumb-wrapper nav {
  padding-top: 0;
}
.tp-product-modal .tp-product-details-wrapper {
  flex: 0 0 auto;
  margin-left: 40px;
}
@media (max-width: 767px) {
  .tp-product-modal .tp-product-details-wrapper {
    margin-left: 0;
  }
}
.tp-product-modal .tp-product-details-wrapper .tp-product-details-action-sm {
  padding-bottom: 0;
  margin-bottom: 0;
  border: none;
}

/*----------------------------------------*/
/*  10.2 Login Css
/*----------------------------------------*/
.tp-login-wrapper {
  padding: 50px 74px 70px;
  background-color: #fff;
}
@media (max-width: 767px) {
  .tp-login-wrapper {
    padding-left: 20px;
    padding-right: 20px;
  }
}
.tp-login-title {
  font-weight: 500;
  font-size: 30px;
  margin-bottom: 4px;
  font-family: var(--tp-ff-onest);
}
.tp-login-top p {
  font-size: 16px;
  font-weight: 400;
  color: #49535B;
}
.tp-login-top p a {
  position: relative;
  display: inline-block;
  color: var(--tp-common-black);
}
.tp-login-top p a::after {
  position: absolute;
  content: "";
  left: auto;
  right: 0;
  bottom: 4px;
  width: 0%;
  height: 1px;
  background-color: var(--tp-common-black);
  transition: 0.3s;
}
.tp-login-top p a:hover::after {
  left: 0;
  right: auto;
  width: 100%;
}
.tp-login-option-item {
  margin-bottom: 10px;
}
.tp-login-option-item:not(:last-child) {
  margin-right: 10px;
}
.tp-login-option-item.has-google a {
  width: 220px;
}
.tp-login-option-item.has-google a img {
  margin-right: 7px;
}
.tp-login-option-item a {
  font-size: 16px;
  color: #041226;
  width: 98px;
  height: 56px;
  line-height: 54px;
  text-align: center;
  border-radius: 8px;
  display: inline-block;
  backdrop-filter: blur(10px);
  border: 1px solid rgba(198, 198, 198, 0.4);
}
.tp-login-option-item a img {
  -webkit-transform: translateY(-2px);
  -moz-transform: translateY(-2px);
  -ms-transform: translateY(-2px);
  -o-transform: translateY(-2px);
  transform: translateY(-2px);
}
.tp-login-option-item a img.apple {
  -webkit-transform: translateY(-3px);
  -moz-transform: translateY(-3px);
  -ms-transform: translateY(-3px);
  -o-transform: translateY(-3px);
  transform: translateY(-3px);
}
.tp-login-option-item a:hover {
  border-color: rgba(77, 61, 48, 0.2);
}
.tp-login-mail {
  position: relative;
  z-index: 1;
}
.tp-login-mail p {
  font-size: 15px;
  color: #55585B;
  margin-bottom: 0;
  padding: 0 20px;
  position: relative;
  display: inline-block;
  background-color: #fff;
}
.tp-login-mail p a {
  color: var(--tp-common-black);
}
.tp-login-mail p a:hover {
  color: var(--tp-common-black);
}
.tp-login-mail::after {
  position: absolute;
  content: "";
  left: 0;
  right: 0;
  bottom: 12px;
  width: 100%;
  height: 1px;
  z-index: -1;
  transition: 0.3s;
  background-color: #C6C6C6;
}
.tp-login-input-wrapper {
  margin-bottom: 20px;
}
.tp-login-input-box {
  position: relative;
}
.tp-login-input-box:not(:last-child) {
  margin-bottom: 15px;
}
.tp-login-input input {
  font-size: 14px;
  border: 1px solid transparent;
  color: var(--tp-common-black);
  background-color: #F4F0EA;
}
.tp-login-input input::placeholder {
  color: rgba(0, 0, 0, 0.4);
}
.tp-login-input input:focus {
  background-color: transparent;
}
.tp-login-input-title label {
  font-size: 16px;
  padding: 0 5px;
  line-height: 1;
  font-weight: 500;
  margin-bottom: 10px;
  color: var(--tp-common-black);
}
.tp-login-input-eye {
  position: absolute;
  right: 26px;
  top: 50%;
  -webkit-transform: translateY(-50%);
  -moz-transform: translateY(-50%);
  -ms-transform: translateY(-50%);
  -o-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-login-input-eye .open-eye {
  display: none;
}
.tp-login-input-eye span {
  transition: 0.3s;
}
.tp-login-input-eye:hover {
  cursor: pointer;
}
.tp-login-input-eye:hover span {
  color: var(--tp-common-black);
}
.tp-login-remeber input {
  display: none;
}
.tp-login-remeber input:checked ~ label::after {
  border-color: #4d3d30;
  background-color: #4d3d30;
}
.tp-login-remeber input:checked ~ label::before {
  visibility: visible;
  opacity: 1;
}
.tp-login-remeber label {
  font-size: 15px;
  position: relative;
  padding-left: 26px;
  z-index: 1;
  color: var(--tp-common-black);
}
.tp-login-remeber label::after {
  position: absolute;
  content: "";
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  border: 1px solid #C3C7C9;
  z-index: -1;
  transition: 0.3s;
}
.tp-login-remeber label::before {
  position: absolute;
  content: url("../img/login/check.svg");
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  visibility: hidden;
  opacity: 0;
  color: var(--tp-common-white);
  transition: 0.3s;
}
.tp-login-remeber label a:hover {
  color: var(--tp-theme-primary);
}
.tp-login-remeber label:hover {
  cursor: pointer;
}
.tp-login-forgot a {
  font-weight: 400;
  font-size: 15px;
  color: var(--tp-common-black);
  position: relative;
  display: inline-block;
}
.tp-login-forgot a::after {
  position: absolute;
  content: "";
  left: auto;
  right: 0;
  bottom: 4px;
  width: 0%;
  height: 1px;
  background-color: var(--tp-common-black);
  transition: 0.3s;
}
.tp-login-forgot a:hover::after {
  left: 0;
  right: auto;
  width: 100%;
}
.tp-login-btn {
  font-size: 16px;
  font-weight: 500;
  padding: 14px 30px;
  text-align: center;
  border-radius: 8px;
  display: inline-block;
  color: var(--tp-common-white);
  border: 1px solid #4d3d30;
  background-color: #4d3d30;
}
.tp-login-btn:hover {
  color: #4d3d30;
  background-color: #fff;
}

/*----------------------------------------*/
/*  10.3 Checkout css
/*----------------------------------------*/
.tp-checkout-verify-item {
  margin-bottom: 40px;
}
.tp-checkout-verify-item:not(:last-child) {
  margin-bottom: 14px;
}
.tp-checkout-verify-reveal {
  width: 100%;
  font-size: 14px;
  margin-bottom: 0;
  padding: 8px 26px;
  display: inline-block;
  border: 1px dashed #AAB0B2;
  color: var(--tp-common-black);
}
.tp-checkout-verify-reveal button {
  position: relative;
  color: var(--tp-common-black);
}
.tp-checkout-verify-reveal button::after {
  position: absolute;
  content: "";
  left: 0;
  bottom: 4px;
  width: 100%;
  height: 1px;
  background-color: var(--tp-common-black);
}
.tp-checkout-btn {
  font-size: 16px;
  font-weight: 500;
  height: 50px;
  padding: 0 30px;
  line-height: 50px;
  text-align: center;
  border-radius: 8px;
  display: inline-block;
  color: var(--tp-common-white);
  background-color: #4D3D30;
  border: 1px solid transparent;
}
.tp-checkout-btn.btn-plr {
  padding: 0 150px;
  border-radius: 0;
}
@media (max-width: 767px) {
  .tp-checkout-btn.btn-plr {
    padding: 0 100px;
  }
}
.tp-checkout-btn.border-style {
  font-weight: 500;
  font-size: 15px;
  color: #4d3d30;
  border-radius: 0;
  text-transform: capitalize;
  background-color: transparent;
  border: 1px solid rgba(77, 61, 48, 0.12);
}
.tp-checkout-btn.border-style span {
  margin-left: 7px;
  transform: translateY(-1px);
  display: inline-block;
}
.tp-checkout-btn.border-style:hover {
  color: var(--tp-common-white);
  background-color: #4d3d30;
  border-color: #4d3d30;
}
.tp-checkout-btn:hover {
  border-color: #4D3D30;
  color: var(--tp-common-black);
  background-color: transparent;
}
.tp-checkout-input {
  margin-bottom: 20px;
}
.tp-checkout-input label {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 12px;
  color: var(--tp-common-black);
}
.tp-checkout-input label span {
  color: red;
}
.tp-checkout-input input, .tp-checkout-input textarea {
  width: 100%;
  padding: 0 26px;
  line-height: 56px;
  font-size: 14px;
  text-transform: capitalize;
  border: 1px solid transparent;
  color: var(--tp-common-black);
  background: #F4F0EA;
}
.tp-checkout-input input::placeholder, .tp-checkout-input textarea::placeholder {
  font-size: 14px;
  line-height: 56px;
  text-transform: capitalize;
  color: rgba(0, 0, 0, 0.4);
}
.tp-checkout-input input:focus, .tp-checkout-input textarea:focus {
  background: transparent;
  border-color: var(--tp-common-black);
}
.tp-checkout-input textarea {
  height: 200px;
  resize: none;
}
.tp-checkout-input .custom-select {
  height: 60px;
  border-radius: 0;
  border: 1px solid transparent;
  color: var(--tp-common-black);
  padding: 6px 12px 0;
  width: 100%;
  border-radius: 8px;
  background: #F4F0EA;
}
.tp-checkout-input .custom-select .selected {
  background: #F4F0EA;
}
.tp-checkout-option {
  margin-bottom: 4px;
}
.tp-checkout-option-wrapper {
  margin-top: 10px;
  margin-bottom: 17px;
}
.tp-checkout-option input {
  display: none;
}
.tp-checkout-option input:checked ~ label::after {
  background-color: #4d3d30;
  border-color: #4d3d30;
}
.tp-checkout-option input:checked ~ label::before {
  visibility: visible;
  opacity: 1;
}
.tp-checkout-option label {
  font-size: 15px;
  color: #55585B;
  position: relative;
  padding-left: 26px;
  z-index: 1;
}
.tp-checkout-option label::after {
  position: absolute;
  content: "";
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  border: 1px solid #C3C7C9;
  z-index: -1;
  transition: all 0.4s ease;
}
.tp-checkout-option label::before {
  position: absolute;
  content: url("../img/login/check.svg");
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  visibility: hidden;
  opacity: 0;
  color: var(--tp-common-white);
  transition: all 0.4s ease;
}
.tp-checkout-option label a:hover {
  color: var(--tp-common-black);
}
.tp-checkout-option label:hover {
  cursor: pointer;
}
.tp-checkout-bill-area {
  padding: 45px 40px 24px;
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .tp-checkout-bill-area {
    padding: 45px 25px 24px;
  }
}
.tp-checkout-bill-title {
  font-weight: 600;
  font-size: 26px;
  margin-bottom: 35px;
}
.tp-checkout-place {
  padding: 44px 50px 50px;
  background: var(--tp-common-white);
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-checkout-place {
    padding: 35px 30px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-checkout-place {
    margin-top: 50px;
  }
}
@media (max-width: 767px) {
  .tp-checkout-place {
    padding: 45px 25px 24px;
  }
}
.tp-checkout-place-title {
  font-size: 26px;
  font-weight: 600;
  margin-right: 37px;
  margin-bottom: 30px;
}
.tp-checkout-payment {
  padding-bottom: 26px;
  margin-bottom: 24px;
  border-bottom: 1px solid #E0E2E3;
}
.tp-checkout-payment-item:not(:last-child) {
  margin-bottom: 10px;
}
.tp-checkout-payment-item.paypal-payment label {
  display: -webkit-box;
  display: -moz-box;
  display: -ms-flexbox;
  display: -webkit-flex;
  display: flex;
  align-items: center;
  flex-wrap: wrap;
}
.tp-checkout-payment-item input {
  display: none;
}
.tp-checkout-payment-item input:checked ~ label::after {
  border-color: #4d3d30;
}
.tp-checkout-payment-item input:checked ~ label::before {
  opacity: 1;
  visibility: visible;
}
.tp-checkout-payment-item label {
  font-size: 14px;
  position: relative;
  padding-left: 27px;
  font-weight: 500;
  color: var(--tp-common-black);
}
.tp-checkout-payment-item label:hover {
  cursor: pointer;
}
.tp-checkout-payment-item label::after {
  position: absolute;
  content: "";
  left: 0;
  top: 5px;
  width: 16px;
  height: 16px;
  border-radius: 50%;
  border: 1px solid #BCBCBC;
  transition: all 0.4s ease;
}
.tp-checkout-payment-item label::before {
  position: absolute;
  content: "";
  left: 3px;
  top: 8px;
  width: 10px;
  height: 10px;
  border-radius: 50%;
  background-color: #4d3d30;
  visibility: hidden;
  opacity: 0;
  transition: all 0.4s ease;
}
.tp-checkout-payment-item label img {
  margin-left: 14px;
  -webkit-transform: translateY(-2px);
  -moz-transform: translateY(-2px);
  -ms-transform: translateY(-2px);
  -o-transform: translateY(-2px);
  transform: translateY(-2px);
}
.tp-checkout-payment-item label a {
  margin-left: 20px;
  position: relative;
}
.tp-checkout-payment-item label a::after {
  position: absolute;
  content: "";
  left: 0;
  bottom: 3px;
  width: 100%;
  height: 1px;
  background-color: var(--tp-common-black);
}
.tp-checkout-payment-desc {
  position: relative;
  padding-top: 10px;
  display: none;
}
.tp-checkout-payment-desc::after {
  position: absolute;
  content: "";
  left: 57px;
  top: 0;
  width: 16px;
  height: 16px;
  background-color: #F6F7F9;
  -webkit-transform: translateY(3px) rotate(45deg);
  -moz-transform: translateY(3px) rotate(45deg);
  -ms-transform: translateY(3px) rotate(45deg);
  -o-transform: translateY(3px) rotate(45deg);
  transform: translateY(3px) rotate(45deg);
}
.tp-checkout-payment-desc p {
  font-size: 14px;
  color: #55585B;
  margin-bottom: 0;
  margin-left: 27px;
  line-height: 1.57;
  padding: 19px 30px;
  background-color: #F6F7F9;
}
.tp-checkout-agree {
  margin-bottom: 24px;
}

.tp-return-customer {
  display: none;
  margin-top: 14px;
  padding: 40px 40px;
  background-color: var(--tp-common-white);
}
.tp-return-customer-input {
  margin-bottom: 20px;
}
.tp-return-customer-input label {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 12px;
  color: var(--tp-common-black);
}
.tp-return-customer-input label span {
  color: red;
}
.tp-return-customer-input input, .tp-return-customer-input textarea {
  width: 100%;
  padding: 0 26px;
  line-height: 56px;
  font-size: 14px;
  text-transform: capitalize;
  border: 1px solid transparent;
  color: var(--tp-common-black);
  background: #F4F0EA;
}
.tp-return-customer-input input::placeholder, .tp-return-customer-input textarea::placeholder {
  font-size: 14px;
  line-height: 56px;
  text-transform: capitalize;
  color: rgba(0, 0, 0, 0.4);
}
.tp-return-customer-input input:focus, .tp-return-customer-input textarea:focus {
  background: transparent;
  border-color: var(--tp-common-black);
}
.tp-return-customer-remeber input {
  display: none;
}
.tp-return-customer-remeber input:checked ~ label::after {
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
.tp-return-customer-remeber input:checked ~ label::before {
  opacity: 1;
  visibility: visible;
}
.tp-return-customer-remeber label {
  font-size: 15px;
  color: #55585B;
  position: relative;
  padding-left: 26px;
  z-index: 1;
}
.tp-return-customer-remeber label::after {
  position: absolute;
  content: "";
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  border: 1px solid #C3C7C9;
  z-index: -1;
  transition: all 0.4s ease;
}
.tp-return-customer-remeber label::before {
  position: absolute;
  content: url("../img/login/check.svg");
  top: 4px;
  left: 0;
  width: 18px;
  height: 18px;
  line-height: 16px;
  text-align: center;
  visibility: hidden;
  opacity: 0;
  color: var(--tp-common-white);
  transition: all 0.4s ease;
}
.tp-return-customer-remeber label a:hover {
  color: var(--tp-common-black);
}
.tp-return-customer-remeber label:hover {
  cursor: pointer;
}
.tp-return-customer-forgot a {
  font-weight: 400;
  font-size: 15px;
  color: var(--tp-common-black);
  position: relative;
  display: inline-block;
}
.tp-return-customer-forgot a::after {
  position: absolute;
  content: url("../img/login/check.svg");
  left: auto;
  right: 0;
  bottom: 4px;
  width: 0%;
  height: 1px;
  background-color: var(--tp-common-black);
  transition: all 0.4s ease;
}
.tp-return-customer-forgot a:hover::after {
  left: 0;
  right: auto;
  width: 100%;
}

.tp-order-details {
  padding: 70px 100px 55px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .tp-order-details {
    padding: 70px 70px 55px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-order-details {
    padding: 70px 30px 55px;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .tp-order-details {
    padding: 70px 50px 55px;
  }
}
@media (max-width: 767px) {
  .tp-order-details {
    padding: 40px 30px 45px;
  }
}
.tp-order-details-icon {
  margin-bottom: 22px;
}
.tp-order-details-icon span {
  display: inline-block;
  width: 120px;
  height: 120px;
  line-height: 118px;
  text-align: center;
  font-size: 55px;
  color: var(--tp-common-white);
  border-bottom: 1px solid #E0E2E3;
  border-radius: 50%;
}
.tp-order-details-icon span svg {
  transform: translateY(-1px);
}
.tp-order-details-title {
  font-size: 30px;
  font-weight: 600;
  color: var(--tp-common-white);
  margin-bottom: 7px;
}
.tp-order-details-content p {
  font-size: 16px;
  color: var(--tp-common-white);
  line-height: 1.38;
}
.tp-order-details-item {
  margin-bottom: 38px;
}
.tp-order-details-item-wrapper .row [class*=col-]:nth-child(2n) .tp-order-details-item {
  padding-left: 40px;
}
@media (max-width: 767px) {
  .tp-order-details-item-wrapper .row [class*=col-]:nth-child(2n) .tp-order-details-item {
    padding-left: 0;
  }
}
.tp-order-details-item h4 {
  font-size: 18px;
  color: var(--tp-common-white);
  margin-bottom: 0;
  font-weight: 400;
}
.tp-order-details-item p {
  font-weight: 700;
  font-size: 18px;
  color: var(--tp-common-white);
  margin-bottom: 0;
}
.tp-order-info-wrapper {
  padding: 42px 50px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .tp-order-info-wrapper {
    padding: 42px 40px;
  }
}
@media (max-width: 767px) {
  .tp-order-info-wrapper {
    padding: 42px 30px;
  }
}
.tp-order-info-title {
  font-size: 26px;
  font-weight: 600;
  margin-bottom: 40px;
}
.tp-order-info-list ul li {
  list-style: none;
  padding: 15px 0;
  display: -webkit-box;
  display: -moz-box;
  display: -ms-flexbox;
  display: -webkit-flex;
  display: flex;
  align-items: center;
  justify-content: space-between;
}
.tp-order-info-list ul li:not(:last-child) {
  border-bottom: 1px solid #E0E2E3;
}
.tp-order-info-list ul li span {
  font-size: 15px;
  color: var(--tp-common-black);
}
.tp-order-info-list ul li.tp-order-info-list-header {
  padding-top: 0;
  padding-bottom: 12px;
}
.tp-order-info-list ul li.tp-order-info-list-header h4 {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 0;
}
.tp-order-info-list ul li.tp-order-info-list-desc p {
  font-size: 15px;
  margin-bottom: 0;
}
.tp-order-info-list ul li.tp-order-info-list-desc p span {
  font-size: 15px;
  font-weight: 500;
}
.tp-order-info-list ul li.tp-order-info-list-subtotal span:last-child {
  color: var(--tp-common-black);
}
.tp-order-info-list ul li.tp-order-info-list-shipping span input {
  display: none;
}
.tp-order-info-list ul li.tp-order-info-list-shipping span input:checked ~ label::after {
  border-color: #4d3d30;
}
.tp-order-info-list ul li.tp-order-info-list-shipping span input:checked ~ label::before {
  opacity: 1;
  visibility: visible;
}
.tp-order-info-list ul li.tp-order-info-list-shipping span label {
  font-size: 14px;
  position: relative;
  padding-right: 27px;
}
.tp-order-info-list ul li.tp-order-info-list-shipping span label span {
  color: var(--tp-common-black);
}
.tp-order-info-list ul li.tp-order-info-list-shipping span label:hover {
  cursor: pointer;
}
.tp-order-info-list ul li.tp-order-info-list-shipping span label::after {
  position: absolute;
  content: "";
  right: 0;
  top: 5px;
  width: 16px;
  height: 16px;
  border-radius: 50%;
  border: 1px solid #BCBCBC;
  transition: all 0.4s ease;
}
.tp-order-info-list ul li.tp-order-info-list-shipping span label::before {
  position: absolute;
  content: "";
  right: 4px;
  top: 9px;
  width: 8px;
  height: 8px;
  border-radius: 50%;
  background-color: #4d3d30;
  visibility: hidden;
  opacity: 0;
  transition: all 0.4s ease;
}
.tp-order-info-list ul li.tp-order-info-list-total {
  padding: 14px 0;
}
.tp-order-info-list ul li.tp-order-info-list-total span {
  font-size: 16px;
  font-weight: 500;
}
.tp-order-inner {
  background-color: var(--tp-common-white);
  box-shadow: 0px 30px 70px rgba(1, 15, 28, 0.1);
}

/*----------------------------------------*/
/*  10.4 Cart css
/*----------------------------------------*/
.tp-cart-header-product {
  padding-left: 30px !important;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-cart-list {
    overflow-x: scroll;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-cart-list {
    overflow-x: scroll;
    margin-right: 0;
  }
}
.tp-cart-list .table > :not(caption) > * > * {
  padding: 20px 0;
  box-shadow: none;
  vertical-align: middle;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-cart-list table {
    width: 840px;
  }
}
.tp-cart-list thead {
  background-color: #EAE5DF;
}
.tp-cart-list thead th {
  font-weight: 500;
  font-size: 14px;
  color: var(--tp-common-black);
  border: 0 !important;
  padding-top: 9px !important;
  padding-bottom: 9px !important;
  background: transparent;
}
.tp-cart-list tr td {
  border-color: #E0E2E3;
}
.tp-cart-list tr td .tp-cart-action-btn {
  font-weight: 400;
  font-size: 14px;
  color: #818487;
}
.tp-cart-list tr td .tp-cart-action-btn svg {
  transform: translateY(-1px);
}
.tp-cart-list tr td .tp-cart-action-btn:hover {
  color: #FF1826;
}
.tp-cart-list tr td.tp-cart-add-to-cart .tp-btn {
  border-radius: 0;
}
.tp-cart-list tbody tr:first-child td {
  padding-top: 30px !important;
}
.tp-cart-img {
  width: 78px;
  margin-right: 20px;
}
.tp-cart-img img {
  width: 78px;
  height: 100px;
  object-fit: cover;
}
.tp-cart-title a {
  margin-left: 20px;
  font-weight: 400;
  font-size: 16px;
  color: var(--tp-common-black);
}
.tp-cart-title a:hover {
  color: var(--tp-common-black);
}
.tp-cart-price {
  width: 126px;
}
.tp-cart-price span {
  font-size: 16px;
  color: var(--tp-common-black);
}
.tp-cart-quantity {
  width: 180px;
}
@media only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-cart-coupon {
    margin-bottom: 20px;
  }
}
.tp-cart-coupon-input-box label {
  font-size: 14px;
  color: var(--tp-common-black);
  margin-bottom: 7px;
}
.tp-cart-coupon-input input {
  background: #EAE5DF;
  margin-right: 4px;
  max-width: 282px;
  font-size: 14px;
  padding-left: 26px;
  padding-right: 26px;
  border-radius: 0;
  color: var(--tp-common-black);
  border: 1px solid transparent;
  text-transform: capitalize;
}
.tp-cart-coupon-input input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  font-size: 14px;
  text-transform: capitalize;
  color: rgba(0, 0, 0, 0.4);
}
.tp-cart-coupon-input input::-moz-placeholder { /* Firefox 19+ */
  font-size: 14px;
  text-transform: capitalize;
  color: rgba(0, 0, 0, 0.4);
}
.tp-cart-coupon-input input:-moz-placeholder { /* Firefox 4-18 */
  font-size: 14px;
  text-transform: capitalize;
  color: rgba(0, 0, 0, 0.4);
}
.tp-cart-coupon-input input:-ms-input-placeholder { /* IE 10+  Edge*/
  font-size: 14px;
  text-transform: capitalize;
  color: rgba(0, 0, 0, 0.4);
}
.tp-cart-coupon-input input::placeholder { /* MODERN BROWSER */
  font-size: 14px;
  text-transform: capitalize;
  color: rgba(0, 0, 0, 0.4);
}
.tp-cart-coupon-input input:focus {
  border-color: #4D3D30;
  background-color: transparent;
}
.tp-cart-coupon-input button {
  font-size: 16px;
  font-weight: 500;
  padding: 17px 30px;
  color: var(--tp-common-white);
  background-color: #4D3D30;
}
.tp-cart-coupon-input button:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.tp-cart-update-btn {
  font-size: 16px;
  font-weight: 500;
  padding: 16px 29px;
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
  border: 1px solid rgba(1, 15, 28, 0.1);
}
.tp-cart-update-btn:hover {
  background-color: #4d3d30;
  color: var(--tp-common-white);
  border-color: var(--tp-common-black);
}
.tp-cart-checkout-wrapper {
  margin-left: -24px;
  padding: 36px 24px 28px;
  background: var(--tp-common-white);
  box-shadow: 0px 30px 70px rgba(1, 15, 28, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .tp-cart-checkout-wrapper {
    margin-top: 50px;
    margin-left: 0;
  }
}
.tp-cart-checkout-top {
  padding-bottom: 13px;
  margin-bottom: 19px;
  border-bottom: 1px solid #E0E2E3;
}
.tp-cart-checkout-top span {
  font-size: 20px;
  color: var(--tp-common-black);
  font-weight: 500;
}
.tp-cart-checkout-shipping {
  padding-bottom: 16px;
  border-bottom: 1px solid #E0E2E3;
  margin-bottom: 15px;
}
.tp-cart-checkout-shipping-title {
  font-weight: 500;
  font-size: 15px;
  margin-bottom: 7px;
}
.tp-cart-checkout-shipping-option:not(:last-child) {
  margin-bottom: 4px;
}
.tp-cart-checkout-shipping-option input {
  display: none;
}
.tp-cart-checkout-shipping-option input:checked + label::after {
  border-color: var(--tp-common-black);
}
.tp-cart-checkout-shipping-option input:checked + label::before {
  opacity: 1;
  visibility: visible;
}
.tp-cart-checkout-shipping-option label {
  font-weight: 400;
  font-size: 14px;
  color: #161C2D;
  position: relative;
  padding-left: 25px;
}
.tp-cart-checkout-shipping-option label:hover {
  cursor: pointer;
}
.tp-cart-checkout-shipping-option label span {
  color: var(--tp-common-black);
}
.tp-cart-checkout-shipping-option label::after {
  position: absolute;
  content: "";
  left: 0;
  top: 5px;
  width: 16px;
  height: 16px;
  border-radius: 50%;
  border: 1px solid #BCBCBC;
  transition: all 0.4s ease;
}
.tp-cart-checkout-shipping-option label::before {
  position: absolute;
  content: "";
  left: 4px;
  top: 9px;
  width: 8px;
  height: 8px;
  border-radius: 50%;
  background-color: var(--tp-common-black);
  visibility: hidden;
  opacity: 0;
  transition: all 0.4s ease;
}
.tp-cart-checkout-total {
  margin-bottom: 25px;
}
.tp-cart-checkout-total span {
  font-weight: 500;
  font-size: 18px;
  color: var(--tp-common-black);
}
.tp-cart-checkout-btn {
  font-size: 16px;
  font-weight: 500;
  padding: 10px 30px;
  text-align: center;
  display: inline-block;
  color: var(--tp-common-white);
  background-color: #4D3D30;
}
.tp-cart-checkout-btn:hover {
  background-color: var(--tp-common-black);
  color: var(--tp-common-white);
}

.cartmini__area {
  position: fixed;
  right: 0;
  top: 0;
  width: 320px;
  height: 100%;
  -webkit-transform: translateX(calc(100% + 80px));
  -moz-transform: translateX(calc(100% + 80px));
  -ms-transform: translateX(calc(100% + 80px));
  -o-transform: translateX(calc(100% + 80px));
  transform: translateX(calc(100% + 80px));
  background: var(--tp-common-white) none repeat scroll 0 0;
  z-index: 99999;
  scrollbar-width: none;
  transition: 0.3s;
}
.cartmini__area::-webkit-scrollbar {
  display: none;
}
.cartmini__area.cartmini-opened {
  -webkit-transform: translateX(0);
  -moz-transform: translateX(0);
  -ms-transform: translateX(0);
  -o-transform: translateX(0);
  transform: translateX(0);
}
.cartmini__wrapper {
  position: relative;
  min-height: 100%;
  padding-left: 25px;
  padding-right: 25px;
}
.cartmini__top-title {
  padding: 20px 0;
  border-bottom: 1px solid #E0E2E3;
}
.cartmini__top-title h4 {
  font-size: 18px;
  font-weight: 600;
  margin-bottom: 0;
  text-transform: capitalize;
}
.cartmini__close {
  position: absolute;
  top: 17px;
  right: 0;
}
.cartmini__close-btn {
  background: transparent;
  color: var(--tp-common-black);
  font-size: 22px;
}
.cartmini__close-btn:hover {
  -webkit-transform: rotate(90deg);
  -moz-transform: rotate(90deg);
  -ms-transform: rotate(90deg);
  -o-transform: rotate(90deg);
  transform: rotate(90deg);
}
.cartmini__shipping {
  padding: 15px 0;
  border-bottom: 1px solid #E0E2E3;
}
.cartmini__shipping .progress {
  height: 10px;
  border-radius: 0;
}
.cartmini__shipping .progress-bar {
  background-color: #ffaf1b;
}
.cartmini__shipping p {
  margin-bottom: 5px;
  font-size: 16px;
}
.cartmini__shipping p span {
  color: red;
  font-weight: 600;
}
.cartmini__widget {
  height: calc(100vh - 380px);
  overflow-y: scroll;
  overscroll-behavior-y: contain;
  scrollbar-width: none;
}
.cartmini__widget::-webkit-scrollbar {
  display: none; /* for Chrome, Safari, and Opera */
}
.cartmini__widget-item {
  position: relative;
  display: flex;
  padding: 20px 0;
  border-bottom: 1px solid rgba(129, 129, 129, 0.2);
}
.cartmini__widget-item:last-child {
  border-bottom: 0;
}
.cartmini__thumb {
  border: 1px solid #E0E2E3;
  margin-right: 15px;
}
.cartmini__thumb img {
  width: 70px;
  height: auto;
}
.cartmini__title {
  font-size: 15px;
  margin-bottom: 4px;
  font-weight: 500;
}
.cartmini__title a {
  display: inline;
  transition: all 0.3s linear;
  background-repeat: no-repeat;
  background-size: 0% 1px, 0 1px;
  background-position: 100% 100%, 0 100%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.cartmini__title a:hover {
  color: #4d3d30;
  background-size: 0% 1px, 100% 1px;
}
.cartmini__content {
  padding-right: 15px;
}
.cartmini__content .tp-product-quantity {
  width: 75px;
  padding: 0;
}
.cartmini__content .tp-product-quantity .tp-cart-input[type=text] {
  height: 30px;
  text-align: center;
  font-size: 13px;
  border: 1px solid #E0E2E3;
  background-color: var(--tp-common-white);
  padding: 0;
}
.cartmini__content .tp-product-quantity .tp-cart-plus,
.cartmini__content .tp-product-quantity .tp-cart-minus {
  width: 20px;
  height: 30px;
  line-height: 30px;
  display: inline-block;
  text-align: center;
  font-size: 13px;
  left: 3px;
}
.cartmini__content .tp-product-quantity .tp-cart-plus svg,
.cartmini__content .tp-product-quantity .tp-cart-minus svg {
  -webkit-transform: translateY(-1px);
  -moz-transform: translateY(-1px);
  -ms-transform: translateY(-1px);
  -o-transform: translateY(-1px);
  transform: translateY(-1px);
  width: 10px;
}
.cartmini__content .tp-product-quantity .tp-cart-plus::after,
.cartmini__content .tp-product-quantity .tp-cart-minus::after {
  display: none;
}
.cartmini__content .tp-product-quantity .tp-cart-plus {
  left: auto;
  right: 3px;
}
.cartmini__del {
  position: absolute;
  top: 15px;
  right: 0;
  width: 25px;
  height: 25px;
  line-height: 25px;
  text-align: center;
  color: var(--tp-common-black);
  font-size: 14px;
}
.cartmini__del:hover {
  color: #4d3d30;
}
.cartmini__checkout {
  padding-top: 15px;
  padding-bottom: 85px;
  width: 100%;
  border-top: 2px solid #E0E2E3;
}
.cartmini__checkout-title h4 {
  font-size: 15px;
  display: inline-block;
  font-weight: 500;
  margin-bottom: 0;
  text-transform: capitalize;
}
.cartmini__checkout-title span {
  float: right;
  font-size: 15px;
  color: var(--tp-common-black);
  font-weight: 500;
}
.cartmini__price {
  font-size: 14px;
  font-weight: 500;
  color: var(--tp-common-black);
}
.cartmini__quantity {
  font-size: 12px;
  font-weight: 500;
}
.cartmini__empty {
  margin-top: 150px;
}
.cartmini__empty img {
  margin-bottom: 30px;
}
.cartmini__empty p {
  font-size: 16px;
  color: var(--tp-common-black);
  margin-bottom: 15px;
}

/*----------------------------------------*/
/*  10.5 Account css
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px), only screen and (min-width: 576px) and (max-width: 767px) {
  .profile__tab {
    margin-right: 0;
    margin-bottom: 50px;
  }
}
.profile__tab nav .nav-tabs {
  padding: 0;
  border: 0;
  margin: 0;
  padding: 20px 0;
  border: 1px solid #E0E2E3;
  background-color: var(--tp-common-white);
}
.profile__tab nav .nav-tabs .nav-link {
  font-weight: 400;
  font-size: 16px;
  padding: 14px 0px;
  margin: 0px 30px;
  position: relative;
  border-radius: 0;
  text-align: left;
  border: 0;
  color: #5D5D63;
  font-family: var(--tp-ff-onest);
}
.profile__tab nav .nav-tabs .nav-link::after {
  position: absolute;
  top: 14px;
  left: -31px;
  height: 25px;
  width: 2px;
  content: "";
  transition: 0.4s;
  opacity: 0;
  visibility: hidden;
  background-color: var(--tp-common-black);
}
.profile__tab nav .nav-tabs .nav-link:not(:last-child) {
  border-bottom: 1px dashed #E0E2E3;
}
.profile__tab nav .nav-tabs .nav-link span {
  margin-right: 7px;
}
.profile__tab nav .nav-tabs .nav-link.active {
  color: var(--tp-common-black);
}
.profile__tab nav .nav-tabs .nav-link.active::after {
  opacity: 1;
  visibility: visible;
}
.profile__tab .tp-tab-menu {
  position: relative;
}
.profile__tab-content {
  padding: 35px 40px 40px;
  background-color: var(--tp-common-white);
}
.profile__info-title {
  font-size: 20px;
  margin-bottom: 25px;
  font-family: var(--tp-ff-onest);
}
.profile__input {
  margin-bottom: 25px;
  position: relative;
}
.profile__input-box h4 {
  font-weight: 500;
  font-size: 14px;
  letter-spacing: -0.02em;
  color: var(--tp-common-black-solid);
  margin-bottom: 10px;
}
.profile__input-box h4 span {
  color: var(--tp-theme-primary);
}
.profile__input-box p {
  font-size: 13px;
  color: var(--tp-common-white);
  opacity: 0.7;
  margin-bottom: 10px;
}
.profile__input > span {
  position: absolute;
  top: 50%;
  left: 20px;
  -webkit-transform: translateY(-50%);
  -moz-transform: translateY(-50%);
  -ms-transform: translateY(-50%);
  -o-transform: translateY(-50%);
  transform: translateY(-50%);
}
.profile__input > span svg {
  -webkit-transform: translateY(-2px);
  -moz-transform: translateY(-2px);
  -ms-transform: translateY(-2px);
  -o-transform: translateY(-2px);
  transform: translateY(-2px);
}
.profile__input input, .profile__input textarea {
  width: 100%;
  height: 60px;
  line-height: 60px;
  padding: 0 25px;
  padding-left: 50px;
  border: 0;
  outline: 0;
  background-color: #F4F0EA;
  border: 1px solid transparent;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-onest);
}
.profile__input input:focus, .profile__input textarea:focus {
  background-color: transparent;
  border-color: var(--tp-theme-primary);
}
.profile__input textarea {
  line-height: 1.5;
  padding: 20px;
  resize: none;
  height: 200px;
  resize: none;
}
.profile__input .nice-select {
  width: 100%;
  float: none;
  height: 60px;
  border: 1px solid #EAEAEF;
  border-radius: 0;
  line-height: 58px;
  padding-left: 27px;
}
.profile__input .nice-select .current {
  color: var(--tp-common-black);
  font-family: var(--tp-ff-onest);
}
.profile__input .nice-select::after {
  right: 25px;
  color: var(--tp-common-black);
}
.profile__input .nice-select.open .list {
  -webkit-transform: scale(1) translateY(0px);
  -moz-transform: scale(1) translateY(0px);
  -ms-transform: scale(1) translateY(0px);
  -o-transform: scale(1) translateY(0px);
  transform: scale(1) translateY(0px);
}
.profile__input .nice-select .list {
  width: 100%;
  border-radius: 0;
  margin-top: 0;
  padding: 13px 8px;
  transform-origin: center center;
  -webkit-transform: scale(0.9) translateY(0px);
  -moz-transform: scale(0.9) translateY(0px);
  -ms-transform: scale(0.9) translateY(0px);
  -o-transform: scale(0.9) translateY(0px);
  transform: scale(0.9) translateY(0px);
  font-family: var(--tp-ff-onest);
}
.profile__input .nice-select .list .option:hover {
  color: var(--tp-common-black);
}
.profile__password input {
  padding: 0 20px;
  background-color: #F4F0EA;
  border: 1px solid transparent;
}
.profile__password input:focus {
  background-color: transparent;
}
.profile__ticket {
  border: 1px solid #E0E2E3;
}
@media only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .profile__ticket {
    overflow-x: scroll;
  }
}
.profile__ticket table thead tr {
  background-color: transparent;
}
.profile__ticket table th {
  color: var(--tp-common-black);
  border-color: #E0E2E3;
  box-shadow: none;
  font-family: var(--tp-ff-onest);
}
.profile__ticket table td {
  color: var(--tp-common-black);
}
.profile__ticket table tbody > tr:first-child {
  background-color: transparent;
}
.profile__ticket table tbody > tr:not(:last-child) {
  border-bottom: 1px solid #E0E2E3;
}
.profile__ticket table tbody > tr td, .profile__ticket table tbody > tr th {
  vertical-align: middle;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-onest);
}
.profile__ticket table tbody > tr > th {
  padding-left: 15px;
  padding-right: 15px;
}
.profile__ticket table tbody > tr th[scope=row] {
  color: var(--tp-common-black);
}
.profile__ticket table tbody > tr td[data-info="status done"] {
  color: #08AF5C;
}
.profile__ticket table tbody > tr td[data-info="status pending"] {
  color: #6364DB;
}
.profile__ticket table tbody > tr td[data-info="status reply"] {
  color: #D93D1E;
}
.profile__ticket table tbody > tr td[data-info="status hold"] {
  color: #FFB422;
}
.profile__ticket table tbody > tr .tp-btn {
  padding: 7px 18px;
  background-color: #E0E2E3;
  color: var(--tp-common-black);
  font-weight: 500;
  min-width: 90px;
}
.profile__ticket table tbody > tr .tp-btn:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.profile__ticket .table {
  margin-bottom: 0;
  --bs-table-bg: none;
}
@media only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .profile__ticket .table {
    width: 700px;
  }
}
.profile__ticket .table > :not(:first-child) {
  border-color: #EAEAEF;
  border-top-width: 1px;
}
.profile__ticket .table > :not(caption) > * > * {
  padding: 1rem 1.5rem;
  border: 0;
  box-shadow: none;
}
@media only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .profile__address-item {
    margin-bottom: 40px;
  }
}
.profile__address-title {
  font-size: 22px;
  margin-bottom: 20px;
  font-family: var(--tp-ff-onest);
}
.profile__address-icon span {
  display: inline-block;
  min-width: 45px;
  margin-right: 20px;
}
@media (max-width: 767px) {
  .profile__address-icon span {
    margin-bottom: 20px;
  }
}
.profile__address-icon span svg {
  width: 45px;
}
.profile__address-icon span svg path {
  fill: var(--tp-common-black);
}
.profile__address-content p {
  font-size: 16px;
  margin-bottom: 10px;
  font-family: var(--tp-ff-onest);
}
.profile__address-content p span {
  font-weight: 600;
  margin-right: 7px;
  color: var(--tp-common-black);
}
.profile__notification-title {
  font-size: 24px;
  margin-bottom: 10px;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-onest);
}
.profile__notification p {
  font-family: var(--tp-ff-onest);
}
.profile__notification-item .form-check-input {
  margin-top: 0;
  width: 40px;
  height: 20px;
  box-shadow: none;
}
.profile__notification-item .form-check-label {
  font-size: 16px;
  margin-left: 10px;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-onest);
}
.profile__notification-item .form-check-label:hover {
  cursor: pointer;
  color: var(--tp-common-black);
}
.profile__notification-item .form-check-input:checked {
  background-color: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.profile__btn .tp-btn {
  padding: 14px 39px;
  border: 1px solid #EAEAEF;
}
.profile__btn .tp-btn-cart {
  font-size: 16px;
  font-weight: 500;
  height: 50px;
  line-height: 45px;
  padding: 0px 30px;
  transition: 0.3s;
  display: inline-block;
  text-align: center;
  border-radius: 8px;
  text-transform: capitalize;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
  background-color: #4D3D30;
  border: 2px solid transparent;
}
.profile__btn .tp-btn-cart:hover {
  border-color: #4D3D30;
  color: var(--tp-common-black);
  background-color: transparent;
}
@media (max-width: 767px) {
  .profile__main-inner {
    margin-bottom: 20px;
  }
}
.profile__main-thumb {
  position: relative;
}
.profile__main-thumb img {
  width: 80px;
  height: 80px;
  border-radius: 50%;
  margin-right: 16px;
}
@media (max-width: 767px) {
  .profile__main-thumb img {
    margin-bottom: 20px;
  }
}
.profile__main-thumb-edit input {
  display: none;
}
.profile__main-thumb-edit label {
  position: absolute;
  bottom: 2px;
  right: 12px;
  width: 25px;
  height: 25px;
  line-height: 25px;
  text-align: center;
  color: var(--tp-common-black);
  background-color: #fff;
  border-radius: 50%;
  transition: 0.3s;
  box-shadow: 0px 1px 2px rgba(25, 25, 26, 0.2);
}
.profile__main-thumb-edit label i {
  margin-left: 2px;
}
.profile__main-thumb-edit label:hover {
  cursor: pointer;
  color: var(--tp-common-white);
  background-color: #4d3d30;
}
.profile__main-title {
  font-size: 24px;
  margin-bottom: 0;
  font-family: var(--tp-ff-onest);
}
.profile__main-content p {
  font-size: 14px;
  margin-bottom: 0;
  font-family: var(--tp-ff-onest);
}
.profile__main-content p span {
  color: var(--tp-common-black);
  font-weight: 500;
}
.profile__main-info-item {
  text-align: center;
  padding: 27px 30px 25px;
  background-color: #F4F0EA;
}
@media only screen and (min-width: 576px) and (max-width: 767px), (max-width: 767px) {
  .profile__main-info-item {
    margin-bottom: 25px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .profile__main-info-item {
    padding: 22px 0 20px;
  }
}
.profile__main-info-icon {
  position: relative;
  margin-bottom: 15px;
}
.profile__main-info-icon > span {
  position: relative;
  display: inline-block;
  width: 60px;
  height: 60px;
  line-height: 60px;
  text-align: center;
}
.profile__main-info-icon > span svg {
  width: 60px;
}
.profile__main-info-icon > span svg path {
  fill: var(--tp-common-black);
}
.profile__main-info-icon .profile-icon-count {
  position: absolute;
  top: 2px;
  right: -8px;
  width: 26px;
  height: 26px;
  line-height: 21px;
  border-radius: 50%;
  font-size: 12px;
  font-weight: 600;
  border: 2px solid #fff;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-onest);
  background-color: #4d3d30;
}
.profile__main-info-title {
  font-size: 18px;
  margin-bottom: 0;
  font-family: var(--tp-ff-onest);
}

.tp-logout-btn {
  font-size: 14px;
  font-weight: 500;
  padding: 6px 18px;
  text-align: center;
  display: inline-block;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-onest);
  border: 1px solid rgba(2, 6, 38, 0.12);
}
.tp-logout-btn:hover {
  color: var(--tp-common-white);
  border-color: #4d3d30;
  background-color: #4d3d30;
}

.tp-profile-input-wrapper {
  margin-bottom: 8px;
}
.tp-profile-input-box {
  position: relative;
  margin-bottom: 30px;
}
.tp-profile-input input {
  background: #F4F0EA;
  border: 1px solid transparent;
  font-size: 14px;
  color: var(--tp-common-black);
}
.tp-profile-input input::-webkit-input-placeholder { /* Chrome/Opera/Safari */
  color: #95999D;
}
.tp-profile-input input::-moz-placeholder { /* Firefox 19+ */
  color: #95999D;
}
.tp-profile-input input:-moz-placeholder { /* Firefox 4-18 */
  color: #95999D;
}
.tp-profile-input input:-ms-input-placeholder { /* IE 10+  Edge*/
  color: #95999D;
}
.tp-profile-input input::placeholder { /* MODERN BROWSER */
  color: #95999D;
}
.tp-profile-input textarea {
  height: 165px;
  resize: none;
}
.tp-profile-input-title label {
  font-size: 16px;
  padding: 0 5px;
  line-height: 1;
  font-weight: 500;
  margin-bottom: 12px;
  display: inline-block;
  color: var(--tp-common-black);
}
.tp-profile-input-eye {
  top: 50%;
  right: 26px;
  position: absolute;
  -webkit-transform: translateY(-50%);
  -moz-transform: translateY(-50%);
  -ms-transform: translateY(-50%);
  -o-transform: translateY(-50%);
  transform: translateY(-50%);
}
.tp-profile-input-eye .open-eye {
  display: none;
}
.tp-profile-input-eye span {
  transition: 0.3s;
}
.tp-profile-input-eye:hover {
  cursor: pointer;
}
.tp-profile-input-eye:hover span {
  color: var(--tp-common-black);
}

/*----------------------------------------*/
/*  10.6 Error Css
/*----------------------------------------*/
.tp-error-title {
  font-weight: 700;
  font-size: 64px;
  margin-bottom: 50px;
  color: var(--tp-common-black);
}
.tp-error-title-sm {
  font-weight: 600;
  font-size: 26px;
  line-height: 1;
  text-transform: uppercase;
  color: var(--tp-common-black);
}
.tp-error-content p {
  font-weight: 400;
  font-size: 18px;
  color: #57575a;
  margin-bottom: 30px;
}
.tp-error-content .tp-btn {
  height: 60px;
  line-height: 55px;
  border-radius: 40px;
  padding: 0 18px 0 24px;
  font-weight: 500;
  font-size: 18px;
  letter-spacing: 0.03em;
  z-index: 9;
  overflow: hidden;
  display: inline-block;
  text-transform: capitalize;
  position: relative;
  transition: all 0.3s;
  background-color: var(--tp-common-black);
  color: var(--tp-common-white);
  border: 2px solid transparent;
}
.tp-error-content .tp-btn:hover {
  background-color: transparent;
  color: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.tp-error-wrapper img {
  margin-bottom: 55px;
}

/* HEADER CSS */
/*----------------------------------------*/
/*   3.1 Header Style
/*----------------------------------------*/
.tp-header-menu.tp-header-cnt-menu > nav > ul {
  margin-left: 270px;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .tp-header-menu.tp-header-cnt-menu > nav > ul {
    margin-left: 100px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-menu.tp-header-cnt-menu > nav > ul {
    margin-left: 0;
  }
}
.tp-header-menu.tp-header-cnt-menu > nav > ul > li > a {
  color: var(--tp-common-black-7);
}
.tp-header-menu.tp-header-cnt-menu > nav > ul > li.has-dropdown::after {
  color: var(--tp-common-black-7);
}
.tp-header-right .cr-header-login a {
  font-size: 15px;
  line-height: 1;
  font-weight: 600;
  border-radius: 6px;
  display: inline-block;
  padding: 11px 20px 12px;
  letter-spacing: -0.15px;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.06);
  background: rgba(255, 255, 255, 0.06);
  backdrop-filter: blur(10px);
}
.tp-header-right .cr-header-login a:hover {
  color: var(--tp-common-black-7);
  background-color: var(--tp-common-white);
}
.tp-header-right.cr-header .tp-btn-white-border {
  border-radius: 6px;
}
.tp-header-cnt-left {
  width: 675px;
  opacity: 0.97;
  padding: 28px 30px;
  display: inline-block;
  border-radius: 16px;
  backdrop-filter: blur(5px);
  background: var(--tp-common-white);
  box-shadow: 5px 6px 50px 5px rgba(16, 48, 42, 0.06);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-cnt-left {
    width: auto;
    padding: 0;
    box-shadow: none;
    backdrop-filter: inherit;
    background-color: transparent;
  }
}
.tp-header-cnt-wrap .tp-header-logo-wrap p {
  margin: 0;
  font-size: 14px;
  font-weight: 500;
  color: var(--tp-common-black-7);
}
.tp-header-cnt-bar-wrap .tp-header-bar {
  font-size: 14px;
  font-weight: 500;
  padding-left: 20px;
  margin-right: 20px;
  text-transform: uppercase;
  color: var(--tp-common-black-7);
  border-left: 1px solid rgba(5, 3, 18, 0.2);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .tp-header-cnt-bar-wrap .tp-header-bar {
    border: none;
  }
}
.tp-header-cnt-bar-wrap .tp-header-bar span {
  margin-left: 8px;
  display: inline-block;
}
.tp-header-cnt-bar-wrap .tp-header-bar:hover {
  color: var(--tp-common-red-2);
}
.tp-header-cnt-bar-wrap .tp-header-8-lang {
  padding-left: 20px;
  border-left: 1px solid rgba(5, 3, 18, 0.2);
}

.ais-header-btn a {
  font-size: 14px;
  font-weight: 500;
  display: inline-block;
  color: var(--tp-common-black-7);
}
.ais-header-btn a span {
  margin-left: 8px;
  width: 24px;
  height: 24px;
  border-radius: 50%;
  place-content: center;
  display: inline-grid;
  background-color: var(--tp-common-blue);
}
.ais-header-btn a:hover {
  color: var(--tp-common-blue);
}

/*----------------------------------------*/
/*   3.2 Hero Style
/*----------------------------------------*/
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-hero-ptb {
    padding-top: 150px;
  }
}
.cst-hero-thumb img {
  border-radius: 16px 16px 120px 16px;
}
@media (max-width: 767px) {
  .cst-hero-thumb-shapes {
    display: none;
  }
}
.cst-hero-thumb-shapes .shape-1 {
  top: 10%;
  left: -120px;
  position: absolute;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-hero-thumb-shapes .shape-1 {
    left: 0;
  }
}
.cst-hero-thumb-shapes .shape-2 {
  right: 50px;
  bottom: 50px;
  position: absolute;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-hero-thumb-shapes .shape-2 {
    bottom: 25%;
  }
}
.cst-hero-wrapper {
  margin-left: 55px;
  align-items: center;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-hero-wrapper {
    margin-left: 0;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cst-hero-wrapper {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-hero-wrapper {
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .cst-hero-wrapper {
    padding-bottom: 60px;
  }
}
.cst-hero-wrapper .shape-1 {
  position: absolute;
  bottom: -10%;
  right: 0;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cst-hero-wrapper .shape-1 {
    bottom: 5%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-hero-wrapper .shape-1 {
    right: 20%;
    bottom: 30%;
  }
}
@media (max-width: 767px) {
  .cst-hero-wrapper .shape-1 {
    display: none;
  }
}
.cst-hero-left {
  margin-right: 30px;
}
@media (max-width: 767px) {
  .cst-hero-left {
    margin-right: 0;
    margin-bottom: 20px;
  }
}
.cst-hero-subtitle {
  font-size: 14px;
  font-weight: 600;
  display: inline-block;
  writing-mode: sideways-lr;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-inter);
}
@media (max-width: 767px) {
  .cst-hero-subtitle {
    writing-mode: inherit;
  }
}
.cst-hero-right {
  padding-left: 30px;
  border-left: 1px solid rgba(255, 255, 255, 0.1);
}
@media (max-width: 767px) {
  .cst-hero-right {
    padding-left: 0;
    border-left: none;
  }
}
.cst-hero-btn-box {
  display: flex;
  gap: 12px;
}
.cst-hero-item {
  gap: 20px;
  display: flex;
  align-items: center;
}
.cst-hero-item-title {
  margin: 0;
  font-size: 18px;
  font-weight: 500;
  letter-spacing: -0.36px;
  color: var(--tp-common-white);
}
.cst-hero-item::before {
  content: "";
  height: 12px;
  width: 12px;
  border-radius: 50%;
  display: inline-block;
  border: 3px solid var(--tp-common-white);
}
.cst-hero-slider-wrapper {
  z-index: 0;
  padding: 30px 0;
  position: relative;
  margin-top: -130px;
  border-top: 1px solid rgba(255, 255, 255, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-hero-slider-wrapper {
    margin-top: 0;
  }
}

.cnt-hero-ptb {
  padding-top: 200px;
  padding-bottom: 250px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-hero-ptb {
    padding-top: 150px;
    padding-bottom: 40px;
  }
}
.cnt-hero-shape {
  position: absolute;
  top: 25%;
  right: 25%;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px), only screen and (min-width: 1400px) and (max-width: 1599px) {
  .cnt-hero-shape {
    top: 32%;
    right: 20%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-hero-shape {
    display: none;
  }
}
.cnt-hero-title {
  font-size: 82px;
  font-weight: 500;
  line-height: 1.05;
  margin-left: -4px;
  margin-bottom: 45px;
  text-transform: uppercase;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-hero-title {
    font-size: 70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-hero-title {
    margin-bottom: 20px;
  }
}
@media (max-width: 767px) {
  .cnt-hero-title {
    font-size: 50px;
  }
  .cnt-hero-title br {
    display: none;
  }
}
.cnt-hero-title span {
  display: inline-block;
  transform: translateY(-30px);
}
.cnt-hero-main-thumb img {
  max-width: inherit;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .cnt-hero-main-thumb img {
    transform: translateX(-50px);
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .cnt-hero-main-thumb img {
    transform: translateX(-100px);
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cnt-hero-main-thumb img {
    transform: scale(0.7) translateX(-150px);
  }
}
@media (max-width: 767px) {
  .cnt-hero-main-thumb img {
    max-width: 100%;
  }
}
.cnt-hero-list {
  width: 100%;
  align-items: center;
  display: inline-flex;
  justify-content: space-between;
}
.cnt-hero-list:not(:last-of-type) {
  border-bottom: 1px solid rgba(5, 3, 18, 0.1);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .cnt-hero-list {
    padding-bottom: 10px;
  }
}
.cnt-hero-list-wrap {
  padding: 40px;
  border-radius: 32px;
  background: var(--tp-common-white);
  box-shadow: 0 20px 120px 0 rgba(0, 0, 0, 0.1);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .cnt-hero-list-wrap {
    padding: 30px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cnt-hero-list-wrap {
    margin-top: -140px;
  }
}
.cnt-hero-list-num {
  width: 150px;
  font-size: 52px;
  font-weight: 500;
  margin-right: 40px;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 1701px) and (max-width: 1800px), only screen and (min-width: 1600px) and (max-width: 1700px) {
  .cnt-hero-list-num {
    width: 95px;
    font-size: 40px;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .cnt-hero-list-num {
    width: 70px;
    font-size: 30px;
  }
}
.cnt-hero-list-name {
  font-size: 20px;
  font-weight: 500;
  color: #696871;
  text-transform: uppercase;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .cnt-hero-list-name {
    font-size: 15px;
  }
}
.cnt-hero-list-icon span {
  display: inline-grid;
  width: 50px;
  height: 50px;
  border-radius: 50%;
  place-content: center;
  border: 1px solid rgba(5, 3, 18, 0.1);
}
.cnt-hero-list-left {
  margin-right: 20px;
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-hero-ptb {
    padding-bottom: 45px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-hero-ptb {
    padding-top: 130px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-hero-shapes {
    display: none;
  }
}
.ais-hero-shapes .shape-1 {
  position: absolute;
  top: 0px;
  right: 10%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-hero-shapes .shape-1 {
    right: 0;
    top: -12%;
  }
}
.ais-hero-shapes .shape-2 {
  position: absolute;
  bottom: -20px;
  left: 4%;
}
.ais-hero-shapes .shape-3 {
  position: absolute;
  bottom: 5%;
  right: 12%;
}
.ais-hero-sub {
  font-size: 14px;
  font-weight: 500;
  padding: 2px 23px;
  border-radius: 50px;
  letter-spacing: -0.14px;
  backdrop-filter: blur(20px);
  background: rgba(255, 255, 255, 0.2);
  border: 1px solid rgba(255, 255, 255, 0.32);
}
.ais-hero-title {
  font-size: 54px;
  font-weight: 600;
  line-height: 1.22;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-inter);
}
@media (max-width: 767px) {
  .ais-hero-title {
    font-size: 40px;
  }
}
@media (max-width: 767px) {
  .ais-hero-title span, .ais-hero-title br {
    display: none;
  }
}
.ais-hero-text {
  margin-bottom: 28px;
}
.ais-hero-text p {
  font-size: 16px;
  font-weight: 500;
  color: rgba(0, 0, 0, 0.8);
}
@media (max-width: 767px) {
  .ais-hero-text p br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-hero-thumb-shapes {
    display: none;
  }
}
.ais-hero-thumb-shapes .shape-1 {
  position: absolute;
  top: 18%;
  left: -16%;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .ais-hero-thumb-shapes .shape-1 {
    left: -12%;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-hero-thumb-shapes .shape-1 {
    left: -6%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-hero-thumb-shapes .shape-1 {
    left: 0;
  }
}
.ais-hero-thumb-shapes .shape-2 {
  position: absolute;
  top: 56%;
  left: -8%;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-hero-thumb-shapes .shape-2 {
    left: 0;
  }
}
.ais-hero-thumb-shapes .shape-3 {
  position: absolute;
  top: -5%;
  z-index: 1;
  right: -13%;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .ais-hero-thumb-shapes .shape-3 {
    right: -8%;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-hero-thumb-shapes .shape-3 {
    right: -2%;
  }
}
.ais-hero-thumb-shapes .shape-4 {
  position: absolute;
  top: 6%;
  right: -16%;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .ais-hero-thumb-shapes .shape-4 {
    right: -10%;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-hero-thumb-shapes .shape-4 {
    right: -6%;
  }
}
/*----------------------------------------*/
/*   3.3 common Style
/*----------------------------------------*/
.cst-section-title {
  font-size: 52px;
  font-weight: 600;
  line-height: 1.1;
  color: var(--tp-common-black);
  font-family: var(--tp-ff-phudu);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-section-title {
    font-size: 45px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-section-title br {
    display: none;
  }
}
.cst-section-title.color-white {
  color: var(--tp-common-white);
}
.cst-section-title.fs-62 {
  font-size: 62px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-section-title.fs-62 {
    font-size: 55px;
  }
}
@media (max-width: 767px) {
  .cst-section-title.fs-62 {
    font-size: 45px;
    margin-bottom: 20px;
  }
  .cst-section-title.fs-62 br {
    display: none;
  }
}
.cst-section-title.fs-32 {
  font-size: 32px;
}
.cst-section-subtitle {
  font-size: 13px;
  font-weight: 600;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-black-7);
}
.cst-section-subtitle.color-white {
  color: var(--tp-common-white);
}

.cnt-section-subtitle {
  font-size: 14px;
  font-weight: 500;
  padding: 1px 17px;
  border-radius: 50px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-red-2);
  font-family: var(--tp-ff-inter);
  border: 1px solid rgba(5, 3, 18, 0.1);
}

.ais-section-subtitle {
  font-size: 14px;
  font-weight: 500;
  padding: 2px 18px;
  border-radius: 50px;
  margin-bottom: 15px;
  display: inline-block;
  border: 1px solid rgba(5, 3, 18, 0.1);
  color: rgba(5, 3, 18, 0.7);
}
.ais-section-title {
  font-size: 42px;
  font-weight: 500;
  line-height: 1.24;
  margin-bottom: 20px;
  color: var(--tp-common-black-7);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-section-title {
    font-size: 40px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-section-title {
    font-size: 38px;
  }
}
@media (max-width: 767px) {
  .ais-section-title {
    font-size: 35px;
  }
  .ais-section-title br {
    display: none;
  }
}

.tp-section-title-clash-600.fw-500 {
  font-weight: 500;
  font-family: var(--tp-ff-clash-medium);
}

.cst-btn {
  font-size: 16px;
  font-weight: 600;
  line-height: 1;
  border-radius: 6px;
  display: inline-block;
  padding: 17px 20px 13px;
  letter-spacing: -0.16px;
  backdrop-filter: blur(10px);
  background: var(--tp-common-green-1);
  color: var(--tp-common-black-7);
  font-family: var(--tp-ff-inter);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
@media (max-width: 767px) {
  .cst-btn {
    padding: 16px 16px 13px;
  }
}
.cst-btn:hover span span.text-1 {
  -webkit-transform: translateY(-150%);
  transform: translateY(-150%);
}
.cst-btn:hover span span.text-2 {
  top: 50%;
  -webkit-transform: translateY(-50%);
  transform: translateY(-50%);
}
.cst-btn span {
  position: relative;
  z-index: 1;
  line-height: 1;
  overflow: hidden;
  display: inline-block;
}
.cst-btn span svg {
  margin-left: 4px;
}
.cst-btn span span.text-1 {
  position: relative;
  display: block;
  transition: 0.3s;
}
.cst-btn span span.text-2 {
  position: absolute;
  top: 100%;
  display: block;
  transition: 0.3s;
}
.cst-btn.transparent {
  border-radius: 6px;
  backdrop-filter: blur(10px);
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.06);
  background: rgba(255, 255, 255, 0.06);
}
.cst-btn.black-t {
  background-color: transparent;
  border-color: var(--tp-common-black-7);
}
.cst-btn.black-t:hover {
  border-color: transparent;
  color: var(--tp-common-black-7);
  background-color: var(--tp-common-green-1);
}
.cst-btn.white-t {
  background-color: transparent;
  color: var(--tp-common-white);
  border-color: var(--tp-common-white);
}
.cst-btn.white-t:hover {
  border-color: transparent;
  color: var(--tp-common-black-7);
  background-color: var(--tp-common-green-1);
}

.tp-btn-black-square.cnt-btn-style {
  gap: 8px;
  font-size: 15px;
  font-weight: 500;
  letter-spacing: 0;
  align-items: center;
  display: inline-flex;
  padding: 9px 9px 9px 22px;
  text-transform: uppercase;
  font-family: var(--tp-ff-clash-medium);
}
.tp-btn-black-square.cnt-btn-style:hover i svg:first-child {
  transform: translate(20px, -21px);
}
.tp-btn-black-square.cnt-btn-style:hover i svg:last-child {
  transform: translate(9px, -9px);
}
.tp-btn-black-square.cnt-btn-style i {
  width: 30px;
  height: 30px;
  text-align: center;
  margin-left: 0px;
  border-radius: 4px;
  display: inline-grid;
  place-content: center;
  background-color: var(--tp-common-red-2);
}
.tp-btn-black-square.cnt-btn-style i svg {
  left: 9px;
  bottom: 6px;
}
.tp-btn-black-square.cnt-btn-style i svg:last-child {
  left: 0;
  bottom: 0;
  color: var(--tp-common-white);
}
.tp-btn-black-square.cnt-btn-style.style-2 {
  padding: 9px 22px 9px 9px;
}
.tp-btn-black-square.cnt-btn-style.btn-transparent {
  background-color: transparent;
  color: var(--tp-common-red-2);
  border: 1px solid var(--tp-common-red-2);
}
.tp-btn-black-square.cnt-btn-style.btn-transparent i svg {
  color: var(--tp-common-white);
}

.tp-btn-black-radius.btn-style-ai:hover i svg:first-child {
  transform: translateX(16px);
}
.tp-btn-black-radius.btn-style-ai:hover i svg:last-child {
  transform: translateX(13px);
}
.tp-btn-black-radius.btn-style-ai i svg {
  transform: none;
}
.tp-btn-black-radius.btn-style-ai i svg:last-child {
  bottom: 0;
}
.tp-btn-black-radius.btn-style-ai.btn-blue-bg i {
  height: 38px;
  width: 38px;
  line-height: 38px;
}

.cnt-bg-clip {
  clip-path: polygon(94.36% 0px, 100% 4%, 100% 100%, 0px 100%, 0% 50%, 0px 0px);
}

p.color-g {
  color: #61616A;
}

@-webkit-keyframes shake {
  0%, 50%, 100% {
    transform: rotate(0);
  }
  5%, 10%, 15%, 20%, 25%, 30%, 35%, 40% {
    transform: rotate(6deg);
  }
  45% {
    transform: rotate(4deg);
  }
  7.5%, 12.5%, 17.5%, 22.5%, 27.5%, 32.5%, 37.5%, 42.5% {
    transform: rotate(-6deg);
  }
  47.5% {
    transform: rotate(-2deg);
  }
}
@keyframes shake {
  0%, 50%, 100% {
    transform: rotate(0);
  }
  5%, 10%, 15%, 20%, 25%, 30%, 35%, 40% {
    transform: rotate(6deg);
  }
  45% {
    transform: rotate(4deg);
  }
  7.5%, 12.5%, 17.5%, 22.5%, 27.5%, 32.5%, 37.5%, 42.5% {
    transform: rotate(-6deg);
  }
  47.5% {
    transform: rotate(-2deg);
  }
}
@keyframes marquee-horizontal-rtl {
  from {
    transform: translateX(-100%);
  }
  to {
    transform: translateX(0);
  }
}
/*----------------------------------------*/
/*   3.2 About Style
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-about-ptb {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.cst-about-shape {
  position: absolute;
  top: 50%;
  left: -5%;
  transform: translateY(-50%);
}
@media only screen and (min-width: 1701px) and (max-width: 1800px) {
  .cst-about-shape {
    left: -10%;
  }
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .cst-about-shape {
    left: -12%;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .cst-about-shape {
    left: -18%;
  }
}
.cst-about-shape img {
  mix-blend-mode: soft-light;
}
@media (max-width: 767px) {
  .cst-about-heading .cst-section-title img {
    display: none;
  }
}
.cst-about-list ul li {
  gap: 15px;
  display: flex;
  list-style: none;
  margin-bottom: 20px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-about-list ul li {
    margin-bottom: 12px;
  }
}
.cst-about-list ul li span {
  display: grid;
  width: 32px;
  height: 32px;
  border-radius: 50%;
  place-content: center;
  background-color: var(--tp-common-green-1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-about-text p {
    margin-bottom: 20px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-about-text p br {
    display: none;
  }
}
.cst-about-text p span {
  color: var(--tp-common-black-7);
}
.cst-about-thumb img {
  border-radius: 8px;
}
.cst-about-right {
  margin-left: -120px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-about-right {
    margin-left: 0;
  }
}

.cst-border-b {
  border-bottom: 1px solid #E8E8E8;
}

.cnt-about-style {
  position: relative;
}
@media (max-width: 767px) {
  .cnt-about-style {
    padding-top: 0;
  }
}
.cnt-about-style .ar-about-top-img img {
  border-radius: 16px;
}
.cnt-about-style .ar-about-thumb {
  border-radius: 16px;
}
.cnt-about-style .ar-about-thumb img {
  margin-top: -10px;
}
.cnt-about-style .ar-about-shape {
  bottom: 140px;
  left: 60px;
  z-index: -1;
}

/*----------------------------------------*/
/*   3.2 Feature Style
/*----------------------------------------*/
@media (max-width: 767px) {
  .cst-feature-ptb {
    padding-bottom: 80px;
  }
}
.cst-feature-top {
  padding-top: 80px;
  border-top: 1px solid rgba(5, 3, 18, 0.06);
}
.cst-feature-item {
  gap: 24px;
  display: flex;
  align-items: center;
}
.cst-feature-item-icon span {
  display: inline-grid;
  place-content: center;
  width: 80px;
  height: 80px;
  border-radius: 50%;
  text-align: center;
  background-color: var(--tp-common-white);
}
.cst-feature-item-title {
  font-size: 24px;
  font-weight: 600;
  margin-bottom: 10px;
  text-transform: uppercase;
  color: var(--tp-common-black-7);
  font-family: var(--tp-ff-phudu);
}
.cst-feature-item-content p {
  font-size: 15px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-feature-item-content p br {
    display: none;
  }
}
.cst-feature-text {
  font-size: 16px;
  font-weight: 500;
  color: #61616A;
  line-height: 1.5;
  font-family: var(--tp-ff-inter);
}
.cst-feature-text span {
  font-size: 13px;
  font-weight: 600;
  padding: 7px 16px;
  margin-right: 5px;
  border-radius: 30px;
  text-transform: uppercase;
  color: var(--tp-common-black-7);
  background-color: var(--tp-common-green-1);
  box-shadow: 0 20px 40px 0 rgba(180, 231, 23, 0.1);
}
.cst-feature-text a {
  position: relative;
  color: var(--tp-common-black-7);
}
.cst-feature-text a::before {
  position: absolute;
  content: "";
  height: 1px;
  width: 100%;
  bottom: -3px;
  left: 0;
  background-color: var(--tp-common-black-7);
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-plan-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media (max-width: 767px) {
  .cnt-plan-ptb {
    padding-top: 80px;
    padding-bottom: 80px;
  }
}
.cnt-plan-box {
  padding-top: 24px;
  border-top: 1px solid rgba(20, 20, 20, 0.1);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-plan-box {
    padding-top: 0;
    border: none;
    padding-bottom: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-plan-heading {
    margin-bottom: 30px;
  }
}
.cnt-plan-item-title {
  position: relative;
  font-size: 24px;
  font-weight: 500;
  color: var(--tp-common-black-7);
  font-family: var(--tp-ff-clash-medium);
}
.cnt-plan-item-title::before {
  width: 12px;
  height: 12px;
  content: "";
  top: -30px;
  left: 50%;
  position: absolute;
  border-radius: 50%;
  display: inline-block;
  transform: translateX(-50%);
  background-color: var(--tp-common-black-7);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-plan-item-title::before {
    display: none;
  }
}
.cnt-plan-item p {
  color: rgba(5, 3, 18, 0.6);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-plan-item p br {
    display: none;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-feature-ptb {
    padding-bottom: 80px;
  }
}
.ais-feature-shape {
  top: 20%;
  right: 12%;
  position: absolute;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-feature-shape {
    right: 5%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-feature-shape {
    display: none;
  }
}
.ais-feature-item.app-feature-item .app-feature-title {
  font-weight: 500;
  font-family: var(--tp-ff-inter);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), (max-width: 767px) {
  .ais-feature-item.app-feature-item .app-feature-title {
    font-size: 20px;
  }
}
.ais-feature-item-btn a {
  font-size: 14px;
  font-weight: 500;
  display: inline-block;
  color: var(--tp-common-black-7);
}
.ais-feature-item-btn a span {
  margin-left: 4px;
  display: inline-block;
  transform: translateY(0px);
}

.app-feature-bottom p span.bg-blue {
  color: var(--tp-common-white);
  border-color: var(--tp-common-blue);
  background-color: var(--tp-common-blue);
}

/*----------------------------------------*/
/*   3.2 Video Style
/*----------------------------------------*/
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-video-ptb {
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-video-ptb {
    padding-bottom: 80px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-video-thumb img {
    border-radius: 400px;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-list-ptb {
    padding-top: 100px;
    padding-bottom: 60px;
  }
}
.ais-list-thumb {
  position: relative;
  overflow: hidden;
}
.ais-list-thumb img {
  width: 100%;
  display: block;
  overflow: hidden;
  object-fit: cover;
  border-radius: 16px;
}
.ais-list-thumb canvas {
  border-radius: 16px;
}
.ais-list-thumb-shape {
  position: absolute;
  bottom: 5%;
  left: 5%;
}
.ais-list-thumb-wrapper {
  margin-right: 80px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-list-thumb-wrapper {
    margin-right: 0;
  }
}
.ais-list-wrap ul {
  display: block;
}
.ais-list-wrap ul li {
  font-size: 18px;
  font-weight: 500;
  list-style: none;
  float: left;
  width: 50%;
  margin-bottom: 26px;
  color: var(--tp-common-black-7);
}
@media (max-width: 767px) {
  .ais-list-wrap ul li {
    width: 100%;
    margin-bottom: 20px;
  }
}

/*----------------------------------------*/
/*   3.2 Service Style
/*----------------------------------------*/
@media (max-width: 767px) {
  .cst-service-ptb {
    padding-bottom: 100px;
  }
}
.cst-service-item {
  border-radius: 32px;
  padding: 30px 16px 16px;
}
.cst-service-item:hover .cst-service-item-thumb img {
  transform: scale(1.2);
}
.cst-service-item-icon span {
  width: 80px;
  height: 80px;
  border-radius: 50%;
  text-align: center;
  display: inline-grid;
  place-content: center;
  background-color: rgba(5, 3, 18, 0.1);
}
.cst-service-item-title {
  font-size: 24px;
  font-weight: 600;
  margin-bottom: 14px;
  text-transform: uppercase;
  color: var(--tp-common-black-7);
  font-family: var(--tp-ff-phudu);
}
.cst-service-item-content {
  padding: 0 20px 40px;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-service-item-content {
    padding: 0 20px 20px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-service-item-content p br {
    display: none;
  }
}
.cst-service-item-thumb {
  overflow: hidden;
  border-radius: 16px;
}
.cst-service-item-thumb img {
  border-radius: 16px;
  transition: all 0.5s ease-in-out;
}

.cnt-service-mlr {
  overflow: hidden;
  margin-left: 60px;
  margin-right: 60px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cnt-service-mlr {
    margin-left: 35px;
    margin-right: 35px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-service-mlr {
    margin-left: 30px;
    margin-right: 30px;
  }
}
@media (max-width: 767px) {
  .cnt-service-mlr {
    margin-left: 20px;
    margin-right: 20px;
  }
}
.cnt-service-mlr .ar-service-height {
  border-radius: 20px;
}
.cnt-service-mlr .ar-service-title-box {
  left: 5%;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cnt-service-mlr .ar-service-title-box {
    margin: 90px 60px 60px 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-service-mlr .ar-service-title-box {
    margin: 40px;
    left: 0;
  }
}
@media (max-width: 767px) {
  .cnt-service-mlr .ar-service-title-box {
    left: 0;
    margin: 20px;
  }
}

@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-exp-ptb {
    padding-bottom: 60px;
  }
}
.ais-exp-bg::after {
  position: absolute;
  content: "";
  top: -10%;
  left: 42%;
  width: 400px;
  height: 400px;
  transform: translateX(-50%);
  border-radius: 384px;
  background: rgba(146, 232, 237, 0.5882352941);
  filter: blur(250px);
}
.ais-exp-shape-3 {
  position: absolute;
  right: -24%;
  top: -27%;
  animation: shake 2.5s ease infinite;
  -webkit-animation: shake 2.5s ease infinite;
}
@media only screen and (min-width: 1600px) and (max-width: 1700px) {
  .ais-exp-shape-3 {
    top: -34%;
    right: -8%;
  }
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .ais-exp-shape-3 {
    top: -35%;
    right: -5%;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-exp-shape-3 {
    right: -4%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-exp-shape-3 {
    right: -2%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-exp-shape-3 {
    display: none;
  }
}
.ais-exp-heading p {
  color: #61616A;
  font-weight: 500;
  margin-bottom: 40px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-exp-heading p {
    margin-bottom: 20px;
  }
}
.ais-exp-heading p span {
  color: var(--tp-common-black-7);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-exp-heading p br {
    display: none;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-exp-thumb-shapes {
    display: none;
  }
}
.ais-exp-thumb-shapes .shape-1 {
  top: 8%;
  left: -13%;
  position: absolute;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-exp-thumb-shapes .shape-1 {
    left: -4%;
  }
}
.ais-exp-thumb-shapes .shape-2 {
  right: 5%;
  bottom: 4%;
  position: absolute;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-exp-thumb-wrapper img {
    width: 100%;
  }
}

.ais-service-bdr {
  border-top: 1px solid rgba(5, 3, 18, 0.1);
  border-bottom: 1px solid rgba(5, 3, 18, 0.1);
}
.ais-service-shape {
  position: absolute;
  left: -5%;
  bottom: 6%;
  z-index: 1;
}
@media (max-width: 767px) {
  .ais-service-shape {
    display: none;
  }
}
.ais-service-wrapper {
  border-radius: 26px;
  padding: 50px 50px 50px 80px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .ais-service-wrapper {
    padding: 50px 50px 50px 50px;
  }
}
@media (max-width: 767px) {
  .ais-service-wrapper {
    padding: 40px;
  }
}

/*----------------------------------------*/
/*   3.2 Portfolio Style
/*----------------------------------------*/
.cst-portfolio-ptb {
  padding-bottom: 200px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-portfolio-ptb {
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-portfolio-ptb {
    padding-bottom: 40px;
  }
}
.cst-portfolio-bg {
  position: relative;
  border-radius: 32px;
  overflow: hidden;
}
.cst-portfolio-bg::after {
  position: absolute;
  content: "";
  right: 0;
  top: 20%;
  width: 435px;
  height: 435px;
  z-index: 0;
  border-radius: 435px;
  filter: blur(100px);
  background: linear-gradient(0deg, rgba(1, 15, 210, 0.32) 0%, rgba(1, 15, 210, 0.32) 100%);
}
.cst-portfolio-bg::before {
  position: absolute;
  top: 0;
  left: 0;
  z-index: 0;
  border-radius: 32px;
  content: url("../img/update/portfolio/portfolio-thumb.png");
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-portfolio-heading .cst-section-title {
    margin-bottom: 25px;
  }
}
.cst-portfolio-item {
  position: relative;
  z-index: 1;
  padding: 40px;
  border-radius: 30px;
  background-color: var(--tp-common-white);
}
@media (max-width: 767px) {
  .cst-portfolio-item {
    padding: 26px;
  }
}
.cst-portfolio-item:hover .cst-portfolio-item-thumb img {
  transform: scale(1.1);
}
.cst-portfolio-item-num {
  font-size: 32px;
  font-weight: 500;
  margin-bottom: 30px;
  display: inline-block;
  font-family: var(--tp-ff-phudu);
  color: var(--tp-common-black-7);
}
@media (max-width: 767px) {
  .cst-portfolio-item-num {
    font-size: 26px;
  }
}
.cst-portfolio-item-thumb {
  overflow: hidden;
  margin-bottom: 20px;
  border-radius: 32px;
}
.cst-portfolio-item-thumb img {
  width: 100%;
  border-radius: 32px;
  transition: all 0.5s ease-in-out;
}
.cst-portfolio-item-title {
  font-size: 42px;
  font-weight: 500;
  margin-bottom: 22px;
  font-family: var(--tp-ff-phudu);
  color: var(--tp-common-black-7);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cst-portfolio-item-title {
    font-size: 34px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-portfolio-item-title {
    font-size: 28px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-portfolio-item-title {
    font-size: 25px;
  }
  .cst-portfolio-item-title br {
    display: none;
  }
}
.cst-portfolio-item-categories span {
  font-size: 12px;
  font-weight: 600;
  padding: 0px 17px;
  margin-bottom: 5px;
  border-radius: 10px;
  display: inline-block;
  text-transform: uppercase;
  font-family: var(--tp-ff-inter);
  color: var(--tp-common-black-7);
  border: 1px solid rgba(5, 3, 18, 0.1);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-portfolio-thumb {
    padding-top: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-portfolio-thumb {
    padding-top: 40px;
  }
}
.cst-portfolio-thumb img {
  border-radius: 24px;
}

@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-portfolio-ptb {
    padding-top: 100px;
  }
}
@media (max-width: 767px) {
  .cnt-portfolio-ptb {
    padding-top: 80px;
    padding-bottom: 60px;
  }
}
.cnt-portfolio-heading p {
  margin-bottom: 34px;
  color: rgba(5, 3, 18, 0.6);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-portfolio-heading p br {
    display: none;
  }
}
.cnt-portfolio-video-wrapper {
  position: relative;
  width: 100%;
  height: 950px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-portfolio-video-wrapper {
    height: auto;
    padding-bottom: 60px;
  }
}
.cnt-portfolio-video-wrapper video {
  width: 100%;
  height: 100%;
  object-fit: cover;
  background-size: cover;
  background-position: center center;
}
.cnt-portfolio-video-card {
  width: 630px;
  margin: 0 auto;
  margin-bottom: 60px;
  padding: 60px 50px;
  border-radius: 16px;
  display: inline-block;
  background-color: #F2F1EE;
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-portfolio-video-card {
    padding: 30px;
  }
}
@media (max-width: 767px) {
  .cnt-portfolio-video-card {
    padding: 20px;
    width: auto;
    margin: 0 20px;
    margin-bottom: 30px;
  }
}
.cnt-portfolio-video-sub {
  font-size: 16px;
  font-weight: 500;
  position: relative;
  margin-bottom: 8px;
  display: inline-block;
  text-transform: uppercase;
  color: var(--tp-common-black-7);
  font-family: var(--tp-ff-clash-medium);
}
.cnt-portfolio-video-sub::before {
  content: "";
  width: 4px;
  height: 4px;
  margin-right: 5px;
  border-radius: 50%;
  display: inline-block;
  transform: translateY(-3px);
  background-color: var(--tp-common-black-7);
}
.cnt-portfolio-video-title {
  font-size: 32px;
  font-weight: 500;
  margin-bottom: 22px;
  color: var(--tp-common-black-7);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-portfolio-video-title {
    font-size: 28px;
  }
}
@media (max-width: 767px) {
  .cnt-portfolio-video-title {
    font-size: 22px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-portfolio-video-title br {
    display: none;
  }
}
.cnt-portfolio-video-thumb {
  width: 100%;
  margin-bottom: 25px;
  border-radius: 16px;
}
.cnt-portfolio-video-thumb img {
  width: 100%;
  border-radius: 16px;
}
.cnt-portfolio-video-text p {
  opacity: 0.6;
  margin-bottom: 0;
  color: var(--tp-common-black-7);
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-portfolio-video-text p br {
    display: none;
  }
}
.cnt-portfolio-banner img {
  margin-top: -150px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-portfolio-banner img {
    margin-top: -100px;
  }
}
@media (max-width: 767px) {
  .cnt-portfolio-banner img {
    margin-top: -20px;
  }
}

/*----------------------------------------*/
/*   3.4 Testimonial Style
/*----------------------------------------*/
@media (max-width: 767px) {
  .cst-testimonial-heading {
    margin-bottom: 25px;
  }
}
.cst-testimonial-heading .cst-section-title {
  font-size: 132px;
  line-height: 1;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cst-testimonial-heading .cst-section-title {
    font-size: 110px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-testimonial-heading .cst-section-title {
    font-size: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-testimonial-heading .cst-section-title {
    font-size: 80px;
  }
}
@media (max-width: 767px) {
  .cst-testimonial-heading .cst-section-title {
    font-size: 55px;
  }
}
.cst-testimonial-item {
  position: relative;
  padding: 45px;
  opacity: 0.97;
  display: flex;
  min-height: 495px;
  border-radius: 16px;
  flex-direction: column;
  backdrop-filter: blur(5px);
  justify-content: space-between;
  border: 1px solid rgba(16, 48, 42, 0.08);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-testimonial-item {
    padding: 35px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-testimonial-item {
    min-height: 450px;
  }
}
.cst-testimonial-item:hover .cst-testimonial-item-shape {
  opacity: 1;
  right: 20px;
}
.cst-testimonial-item-icon {
  margin-bottom: 30px;
}
.cst-testimonial-item-icon span {
  display: inline-grid;
  place-content: center;
  width: 40px;
  height: 40px;
  border-radius: 50%;
  background-color: #050312;
}
.cst-testimonial-item-text {
  margin-bottom: 70px;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-testimonial-item-text {
    margin-bottom: 30px;
  }
}
.cst-testimonial-item-text p {
  font-size: 22px;
  font-weight: 500;
  letter-spacing: -0.88px;
}
.cst-testimonial-item-user {
  gap: 16px;
  display: flex;
  align-items: center;
}
.cst-testimonial-item-user-thumb img {
  border-radius: 50%;
}
.cst-testimonial-item-user-content h4 {
  font-weight: 600;
  margin-bottom: 2px;
  color: var(--tp-common-black-7);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-testimonial-item-user-content h4 {
    font-size: 20px;
  }
}
.cst-testimonial-item-user-content span {
  font-size: 16px;
  color: rgba(5, 3, 18, 0.8);
}
.cst-testimonial-item-shape {
  position: absolute;
  top: 20px;
  right: 30px;
  opacity: 0;
  transition: all 0.5s ease-in-out;
}
.cst-testimonial-slider-wrapper {
  margin-top: -110px;
  margin-right: -300px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-testimonial-slider-wrapper {
    margin-top: -70px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-testimonial-slider-wrapper {
    margin-top: 0;
  }
}
@media (max-width: 767px) {
  .cst-testimonial-slider-wrapper {
    margin-right: 0;
  }
}
.cst-testimonial-slider-wrapper .dgm-testimonial-dot {
  padding-left: 39%;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cst-testimonial-slider-wrapper .dgm-testimonial-dot {
    padding-left: 37%;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-testimonial-slider-wrapper .dgm-testimonial-dot {
    padding-left: 35%;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .cst-testimonial-slider-wrapper .dgm-testimonial-dot {
    padding-left: 30%;
  }
}
.cst-testimonial-slider-wrapper .dgm-testimonial-dot .swiper-pagination-bullet {
  border-color: #E1E5E4;
  background-color: #E1E5E4;
}
.cst-testimonial-slider-wrapper .dgm-testimonial-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {
  border-color: #050312;
  background-color: #050312;
}

.ais-testimonial-ptb {
  margin: 0 30px;
  overflow: hidden;
  border-radius: 30px;
}
@media (max-width: 767px) {
  .ais-testimonial-ptb {
    margin: 0;
  }
}
@media only screen and (min-width: 576px) and (max-width: 767px) {
  .ais-testimonial-ptb {
    margin: 0 20px;
  }
}
.ais-testimonial-wrap::before {
  position: absolute;
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 400px;
  z-index: 1;
  background: linear-gradient(91deg, #F8E9D9 10.9%, rgba(255, 255, 255, 0) 88.65%);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-testimonial-wrap::before {
    width: 200px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-testimonial-wrap::before {
    width: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-testimonial-wrap::before {
    display: none;
  }
}
.ais-testimonial-wrap::after {
  position: absolute;
  content: "";
  top: 0;
  right: 0;
  height: 100%;
  width: 400px;
  z-index: 1;
  background: linear-gradient(-91deg, #F8E9D9 10.9%, rgba(255, 255, 255, 0) 88.65%);
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px) {
  .ais-testimonial-wrap::after {
    width: 200px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-testimonial-wrap::after {
    width: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-testimonial-wrap::after {
    display: none;
  }
}

.app-testimonial-wrapper.ais-rtl {
  animation: marquee-horizontal-rtl 30s linear infinite;
}

/*----------------------------------------*/
/*   3.4 Faq Style
/*----------------------------------------*/
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-faq-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-faq-heading .cst-section-title {
    margin-bottom: 25px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-faq-wrap {
    padding-left: 0;
  }
}
.cst-faq-wrap .ai-faq-accordion-wrap {
  border-top: 1px solid rgba(0, 0, 0, 0.1);
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.cst-faq-wrap .ai-faq-accordion-wrap .accordion-items {
  padding-left: 0;
}
.cst-faq-wrap .ai-faq-accordion-wrap .accordion-header .accordion-buttons .accordion-icon {
  left: auto;
  right: 0;
}
.cst-faq-wrap .ai-faq-accordion-wrap .accordion-body {
  padding-right: 30px;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-faq-ptb {
    padding-top: 100px;
    padding-bottom: 100px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cnt-faq-wrap .ar-award-year {
    min-width: 85px;
  }
}
@media (max-width: 767px) {
  .cnt-faq-wrap .ar-award-year {
    margin-bottom: 10px;
  }
}
.cnt-faq-heading .tp-section-title-clash-600.fs-60 {
  font-size: 56px;
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-faq-heading .tp-section-title-clash-600.fs-60 {
    font-size: 40px;
    padding-bottom: 20px;
  }
  .cnt-faq-heading .tp-section-title-clash-600.fs-60 br {
    display: none;
  }
}

/*----------------------------------------*/
/*   3.4 Cta Style
/*----------------------------------------*/
.cst-cta-wrapper {
  position: relative;
  border-radius: 32px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .cst-cta-wrapper {
    height: calc(100% + 100px);
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cst-cta-wrapper {
    height: calc(100% + 200px);
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-cta-wrapper {
    height: calc(100% + 300px);
  }
}
.cst-cta-thumb {
  position: relative;
  border-radius: 32px;
  overflow: hidden;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-cta-thumb {
    height: 100%;
  }
}
.cst-cta-thumb::before {
  position: absolute;
  content: "";
  right: 0;
  top: 0%;
  width: 1000px;
  height: 1000px;
  z-index: 0;
  border-radius: 435px;
  filter: blur(115px);
  background: rgba(1, 15, 212, 0.32);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-cta-thumb::before {
    display: none;
  }
}
.cst-cta-thumb::after {
  position: absolute;
  content: "";
  left: -5%;
  top: -10%;
  width: 500px;
  height: 500px;
  z-index: 0;
  border-radius: 435px;
  filter: blur(115px);
  background: rgba(1, 15, 212, 0.5);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-cta-thumb::after {
    display: none;
  }
}
.cst-cta-thumb img {
  object-fit: cover;
  border-radius: 32px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px), only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-cta-thumb img {
    height: 100%;
  }
}
.cst-cta-content {
  top: 40px;
  left: 60px;
  z-index: 1;
  width: 595px;
  position: absolute;
  border-radius: 24px;
  background: #F6F5F2;
  padding: 45px 50px 30px;
  backdrop-filter: blur(16px);
  border: 1px solid rgba(5, 3, 18, 0.1);
  box-shadow: 5px 6px 99px 5px rgba(16, 48, 42, 0.3);
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-cta-content {
    position: inherit;
    left: 0;
    width: 100%;
  }
}
@media (max-width: 767px) {
  .cst-cta-content {
    padding: 40px 30px 30px;
  }
}
.cst-cta-content-text {
  font-size: 16px;
  color: #66666C;
  margin-bottom: 30px;
}
@media (max-width: 767px) {
  .cst-cta-content .cst-section-title {
    font-size: 35px;
  }
}
.cst-cta-input-box .tp-contact-form-input label {
  font-size: 13px;
  font-weight: 400;
}
.cst-cta-input-box .tp-contact-form-input input {
  height: 50px;
}
.cst-cta-input-box .tp-contact-form-input textarea {
  height: 125px;
}
.cst-cta-input-box .tp-contact-form-input input, .cst-cta-input-box .tp-contact-form-input textarea {
  border-radius: 6px;
  background: var(--tp-common-white);
  border-color: rgba(5, 3, 18, 0.1);
}
.cst-cta-input-box .tp-contact-form-input input:focus, .cst-cta-input-box .tp-contact-form-input textarea:focus {
  border-color: var(--tp-common-green-1);
}
.cst-cta-input-box .tp-contact-form-input input::placeholder, .cst-cta-input-box .tp-contact-form-input textarea::placeholder {
  color: #66666C;
}
.cst-cta-input-box .tp-contact-form-btn button {
  padding: 15px 35px;
  color: var(--tp-common-black);
  background-color: var(--tp-common-green-1);
}
@media (max-width: 767px) {
  .cst-cta-input-box .tp-contact-form-btn button {
    padding: 15px 30px;
  }
}

.ais-cta-wrapper {
  overflow: hidden;
  border-radius: 26px;
  border: 1px solid rgba(5, 3, 18, 0.1);
}
.ais-cta-wrapper::after {
  position: absolute;
  content: "";
  top: -24%;
  right: -15%;
  width: 634px;
  height: 634px;
  border-radius: 634px;
  background: #E2F8C8;
  filter: blur(250px);
}
@media only screen and (min-width: 768px) and (max-width: 991px) {
  .ais-cta-wrap {
    padding: 0 40px;
  }
}
@media (max-width: 767px) {
  .ais-cta-wrap {
    padding: 0 25px;
  }
}
.ais-cta-wrap p {
  color: #61616A;
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-cta-wrap p {
    margin-bottom: 20px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-cta-shapes {
    display: none;
  }
}
.ais-cta-shapes .shape-1 {
  position: absolute;
  top: 18%;
  left: 20%;
}
.ais-cta-shapes .shape-2 {
  position: absolute;
  bottom: 0;
  left: 9%;
}
.ais-cta-shapes .shape-3 {
  position: absolute;
  top: 20%;
  right: 28%;
  z-index: 1;
}
.ais-cta-shapes .shape-4 {
  position: absolute;
  top: 34%;
  right: 16%;
  z-index: 1;
}
@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-cta-shapes .shape-4 {
    right: 6%;
  }
}
.ais-cta-shapes .shape-5 {
  position: absolute;
  right: 10%;
  bottom: 12%;
  z-index: 1;
}

/*----------------------------------------*/
/*   3.3 Brand Style
/*----------------------------------------*/
.cnt-brand-style.ar-brand-style .tp-brand-title {
  font-size: 18px;
  font-family: var(--tp-ff-inter);
}
.cnt-brand-style.ar-brand-style .tp-brand-title::after {
  width: 12px;
  height: 12px;
  transform: translateY(-1px);
  background-color: transparent;
  border: 3px solid var(--tp-common-white);
}

.ais-brand-blur {
  padding: 30px 0;
  position: relative;
}
.ais-brand-blur::after {
  position: absolute;
  content: "";
  right: 0;
  top: 0;
  height: 100%;
  width: 230px;
  z-index: 1;
  background: linear-gradient(-270deg, rgba(253, 252, 254, 0) 3.5%, #FDFCFE 100%);
}
.ais-brand-blur::before {
  position: absolute;
  content: "";
  left: 0;
  top: 0;
  height: 100%;
  width: 230px;
  z-index: 2;
  background: linear-gradient(270deg, rgba(253, 252, 254, 0) 3.5%, #FDFCFE 100%);
}

/*----------------------------------------*/
/*   3.3 Team Style
/*----------------------------------------*/
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px) {
  .cst-team-ptb {
    padding-top: 120px;
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-team-ptb {
    padding-top: 100px;
    padding-bottom: 40px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-team-heading {
    margin-bottom: 30px;
  }
}
.cst-team-box .dgm-team-thumb img {
  border-radius: 16px;
}
.cst-team-box .dgm-team-thumb .tp--hover-img canvas {
  border-radius: 16px;
}

@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-team-ptb {
    padding-top: 100px;
    padding-bottom: 80px;
  }
}
@media (max-width: 767px) {
  .cnt-team-ptb {
    padding-top: 80px;
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cnt-team-heading {
    margin-bottom: 30px;
  }
}
.cnt-team-item:hover .cnt-team-item-thumb img {
  transform: scale(1.1);
}
.cnt-team-item-thumb {
  overflow: hidden;
  border-radius: 16px;
}
.cnt-team-item-thumb img {
  width: 100%;
  border-radius: 16px;
  transition: all 0.5s ease-in-out;
}
.cnt-team-item-title {
  font-weight: 500;
  margin-bottom: 2px;
  font-family: var(--tp-ff-clash-medium);
}
.cnt-team-item-title:hover a {
  color: var(--tp-common-red-2);
}
.cnt-team-item-content p {
  color: rgba(5, 3, 18, 0.6);
}
.cnt-team-item-social a {
  font-size: 14px;
  font-weight: 500;
  text-transform: uppercase;
}
.cnt-team-item-social a:hover span {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-2);
}
.cnt-team-item-social a span {
  border-radius: 30px;
  display: inline-block;
  -webkit-transition: all 0.3s ease-in-out;
  -moz-transition: all 0.3s ease-in-out;
  -ms-transition: all 0.3s ease-in-out;
  -o-transition: all 0.3s ease-in-out;
  transition: all 0.3s ease-in-out;
  border: 1px solid rgba(20, 20, 20, 0.1);
}
.cnt-team-item-social a .bdr-1 {
  width: 30px;
  height: 30px;
  margin-right: -5px;
  text-align: center;
  display: inline-grid;
  place-content: center;
}
.cnt-team-item-social a .bdr-2 {
  padding: 1px 14px;
}

/*----------------------------------------*/
/*   3.4 blog Style
/*----------------------------------------*/
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px) {
  .cnt-blog-ptb {
    padding-top: 100px;
  }
}
@media (max-width: 767px) {
  .cnt-blog-ptb {
    padding-top: 80px;
  }
}
.cnt-blog-item-content {
  position: absolute;
  top: 60px;
  left: 60px;
}
@media (max-width: 767px) {
  .cnt-blog-item-content {
    left: 40px;
    top: 40px;
  }
}
.cnt-blog-item-sub {
  font-size: 16px;
  font-weight: 500;
  margin-bottom: 15px;
  display: inline-block;
  letter-spacing: 0.15px;
  text-transform: uppercase;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-medium);
}
.cnt-blog-item-title {
  font-size: 60px;
  font-weight: 500;
  line-height: 1;
  margin-bottom: 30px;
  letter-spacing: 0.6px;
  color: var(--tp-common-white);
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cnt-blog-item-title {
    font-size: 45px;
  }
}
@media (max-width: 767px) {
  .cnt-blog-item-title {
    font-size: 40px;
  }
}
.cnt-blog-item-thumb {
  position: relative;
}
.cnt-blog-item-thumb::before {
  content: "";
  top: 0;
  left: 0;
  height: 100%;
  width: 100%;
  border-radius: 16px;
  position: absolute;
  background-color: rgba(5, 3, 18, 0.32);
}
.cnt-blog-item-thumb img {
  width: 100%;
  border-radius: 16px;
}
.cnt-blog-item-btn .tp-btn-black-square.cnt-btn-style.btn-transparent {
  color: var(--tp-common-white);
  border-color: var(--tp-common-white);
}
.cnt-blog-item-box {
  padding: 25px 30px;
  border-radius: 16px;
  background-color: var(--tp-common-white);
}
.cnt-blog-item-2 {
  gap: 50px;
  display: flex;
  align-items: start;
}
@media only screen and (min-width: 1200px) and (max-width: 1399px) {
  .cnt-blog-item-2 {
    gap: 15px;
  }
}
@media (max-width: 767px) {
  .cnt-blog-item-2 {
    flex-wrap: wrap;
    gap: 20px;
  }
}
.cnt-blog-item-2:hover .cnt-blog-item-2-thumb img {
  transform: scale(1.1);
}
.cnt-blog-item-2.bbr {
  padding-bottom: 30px;
  border-bottom: 1px solid rgba(5, 3, 18, 0.1);
}
.cnt-blog-item-2-user {
  gap: 15px;
  flex: 0 0 auto;
  align-items: center;
}
.cnt-blog-item-2-user-title {
  font-size: 14px;
  font-weight: 600;
  margin-bottom: 2px;
  letter-spacing: -0.28px;
}
.cnt-blog-item-2-user-content p {
  margin: 0;
  font-size: 14px;
}
.cnt-blog-item-2-thumb {
  overflow: hidden;
  border-radius: 8px;
  margin-bottom: 20px;
}
.cnt-blog-item-2-thumb img {
  width: 100%;
  border-radius: 8px;
  transition: all 0.5s ease-in-out;
}
.cnt-blog-item-2-title {
  font-weight: 500;
  margin-bottom: 12px;
  font-family: var(--tp-ff-clash-medium);
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), (max-width: 767px) {
  .cnt-blog-item-2-title br {
    display: none;
  }
}
.cnt-blog-item-2-title a:hover {
  color: var(--tp-common-red-2);
}
.cnt-blog-item-2-content {
  width: 100%;
}
.cnt-blog-item-2-content p {
  margin: 0;
  font-size: 12px;
  font-weight: 500;
  text-transform: uppercase;
  color: rgba(5, 3, 18, 0.8);
}

@media only screen and (min-width: 992px) and (max-width: 1199px) {
  .ais-blog-ptb {
    padding-top: 100px;
    padding-bottom: 60px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .ais-blog-ptb {
    padding-top: 80px;
    padding-bottom: 40px;
  }
}
.ais-blog-item-wrapper .creative-blog-title-sm {
  font-size: 24px;
  font-weight: 500;
  color: #050312;
}

/*----------------------------------------*/
/*   3.4 Footer Style
/*----------------------------------------*/
.cst-footer-ptb {
  margin-top: -190px;
  padding-top: 280px;
}
@media only screen and (min-width: 1400px) and (max-width: 1599px) {
  .cst-footer-ptb {
    margin-top: -100px;
  }
}
@media only screen and (min-width: 1200px) and (max-width: 1399px), only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-footer-ptb {
    margin-top: 0px;
  }
}
@media only screen and (min-width: 992px) and (max-width: 1199px), only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-footer-ptb {
    margin-top: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-footer-ptb {
    padding-top: 100px;
  }
}
@media only screen and (min-width: 768px) and (max-width: 991px), (max-width: 767px) {
  .cst-footer-wrap {
    padding-bottom: 0;
  }
}
.cst-footer-style .dgm-footer-widget-paragraph p {
  color: #CED4E9;
}
.cst-footer-style .dgm-footer-widget-paragraph.color-style p {
  color: #CED4E9;
}
.cst-footer-style .dgm-footer-widget-title {
  color: var(--tp-common-white);
}
.cst-footer-style .dgm-footer-widget-menu ul li a {
  color: #CED4E9;
}
.cst-footer-style .dgm-footer-widget-menu ul li a:hover {
  color: var(--tp-common-white);
}
.cst-footer-style .dgm-footer-widget-input input {
  color: var(--tp-common-white);
  background-color: transparent;
  border-color: rgba(255, 255, 255, 0.1);
}
.cst-footer-style .dgm-footer-widget-input input:focus {
  border-color: var(--tp-common-white);
}
.cst-footer-style .dgm-footer-widget-input .input-button .tp-btn-gradient.sm {
  color: var(--tp-common-black-7);
  background: var(--tp-common-green-1);
}
.cst-footer-style .app-footer-rating {
  border-radius: 12px;
  border: 1px solid rgba(255, 255, 255, 0.1);
  background: rgba(255, 255, 255, 0.03);
}
.cst-footer-style .app-footer-rating span, .cst-footer-style .app-footer-rating a {
  color: var(--tp-common-white);
}
.cst-footer-style .app-footer-widget-info-title {
  color: #CED4E9;
}
.cst-footer-style .app-footer-widget-info a {
  color: var(--tp-common-white);
}
.cst-footer-style .app-copyright-text p {
  color: #CED4E9;
}
.cst-footer-style .app-copyright-text p a:hover {
  border-color: var(--tp-common-white);
}

@media (max-width: 767px) {
  .ais-footer-style .crp-footer-widget {
    margin-bottom: 40px;
  }
}
.ais-footer-style .crp-footer-widget p {
  color: #61616A;
}
.ais-footer-style .crp-footer-widget-title {
  font-size: 26px;
  font-weight: 500;
  color: var(--tp-common-black-7);
  font-family: var(--tp-ff-inter);
}
.ais-footer-style .crp-footer-widget-menu ul li a {
  color: #61616A;
}
.ais-footer-style .crp-footer-widget-info a {
  color: #61616A;
}
.ais-footer-style .crp-footer-widget-info a.tel {
  color: var(--tp-common-black-7);
}
.ais-footer-style .crp-footer-social a {
  color: var(--tp-common-black-7);
  border: 1px solid rgba(116, 99, 255, 0.1);
}
.ais-footer-style .crp-footer-social a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-blue);
}
.ais-footer-copyright {
  border-top: 1px solid rgba(5, 3, 18, 0.1);
}
.ais-footer-copyright p {
  color: #61616A;
}
.ais-footer-copyright p a span {
  color: var(--tp-common-black-7);
}

/*----------------------------------------*/
/*   3.5 Dark Style
/*----------------------------------------*/
.agntix-dark .cst-section-title {
  color: var(--tp-common-white);
}
.agntix-dark .cst-about-text p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cst-about-text p span {
  color: var(--tp-common-white);
}
.agntix-dark .cst-about-list ul li {
  color: var(--tp-common-white);
}
.agntix-dark .cst-btn.black-t {
  color: var(--tp-common-white);
  border-color: var(--tp-common-white);
}
.agntix-dark .cst-btn.black-t:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-green-1);
}
.agntix-dark .cst-feature-top {
  border-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .cst-feature-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .cst-feature-item-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cst-feature-text {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cst-feature-text a {
  color: var(--tp-common-white);
}
.agntix-dark .cst-feature-text a::before {
  background-color: var(--tp-common-white);
}
.agntix-dark .cst-section-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .cst-border-b {
  border-color: #1F1E24;
}
.agntix-dark .cst-testimonial-item-text p {
  color: var(--tp-common-white);
}
.agntix-dark .cst-testimonial-item-icon span {
  filter: invert(1);
}
.agntix-dark .cst-testimonial-item-user-content h4 {
  color: var(--tp-common-white);
}
.agntix-dark .cst-testimonial-item-user-content span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cst-testimonial-slider-wrapper .dgm-testimonial-dot .swiper-pagination-bullet {
  background-color: #0E0F11;
}
.agntix-dark .cst-cta-content {
  background-color: #1A1B1E;
}
.agntix-dark .tp-header-cnt-left {
  background-color: #1b1b1d;
}
.agntix-dark .tp-header-cnt-wrap .tp-header-logo-wrap p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-header-cnt-bar-wrap .tp-header-bar {
  color: var(--tp-common-white);
  border-color: rgba(255, 255, 255, 0.08);
}
.agntix-dark .tp-header-cnt-bar-wrap .tp-header-8-lang {
  border-color: rgba(255, 255, 255, 0.08);
}
.agntix-dark .tp-btn-black-square.cnt-btn-style {
  border-color: transparent;
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-btn-black-square.cnt-btn-style i {
  color: var(--tp-common-white);
}
.agntix-dark .cnt-hero-title {
  color: var(--tp-common-white);
}
.agntix-dark .cnt-hero-list-wrap {
  background-color: #1b1b1d;
}
.agntix-dark .cnt-hero-list-num {
  color: var(--tp-common-white);
}
.agntix-dark .cnt-hero-list:not(:last-of-type) {
  border-color: rgba(255, 255, 255, 0.08);
}
.agntix-dark .cnt-hero-list-name {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cnt-hero-list-icon span {
  filter: invert(1);
}
.agntix-dark .cnt-about-style .ar-about-shape {
  filter: invert(1);
}
.agntix-dark .cnt-section-subtitle {
  border-color: rgba(255, 255, 255, 0.2);
}
.agntix-dark .cnt-portfolio-heading p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cnt-plan-box {
  border-color: rgba(255, 255, 255, 0.08);
}
.agntix-dark .cnt-plan-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .cnt-plan-item-title::before {
  background-color: var(--tp-common-white);
}
.agntix-dark .cnt-plan-item p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cnt-plan-thumb img {
  filter: invert(1);
}
.agntix-dark .cnt-team-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .cnt-team-item-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cnt-team-item-social a span {
  color: var(--tp-common-white);
  border-color: rgba(255, 255, 255, 0.08);
}
.agntix-dark .cnt-blog-item-btn .tp-btn-black-square.cnt-btn-style.btn-transparent {
  color: var(--tp-common-black);
}
.agntix-dark .cnt-blog-item-box {
  background-color: #1b1b1d;
}
.agntix-dark .cnt-blog-item-2-user-title {
  color: var(--tp-common-white);
}
.agntix-dark .cnt-blog-item-2-user-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cnt-blog-item-2-title {
  color: var(--tp-common-white);
}
.agntix-dark .cnt-blog-item-2-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .cnt-hero-shape {
  filter: invert(1);
}

/*----------------------------------------*/
/*  10.7 Dark Css Start
/*----------------------------------------*/
.agntix-dark body {
  background-color: #0E0F11;
}
.agntix-dark .tp-section-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .tp-about-text p {
  color: var(--tp-common-white);
}
.agntix-dark .tp-about-avater-info p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-about-shape-1 img {
  filter: invert(1);
  opacity: 0.4;
}
.agntix-dark .tp-about-funcact-item span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-about-funcact-item p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-service-item {
  background-color: #0e0f11;
  border-color: rgba(202, 202, 202, 0.4);
}
.agntix-dark .tp-service-number span {
  color: var(--tp-common-white);
}
.agntix-dark .tp_text_invert > div {
  background-image: linear-gradient(to right, #fff 50%, #383C3E 50%);
}
.agntix-dark .tp-service-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-service-category span {
  color: var(--tp-common-white);
  border-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-service-category span:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-project-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-project-category span {
  color: var(--tp-common-white);
  border-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-project-category span:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-funfact-green-wrap {
  border-color: #0E0F11;
}
.agntix-dark .tp-funfact-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .tp-funfact-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-funfact-number span i {
  -webkit-text-stroke: 6px #1A1B1E;
}
.agntix-dark .tp-section-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-work-item {
  border-color: #0E0F11;
  background-color: #1A1B1E;
}
.agntix-dark .tp-work-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-work-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-award-item {
  background: rgba(38, 37, 40, 0.9);
}
.agntix-dark .tp-about-avater-info {
  border-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-header-3-style .tp-header-menu > nav > ul > li > a {
  font-size: 16px;
  color: var(--tp-common-white);
}
.agntix-dark .tp-header-3-style .tp-header-dropdown nav ul li.has-dropdown::after {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-bg {
  inset: 0;
  filter: invert(1);
}
.agntix-dark .dgm-hero-social a span {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-title {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-social-text span {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-funfact span {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-funfact p {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-content .tp-btn-black-square {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-rotate-text span {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-hero-text-box {
  filter: invert(1);
}
.agntix-dark .tp-section-title-grotesk {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-about-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .dgm-about-review h4 {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-about-review span {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-about-ratting h4 {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-about-review-box {
  border-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .dgm-about-review::after {
  background-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .dgm-about-ratting-icon span {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .dgm-step-title {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-step-title-sm {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-step-item p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .dgm-hero-rotate-text span::after {
  background-color: var(--tp-common-white);
}
.agntix-dark .dgm-team-title-sm {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-team-content span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .dgm-team-social a {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .dgm-team-social a:hover span {
  color: var(--tp-common-black);
}
.agntix-dark .dgm-brand-item {
  border: 1px solid #1F1E24;
}
.agntix-dark .dgm-brand-item img {
  filter: invert(1);
}
.agntix-dark .dgm-hero-social-text span::after {
  background-color: rgba(255, 255, 255, 0.4);
}
.agntix-dark .dgm-testimonial-bg {
  filter: invert(1);
}
.agntix-dark .dgm-testimonial-title-box .tp-section-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-testimonial-quote span {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-testimonial-text p {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-testimonial-author-name {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-testimonial-author-info span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .dgm-testimonial-dot .swiper-pagination-bullet {
  border: 1px solid rgba(255, 255, 255, 0.8);
}
.agntix-dark .dgm-testimonial-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {
  background-color: var(--tp-common-white);
}
.agntix-dark .dgm-blog-main {
  border-color: #1F1E24;
}
.agntix-dark .dgm-blog-item {
  border-color: #1F1E24;
}
.agntix-dark .dgm-blog-category span {
  color: #effac0;
  background-color: rgba(239, 250, 192, 0.1);
}
.agntix-dark .dgm-blog-meta h4 {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-blog-meta span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .dgm-blog-title-sm {
  color: var(--tp-common-white);
}
.agntix-dark .dgm-footer-area {
  background-color: rgba(255, 255, 255, 0.04);
}
.agntix-dark .tp-copyright-2-area {
  background-color: rgba(255, 255, 255, 0.04);
}
.agntix-dark .tp-copyright-img {
  filter: invert(1);
  opacity: 0.4;
}
.agntix-dark .ar-hero-title {
  color: var(--tp-common-white);
}
.agntix-dark .ar-category-item span {
  color: var(--tp-common-white);
}
.agntix-dark .ar-category-item a {
  color: var(--tp-common-white);
}
.agntix-dark .ar-hero-bg {
  border-left: 1px solid rgba(255, 255, 255, 0.08);
  border-right: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .ar-hero-border {
  border-color: rgba(255, 255, 255, 0.08);
}
.agntix-dark .ar-category-item:not(:last-child)::after {
  background-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-section-title-clash-600 {
  color: var(--tp-common-white);
}
.agntix-dark .ar-about-title-sm {
  color: var(--tp-common-white);
}
.agntix-dark .tp-btn-black-solid {
  color: var(--tp-common-black);
  border: 1px solid transparent;
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-btn-black-solid:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-2);
  border-color: var(--tp-common-red-2);
}
.agntix-dark .ar-banner-shape img {
  filter: invert(1);
}
.agntix-dark .ar-about-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .ar-about-exp-box {
  border: 1px solid rgba(255, 255, 255, 0.08);
  border-top: 4px solid var(--tp-common-red-2);
}
.agntix-dark .ar-project-category span {
  color: var(--tp-common-white);
}
.agntix-dark .ar-project-category i {
  color: var(--tp-common-white);
}
.agntix-dark .ar-project-item {
  border-color: rgba(255, 255, 255, 0.2);
}
.agntix-dark .tp-btn-red-circle-text {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-2);
  border: 1px solid var(--tp-common-red-2);
}
.agntix-dark .tp-btn-red-circle-icon {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-2);
  border: 1px solid var(--tp-common-red-2);
}
.agntix-dark .tp-btn-red-circle-box:hover .tp-btn-red-circle-text {
  border-color: transparent;
}
.agntix-dark .tp-btn-red-circle-box:hover > :nth-child(1) {
  border-color: transparent;
}
.agntix-dark .ar-funfact-item h4 {
  color: var(--tp-common-white);
}
.agntix-dark .ar-funfact-item span {
  color: var(--tp-common-white);
}
.agntix-dark .ar-testimonial-shape-1 {
  filter: invert(1);
}
.agntix-dark .ar-testimonial-item p {
  color: var(--tp-common-white);
}
.agntix-dark .fraction-wrapper #paginations span {
  color: var(--tp-common-white);
}
.agntix-dark .shop-slider-progress-bar {
  background-color: rgba(255, 255, 255, 0.4);
}
.agntix-dark .ar-testimonial-arrow button {
  color: var(--tp-common-white);
  border-color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .ar-testimonial-arrow button:hover {
  border-color: transparent;
}
.agntix-dark .crp-text-slider-active.app-text-slider-color .swiper-wrapper .crp-text-slider-item span {
  color: var(--tp-common-white);
}
.agntix-dark .crp-text-slider-active.app-text-slider-color .swiper-wrapper .crp-text-slider-item.stroke-text span {
  color: transparent;
  -webkit-text-stroke: 2px rgba(255, 255, 255, 0.9);
}
.agntix-dark .app-hero-round-shape {
  opacity: 0.1;
}
.agntix-dark .app-hero-btn-text p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .ar-award-shape-1 {
  filter: invert(1);
}
.agntix-dark .ar-award-wrap {
  border-left: 1px solid rgba(255, 255, 255, 0.08);
  border-right: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .ar-award-year {
  color: var(--tp-common-white);
}
.agntix-dark .ar-award-title {
  color: var(--tp-common-white);
}
.agntix-dark .ar-award-icon svg {
  color: var(--tp-common-white);
}
.agntix-dark .ar-award-category {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .ar-award-item {
  border-bottom: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .ar-award-item:first-child {
  border-top: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .ar-brand-bg {
  border-top: 1px solid rgba(255, 255, 255, 0.08);
  border-bottom: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .ar-brand-item img {
  filter: invert(1);
}
.agntix-dark .ar-blog-title-sm {
  color: var(--tp-common-white);
}
.agntix-dark .ar-blog-meta {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-header-8-border {
  border-bottom: 1px solid rgba(252, 252, 252, 0.08);
}
.agntix-dark .app-brand-item {
  border-right: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .app-brand-item img {
  filter: invert(1);
}
.agntix-dark .tp-section-subtitle.border-bg.bg-color {
  background: var(--tp-common-black);
}
.agntix-dark .tp-section-title-phudu {
  color: var(--tp-common-white);
}
.agntix-dark .app-feature-heading p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-feature-item {
  background-color: #1A1B1E;
}
.agntix-dark .app-feature-item-icon span {
  color: var(--tp-common-white);
}
.agntix-dark .app-feature-title {
  color: var(--tp-common-white);
}
.agntix-dark .app-feature-item-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-feature-bottom p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-feature-bottom p a {
  color: var(--tp-common-white);
}
.agntix-dark .app-feature-2-bg .main-bg {
  opacity: 0.1;
}
.agntix-dark .app-feature-2-brd {
  background: rgba(255, 255, 255, 0.08);
}
.agntix-dark .app-feature-2-content-icon span {
  filter: invert(1);
}
.agntix-dark .app-feature-2-content-icon p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-review-bg {
  background: linear-gradient(265deg, rgba(208, 242, 240, 0.1) 16.29%, rgba(197, 224, 252, 0.1) 84.71%);
}
.agntix-dark .app-review-heading p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-review-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .app-review-item-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-stack-item.dark-stack-color .app-stack-number {
  background: linear-gradient(0deg, rgba(33, 33, 45, 0.1) 13.2%, rgba(247, 247, 253, 0.1) 94.29%);
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
}
.agntix-dark .app-stack-item.dark-stack-color .app-stack-title {
  color: var(--tp-common-white);
}
.agntix-dark .app-stack-item.dark-stack-color .app-stack-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-stack-item.dark-stack-color .app-stack-content::before {
  background-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .app-stack-item.dark-stack-color .app-stack-content::after {
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-gsap-bg {
  background-color: #1a1b1e;
}
.agntix-dark .app-price-store p b {
  color: var(--tp-common-white);
}
.agntix-dark .app-price-tab-wrap .ai-price-tab ul {
  background: #1a1b1e;
}
.agntix-dark .app-price-box {
  background: #1a1b1e;
}
.agntix-dark .app-price-tab-wrap .ai-price-tab ul li button.active {
  color: var(--tp-common-black);
}
.agntix-dark .app-price-tab-wrap .ai-price-tab ul li button {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-price-tab-wrap .ai-price-tab #lineMarker {
  background: var(--tp-common-white);
}
.agntix-dark .crp-price-item {
  border: none;
  background: rgb(26, 27, 30);
}
.agntix-dark .app-price-box .crp-price-head span {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.06);
}
.agntix-dark .app-price-box .crp-price-head h4 {
  color: var(--tp-common-white);
}
.agntix-dark .app-price-box .crp-price-head p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-price-box .crp-price-head {
  border-color: rgba(255, 255, 255, 0.06);
}
.agntix-dark .app-price-box .row [class*=col-]:not(:last-child) {
  border-right: 1px solid rgba(255, 255, 255, 0.06);
}
.agntix-dark .app-price-box .crp-price-list ul li {
  color: var(--tp-common-white);
}
.agntix-dark .app-price-box .crp-price-list ul li span {
  filter: invert(1);
}
.agntix-dark .app-price-box .crp-price-head h4 i {
  color: var(--tp-common-white);
}
.agntix-dark .app-price-box .crp-price-item.active {
  background: linear-gradient(265deg, rgba(208, 242, 240, 0.06) 16.29%, rgba(197, 224, 252, 0.06) 84.71%);
}
.agntix-dark .app-price-btn-box .animated-border-box .tp-btn-black-border {
  color: var(--tp-common-white);
  background: rgb(49, 50, 52);
}
.agntix-dark .app-testimonial-big-text h3 {
  background: linear-gradient(180deg, rgba(255, 255, 255, 0.1) 0%, rgba(255, 255, 255, 0) 100%);
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
}
.agntix-dark .app-testimonial-review {
  border: 1px solid #000;
  background: linear-gradient(180deg, rgba(0, 0, 0, 0.6) 0.96%, rgba(0, 0, 0, 0.6) 100%);
}
.agntix-dark .app-testimonial-review-content span {
  color: var(--tp-common-white);
}
.agntix-dark .app-testimonial-review-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-testimonial-item {
  background: #1a1b1e;
}
.agntix-dark .app-testimonial-item-icon-title {
  color: var(--tp-common-white);
}
.agntix-dark .app-testimonial-item-icon-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-testimonial-item-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-testimonial-item-icon span {
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .app-faq-wrap .ai-faq-accordion-wrap .accordion {
  background: #1a1b1e;
}
.agntix-dark .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons {
  color: var(--tp-common-white);
}
.agntix-dark .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items:not(:last-child) {
  border-bottom: 2px solid rgb(0, 0, 0);
}
.agntix-dark .app-cta-wrap {
  background: #1a1b1e;
}
.agntix-dark .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon {
  background-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::after, .agntix-dark .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::before {
  background-color: var(--tp-common-white);
}
.agntix-dark .app-cta-heading p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-footer-col-1 .dgm-footer-widget-paragraph p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-footer-widget .dgm-footer-widget-title {
  color: var(--tp-common-white);
}
.agntix-dark .app-footer-widget-info-title {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-footer-widget-info a {
  color: var(--tp-common-white);
}
.agntix-dark .app-footer-widget .dgm-footer-widget-menu ul li a {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-footer-widget .dgm-footer-widget-menu ul li a:hover {
  color: var(--tp-common-white);
}
.agntix-dark .app-footer-widget .dgm-footer-widget-paragraph.color-style p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-copyright-text p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-copyright-text p a {
  color: var(--tp-common-white);
}
.agntix-dark .app-price-store p span {
  filter: invert(1);
}
.agntix-dark .app-price-store p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .app-footer-rating {
  background: #1a1b1e;
}
.agntix-dark .app-footer-rating .app-hero-bottom-rating-point span {
  color: var(--tp-common-white);
}
.agntix-dark .app-footer-rating .app-hero-bottom-rating-star a {
  color: var(--tp-common-white);
}
.agntix-dark .app-footer-widget .dgm-footer-widget-input input {
  background: #1a1b1e;
  color: var(--tp-common-white);
}
.agntix-dark .app-footer-widget .dgm-footer-widget-input input:focus {
  border-color: var(--tp-common-white);
}
.agntix-dark .app-copyright-text p a:hover {
  border-bottom: 1px solid white;
}
.agntix-dark .tp-copyright-2-border.app-copyright-border {
  border-color: rgba(255, 255, 255, 0.06);
}
.agntix-dark .app-feature-2-content .tp-section-subtitle.border-bg {
  border-color: rgba(0, 0, 0, 0.1);
}
.agntix-dark .it-hero-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .it-hero-title {
  color: var(--tp-common-white);
}
.agntix-dark .it-hero-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-btn-black-radius.btn-blue-bg.btn-border {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .it-feature-shape-1 {
  filter: invert(1);
}
.agntix-dark .it-hero-shape-2 {
  filter: invert(1);
}
.agntix-dark .tp-section-subtitle-platform.platform-text-black {
  color: var(--tp-common-white);
}
.agntix-dark .tp-section-title-platform.platform-text-black {
  color: var(--tp-common-white);
}
.agntix-dark .it-feature-item::before {
  background: #1A1B1E;
}
.agntix-dark .it-feature-title {
  color: var(--tp-common-white);
}
.agntix-dark .it-feature-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .it-feature-category span {
  color: rgba(255, 255, 255, 0.6);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .it-feature-category span:hover {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-dark .it-feature-icon::before {
  opacity: 0.1;
}
.agntix-dark .it-about-title-box p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .it-about-shape-2 {
  filter: invert(1);
}
.agntix-dark .it-about-shape-1 {
  filter: invert(1);
}
.agntix-dark .it-project-item {
  background: #1A1B1E;
}
.agntix-dark .it-project-title {
  color: var(--tp-common-white);
}
.agntix-dark .it-project-content span {
  color: rgba(255, 255, 255, 0.6);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .it-project-content span:hover {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-dark .it-project-dots .swiper-pagination-bullet {
  background: #1A1B1E;
}
.agntix-dark .it-project-dots .swiper-pagination-bullet.swiper-pagination-bullet-active {
  opacity: 1;
  background: #7463FF;
}
.agntix-dark .it-testimonial-content img {
  filter: invert(1);
}
.agntix-dark .it-testimonial-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .it-testimonial-content span {
  color: var(--tp-common-white);
}
.agntix-dark .it-comparison-bg {
  background: #1A1B1E;
}
.agntix-dark .it-comparison-logo {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .it-comparison-logo img {
  filter: invert(1);
}
.agntix-dark .it-comparison-content span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .it-comparison-content span i {
  color: var(--tp-common-white);
}
.agntix-dark .it-comparison-item {
  border-right: 3px solid #0e0f11;
}
.agntix-dark .it-benifit-title {
  color: var(--tp-common-white);
}
.agntix-dark .it-benifit-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .it-benifit-item {
  border-left: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .it-benifit-title::before {
  background-color: var(--tp-common-white);
}
.agntix-dark .it-benifit-shape {
  opacity: 0.1;
}
.agntix-dark .it-benifit-icon::after {
  background-color: #0E0F11;
}
.agntix-dark .it-benifit-icon span {
  color: var(--tp-common-white);
}
.agntix-dark .it-faq-shape-1 {
  filter: invert(1);
}
.agntix-dark .it-faq-shape-2 {
  filter: invert(1);
}
.agntix-dark .st-hero-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-hero-border .tp-border-line {
  border-right: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .st-hero-border .tp-border-line {
  border-right: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .st-hero-bottom-right p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-hero-user-content span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-banner-text-bg .bg-shape {
  filter: invert(1);
}
.agntix-dark .st-brand-heading span {
  color: var(--tp-common-white);
}
.agntix-dark .st-brand-border {
  border-bottom: 1px solid rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-brand-border::after {
  background-color: rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-brand-item img {
  filter: invert(1);
}
.agntix-dark .st-about-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-about-card {
  background-color: #1A1B1E;
}
.agntix-dark .st-about-card-tag span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-about-card-btn a {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .st-about-card-bottom span {
  color: var(--tp-common-white);
}
.agntix-dark .st-about-shape {
  filter: invert(1);
}
.agntix-dark .tp-section-title-playfair {
  color: var(--tp-common-white);
}
.agntix-dark .tp-section-title-playfair span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-portfolio-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-portfolio-item-btn a {
  color: var(--tp-common-white);
}
.agntix-dark .st-portfolio-item-content {
  border-bottom: 1px solid rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-testimonial-shape-1 {
  filter: invert(1);
}
.agntix-dark .st-testimonial-bottom span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-testimonial-bottom span a {
  color: var(--tp-common-white);
}
.agntix-dark .st-testimonial-item {
  background: #1A1B1E;
}
.agntix-dark .st-testimonial-box {
  background: var(--tp-common-brown);
  box-shadow: -10px 10px 60px 0px #0e0f11;
}
.agntix-dark .st-testimonial-item-quote img {
  opacity: 0.1;
  filter: invert(1);
}
.agntix-dark .st-hero-shape {
  filter: invert(1);
}
.agntix-dark .st-testimonial-box-top i {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-testimonial-box-top {
  border-bottom: 1px solid rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-testimonial-box-content p {
  color: var(--tp-common-white);
}
.agntix-dark .st-testimonial-box-rating {
  color: var(--tp-common-white);
}
.agntix-dark .st-award-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-award-title span {
  color: rgba(255, 255, 255, 0.4);
}
.agntix-dark .st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-left .ar-award-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-right .ar-award-category {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-award-wrapper .ar-award-right-wrap .ar-award-item .ar-award-box-left .ar-award-year {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-award-wrapper .ar-award-right-wrap .ar-award-item::after {
  background-color: #1A1B1E;
}
.agntix-dark .st-choose-list ul li {
  color: var(--tp-common-white);
}
.agntix-dark .st-choose-text-wrap p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-choose-bg::after {
  background-color: #1A1B1E;
}
.agntix-dark .st-counter-wrapper {
  border-color: rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-counter-wrapper .row [class*=col-]:not(:last-child) {
  border-right: 1px solid rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-counter-item h4 {
  color: var(--tp-common-white);
}
.agntix-dark .st-counter-item span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-counter-item::before {
  background: linear-gradient(180deg, rgba(255, 255, 255, 0) 0%, rgba(255, 255, 255, 0.1) 100%);
}
.agntix-dark .st-blog-text p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-blog-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-blog-item-tags span {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-blog-item-tags-devide {
  background: rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-blog-item-tags p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-footer-widget-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-footer-widget-social-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-footer-widget-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-footer-widget-info-title a {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-footer-widget-menu ul li a {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-footer-top-icon span {
  border-bottom: 7px solid var(--tp-common-white);
}
.agntix-dark .st-footer-top-border {
  border-bottom: 1px solid rgba(255, 255, 255, 0.15);
}
.agntix-dark .st-copyright-sub {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .st-copyright-title {
  color: var(--tp-common-white);
}
.agntix-dark .st-copyright-title span {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-btn-border-2.st {
  color: var(--tp-common-white);
  border-color: rgba(255, 255, 255, 0.15);
}
.agntix-dark .tp-btn-border-2.st:hover {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .st-cta-wrapper .tp-btn-border-2.st {
  color: var(--tp-common-black);
}
.agntix-dark .st-hero-plain span {
  background-color: rgba(255, 255, 255, 0.0901960784);
}
.agntix-dark .ar-about-us-4-title-box .ar-about-us-4-icon {
  filter: invert(1);
}
.agntix-dark .ar-about-us-4-title-box.shape-color .ar-about-us-4-icon {
  filter: invert(0);
}
.agntix-dark .tp-service-4-bg-shape {
  filter: invert(1);
}
.agntix-dark .tp-career-details-sidebar-btn a:hover {
  background-color: #fff;
  color: var(--tp-common-black);
}
.agntix-dark .tp-team-details-input-content input, .agntix-dark .tp-team-details-input-content textarea {
  color: #F8F8FB;
}
.agntix-dark .tp-team-part-item-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-career-details-sidebar-item-icon span {
  filter: invert(1);
  background-color: rgba(255, 255, 255, 0.4);
}
.agntix-dark .tp-career-details-info-item span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-career-details-sidebar-item-content span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .breadcrumb__list span a:hover {
  color: var(--tp-common-white);
}

.agntix-dark .tp-footer-style-6 .tp-footer-widget-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-footer-style-6 .tp-footer-widget-info a {
  color: var(--tp-common-white);
}
.agntix-dark .tp-footer-style-6 .tp-footer-widget-title-sm {
  color: var(--tp-common-white);
}
.agntix-dark .tp-copyright-style-6 .tp-copyright-left span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-copyright-style-6 .tp-copyright-right a {
  color: var(--tp-common-white);
}
.agntix-dark .tp-shop-category-item {
  border-color: #59493D;
}
.agntix-dark .tp-shop-category-item i {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-shop-category-item span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-shop-category-item:hover {
  background-color: #59493D;
}
.agntix-dark .tp-shop-category-item:hover i {
  color: var(--tp-common-white);
}
.agntix-dark .tp-shop-category-item:hover span {
  color: var(--tp-common-white);
}
.agntix-dark .shop-text-slider-active {
  border-bottom: 1px solid #59493D;
}
.agntix-dark .tp-hero-shop-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-hero-shop-slider-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .tp-hero-shop-slider-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-hero-shop-btn .tp-btn-white-border.coffee-bg {
  border-color: transparent;
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-hero-shop-slider-nav-thumb img {
  border: 1px solid rgba(232, 224, 212, 0.1);
  background-color: transparent;
}
.agntix-dark .shop-text-slider-item {
  background-color: #453528;
}
.agntix-dark .tp-action-btn {
  color: #fff;
  background: #59493D;
}
.agntix-dark .tp-action-btn:hover {
  background-color: #453528;
}
.agntix-dark .tp-shop-about-content p {
  color: #fff;
}
.agntix-dark .tp-checkout-btn.border-style {
  font-weight: 500;
  font-size: 15px;
  color: #4d3d30;
  text-transform: capitalize;
  background-color: transparent;
  border: 1px solid rgba(77, 61, 48, 0.12);
}
.agntix-dark .tp-checkout-btn.border-style {
  color: #4d3d30;
  background-color: #e3ddd7;
  border: 1px solid transparent;
}
.agntix-dark .tp-checkout-btn.border-style:hover {
  background-color: transparent;
  border-color: #e3ddd7;
}
.agntix-dark .tp-checkout-btn {
  color: #4d3d30;
  background-color: #e3ddd7;
  border: 1px solid transparent;
}
.agntix-dark .tp-checkout-btn:hover {
  background-color: transparent;
  border-color: #e3ddd7;
  color: #e3ddd7;
}
.agntix-dark .tp-product-testimonial-ptb .app-testimonial-item {
  background: #4d3d30;
}
.agntix-dark .tp-product-testimonial-ptb .app-testimonial-item-content p {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-testimonial-user-name {
  color: var(--tp-common-white);
}
.agntix-dark .tp-shop-feature-item p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-shop-feature-item span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-testimonial-user {
  border: 1px solid #59493D;
}
.agntix-dark .tp-shop-feature-item h4 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-testimonial-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-shop-newsletter-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-shop-newsletter-content span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-header-shop-menu > nav > ul > li > a {
  color: #4d3d30;
  border-right: 1px solid rgba(77, 61, 48, 0.2);
}
.agntix-dark .tp-shop-section-title.fs-100 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-instagram-heading p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-shop-about-circle-text {
  filter: invert(1);
}
.agntix-dark .shop-text-slider-item span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-hero-shop-slider-nav-thumb.slick-current img {
  border-color: #59493D;
  background-color: #59493D;
}
.agntix-dark .ar-about-us-4-title {
  color: var(--tp-common-white);
}
.agntix-dark .ar-about-us-4-title-box p {
  color: rgba(249, 244, 232, 0.6);
}
.agntix-dark .ar-about-us-4-text-title {
  color: var(--tp-common-white);
}
.agntix-dark .creative-service-subtitle-box .tp-section-subtitle.fs-17.pre-circle::before {
  background-color: var(--tp-common-red-3);
}
.agntix-dark .creative-service-top-content p {
  color: var(--tp-common-white);
}
.agntix-dark .creative-service-item.about-us-4 .creative-service-content > span {
  color: var(--tp-common-white);
}
.agntix-dark .creative-service-title {
  color: var(--tp-common-black);
}
.agntix-dark .creative-service-item.about-us-4 .creative-service-title a {
  background: linear-gradient(#FF5722, #FF5722) left no-repeat, #ffffff;
  background-size: auto, auto;
  background-clip: border-box, border-box;
  background-size: 0% 100%;
  background-clip: text;
  -webkit-background-clip: text;
}
.agntix-dark .creative-service-item.about-us-4 .creative-service-link a {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .creative-service-item.about-us-4 .creative-service-category span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .creative-service-item.about-us-4 .creative-service-category span::before {
  background-color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-about-us-2-text p {
  color: rgba(249, 244, 232, 0.6);
}
.agntix-dark .tp-about-us-2-wrap {
  border: 1px solid rgba(255, 248, 232, 0.06);
}
.agntix-dark .tp-about-us-2-line img {
  filter: invert(1);
}
.agntix-dark .tp-about-us-2-wrap::after {
  background-color: rgba(255, 248, 232, 0.06);
}
.agntix-dark .tp-about-us-2-text p::before {
  background-color: #999da6;
}
.agntix-dark .tp-about-us-2-btn a {
  color: rgba(255, 255, 255, 0.7);
  border: 1px solid rgba(255, 248, 232, 0.06);
}
.agntix-dark .tp-about-us-2-btn a:hover {
  background: var(--tp-common-white);
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
}
.agntix-dark .tp-about-us-2-text-title {
  color: rgba(255, 255, 255, 0.7);
  border: 1px solid rgba(255, 248, 232, 0.06);
}
.agntix-dark .tp-section-subtitle-clash.clash-subtitle-pos.about-us-2 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-about-us-2-thumb-shape img {
  filter: invert(1);
}
.agntix-dark .tp-about-us-2-right-shape img {
  filter: invert(1);
}
.agntix-dark .studio-about-content.about-us-2 p {
  color: #bfbfc0;
}
.agntix-dark .tp-btn-red-border.about-us-2 {
  color: var(--tp-common-white);
}
.agntix-dark .studio-service-dark .tp-award-item {
  background-color: transparent;
}
.agntix-dark .tp-career-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-btn .st-hero-btn a {
  border: 1px solid #0E0F11;
  background-color: #1A1B1E;
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-btn .st-hero-btn a .st-hero-btn-text {
  color: var(--tp-common-white);
}
.agntix-dark .tp-benefit-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-benefit-item.tp-benefit-borber-bottom {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-benefit-item {
  border-right: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-career-opening-heading span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-career-opening-title-name {
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-opening-role span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-career-opening-Type span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-career-opening-item {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .pp-service-2-banner-text p, .agntix-dark .pp-service-2-banner-text a {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-text p {
  color: #c6c6c6;
}
.agntix-dark .tp-service-4-banner-breadcrumb span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-banner-breadcrumb span a {
  color: #c6c6c6;
}
.agntix-dark .tp-service-4-banner-breadcrumb span:not(:last-of-type)::after {
  background: #c6c6c6;
}
.agntix-dark .tp-service-4-border {
  border-bottom: 1px solid rgba(34, 34, 34, 0.79);
}
.agntix-dark .tp-service-4-solution-subtitle p {
  border: 1px solid rgba(34, 34, 34, 0.79);
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-solution-subtitle p::before {
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-solution-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-solution-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-solution-item-content p {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-service-4-solution-item-btn a {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-solution-item {
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-service-4-solution-item-icon span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-price-shape {
  filter: invert(1);
}
.agntix-dark .service-4-price {
  background: #282a2e !important;
}
.agntix-dark .service-4-price .crp-price-item {
  background: transparent;
}
.agntix-dark .tp-section-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-process-list p {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-4-process-list span {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .tp-service-4-process-list:not(:last-child) span::before {
  background-color: rgba(255, 255, 255, 0.08);
}
.agntix-dark .tp-service-4-process-wrapper p {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-service-5-text p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-service-5-list ul li {
  color: var(--tp-common-white);
}
.agntix-dark .tp-benefits-heading p {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-service-5-price-item-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-5-price-item-list ul li {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-service-5-price-item-list ul li span {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-service-5-price-item-head h4 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-service-5-price-item {
  border-top: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .tp-career-details-subtitle {
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-details-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-details-info-item h5 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-details-title-2 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-details-wrap p {
  color: rgba(255, 255, 255, 0.8);
}
.agntix-dark .tp-career-details-list ul li {
  color: rgba(249, 244, 232, 0.9);
}
.agntix-dark .tp-career-details-sidebar-box {
  border: 1px solid rgba(255, 255, 255, 0.1);
  background: #1b1b1d;
}
.agntix-dark .creative-service-item.about-us-4 {
  border-color: rgba(255, 255, 255, 0.1);
}
.agntix-dark .creative-service-wrap .row [class*=col-] .creative-service-item:last-child {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-career-details-sidebar-heading span {
  color: rgba(255, 255, 255, 0.8);
}
.agntix-dark .tp-career-details-sidebar-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-career-details-sidebar-item-content h5 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-faq-text p {
  color: rgba(255, 255, 255, 0.9);
}
.agntix-dark .tp-team-hero-subtitle span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-hero-text p {
  color: rgba(249, 244, 232, 0.9);
}
.agntix-dark .des-team-item-box.team-inner-color span {
  color: rgba(249, 244, 232, 0.2);
}
.agntix-dark .des-team-item-box.team-inner-color.active .des-team-title {
  color: var(--tp-common-white);
}
.agntix-dark .des-team-item-box.team-inner-color .des-team-title {
  color: rgba(249, 244, 232, 0.2);
}
.agntix-dark .des-team-item-box.team-inner-color.active span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-part-shape img {
  filter: invert(1);
}
.agntix-dark .ar-hero-title-box p {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-team-part-item {
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-team-part-item-title h4 {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-part-item-title p {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-team-part-item-content svg {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-details-text-sub {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-team-details-text-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-details-text p {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-team-details-more ul li span {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-team-details-more ul li {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-details-more-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-details-input-content input, .agntix-dark .tp-team-details-input-content textarea {
  background-color: #1a1b1e;
}
.agntix-dark .tp-team-details-progress-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-details-progress-counter {
  color: var(--tp-common-white);
}
.agntix-dark .tp-team-details-info-contact a {
  color: rgba(255, 255, 255, 0.7);
}
.agntix-dark .tp-team-details-info-contact {
  border-top: 1px solid rgba(255, 255, 255, 0.1);
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-team-details-info-contact a:not(:last-of-type) {
  border-right: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-team-details-info-social .tp-footer-widget-social a {
  border: 1px solid rgba(255, 255, 255, 0.08);
  color: var(--tp-common-white);
}
.agntix-dark .ai-faq-accordion-dark-wrap.app-faq-wrap .ai-faq-accordion-wrap .accordion {
  background: transparent;
}
.agntix-dark .ai-faq-accordion-dark-wrap.app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items:not(:last-child) {
  border-bottom: 2px solid rgba(255, 255, 255, 0.03);
}
.agntix-dark .tp-error-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-error-wrapper img {
  filter: invert(1);
}
.agntix-dark .tp-error-title-sm {
  color: var(--tp-common-white);
}
.agntix-dark .tp-error-content .tp-btn {
  background-color: var(--tp-common-white);
  color: var(--tp-common-black);
}
.agntix-dark .tp-error-content .tp-btn:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-white);
  background-color: transparent;
}
.agntix-dark .tp-contact-form-input input, .agntix-dark .tp-contact-form-input textarea {
  background: #1D1D1F;
  border-color: #1D1D1F;
  color: var(--tp-common-white);
}
.agntix-dark .tp-contact-form-input input:focus, .agntix-dark .tp-contact-form-input textarea:focus {
  background: transparent;
  border-color: var(--tp-common-red-3);
}
.agntix-dark .tp-contact-form-input label {
  color: var(--tp-common-white);
}
.agntix-dark .tp-shop-section-subtitle {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-shop-section-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-cats a {
  color: var(--tp-common-white);
  border-color: #59493D;
}
.agntix-dark .tp-product-cats a:hover {
  background-color: #59493D;
}
.agntix-dark .tp-product-filter-select .custom-select .selected {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-filter-select .custom-select {
  border-color: #59493D;
}
.agntix-dark .custom-select .selected .arrow {
  filter: invert(1);
}
.agntix-dark .tp-product-item-title, .agntix-dark .tp-product-item-price {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-item-title, .agntix-dark .tp-product-item-price {
  color: var(--tp-common-white);
}
.agntix-dark .basic-pagination.product-pagination ul li > a {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .basic-pagination.product-pagination ul li .current {
  background-color: var(--tp-common-white);
  color: var(--tp-common-black);
}
.agntix-dark .basic-pagination.product-pagination ul li:hover a {
  background-color: var(--tp-common-white);
  color: var(--tp-common-black);
}
.agntix-dark .breadcrumb__list span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .breadcrumb__style-2 .breadcrumb__list span:last-child {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-category span {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-stock span {
  color: var(--tp-common-white);
  background-color: rgba(255, 255, 255, 0.06);
}
.agntix-dark .tp-product-details-reviews span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-sort-desc p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-sort-desc p span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-price.new-price {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-price.old-price {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-variation-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-variation-list button:hover, .agntix-dark .tp-product-details-variation-list button.active {
  box-shadow: 0px 1px 2px rgba(255, 255, 255, 0.9);
}
.agntix-dark .tp-product-details-variation-list button .tp-color-variation-tootltip {
  color: var(--tp-common-black);
  background-color: #e8e0d4;
}
.agntix-dark .tp-product-details-quantity .tp-cart-input[type=text] {
  background-color: #4D3D30;
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-action-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-tab-line {
  background-color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-quantity .tp-cart-plus, .agntix-dark .tp-product-details-quantity .tp-cart-minus {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-add-to-cart-btn {
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.08);
}
.agntix-dark .tp-product-details-buy-now-btn:hover {
  background-color: var(--tp-common-white);
  color: var(--tp-common-black);
}
.agntix-dark .tp-product-details-variation-list button .tp-color-variation-tootltip::before {
  border-top: 6px solid #e8e0d4;
}
.agntix-dark .tp-product-details-action-sm-btn {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-action-sm-btn:hover {
  color: var(--tp-common-white);
}
.agntix-dark .agntix-dark .tp-product-details-action-sm-btn i,
.agntix-dark .tp-product-details-action-sm-btn svg {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-query-item p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-query-item > span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-social span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-social a {
  color: var(--tp-common-white);
  border: 1px solid transparent;
  background-color: #4d3d30;
}
.agntix-dark .tp-product-details-social a:hover {
  color: #4d3d30;
  border-color: #4d3d30;
  background-color: var(--tp-common-white);
}
.agntix-dark .modal-content {
  background-color: #453528;
}
.agntix-dark .tp-product-modal .tp-product-modal-close-btn {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-msg ul li {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-msg ul li::after {
  filter: invert(1);
}
.agntix-dark .tp-product-details-payment p {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-payment {
  background-color: #4d3d30;
}
.agntix-dark .tp-product-details-action-sm {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-product-details-tab-nav .nav-tabs .nav-link.active, .agntix-dark .tp-product-details-tab-nav .nav-tabs .nav-link:hover {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-tab-nav .nav-tabs {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-product-details-additional-info table tr:not(:last-child) {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-product-details-tab-nav .nav-tabs .nav-link {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-additional-info table tr td:first-child {
  background-color: #4d3d30;
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-additional-info table tr td:last-child {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-additional-info table {
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-product-details-desc-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-desc-content p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-thumb-wrapper .nav-tab .nav-links {
  background-color: #4d3d30;
}
.agntix-dark .tp-product-details-thumb-wrapper .nav-tab .nav-links.active {
  border: 1px solid #e8e0d4;
  background: #e8e0d4;
}
.agntix-dark .tp-product-details-review-number {
  border: 1px solid #584A3E;
  background-color: #4D3D30;
}
.agntix-dark .tp-product-details-review-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-number-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-summery-value span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-summery-rating p {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-rating-percent span {
  color: #A0A2A4;
}
.agntix-dark .tp-product-details-review-rating-item > span {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-form-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-form > p {
  color: #A0A2A4;
}
.agntix-dark .tp-product-details-review-form-rating p {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-input input, .agntix-dark .tp-product-details-review-input textarea {
  border-color: #584A3E;
  background: #4D3D30;
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-input input::placeholder, .agntix-dark .tp-product-details-review-input textarea::placeholder {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-review-input input:focus, .agntix-dark .tp-product-details-review-input textarea:focus {
  border-color: rgba(255, 255, 255, 0.9);
}
.agntix-dark .tp-product-details-review-input-title label {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-remeber label {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-review-remeber label::after {
  border: 1px solid #686a6c;
}
.agntix-dark .tp-product-details-review-btn {
  color: var(--tp-common-black);
  border: 1px solid #F4F0EA;
  background-color: #F4F0EA;
}
.agntix-dark .tp-product-details-review-btn:hover {
  color: #F4F0EA;
  background-color: transparent;
}
.agntix-dark .tp-product-details-review-remeber input:checked ~ label::after {
  border: 1px solid #F4F0EA;
  background-color: #F4F0EA;
}
.agntix-dark .tp-product-details-review-avater-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-avater-meta {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-review-avater-comment p {
  color: rgba(255, 255, 255, 0.6);
}
.agntix-dark .tp-product-details-bottom {
  border-bottom: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-dark .tp-product-related-title {
  color: var(--tp-common-white);
}
.agntix-dark .tp-product-details-review-remeber label::before {
  filter: invert(1);
}
.agntix-dark .tp-header-8-lang a {
  color: var(--tp-common-white);
}
.agntix-dark .tp-header-8-lang a:hover {
  color: var(--tp-common-red-2);
}

/*----------------------------------------*/
/*  10.8 Light Css Start
/*----------------------------------------*/
.agntix-light .des-about-text .tp-btn-border {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .des-about-text .tp-btn-border:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.agntix-light .des-text-item.sm span {
  color: rgba(0, 0, 0, 0.1);
}
.agntix-light .des-text-moving-area {
  padding-bottom: 60px;
}
.agntix-light .des-about-area {
  padding-top: 160px;
}
.agntix-light .tp_text_invert_3 > div {
  background-image: linear-gradient(to right, #000 50%, #e4e4e4 50%);
}
.agntix-light .des-text-title {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-light .des-text-title-wrap::after {
  background-color: rgba(0, 0, 0, 0.06);
}
.agntix-light .des-text-title-box p {
  color: var(--tp-common-black);
}
.agntix-light .des-text-moving-top.active .des-text-item.sm span {
  color: var(--tp-common-black);
}
.agntix-light .tp-section-subtitle {
  color: var(--tp-common-black);
}
.agntix-light .tp-section-title-mango {
  color: var(--tp-common-black);
}
.agntix-light .des-project-top-text p {
  color: var(--tp-text-body);
}
.agntix-light .des-project-total span {
  color: var(--tp-common-black);
}
.agntix-light .des-project-total span::before {
  background-color: var(--tp-common-black);
}
.agntix-light .des-project-info span {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .des-project-info h4 {
  color: var(--tp-common-black);
}
.agntix-light .des-project-item {
  border-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .des-brand-item.black-style .des-brand-item-inner {
  background-color: rgb(246, 246, 249);
}
.agntix-light .des-brand-item.black-style .des-brand-item-inner img {
  filter: invert(0);
}
.agntix-light .tp-header-4-style .tp-header-menu nav ul li a {
  color: var(--tp-common-black);
}
.agntix-light .tp-header-4-style .tp-header-dropdown nav ul li.has-dropdown::after {
  color: var(--tp-common-black);
}
.agntix-light .creative-hero-black-box {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-hero-title em {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-hero-title {
  color: var(--tp-common-black);
}
.agntix-light .creative-hero-title i {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-hero-btn {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-hero-black-box::before {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-hero-title em::before {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-hero-title i::before {
  box-shadow: 0px 18px 0 0 #fff;
}
.agntix-light .creative-hero-btn::before {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-hero-title img {
  filter: invert(1);
}
.agntix-light .creative-2-hero-title img {
  filter: invert(1);
}
.agntix-light .creative-2-hero-title {
  color: var(--tp-common-black);
}
.agntix-light .creative-2-hero-text p {
  color: var(--tp-common-black);
}
.agntix-light .creative-2-hero-icon {
  color: var(--tp-common-black);
}
.agntix-light .design-choose-2-style .design-choose-item {
  background-color: #fff;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .design-choose-2-style .design-choose-item span {
  color: var(--tp-common-black);
}
.agntix-light .design-choose-2-style .design-choose-item p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .creative-hero-banner::after {
  box-shadow: 0px -18px 0 0 #fbfbfb;
}
.agntix-light .tp-header-border {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .creative-hero-avater-box {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-hero-avater-info h4 {
  color: var(--tp-common-black);
}
.agntix-light .creative-hero-avater-info span {
  color: var(--tp-text-body);
}
.agntix-light .tp-section-subtitle.fs-17.pre-circle::before {
  background-color: var(--tp-common-black);
}
.agntix-light .creative-about-text p {
  color: var(--tp-common-black);
}
.agntix-light .creative-brand-item img {
  filter: invert(1);
}
.agntix-light .tp-section-title.fs-64 {
  color: var(--tp-common-black);
}
.agntix-light .creative-project-title-sm {
  color: var(--tp-common-black);
}
.agntix-light .creative-project-meta span {
  color: var(--tp-common-black);
}
.agntix-light .creative-project-meta span:not(:last-child)::after {
  background-color: var(--tp-common-black);
}
.agntix-light .creative-project-category {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-project-category::before {
  box-shadow: 0px -17px 0 0 #FFF;
}
.agntix-light .creative-project-category::after {
  box-shadow: 0px -17px 0 0 #FFF;
}
.agntix-light .creative-project-btn-box p {
  color: var(--tp-common-black);
}
.agntix-light .tp-section-title.fs-44 {
  color: var(--tp-common-black);
}
.agntix-light .creative-blog-top-content p {
  color: #4d5051;
}
.agntix-light .creative-service-content > span {
  color: var(--tp-common-black);
}
.agntix-light .creative-service-title {
  color: var(--tp-common-black);
}
.agntix-light .creative-service-item.about-us-4 {
  border-color: rgba(0, 0, 0, 0.2);
}
.agntix-light .creative-service-item.about-us-4 .creative-service-title a {
  background: linear-gradient(#D0FF71, #D0FF71) left no-repeat, #111013;
  background-size: auto, auto;
  background-clip: border-box, border-box;
  background-size: 0% 100%;
  background-clip: text;
  -webkit-background-clip: text;
}
.agntix-light .creative-service-item.about-us-4:hover .creative-service-title a {
  background-size: 100% 100%;
}
.agntix-light .creative-service-item.about-us-4:hover .creative-service-link a {
  background-color: #d0ff71;
  color: var(--tp-common-black);
  border: 1px solid rgb(208, 255, 113);
}
.agntix-light .creative-choose-text p {
  color: var(--tp-common-black);
}
.agntix-light .creative-choose-text p span {
  background-color: #fff;
}
.agntix-light .creative-choose-text p span svg {
  filter: invert(1);
}
.agntix-light .creative-choose-text-middle::before {
  box-shadow: 0px 18px 0 0 #fff;
}
.agntix-light .creative-choose-avater-box {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-choose-avater-info h4 {
  color: var(--tp-common-black);
}
.agntix-light .creative-choose-avater-info span {
  color: var(--tp-text-body);
}
.agntix-light .creative-choose-avater-box::after {
  bottom: 34px;
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-choose-customer {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-choose-customer-info h4 {
  color: var(--tp-text-body);
}
.agntix-light .creative-choose-customer-info span {
  color: var(--tp-text-body);
}
.agntix-light .creative-choose-customer::before {
  box-shadow: 0px 13px 0 0 #fff;
}
.agntix-light .creative-choose-customer::after {
  box-shadow: 0px 13px 0 0 #fff;
}
.agntix-light .creative-testimonial-item {
  background-color: #f6f6f9;
}
.agntix-light .creative-testimonial-avater-info h4 {
  color: var(--tp-common-black);
}
.agntix-light .creative-testimonial-avater-info span {
  color: var(--tp-text-body);
}
.agntix-light .creative-testimonial-text p {
  color: var(--tp-common-black);
}
.agntix-light .creative-testimonial-text p span svg {
  filter: invert(1);
}
.agntix-light .creative-testimonial-slider-wrap .tp-scrollbar {
  background: rgba(0, 0, 0, 0.1);
}
.agntix-light .creative-testimonial-slider-wrap .tp-scrollbar .swiper-scrollbar-drag {
  background: var(--tp-common-black);
}
.agntix-light .creative-work-square-box {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-work-square-box::after, .agntix-light .creative-work-square-box::before {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-work-item {
  background-color: var(--tp-common-white);
}
.agntix-light .creative-work-icon img {
  filter: invert(1);
}
.agntix-light .creative-work-content p {
  color: var(--tp-common-black);
}
.agntix-light .creative-blog-meta span {
  color: var(--tp-text-body);
}
.agntix-light .creative-blog-meta span:not(:last-child)::after {
  background-color: rgb(46, 45, 45);
}
.agntix-light .creative-blog-title-sm {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-footer-widget-social {
  background-color: #fff;
}
.agntix-light .creative-footer-style .tp-footer-widget-social::after, .agntix-light .creative-footer-style .tp-footer-widget-social::before {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-footer-text {
  background-color: #fff;
}
.agntix-light .creative-footer-text::after, .agntix-light .creative-footer-text::before {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-footer-text p {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-footer-widget-menu ul li a:hover {
  border: 1px solid rgb(208, 255, 113);
}
.agntix-light .creative-footer-style .tp-footer-widget-title {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-footer-widget-title-sm {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-copyright-big-text {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-footer-widget-menu ul li a {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .creative-footer-style .tp-footer-widget-info a {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-copyright-left span {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-copyright-right a {
  color: var(--tp-common-black);
}
.agntix-light .creative-footer-style .tp-footer-widget-social a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.agntix-light .tp_text_invert_2 > div {
  background-size: 200% 100%;
  background-position: 100%;
  -webkit-background-clip: text;
  background-clip: text;
  color: transparent;
  background-image: linear-gradient(to right, #111013 50%, #e4e4e4 50%);
}
.agntix-light .design-project-title-box p {
  color: var(--tp-common-black-7);
}
.agntix-light .tp-btn-sky-border {
  color: var(--tp-common-black-7);
  border: 1.5px solid #0e0f11;
}
.agntix-light .tp-btn-sky-border:hover {
  background-color: #0e0f11;
  color: var(--tp-common-white);
}
.agntix-light .design-project-title {
  color: var(--tp-common-black-7);
}
.agntix-light .design-project-content span {
  color: var(--tp-common-black-7);
}
.agntix-light .design-choose-title-box p {
  color: var(--tp-common-black-7);
}
.agntix-light .design-choose-content p {
  color: var(--tp-common-black-7);
}
.agntix-light .creative-footer-style .tp-footer-widget-title-sm.pre::before {
  background-color: var(--tp-common-black);
}
.agntix-light .design-service-left span {
  color: var(--tp-text-body);
}
.agntix-light .design-service-left span::after {
  background-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .design-service-accordion .accordion-buttons span {
  color: var(--tp-text-body);
}
.agntix-light .design-service-accordion .accordion-body p {
  color: var(--tp-text-body);
}
.agntix-light .design-service-accordion .accordion-buttons i {
  color: var(--tp-common-black-7);
}
.agntix-light .design-service-accordion .accordion-buttons:not(.collapsed) i {
  color: var(--tp-common-black);
}
.agntix-light .design-service-category a {
  color: var(--tp-common-black-7);
  border-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .design-service-category a:hover {
  color: var(--tp-common-white);
}
.agntix-light .creative-project-social a {
  background-color: #f6f6f9;
  color: var(--tp-common-black);
  border-color: var(--tp-common-white);
}
.agntix-light .creative-project-social::after {
  background-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .design-hero-slide-text span {
  color: var(--tp-common-black-7);
}
.agntix-light .design-hero-content p {
  color: var(--tp-common-black-7);
}
.agntix-light .design-hero-social a {
  color: var(--tp-common-black-7);
}
.agntix-light .design-hero-social a:not(:last-child)::after {
  background-color: rgba(0, 0, 0, 0.4);
}
.agntix-light .tp-btn-sky-border.solid-bg {
  color: var(--tp-common-white);
  background-color: #0e0f11;
}
.agntix-light .tp-btn-sky-border.solid-bg:hover {
  color: var(--tp-common-black-7);
  background-color: transparent;
}
.agntix-light .creative-text-item span {
  color: var(--tp-common-black-7);
}
.agntix-light .creative-text-item span::after {
  background-color: var(--tp-common-black-7);
}
.agntix-light .design-work-content p {
  color: var(--tp-common-black-7);
}
.agntix-light .design-award-title-box p {
  color: var(--tp-common-black-7);
}
.agntix-light .design-award-item {
  border-bottom: 1px solid rgba(0, 0, 0, 0.3);
}
.agntix-light .design-award-item:hover {
  border-color: var(--tp-common-black-7);
}
.agntix-light .design-award-item::before {
  background: rgba(0, 0, 0, 0.3);
}
.agntix-light .design-award-item::after {
  background: rgba(0, 0, 0, 0.3);
}
.agntix-light .design-award-item:hover::before, .agntix-light .design-award-item:hover::after {
  background: var(--tp-common-black-7);
}
.agntix-light .design-award-item.active .design-award-content h4 {
  color: var(--tp-common-black-7);
}
.agntix-light .design-award-item.active .design-award-content span {
  color: var(--tp-common-black-7);
}
.agntix-light .design-award-content h4 {
  color: rgba(0, 0, 0, 0.25);
}
.agntix-light .design-award-content span {
  color: rgba(0, 0, 0, 0.25);
}
.agntix-light .tp-testimonial-ratting {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-testimonial-ratting img {
  filter: invert(1);
}
.agntix-light .tp-testimonial-ratting-icon span {
  color: var(--tp-common-black-7);
}
.agntix-light .tp-testimonial-ratting-info p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .design-footer-widget-title {
  color: var(--tp-common-black-7);
}
.agntix-light .design-footer-widget-input input {
  color: var(--tp-common-black);
  border-color: rgba(20, 20, 20, 0.1);
}
.agntix-light .design-footer-widget-input input::placeholder {
  color: var(--tp-common-black);
}
.agntix-light .design-footer-widget-input input:focus {
  border-color: var(--tp-common-black-7);
}
.agntix-light .design-footer-widget-input-icon {
  background-color: var(--tp-common-black-7);
}
.agntix-light .design-footer-widget-info a {
  color: var(--tp-common-black);
}
.agntix-light .design-footer-middle {
  border-bottom: 1px solid rgba(0, 0, 0, 0.2);
}
.agntix-light .design-footer-top-wrap {
  border-bottom: 1px solid rgba(0, 0, 0, 0.2);
}
.agntix-light .design-copyright-text p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .design-copyright-backtoTop a {
  color: var(--tp-common-black-7);
}
.agntix-light .design-copyright-backtoTop a span {
  color: var(--tp-common-black-7);
}
.agntix-light .design-copyright-big-text img {
  filter: invert(1);
}
.agntix-light .design-hero-circle-1 {
  filter: blur(400px);
  -webkit-filter: blur(400px);
  background-color: rgba(5, 45, 146, 0.2);
}
.agntix-light .design-hero-circle-2 {
  filter: blur(400px);
  -webkit-filter: blur(400px);
  background-color: rgba(109, 97, 255, 0.1);
}
.agntix-light .creative-choose-text-bottom::after {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .des-team-item-box span {
  color: #ECECEC;
}
.agntix-light .des-team-item-box .des-team-title {
  color: #ECECEC;
}
.agntix-light .des-team-item-box.active span {
  color: #111013;
}
.agntix-light .des-team-item-box.active .des-team-title {
  color: #111013;
}
.agntix-light .des-team-wrap.des-team-inner-style .des-team-item-box span {
  color: #ECECEC;
}
.agntix-light .des-team-wrap.des-team-inner-style .des-team-item-box .des-team-title {
  color: #ECECEC;
}
.agntix-light .des-team-wrap.des-team-inner-style .des-team-item-box.active span {
  color: #2A4C3A;
}
.agntix-light .des-team-wrap.des-team-inner-style .des-team-item-box.active .des-team-title {
  color: #2A4C3A;
}
.agntix-light .studio-hero-info a, .agntix-light .studio-hero-info span {
  color: var(--tp-common-black-7);
}
.agntix-light .studio-hero-banner-text span {
  color: var(--tp-common-black-7);
}
.agntix-light .tp-section-subtitle-clash {
  color: var(--tp-common-black-7);
}
.agntix-light .studio-about-content p {
  color: var(--tp-common-black-7);
}
.agntix-light .studio-project-number span {
  color: var(--tp-common-black-7);
}
.agntix-light .studio-project-number i {
  color: var(--tp-common-black-7);
}
.agntix-light .studio-project-title-sm {
  color: var(--tp-common-black-7);
}
.agntix-light .studio-project-content span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .studio-service-item-wrap .tp-award-year {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .studio-service-item-wrap .tp-award-text {
  color: var(--tp-common-black-7);
}
.agntix-light .tp-award-icon {
  color: var(--tp-common-black);
}
.agntix-light .studio-service-item-wrap .tp-award-item {
  border-top: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .studio-service-item-wrap {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .studio-award-content p {
  color: var(--tp-common-black-7);
}
.agntix-light .studio-award-icon img {
  filter: invert(1);
}
.agntix-light .studio-award-icon {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .studio-award-item span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .design-testimonial-author h4 {
  color: var(--tp-common-black-7);
}
.agntix-light .design-testimonial-author span {
  color: var(--tp-text-body);
}
.agntix-light .design-testimonial-review h4 {
  color: var(--tp-common-black-7);
}
.agntix-light .design-testimonial-text p {
  color: var(--tp-common-black-7);
}
.agntix-light .design-testimonial-item {
  background-color: rgb(246, 246, 249);
}
.agntix-light .studio-team-title-box p {
  color: rgba(0, 0, 0, 0.8);
}
.agntix-light .studio-step-item {
  box-shadow: none;
  background-color: rgb(246, 246, 249);
}
.agntix-light .tp-btn-red-border {
  color: var(--tp-common-red);
}
.agntix-light .tp-btn-red-border:hover {
  color: var(--tp-common-white);
}
.agntix-light .tp-section-title.fs-54 {
  color: var(--tp-common-black);
}
.agntix-light .ai-choose-text p {
  color: var(--tp-common-black);
}
.agntix-light .ai-choose-bottom-text p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .ai-choose-bottom-text p a {
  color: var(--tp-common-black);
}
.agntix-light .ai-choose-icon span {
  color: var(--tp-common-black);
  background: rgba(0, 0, 0, 0.08);
}
.agntix-light .ai-choose-bottom-text {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .ai-choose-shape {
  filter: invert(1);
}
.agntix-light .ai-about-title-box p {
  color: var(--tp-common-black);
}
.agntix-light .ai-about-list ul li p {
  color: var(--tp-common-black);
}
.agntix-light .ai-about-list ul li > span > span svg {
  color: var(--tp-common-black);
}
.agntix-light .ai-about-list ul li > span > span i {
  background: rgba(0, 0, 0, 0.08);
}
.agntix-light .ai-text-slider span {
  color: rgba(0, 0, 0, 0.02);
  -webkit-text-stroke: 2px rgba(0, 0, 0, 0.197);
  text-shadow: inset 0 -6px 12px 0 rgba(0, 0, 0, 0.14);
}
.agntix-light .ai-text-slider img {
  filter: invert(1);
}
.agntix-light .ai-service-top-text p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .ai-service-item {
  background-color: white;
}
.agntix-light .ai-service-title-sm {
  color: var(--tp-common-black);
}
.agntix-light .ai-service-content p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .ai-service-link a {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .ai-service-item::after {
  filter: invert(1);
  background: -webkit-linear-gradient(90deg, #08041D 0%, rgba(255, 255, 255, 0.1) 100%);
}
.agntix-light .ai-service-link a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.agntix-light .ai-price-title-box p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .ai-price-tab ul {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .ai-price-tab ul li button.active {
  color: var(--tp-common-white);
}
.agntix-light #lineMarker {
  background: var(--tp-common-black);
}
.agntix-light .ai-price-tab ul li button {
  color: var(--tp-common-black);
}
.agntix-light .ai-price-item {
  background-color: #F6F6F9;
}
.agntix-light .ai-price-head span {
  color: var(--tp-common-black);
}
.agntix-light .ai-price-head h4 {
  color: var(--tp-common-black);
}
.agntix-light .ai-price-head h4 i {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .ai-price-list-item span {
  color: var(--tp-common-black);
}
.agntix-light .ai-price-list-item i {
  color: var(--tp-common-black);
  border: 2px solid rgba(0, 0, 0, 0.2);
}
.agntix-light .ai-price-bottom-text span {
  color: rgba(0, 0, 0, 0.7);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .ai-price-bottom-text span a {
  color: var(--tp-common-black);
}
.agntix-light .ai-faq-video a {
  background: rgba(0, 0, 0, 0.06);
  border: 1px solid rgba(0, 0, 0, 0.1);
  box-shadow: 0 2px 10px 0 rgba(0, 0, 0, 0.1);
}
.agntix-light .ai-faq-accordion-wrap .accordion-header .accordion-buttons {
  color: var(--tp-common-black);
}
.agntix-light .ai-faq-accordion-wrap .accordion-body p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .ai-faq-accordion-wrap .accordion-header .accordion-buttons .accordion-icon::before {
  background-color: var(--tp-common-black);
}
.agntix-light .ai-faq-accordion-wrap .accordion-header .accordion-buttons .accordion-icon::after {
  background-color: var(--tp-common-black);
}
.agntix-light .ai-blog-content span {
  background: linear-gradient(139deg, #9968ff 0%, #ff6cb2 49%, #ffaf56 100%);
  background-clip: text;
  -webkit-background-clip: text;
  -webkit-text-fill-color: transparent;
}
.agntix-light .ai-blog-title {
  color: var(--tp-common-black);
}
.agntix-light .ai-blog-meta span {
  color: rgba(0, 0, 0, 0.4);
}
.agntix-light .ai-blog-meta span:not(:last-child)::after {
  background-color: rgba(0, 0, 0, 0.4);
}
.agntix-light .ai-blog-item {
  border: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .tp-section-subtitle-teko {
  color: #2A4C3A;
}
.agntix-light .tp-section-subtitle-teko i {
  color: #2A4C3A;
}
.agntix-light .tp-section-title-teko {
  color: #2A4C3A;
}
.agntix-light .tp-section-title-teko span {
  color: #2A4C3A;
}
.agntix-light .crp-about-text p {
  color: rgba(0, 0, 0, 0.8);
}
.agntix-light .crp-service-icon span {
  background-color: #2A4C3A;
}
.agntix-light .crp-service-title-sm {
  color: #2a4c3a;
}
.agntix-light .crp-service-content p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .crp-service-link {
  color: #2a4c3a;
}
.agntix-light .crp-service-link i {
  color: #2A4C3A;
}
.agntix-light .tp-btn-yellow-border {
  color: #2A4C3A;
  border: 1px solid #2A4C3A;
}
.agntix-light .crp-project-item {
  background-color: var(--tp-common-white);
  border: 1px solid rgba(42, 76, 58, 0.1);
}
.agntix-light .crp-process-title-sm {
  color: #2A4C3A;
}
.agntix-light .crp-process-content p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .crp-blog-title {
  color: var(--tp-common-black);
}
.agntix-light .crp-blog-meta {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .crp-blog-title-sm {
  color: #2A4C3A;
}
.agntix-light .crp-blog-category span {
  color: #2A4C3A;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .crp-price-title-box .tp-section-subtitle-teko {
  color: var(--tp-common-white);
}
.agntix-light .crp-price-title-box .tp-section-title-teko {
  color: var(--tp-common-cream-3);
}
.agntix-light .crp-price-title-box .tp-section-title-teko span {
  color: var(--tp-common-yellow-green);
}
.agntix-light .crp-price-btn-box .tp-btn-yellow-border {
  color: var(--tp-common-yellow-green);
  border: 1px solid var(--tp-common-yellow-green);
}
.agntix-light .crp-about-btn-box .tp-btn-yellow-green {
  color: #fff;
  background-color: #2A4C3A;
}
.agntix-light .creative-hero-black-box::after {
  box-shadow: 0px -18px 0 0 #fff;
}
.agntix-light .creative-hero-title em::after {
  box-shadow: 0px 18px 0 0 #fff;
}
.agntix-light .tp-price-light-anim .animated-border-box::before {
  background-image: conic-gradient(rgb(255, 255, 255), #000, rgb(255, 255, 255) 25%);
}
.agntix-light .ai-faq-accordion-wrap .accordion-items:not(:last-child) {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .ai-price-btn .tp-btn-black-border {
  color: var(--tp-common-black);
  background: rgb(255, 255, 255);
}
.agntix-light .cr-multi-border {
  border-color: rgba(0, 0, 0, 0.06);
}
.agntix-light .cr-multi-border::after, .agntix-light .cr-multi-border::before {
  background: linear-gradient(180deg, rgba(0, 0, 0, 0) 0%, #000 100%);
}
.agntix-light .ca-brand-sub img {
  filter: invert(1);
}
.agntix-light .tp-btn-white-border.tp-btn-light-bg {
  color: #0E0F11;
  background-color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-light .tp-btn-white-border.tp-btn-light-bg:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-white);
  background-color: transparent;
}
.agntix-light .cr-brand-heading p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-brand-wrapper .app-brand-item {
  border-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .cr-brand-wrapper .app-brand-item img {
  filter: invert(1);
}
.agntix-light .cr-brand-bottom img {
  filter: invert(1);
}
.agntix-light .tp-section-subtitle-gradient.ct {
  border-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-section-title-onest {
  color: var(--tp-common-black);
}
.agntix-light .cr-feature-heading p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-feature-heading {
  border-bottom: 1px solid rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-multi-border-bottom {
  border-bottom: 1px solid rgba(0, 0, 0, 0.06);
}
.agntix-light .cr-feature-2-bg {
  filter: invert(1);
}
.agntix-light .cr-feature-2-heading p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-feature-2-btn .tp-btn-white-border {
  color: var(--tp-common-white);
  border: 1px solid rgba(0, 0, 0, 0.1);
  background-color: var(--tp-common-black);
}
.agntix-light .cr-feature-2-btn .tp-btn-white-border:hover {
  color: var(--tp-common-black);
  background-color: transparent;
  border-color: var(--tp-common-black);
}
.agntix-light .cr-feature-2-item {
  border-color: #ebebeb;
}
.agntix-light .cr-feature-2-item span {
  background-color: #ebebeb;
}
.agntix-light .cr-feature-2-ptb {
  border-bottom: 1px solid rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-feature-3-border-box {
  border-color: rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-feature-3-border-box::after, .agntix-light .cr-feature-3-border-box::before {
  background: linear-gradient(180deg, rgba(0, 0, 0, 0) 0%, #000 100%);
}
.agntix-light .cr-feature-3-border {
  border-bottom: 1px solid rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-service-item {
  border-left: 1px dashed rgba(0, 0, 0, 0.08);
}
.agntix-light .cr-service-item-icon span {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .cr-service-item-icon span svg {
  filter: invert(1);
}
.agntix-light .cr-service-item-title {
  color: var(--tp-common-black);
}
.agntix-light .cr-feature-3-heading .tp-section-title-onest {
  color: var(--tp-common-white);
}
.agntix-light .cr-service-item-content p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-hero-heading .tp-section-title-onest {
  color: var(--tp-common-white);
}
.agntix-light .cr-service-ptb {
  border-bottom: 1px solid rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-testimonial-box {
  border-color: rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-testimonial-ptb {
  border-bottom: 1px solid rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-testimonial-content span {
  color: var(--tp-common-black);
}
.agntix-light .cr-testimonial-content p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-testimonial-title {
  color: var(--tp-common-black);
}
.agntix-light .cr-testimonial-nav button {
  color: var(--tp-common-black);
  background: rgba(0, 0, 0, 0.06);
  border: 1px solid rgba(0, 0, 0, 0.06);
}
.agntix-light .cr-testimonial-nav button:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
.agntix-light .cr-testimonial-wrapper {
  background: #F6F6F9;
  box-shadow: 0px 0px 4px 0px rgba(0, 0, 0, 0.12) inset, 0px 0px 2px 2px rgba(255, 255, 255, 0.4);
}
.agntix-light .cr-testimonial-item-subtitle {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-testimonial-item-top img {
  filter: invert(1);
}
.agntix-light .cr-testimonial-item-title {
  color: var(--tp-common-black);
}
.agntix-light .cr-testimonial-item-user span {
  color: var(--tp-common-black);
}
.agntix-light .cr-testimonial-item-user p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-blog-item {
  border: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .cr-blog-item-category {
  color: var(--tp-common-black);
}
.agntix-light .cr-blog-item-title {
  color: var(--tp-common-black);
}
.agntix-light .cr-blog-item-meta {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-blog-bottom-text {
  color: var(--tp-common-black);
}
.agntix-light .cr-blog-bottom-border {
  border-bottom: 1px solid rgba(0, 0, 0, 0.07);
}
.agntix-light .cr-cta-text {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .cr-cta-bg {
  filter: invert(1);
}
.agntix-light .cr-footer-border-wrap {
  border-color: rgba(0, 0, 0, 0.06);
}
.agntix-light .cr-cta-btn .tp-btn-white-border {
  color: var(--tp-common-white);
  border: 1px solid rgba(0, 0, 0, 0.1);
  background-color: var(--tp-common-black);
}
.agntix-light .cr-cta-btn .tp-btn-white-border:hover {
  background-color: transparent;
  color: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.agntix-light .tp-hero-5-thumb-content p {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-hero-5-thumb-content::after {
  background-color: var(--tp-common-black-8);
}
@media (min-width: 1800px) {
  .agntix-light .tp-hero-5-bdr-left {
    border-left: 1px solid rgba(46, 46, 46, 0.1);
  }
}
.agntix-light .tp-hero-5-title span {
  -webkit-text-stroke: 2px var(--tp-common-black-8);
  text-stroke: 2px var(--tp-common-black-8);
}
.agntix-light .tp-hero-5-title {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-hero-5-title-box p {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-hero-5-title-box .tp-btn-cream-bdr {
  color: var(--tp-common-black-8);
  border: 1px solid var(--tp-common-black-8);
}
.agntix-light .tp-hero-5-title-box .tp-btn-cream-bdr:hover {
  background-color: var(--tp-common-black-8);
  color: #F3F1EA;
}
.agntix-light .tp-project-5-title-box-bg,
.agntix-light .tp-text-slider-5-style .tp-text-slider-4-wrap {
  background-color: #E5E1D3;
}
.agntix-light .tp-text-slider-5-style .tp-text-slider-4-item span {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-text-slider-4-item img {
  filter: invert(100%) sepia(80%) saturate(280%) hue-rotate(200deg) brightness(105%) contrast(100%);
}
.agntix-light .tp-about-5-subtitle {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-section-title-5.fs-140 {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-about-5-title-box p {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-section-subtitle, .agntix-light .tp-project-5-section-title, .agntix-light .tp-project-5-section-link {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-section-box {
  border-top: 1px solid rgba(46, 46, 46, 0.1);
}
.agntix-light .tp-project-5-title-box.active .tp-project-5-title {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-title {
  color: rgba(47, 46, 43, 0.3);
}
.agntix-light .tp-project-5-title-box span {
  color: rgba(47, 46, 43, 0.3);
}
.agntix-light .tp-project-5-title-box.active span {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-2-title {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-2-item {
  border: 1px solid var(--tp-common-black-8);
  background: rgba(243, 241, 234, 0.9);
}
.agntix-light .tp-project-5-2-content span {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-2-title-sm {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-2-shape span {
  filter: invert(100%) sepia(80%) saturate(280%) hue-rotate(200deg) brightness(105%) contrast(100%);
}
.agntix-light .tp-project-5-2-btn {
  border-top: 1px solid var(--tp-common-black-8);
  border-bottom: 1px solid var(--tp-common-black-8);
}
.agntix-light .tp-project-5-2-btn a {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-project-5-2-btn a span {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-testimonial-5-content .quote-shape svg {
  color: rgba(62, 62, 33, 0.25);
  stroke-width: 0.5px;
  stroke: rgba(207, 194, 146, 0.3);
}
.agntix-light .tp-testimonial-5-content p {
  color: var(--tp-common-white);
}
.agntix-light .tp-testimonial-5-content span {
  color: var(--tp-common-white);
}
.agntix-light .tp-testimonial-5-content span::before {
  background-color: var(--tp-common-white);
}
.agntix-light .tp-testimonial-5-bg {
  mix-blend-mode: normal;
}
.agntix-light .tp-footer-15-social span {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-footer-15-social a {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-footer-15-social a span {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-footer-15-social::after {
  background-color: var(--tp-common-black-8);
}
.agntix-light .tp-footer-15-social a::after {
  background-color: var(--tp-common-black-8);
}
.agntix-light .tp-footer-15-copyright-text span {
  color: var(--tp-common-black-8);
}
.agntix-light .tp-footer-15-copyright-text span a::after {
  background-color: var(--tp-common-black-8);
}
.agntix-light .pp-brand-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-brand-title i {
  color: rgba(0, 0, 0, 0.3);
}
.agntix-light .pp-brand-area {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-service-heading span {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-item {
  border-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-service-item-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-banner-wrap img {
  opacity: 1;
}
.agntix-light .pp-project-heading .tp-section-title-teko {
  color: var(--tp-common-black-7);
}
.agntix-light .pp-project-item-title {
  color: var(--tp-common-black-7);
}
.agntix-light .pp-project-item-title:hover a {
  color: var(--tp-common-black-7);
}
.agntix-light .pp-project-item-meta {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .pp-text-slider-wrapper .pp-brand-title {
  color: var(--tp-common-white);
}
.agntix-light .pp-about-heading .tp-section-title-teko {
  color: var(--tp-common-black-7);
}
.agntix-light .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-text-2 {
  color: rgba(0, 0, 0, 0.4);
}
.agntix-light .tp-award-year {
  color: var(--tp-common-black);
}
.agntix-light .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-position {
  color: var(--tp-common-black);
}
.agntix-light .pp-award-wrapper .tp-award-item-wrap .tp-award-item .row [class*=col-] .tp-award-link {
  color: var(--tp-common-black);
}
.agntix-light .pp-award-wrapper .tp-award-item-wrap .tp-award-item {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-award-wrapper .tp-award-item-wrap .tp-award-item::after {
  background: rgba(0, 0, 0, 0.07);
}
.agntix-light .tp-award-item:hover .tp-award-year, .agntix-light .tp-award-item:hover .tp-award-text, .agntix-light .tp-award-item:hover .tp-award-position, .agntix-light .tp-award-item:hover .tp-award-icon {
  color: var(--tp-common-black);
}
.agntix-light .tp-award-text {
  color: var(--tp-common-black);
}
.agntix-light .pp-social-item.active .pp-social-item-wrap .pp-social-item-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-social-item {
  border-bottom: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .pp-social-item-title {
  color: rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-social-item-wrap p {
  color: rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-social-item.active .pp-social-item-wrap p {
  color: var(--tp-common-black);
}
.agntix-light .pp-hero-btn .tp-btn-red-circle-box.tp-pp-btn-style:hover .tp-btn-red-circle-text {
  color: var(--tp-common-black);
  background-color: #FFF669;
}
.agntix-light .pp-hero-btn .tp-btn-red-circle-box.tp-pp-btn-style .tp-btn-red-circle-icon {
  background: #FFF669;
  color: var(--tp-common-black);
  border: 1px solid #FFF669;
}
.agntix-light .pp-hero-btn .tp-btn-red-circle-box.tp-pp-btn-style .tp-btn-red-circle-text {
  color: #FFF669;
  border: 1px solid #FFF669;
}
.agntix-light .ai-project-title-box span {
  filter: invert(1);
}
.agntix-light .tp-hero-2-btn-box .tp-btn-border {
  color: var(--tp-common-cream);
  border: 1px solid rgba(249, 244, 232, 0.1);
}
.agntix-light .crp-hero-subtitle .tp-section-subtitle-teko {
  color: var(--tp-common-cream-3);
}
.agntix-light .tp-work-item.about-us-3-bg {
  border: 4px solid #fff;
  background-color: #edf2ef;
}
.agntix-light .crp-price-shape-2 {
  filter: invert(1);
  opacity: 0.1;
}
.agntix-light .inner-service-1-category-item i {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-process-item p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .sidebar-search input:focus {
  border: 1px solid var(--tp-common-black);
}
.agntix-light .postbox-title a {
  display: inline;
  transition: all 0.3s linear;
  background-repeat: no-repeat;
  background-size: 0% 1px, 0 1px;
  background-position: 100% 94%, 0 94%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.agntix-light .postbox-title a:hover {
  color: var(--tp-common-black);
  background-size: 0% 1px, 100% 1px;
}
.agntix-light .rc-post-title a {
  display: inline;
  transition: all 0.3s linear;
  background-repeat: no-repeat;
  background-size: 0% 1px, 0 1px;
  background-position: 100% 94%, 0 94%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.agntix-light .rc-post-title a:hover {
  color: var(--tp-common-black);
  background-size: 0% 1px, 100% 1px;
}
.agntix-light .basic-pagination ul li .current {
  border-color: #FF5722;
  background-color: #FF5722;
  color: var(--tp-common-white);
}
.agntix-light .basic-pagination ul li:hover a {
  border-color: #FF5722;
  background-color: #FF5722;
  color: var(--tp-common-white);
}
.agntix-light .blog-footer-style.creative-footer-style .tp-footer-widget-social a {
  color: var(--tp-common-white);
  background-color: #FF5722;
}
.agntix-light .blog-footer-style.creative-footer-style .tp-footer-widget-menu ul li a:hover {
  border: 1px solid rgb(244, 83, 34);
  background-color: var(--tp-common-red-3);
  color: var(--tp-common-white);
}
.agntix-light .blog-footer-style.creative-footer-style .tp-footer-widget-info a:hover {
  color: var(--tp-common-red-3);
}
.agntix-light .rc-post-wrap .rc-post:not(:last-child) {
  border-bottom: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .tp-btn-yellow-green.sidebar-btn {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.agntix-light .sidebar-widget-author-social a:hover span {
  color: var(--tp-common-red-3);
}
.agntix-light .tagcloud a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.agntix-light .postbox-details-list ul li i {
  color: var(--tp-common-red-3);
}
.agntix-light .postbox-details-social a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-3);
}
.agntix-light .postbox__comment-reply a:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-red-3);
  background-color: var(--tp-common-red-3);
}
.agntix-light .postbox-details-input input:focus, .agntix-light .postbox-details-input textarea:focus {
  border-color: var(--tp-common-red-3);
}
.agntix-light .pp-project-item-title a {
  display: inline;
  transition: all 0.3s linear;
  background-repeat: no-repeat;
  background-size: 0% 1px, 0 1px;
  background-position: 100% 100%, 0 75%;
  background-image: linear-gradient(currentcolor, currentcolor), linear-gradient(currentcolor, currentcolor);
}
.agntix-light .pp-project-item-title a:hover {
  color: var(--tp-common-black);
  background-size: 0% 1px, 100% 1px;
}
.agntix-light .crp-service-shape-wrap {
  opacity: 0.6;
}
.agntix-light .crp-inner-style .pp-award-left .tp-section-subtitle-clash {
  color: #2A4C3A;
}
.agntix-light .crp-inner-style .pp-about-heading .tp-section-title-teko {
  color: #2A4C3A;
}
.agntix-light .pp-service-details-process-item span {
  color: var(--tp-common-white);
  background-color: var(--tp-common-red-2);
}
.agntix-light .tp-portfolio-slicer-meta {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-slicer-meta:not(:last-of-type)::after {
  background-color: var(--tp-common-black);
}
@keyframes animate-pulse-2 {
  0% {
    box-shadow: 0 0 0 0 rgba(0, 0, 0, 0.1), 0 0 0 0 rgba(0, 0, 0, 0.1);
  }
  40% {
    box-shadow: 0 0 0 50px rgba(0, 0, 74, 0), 0 0 0 0 rgba(0, 0, 0, 0.1);
  }
  80% {
    box-shadow: 0 0 0 50px rgba(0, 0, 74, 0), 0 0 0 30px rgba(0, 0, 74, 0);
  }
  100% {
    box-shadow: 0 0 0 0 rgba(0, 0, 74, 0), 0 0 0 30px rgba(0, 0, 74, 0);
  }
}

.agntix-light .tp-career-shape-1 {
  filter: invert(1);
}
.agntix-light .tp-slider-elegant-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-footer-widget-menu ul li a {
  color: var(--tp-common-black);
  background-color: var(--tp-common-white);
}
.agntix-light .tp-header-14-info a {
  color: var(--tp-common-black);
}
.agntix-light .coverflow-slider-title-sm {
  color: var(--tp-common-black);
}
.agntix-light .coverflow-slider-title-sm .tp-line-white {
  background-position: 100% 100%, 0 88%;
}
.agntix-light .tp-footer-style-6 .tp-footer-widget-title {
  color: var(--tp-common-white);
}
.agntix-light .tp-footer-style-6 .tp-footer-widget-title-sm {
  color: var(--tp-common-white);
}
.agntix-light .tp-footer-style-6 .tp-footer-widget-info a {
  color: var(--tp-common-white);
}
.agntix-light .tp-footer-style-6 .tp-footer-widget-info a:hover {
  color: var(--tp-common-red-2);
}
.agntix-light .tp-copyright-style-6 .tp-copyright-left span {
  color: var(--tp-common-white);
}
.agntix-light .tp-copyright-style-6 .tp-copyright-right a {
  color: var(--tp-common-white);
}
.agntix-light .tp-btn-white-border {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-btn-white-border:hover {
  color: var(--tp-common-black);
  background-color: transparent;
  border-color: var(--tp-common-black);
}
.agntix-light .tp-btn-white-border.tp-btn-transparent {
  color: var(--tp-common-black);
  background-color: transparent;
  border-color: rgba(0, 0, 0, 0.2);
}
.agntix-light .tp-btn-white-border.tp-btn-transparent:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-slicer-title-sm {
  color: var(--tp-common-black);
}
.agntix-light .tp-perspective-slider .tp-perspective-inner .tp-perspective-image::before {
  background: #fff;
}
.agntix-light .tp-perspective-slider .tp-perspective-inner .tp-perspective-image::after {
  background: #fff;
}
.agntix-light .tp-perspective-social-info span {
  color: var(--tp-common-black);
}
.agntix-light .tp-perspective-scroll a {
  color: var(--tp-common-black);
}
.agntix-light .coverflow-slider-arrow button {
  color: var(--tp-common-black);
}
.agntix-light .tp-header-14-bar-wrap .tp-header-8-bar {
  background-color: transparent;
  border: 1px solid rgba(0, 0, 0, 0.2);
}
.agntix-light .tp-header-14-bar-wrap .tp-header-8-bar span {
  color: var(--tp-common-black);
}
.agntix-light .tp-header-14-bar-wrap .tp-header-8-bar:hover {
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
.agntix-light .tp-header-14-bar-wrap .tp-header-8-bar:hover span {
  color: var(--tp-common-white);
}
.agntix-light .creative-footer-style .tp-footer-widget-social a {
  color: var(--tp-common-black);
  background-color: #d0ff71;
}
.agntix-light .tp-section-title-teko.fs-80 span {
  color: rgba(0, 0, 0, 0.3);
}
.agntix-light .tp-section-title-teko.fs-80 {
  color: var(--tp-common-black);
}
.agntix-light .pp-about-content p {
  color: var(--tp-common-black);
}
.agntix-light .pp-about-bottom-btn a span {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-about-bottom-btn a span {
  color: var(--tp-common-black);
}
.agntix-light .tp-btn-red-circle-box.tp-pp-btn-style .tp-btn-red-circle-text {
  color: var(--tp-common-black);
  border: 1px solid var(--tp-common-black);
}
.agntix-light .tp-btn-red-circle-box.tp-pp-btn-style .tp-btn-red-circle-icon {
  background: var(--tp-common-black);
  color: var(--tp-common-white);
  border: 1px solid var(--tp-common-black);
}
.agntix-light .tp-btn-red-circle-box.tp-pp-btn-style:hover .tp-btn-red-circle-text {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.agntix-light .pp-about-me-service-subtitle {
  color: var(--tp-common-black);
}
.agntix-light .pp-about-me-service-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-about-me-skill.pp-skill-list-wrap .pp-skill-list-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-about-me-skill.pp-skill-list-wrap .pp-skill-list ul li {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .pp-about-me-service-heading img {
  filter: invert(1);
}
.agntix-light .pp-about-me-tool-item-content span {
  color: var(--tp-common-black);
}
.agntix-light .pp-about-me-tool-item-content p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .pp-about-me-tool-item {
  border: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .pp-about-me-tool-item-icon span {
  background: #F6F6F9;
}
.agntix-light .pp-about-me-tool-item-icon span img {
  filter: saturate(1);
  mix-blend-mode: normal;
}
.agntix-light .pp-about-me-experience-item p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .pp-about-me-experience-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-footer-subtitle {
  color: var(--tp-common-black);
}
.agntix-light .pp-footer-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-footer-box {
  background-color: var(--tp-common-yellow-1);
}
.agntix-light .pp-footer-btn {
  border: 1px solid rgba(0, 0, 0, 0.1);
  color: var(--tp-common-black);
}
.agntix-light .pp-footer-copyright-text p {
  color: rgba(20, 20, 20, 0.6);
}
.agntix-light .pp-footer-copyright-text-center p {
  color: var(--tp-common-black);
}
.agntix-light .pp-footer-copyright-text-center::before {
  background-color: var(--tp-common-black);
}
.agntix-light .pp-footer-copyright-text-center::after {
  background-color: rgba(20, 20, 20, 0.2);
}
.agntix-light .des-about-text p {
  color: var(--tp-common-black);
}
.agntix-light .inner-service-1-text span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .inner-service-1-text p {
  color: var(--tp-common-black);
}
.agntix-light .inner-service-1-category-item span {
  color: var(--tp-common-black);
}
.agntix-light .inner-service-1-category-item {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .inner-service-1-category-item:first-child {
  border-top: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .inner-service-1-left > span {
  color: var(--tp-common-black);
}
.agntix-light .inner-service-1-thumb-text span {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .ar-about-us-4-text-title {
  color: rgba(0, 0, 0, 0.1);
}
.agntix-light .service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons {
  color: var(--tp-common-black);
}
.agntix-light .service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-body p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon {
  border: 1px solid #F3F3F9;
  background-color: #F3F3F9;
}
.agntix-light .service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::before, .agntix-light .service-faq-style .app-faq-wrap .ai-faq-accordion-wrap .accordion .accordion-items .accordion-header .accordion-buttons .accordion-icon::after {
  background-color: rgba(0, 0, 0, 0.6);
}
.agntix-light .pp-service-details-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-overview-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-overview-wrapper p {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-overview-wrapper h4 {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-overview-list ul li {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-overview-list ul li span {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-service-details-overview-heading {
  border-bottom: 1px solid rgba(0, 0, 0, 0.11);
}
.agntix-light .tp-service-4-solution-item.service-details .tp-service-4-solution-item-title {
  color: var(--tp-common-black);
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-service-4-solution-item.service-details .tp-service-4-solution-item-content ul li {
  color: var(--tp-common-black);
}
.agntix-light .tp-service-4-solution-item.service-details {
  border-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-service-5-price-heading.service-details .tp-career-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-service-5-price-item.service-details .tp-service-5-price-item-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-service-5-price-item.service-details .tp-service-5-price-item-list ul li {
  color: var(--tp-common-black);
}
.agntix-light .tp-service-5-price-item.service-details .tp-service-5-price-item-head h4 {
  color: var(--tp-common-black);
}
.agntix-light .tp-service-5-price-item.service-details {
  border-color: rgba(0, 0, 0, 0.08);
}
.agntix-light .pp-service-details-process-subtitle {
  background: rgba(3, 3, 3, 0.0705882353);
  color: var(--tp-common-red-2);
}
.agntix-light .pp-service-details-process-title {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-process-box::before {
  background-color: rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-service-details-process-item h4 {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-process-bottom span {
  background: transparent;
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .pp-service-details-process-bottom span a {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-process-bottom span a:hover {
  color: var(--tp-common-red-2);
}
.agntix-light .tp-breadcrumb-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-breadcrumb-list span:last-child {
  color: var(--tp-common-black);
}
.agntix-light .tp-breadcrumb-list span {
  color: rgba(0, 0, 0, 0.4);
}
.agntix-light .postbox-item {
  border: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .postbox-author-name {
  color: rgba(0, 0, 0, 0.9);
}
.agntix-light .postbox-author-info span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-meta span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-tag {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-title {
  color: var(--tp-common-black);
}
.agntix-light .postbox-content p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-btn-yellow-border.postbox-btn {
  color: var(--tp-common-black);
  background: #F6F6F9;
  border: 1px solid #F6F6F9;
}
.agntix-light .postbox-blockquote {
  background: #F6F6F9;
}
.agntix-light .postbox-blockquote-paragraph p {
  color: var(--tp-common-black);
}
.agntix-light .basic-pagination ul li > a {
  border: 1px solid rgba(0, 0, 0, 0.08);
  color: var(--tp-common-black);
}
.agntix-light .sidebar-search input {
  background: #F6F6F9;
  border-color: #F6F6F9;
  color: var(--tp-common-black);
}
.agntix-light .sidebar-search input:focus {
  background: transparent;
}
.agntix-light .sidebar-search input::placeholder {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .sidebar-search button {
  color: var(--tp-common-black);
}
.agntix-light .sidebar-widget-author-name {
  color: var(--tp-common-black);
}
.agntix-light .sidebar-widget-author-content span {
  color: rgba(0, 0, 0, 0.4);
}
.agntix-light .sidebar-widget-author-content p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .sidebar-widget-author-social a span {
  color: var(--tp-common-black);
}
.agntix-light .sidebar-widget-author {
  border: 1px solid rgba(0, 0, 0, 0.06);
}
.agntix-light .sidebar-widget-title {
  color: var(--tp-common-black);
}
.agntix-light .sidebar-widget-category ul li a {
  color: rgba(0, 0, 0, 0.8);
  background: #F6F6F9;
}
.agntix-light .sidebar-widget-category ul li a span:last-child {
  color: rgba(0, 0, 0, 0.4);
}
.agntix-light .sidebar-widget-category ul li a:hover span:last-child {
  color: var(--tp-common-red-3);
}
.agntix-light .sidebar-widget-category ul li a:hover {
  color: var(--tp-common-red-3);
}
.agntix-light .rc-post-category a {
  color: rgb(98, 98, 100);
  background: #F6F6F9;
}
.agntix-light .rc-post-title {
  color: var(--tp-common-black);
}
.agntix-light .rc-post-title a:hover {
  color: rgba(0, 0, 0, 0.8);
}
.agntix-light .rc-post-meta span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tagcloud a {
  color: rgba(0, 0, 0, 0.6);
  background: #F6F6F9;
}
.agntix-light .pp-service-details-about-item span {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-about-item p {
  color: var(--tp-common-black);
}
.agntix-light .pp-service-details-about-item {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-blog-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-blog-heading-wrap .tp-section-subtitle.pre::before {
  background: #ff5722;
}
.agntix-light .tp-blog-title a {
  background-color: #F6F6F9;
}
.agntix-light .tp-blog-list-item-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-blog-list-item-tags p {
  color: rgba(0, 0, 0, 0.4);
}
.agntix-light .tp-blog-list-item-tags-name {
  color: var(--tp-common-black);
}
.agntix-light .tp-blog-list-item-meta {
  color: #141414;
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-blog-list-item {
  border-top: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .tp-blog-list-item-wrap .tp-blog-list-item:last-child {
  border-bottom: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .tp-blog-masonry-item {
  border: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .tp-blog-masonry-item-user-content span {
  color: rgba(0, 0, 0, 0.9);
}
.agntix-light .tp-blog-masonry-item-user-content p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-blog-masonry-item-time span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-blog-masonry-tag span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-blog-masonry-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-blog-masonry-btn a {
  color: #ff5722;
}
.agntix-light .tp-blog-masonry-item-2 {
  background: #F6F6F9;
}
.agntix-light .tp-blog-masonry-item-3 {
  background: #F6F6F9;
}
.agntix-light .tp-blog-masonry-item-icon span {
  background: #e3e3e5;
}
.agntix-light .tp-blog-masonry-item-text span {
  color: var(--tp-common-black);
}
.agntix-light .tp-blog-masonry-item-text p {
  color: var(--tp-common-black);
}
.agntix-light .postbox-details-tag span {
  color: var(--tp-common-black);
}
.agntix-light .postbox-details-tag span:last-child::after {
  background-color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-details-meta .postbox-author-name {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-details-meta > div:not(:first-child)::after {
  background: rgba(0, 0, 0, 0.1);
}
.agntix-light .postbox-details-text p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox-details-quote p {
  color: var(--tp-common-black);
}
.agntix-light .postbox-details-quote span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-details-quote span::before {
  background-color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-details-text p span {
  color: #ff5722;
}
.agntix-light .postbox-details-list ul li {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox-details-list ul li::before {
  background-color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox-details-list ul li span {
  color: rgba(0, 0, 0, 0.3);
}
.agntix-light .postbox-details-code {
  background: rgb(246, 246, 249);
}
.agntix-light .postbox-details-code pre {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox-details-author .sidebar-widget-author {
  background: rgb(246, 246, 249);
}
.agntix-light .postbox-details-social a {
  background-color: rgb(246, 246, 249);
  color: rgba(0, 0, 0, 0.8);
}
.agntix-light .postbox__comment-title {
  color: var(--tp-common-black);
}
.agntix-light .postbox__comment-name h5 {
  color: var(--tp-common-black);
}
.agntix-light .postbox__comment-name span {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox__comment-text p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox__comment-reply a {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .postbox-details-form {
  border: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .postbox-details-form-title {
  color: var(--tp-common-black);
}
.agntix-light .postbox-details-form p {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox-details-input label {
  color: var(--tp-common-black);
}
.agntix-light .postbox-details-input input, .agntix-light .postbox-details-input textarea {
  background: rgb(246, 246, 249);
  color: var(--tp-common-black);
  border: 1px solid rgb(246, 246, 249);
}
.agntix-light .postbox-details-input input:focus, .agntix-light .postbox-details-input textarea:focus {
  background: transparent;
}
.agntix-light .postbox-details-remeber label {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .postbox-details-remeber label::before {
  color: var(--tp-common-black);
  filter: invert(1);
}
.agntix-light .postbox-details-remeber label::after {
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-blog-details-without-heading .postbox-details-item .postbox-tag span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .postbox-details-item.item-border {
  border: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .tp-contact-category-btn {
  border: 1px solid rgba(0, 0, 0, 0.08);
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-me-interest-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-me-interest-form-wrap .tp-contact-form-input input, .agntix-light .tp-contact-me-interest-form-wrap .tp-contact-form-input textarea {
  background: rgb(246, 246, 249);
  color: var(--tp-common-black);
  border: 1px solid rgb(246, 246, 249);
}
.agntix-light .tp-contact-me-interest-form-wrap .tp-contact-form-input input:focus, .agntix-light .tp-contact-me-interest-form-wrap .tp-contact-form-input textarea:focus {
  background: transparent;
  border-color: var(--tp-common-black);
}
.agntix-light .tp-contact-me-interest-form-wrap .tp-contact-form-input label {
  color: var(--tp-common-black);
}
.agntix-light .tp-career-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-text p {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .tp-contact-us-text p:hover {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-form-wrapper {
  background: #F6F6F9;
}
.agntix-light .tp-contact-us-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-wrap .tp-contact-form-input label {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-wrap .tp-contact-form-input input, .agntix-light .tp-contact-us-wrap .tp-contact-form-input textarea {
  background: #fff;
  border-color: rgb(237, 237, 245);
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-wrap .tp-contact-form-input input:focus, .agntix-light .tp-contact-us-wrap .tp-contact-form-input textarea:focus {
  background: transparent;
  border-color: var(--tp-common-red-3);
}
.agntix-light .cn-contactform-support-text span {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-content {
  background: #F6F6F9;
}
.agntix-light .tp-contact-us-info-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-info-details a {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .tp-contact-us-info-details a:hover {
  color: var(--tp-common-black);
}
.agntix-light .tp-contact-us-btn .tp-btn-yellow-green {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-contact-us-btn .tp-btn-yellow-green.active {
  color: var(--tp-common-white);
}
.agntix-light .tp-portfolio-inner-tab-wrap nav .nav-tabs .nav-link {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-portfolio-inner-tab-wrap nav .nav-tabs .nav-link.active, .agntix-light .tp-portfolio-inner-tab-wrap nav .nav-tabs .nav-link:hover {
  background: var(--tp-grey-2);
  border: 1px solid var(--tp-grey-2);
}
.agntix-light .tp-portfolio-inner-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-inner-content span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-portfolio-masonry-big-text {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-top-left span {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-top-left span {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-top-right p {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-top-right span {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-social a {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-portfolio-masonry-social a:hover {
  color: var(--tp-common-white);
  border-color: var(--tp-common-black);
  background-color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-wrap {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-portfolio-masonry-grid-heading span {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-grid-heading span::after {
  background-color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-grid-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-masonry-grid-categories span {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-btn-animation span {
  color: var(--tp-common-black);
}
.agntix-light .tp-btn-animation {
  background: rgb(246, 246, 249);
}
.agntix-light .tp-portfolio-metro-shape span {
  color: rgba(0, 0, 0, 0.8);
}
.agntix-light .tp-portfolio-metro-social a {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-portfolio-details-1-sub {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-portfolio-details-1-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-details-btn {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-portfolio-details-btn:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-details-1-content p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-portfolio-details-1-list ul li {
  color: var(--tp-common-black);
}
.agntix-light .tp-portfolio-details-1-list ul li span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-portfolio-details-1-list ul li:not(:last-of-type) {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-pd-1-about-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-about-text {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-about-list ul li {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-about-list ul li::before {
  background-color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-work-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-work-content p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-pd-1-work-item-text span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-pd-1-work-item-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-work-item {
  border-bottom: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-pd-1-np-content span {
  color: rgba(0, 0, 0, 0.2);
}
.agntix-light .tp-pd-1-np-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-np-content p {
  color: rgba(0, 0, 0, 0.2);
}
.agntix-light .tp-pd-3-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-3-subtitle {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-btn-border {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-btn-border:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.agntix-light .tp-pd-3-overview-text p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-pd-3-overview-info span {
  color: rgba(0, 0, 0, 0.5);
}
.agntix-light .tp-pd-3-overview-info h4 {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-3-navigation-title {
  color: var(--tp-common-black);
}
.agntix-light .des-portfolio-title {
  color: var(--tp-common-white);
}
.agntix-light .des-footer-title {
  color: var(--tp-common-white);
}
.agntix-light .des-footer-top span {
  color: var(--tp-common-white);
}
.agntix-light .tp-pd-2-categories span {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-pd-2-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-2-bottom-item span {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .tp-pd-2-bottom-item h6 {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-2-overview-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-2-overview-wrap p {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-pd-2-overview-wrap ul li:not(:last-of-type) {
  border-bottom: 1px solid rgba(0, 0, 0, 0.08);
}
.agntix-light .tp-pd-2-overview-wrap ul li {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-2-dot .swiper-pagination-bullet {
  background: rgba(0, 0, 0, 0.3);
}
.agntix-light .tp-pd-2-dot .swiper-pagination-bullet.swiper-pagination-bullet-active {
  background-color: var(--tp-common-black);
}
.agntix-light .tp-pd-2-step-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-2-step-item-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-2-step-item span {
  color: rgba(0, 0, 0, 0.6);
}
.agntix-light .tp-pd-2-np-content a {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.1);
}
.agntix-light .tp-pd-2-np-content a:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
}
.agntix-light .tp-pd-4-title {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-4-bottom-btn .tp-portfolio-details-btn {
  color: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.agntix-light .tp-pd-4-bottom-btn .tp-portfolio-details-btn:hover {
  color: var(--tp-common-white);
  background-color: var(--tp-common-black);
  border: 1px solid var(--tp-common-black);
}
.agntix-light .tp-pd-4-about-sub {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-about-text.color-cng {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-4-color-content span {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-4-color-content p {
  color: var(--tp-common-black);
}
.agntix-light .tp-pd-1-work-title.ff-clash {
  color: var(--tp-common-black);
}
.agntix-light .project-details-video-overlay::after {
  background: linear-gradient(180deg, rgba(18, 18, 18, 0) 1.63%, #fff 26.67%);
}
.agntix-light .project-details-1-info span {
  color: var(--tp-common-black);
}
.agntix-light .project-details-1-info h4 {
  color: rgba(0, 0, 0, 0.7);
}
.agntix-light .project-details-1-subtitle {
  color: var(--tp-common-black);
}
.agntix-light .project-details-1-title {
  color: var(--tp-common-black);
}
.agntix-light .project-details-1-title-box p {
  color: var(--tp-common-black);
}
.agntix-light .project-details-1-navigation a span {
  color: var(--tp-common-black);
}
.agntix-light .project-details-1-navigation a i {
  color: var(--tp-common-black);
  border: 1px solid rgba(0, 0, 0, 0.14);
}
.agntix-light .project-details-1-navigation a:hover i {
  color: var(--tp-common-white);
  background: var(--tp-common-black);
  border-color: var(--tp-common-black);
}
.agntix-light .tp-header-light .tp-header-14-info a {
  color: var(--tp-common-white);
}
.agntix-light .tp-header-light .tp-header-14-bar-wrap .tp-header-8-bar {
  background-color: transparent;
  border: 1px solid rgba(255, 255, 255, 0.2);
}
.agntix-light .tp-header-light .tp-header-14-bar-wrap .tp-header-8-bar span {
  color: var(--tp-common-white);
}
.agntix-light .tp-header-light .tp-header-14-bar-wrap .tp-header-8-bar:hover {
  border-color: var(--tp-common-white);
  background-color: var(--tp-common-white);
}
.agntix-light .tp-header-light .tp-header-14-bar-wrap .tp-header-8-bar:hover span {
  color: var(--tp-common-black);
}
.agntix-light .tp-hero-2-btn-box.tp-light-bg-btn .tp-btn-border:hover {
  color: var(--tp-common-black);
  border-color: var(--tp-common-cream);
  background-color: var(--tp-common-cream);
}
.agntix-light .ai-about-list ul li:hover span span i {
  background-color: var(--tp-common-black);
}
.agntix-light .ai-about-list ul li:hover span span svg {
  color: var(--tp-common-white);
}
.agntix-light .pp-about-me-social .tp-footer-widget-social a {
  background-color: transparent;
  color: var(--tp-common-white);
  border: 1px solid rgba(255, 255, 255, 0.1);
}
.agntix-light .pp-about-me-social .tp-footer-widget-social a:hover {
  color: #2F1F19;
  background-color: var(--tp-common-white);
}

/*# sourceMappingURL=main.css.map */


/* ==== zenkovf.css ==== */
/* Unbounded — переменный шрифт, размещён локально.
   Раньше грузился с fonts.googleapis.com: два внешних хоста в критическом пути,
   каждый со своим DNS и TLS. Теперь один origin, два файла. */
@font-face {
  font-family: "Unbounded";
  src: url("../fonts/unbounded/unbounded-cyrillic.woff2") format("woff2");
  font-weight: 200 900;
  font-display: swap;
  unicode-range: U+0301, U+0400-045F, U+0490-0491, U+04B0-04B1, U+2116;
}
@font-face {
  font-family: "Unbounded";
  src: url("../fonts/unbounded/unbounded-latin.woff2") format("woff2");
  font-weight: 200 900;
  font-display: swap;
  unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+2000-206F, U+2192, U+2212, U+2215;
}

/* ==========================================================================
   zenkovf studio — override layer
   Две гарнитуры: Clash Display (заголовки) + Inter (текст).
   Чинит переполнение текста, нечитаемый dirtyline-шрифт и пр.
   ========================================================================== */

:root {
  /* подменяем нечитаемый dirtyline на фирменную гарнитуру глобально */
  --tp-ff-dirtyline: "Unbounded", sans-serif;
  --zf-display: "Unbounded", sans-serif;
  --zf-display-medium: "Unbounded", sans-serif;
  --zf-body: "Unbounded", sans-serif;
  --zf-accent: #0b0b0c;
  --zf-muted: #6b6b70;
  --zf-line: #e6e6e8;
  --zf-bg-soft: #f5f5f3;
  --zf-gold: #b3946a;
  --zf-gold-soft: #f3ece1;
}

/* --- ГЛОБАЛЬНЫЙ шрифт: Unbounded на весь сайт --- */
*:not(i):not([class*="fa-"]):not([class^="fa"]):not([class*="flaticon"]):not([class*="tp-icon"]) {
  font-family: "Unbounded", sans-serif !important;
}

/* --- глобально: гасим горизонтальный вынос текста за экран --- */
html, body { overflow-x: hidden; }

/* Анимации горизонтального скролла шаблона выталкивают гигантские
   заголовки за вьюпорт — отключаем трансформации, оставляем статичный текст. */
.tp-text-right-scroll,
.tp-text-left-scroll {
  transform: none !important;
  display: inline !important;
}

/* Гигантский текст hero */
.design-hero-slide-text span,
.design-hero-slide-text span i,
.zf-tw-text {
  font-family: var(--zf-display) !important;
  font-size: clamp(22px, 5vw, 64px) !important;
  letter-spacing: -0.02em !important;
  font-weight: 700 !important;
  white-space: nowrap;
}

/* ---- Typewriter effect ---- */
.zf-tw-wrap { display: block; }
.zf-tw-text { display: inline; }
.zf-tw-cursor {
  display: inline-block;
  width: .06em; height: .88em;
  background: currentColor;
  vertical-align: -.04em;
  margin-left: .06em;
  border-radius: 1px;
}
.zf-tw-cursor.zf-tw-blink {
  animation: zf-tw-blink .75s step-end infinite;
}
@keyframes zf-tw-blink {
  0%, 100% { opacity: 1; }
  50%       { opacity: 0; }
}
.design-hero-content p { font-family: var(--zf-body) !important; }

/* --- единый стиль крупных секционных заголовков (вместо dirtyline) --- */
.tp-section-title-dirtyline {
  font-family: var(--zf-display) !important;
  font-size: clamp(40px, 7vw, 96px) !important;
  line-height: 1.02 !important;
  letter-spacing: -0.02em !important;
  font-weight: 600 !important;
  color: var(--zf-accent) !important;
  text-transform: none !important;
  word-break: normal;
  overflow-wrap: break-word;
  max-width: 100%;
}
.tp-section-title-dirtyline span { font-family: inherit !important; }

/* Заголовки кейсов — был нечитаемый готический шрифт */
.design-project-title,
.design-project-title a {
  font-family: var(--zf-display) !important;
  font-size: clamp(34px, 5vw, 72px) !important;
  line-height: 1.05 !important;
  letter-spacing: -0.02em !important;
  font-weight: 600 !important;
  text-transform: none !important;
  color: var(--zf-accent) !important;
}
.design-project-content span {
  font-family: var(--zf-body) !important;
  letter-spacing: 0.02em;
  color: var(--zf-muted);
}

/* Гигантская подложка "услуги" 410px -> вменяемый размер, не переполняет */
.design-service-big-text h4 {
  font-family: var(--zf-display) !important;
  font-size: clamp(64px, 16vw, 240px) !important;
  line-height: 0.95 !important;
  letter-spacing: -0.03em !important;
  white-space: normal !important;
  word-break: normal;
}
.design-service-left span { font-family: var(--zf-body) !important; }

/* Услуги: контент прижимаем левее, как просил пользователь */
@media (min-width: 1200px) {
  .design-service-area .col-xxl-7.col-xl-9 { flex: 0 0 auto; width: 72%; }
  .design-service-area .col-xxl-5.col-xl-3 { flex: 0 0 auto; width: 28%; }
}

/* Логотип и большой текст футера — приводим к фирменной гарнитуре (без Times) */
.tp-header-logo a,
.tp-offcanvas-2-logo a {
  font-family: var(--zf-display) !important;
  letter-spacing: -0.01em !important;
  text-transform: lowercase;
}
.design-copyright-big-text span {
  font-family: var(--zf-display) !important;
  letter-spacing: -0.02em !important;
  text-transform: lowercase;
}

/* Заголовок "Наши работы" — делаем пропорциональным и читаемым */
.design-project-title-box .tp-section-title-dirtyline {
  font-size: clamp(48px, 8vw, 110px) !important;
}
.design-project-title-box p {
  font-family: var(--zf-body) !important;
  font-size: 18px;
  color: var(--zf-muted);
  max-width: 460px;
}

/* ==========================================================================
   Баннер «что внутри сайта» — captioned панель (вместо безымянной картинки)
   ========================================================================== */
.zf-feature-area { padding: 40px 0 60px; }
.zf-feature-inner {
  display: grid;
  grid-template-columns: 1fr 1.25fr;
  gap: 56px;
  align-items: center;
}
.zf-feature-text h2 {
  font-family: var(--zf-display);
  font-size: clamp(30px, 4vw, 48px);
  line-height: 1.08;
  letter-spacing: -0.02em;
  color: var(--zf-accent);
  margin-bottom: 22px;
}
.zf-feature-text p {
  font-family: var(--zf-body);
  font-size: 18px;
  line-height: 1.6;
  color: var(--zf-muted);
  margin-bottom: 28px;
  max-width: 480px;
}
.zf-feature-list { list-style: none; padding: 0; margin: 0; display: grid; gap: 14px; }
.zf-feature-list li {
  font-family: var(--zf-body);
  font-size: 16px;
  color: var(--zf-accent);
  display: flex;
  gap: 12px;
  align-items: flex-start;
}
.zf-feature-list li::before {
  content: "";
  width: 8px; height: 8px;
  margin-top: 8px;
  border-radius: 50%;
  background: var(--zf-accent);
  flex: 0 0 auto;
}
.zf-feature-figure { position: relative; }
.zf-feature-figure img {
  width: 100%;
  border-radius: 16px;
  box-shadow: 0 30px 70px rgba(0,0,0,0.12);
  display: block;
}
.zf-feature-figure figcaption {
  font-family: var(--zf-body);
  font-size: 14px;
  color: var(--zf-muted);
  margin-top: 16px;
  text-align: center;
}
@media (max-width: 991px) {
  .zf-feature-inner { grid-template-columns: 1fr; gap: 36px; }
}

/* ==========================================================================
   Калькулятор / форма заявки
   ========================================================================== */
.zf-calc-area { padding: 120px 0; background: var(--zf-bg-soft); }
.zf-calc-head { text-align: center; max-width: 720px; margin: 0 auto 64px; }
.zf-calc-head h2 {
  font-family: var(--zf-display);
  font-size: clamp(40px, 6vw, 84px);
  line-height: 1.0;
  letter-spacing: -0.03em;
  color: var(--zf-accent);
  margin-bottom: 20px;
}
.zf-calc-head p {
  font-family: var(--zf-body);
  font-size: 18px;
  line-height: 1.6;
  color: var(--zf-muted);
}
.zf-calc-grid {
  display: grid;
  grid-template-columns: 1.5fr 1fr;
  gap: 40px;
  align-items: start;
}
.zf-calc-form { display: grid; gap: 40px; }
.zf-field-group > h4 {
  font-family: var(--zf-display);
  font-size: 22px;
  letter-spacing: -0.01em;
  color: var(--zf-accent);
  margin: 0 0 6px;
}
.zf-field-group > .zf-hint {
  font-family: var(--zf-body);
  font-size: 14px;
  color: var(--zf-muted);
  margin: 0 0 20px;
}
.zf-options { display: grid; grid-template-columns: repeat(2, 1fr); gap: 14px; }
.zf-options.cols-1 { grid-template-columns: 1fr; }
.zf-option {
  position: relative;
  display: flex;
  justify-content: space-between;
  align-items: center;
  gap: 12px;
  padding: 18px 22px;
  border: 1px solid var(--zf-line);
  border-radius: 12px;
  background: #fff;
  cursor: pointer;
  transition: border-color .2s ease, box-shadow .2s ease, background .2s ease;
}
.zf-option:hover { border-color: #c9c9cc; }
.zf-option input { position: absolute; opacity: 0; pointer-events: none; }
.zf-option .zf-opt-name {
  font-family: var(--zf-body);
  font-size: 16px;
  font-weight: 500;
  color: var(--zf-accent);
}
.zf-option .zf-opt-desc {
  display: block;
  font-family: var(--zf-body);
  font-size: 13px;
  font-weight: 400;
  color: var(--zf-muted);
  margin-top: 4px;
}
.zf-option .zf-opt-price {
  font-family: var(--zf-display-medium);
  font-size: 15px;
  color: var(--zf-muted);
  white-space: nowrap;
}
.zf-option.is-checked {
  border-color: var(--zf-accent);
  background: #fff;
  box-shadow: 0 0 0 1px var(--zf-accent) inset;
}
.zf-option.is-checked .zf-opt-price { color: var(--zf-accent); }

/* sticky сводка цены */
.zf-summary {
  position: sticky;
  top: 30px;
  background: var(--zf-accent);
  color: #fff;
  border-radius: 18px;
  padding: 36px 34px;
}
.zf-summary h3 {
  font-family: var(--zf-display);
  font-size: 20px;
  letter-spacing: -0.01em;
  color: #fff;
  margin: 0 0 24px;
}
.zf-summary-lines { display: grid; gap: 10px; margin-bottom: 24px; min-height: 24px; }
.zf-summary-line {
  display: flex;
  justify-content: space-between;
  gap: 16px;
  font-family: var(--zf-body);
  font-size: 14px;
  color: rgba(255,255,255,0.7);
}
.zf-summary-line span:last-child { color: #fff; white-space: nowrap; }
.zf-summary-empty { font-family: var(--zf-body); font-size: 14px; color: rgba(255,255,255,0.5); }
.zf-summary-total {
  border-top: 1px solid rgba(255,255,255,0.18);
  padding-top: 22px;
  margin-bottom: 8px;
}
.zf-summary-total .zf-total-label {
  font-family: var(--zf-body);
  font-size: 14px;
  color: rgba(255,255,255,0.7);
  display: block;
  margin-bottom: 6px;
}
.zf-summary-total .zf-total-value {
  font-family: var(--zf-display);
  font-size: clamp(32px, 4vw, 44px);
  letter-spacing: -0.02em;
  color: #fff;
  line-height: 1;
}
.zf-summary-note {
  font-family: var(--zf-body);
  font-size: 13px;
  color: rgba(255,255,255,0.55);
  margin: 10px 0 26px;
  line-height: 1.5;
}
.zf-summary-send {
  display: flex;
  align-items: center;
  justify-content: center;
  width: 100%;
  padding: 17px 24px;
  border: none;
  border-radius: 12px;
  background: #fff;
  color: var(--zf-accent);
  font-family: var(--zf-display-medium);
  font-size: 16px;
  cursor: pointer;
  text-decoration: none;
  transition: transform .15s ease, background .2s ease;
}
.zf-summary-send:hover { transform: translateY(-1px); color: var(--zf-accent); }
.zf-summary-alt {
  display: flex;
  gap: 10px;
  margin-top: 12px;
}
.zf-summary-alt a {
  flex: 1;
  text-align: center;
  padding: 13px;
  border: 1px solid rgba(255,255,255,0.25);
  border-radius: 12px;
  font-family: var(--zf-body);
  font-size: 14px;
  color: #fff;
  text-decoration: none;
  transition: background .2s ease;
}
.zf-summary-alt a:hover { background: rgba(255,255,255,0.1); color: #fff; }

/* контактные поля внутри формы */
.zf-contact-fields { display: grid; grid-template-columns: 1fr 1fr; gap: 14px; }
.zf-contact-fields input {
  width: 100%;
  padding: 16px 20px;
  border: 1px solid var(--zf-line);
  border-radius: 12px;
  font-family: var(--zf-body);
  font-size: 16px;
  background: #fff;
  color: var(--zf-accent);
}
.zf-contact-fields input:focus { outline: none; border-color: var(--zf-accent); }

@media (max-width: 991px) {
  .zf-calc-grid { grid-template-columns: 1fr; }
  .zf-summary { position: static; }
  .zf-options { grid-template-columns: 1fr; }
  .zf-contact-fields { grid-template-columns: 1fr; }
  .zf-calc-area { padding: 80px 0; }
}

/* ==========================================================================
   Соцсети — плейсхолдер «скоро»
   ========================================================================== */
.zf-social-soon {
  display: inline-flex;
  align-items: center;
  gap: 10px;
  font-family: var(--zf-body);
  font-size: 14px;
  color: var(--zf-muted);
}
.zf-social-soon .zf-soon-tag {
  font-size: 11px;
  letter-spacing: 0.08em;
  text-transform: uppercase;
  padding: 3px 8px;
  border: 1px solid var(--zf-line);
  border-radius: 20px;
  color: var(--zf-muted);
}

/* about / команда — единая гарнитура */
.design-award-content h4 { font-family: var(--zf-display) !important; font-weight: 500 !important; }
.design-award-content span { font-family: var(--zf-body) !important; }
.design-award-title-box p,
.design-choose-title-box p { font-family: var(--zf-body) !important; }

/* интро-блок «о подходе» — наполненный, по центру */
.zf-intro-points {
  display: grid;
  grid-template-columns: repeat(3, 1fr);
  gap: 32px;
  max-width: 1000px;
  margin: 48px auto 0;
}
.zf-intro-point h4 {
  font-family: var(--zf-display);
  font-size: 20px;
  letter-spacing: -0.01em;
  color: var(--zf-accent);
  margin-bottom: 10px;
}
.zf-intro-point p {
  font-family: var(--zf-body);
  font-size: 15px;
  line-height: 1.55;
  color: var(--zf-muted);
  margin: 0;
}
@media (max-width: 767px) {
  .zf-intro-points { grid-template-columns: 1fr; gap: 24px; }
}

/* ==========================================================================
   v2 REDESIGN — кастомные секции, UI/UX-эффекты (CSS + IntersectionObserver)
   ========================================================================== */

/* reveal on scroll — быстрый и короткий, чтобы при быстром скролле успевало показаться */
.zf-reveal {
  opacity: 0;
  transform: translateY(16px);
  transition: opacity .42s cubic-bezier(.22,.61,.36,1), transform .42s cubic-bezier(.22,.61,.36,1);
  will-change: opacity, transform;
}
.zf-reveal.is-in { opacity: 1; transform: none; }

/* eyebrow */
.zf-eyebrow {
  display: inline-flex;
  align-items: center;
  gap: 10px;
  font-family: var(--zf-body);
  font-size: 13px;
  letter-spacing: .16em;
  text-transform: uppercase;
  color: var(--zf-muted);
  margin-bottom: 20px;
}
.zf-eyebrow::before {
  content: "";
  width: 26px;
  height: 1px;
  background: var(--zf-accent);
  opacity: .45;
}

/* ---------- FEATURE block ---------- */
.zf-feature-area { padding: 130px 0; background: #fff; overflow: hidden; }
.zf-feature-inner {
  display: grid;
  grid-template-columns: 1fr 1.05fr;
  gap: 80px;
  align-items: center;
}
.zf-feature-text h2 {
  font-family: var(--zf-display);
  font-size: clamp(30px, 3.6vw, 54px);
  line-height: 1.05;
  letter-spacing: -.025em;
  color: var(--zf-accent);
  margin: 0 0 22px;
}
.zf-feature-text > p {
  font-family: var(--zf-body);
  font-size: 18px;
  line-height: 1.6;
  color: var(--zf-muted);
  max-width: 480px;
  margin: 0;
}
.zf-feature-rows { display: grid; gap: 8px; margin-top: 36px; }
.zf-feature-row {
  display: flex;
  gap: 18px;
  align-items: flex-start;
  padding: 14px;
  border-radius: 14px;
  transition: background .35s ease;
}
.zf-feature-row:hover { background: var(--zf-bg-soft); }
.zf-feature-ic {
  flex: 0 0 auto;
  width: 48px;
  height: 48px;
  border-radius: 13px;
  background: var(--zf-bg-soft);
  display: grid;
  place-items: center;
  color: var(--zf-accent);
  transition: background .35s ease, color .35s ease, transform .35s ease;
}
.zf-feature-ic svg { width: 22px; height: 22px; }
.zf-feature-row:hover .zf-feature-ic { background: var(--zf-accent); color: #fff; transform: translateY(-2px); }
.zf-feature-row h4 { font-family: var(--zf-display); font-size: 18px; letter-spacing: -.01em; color: var(--zf-accent); margin: 2px 0 4px; }
.zf-feature-row p { font-family: var(--zf-body); font-size: 14.5px; line-height: 1.5; color: var(--zf-muted); margin: 0; }

.zf-feature-visual { position: relative; padding: 20px; }
.zf-feature-glow {
  position: absolute;
  inset: -8% -4%;
  background: radial-gradient(closest-side, rgba(196,176,148,.45), rgba(196,176,148,0) 72%);
  filter: blur(36px);
  z-index: 0;
}
.zf-feature-figure {
  position: relative;
  z-index: 1;
  margin: 0;
  border-radius: 18px;
  overflow: hidden;
  box-shadow: 0 40px 90px rgba(0,0,0,.18);
}
.zf-feature-figure img { display: block; width: 100%; }
.zf-float { animation: zf-float 7s ease-in-out infinite; }
@keyframes zf-float {
  0%, 100% { transform: perspective(1500px) rotateY(-7deg) rotateX(2deg) translateY(0); }
  50%      { transform: perspective(1500px) rotateY(-7deg) rotateX(2deg) translateY(-14px); }
}
.zf-feature-badge {
  position: absolute;
  left: 4px;
  bottom: 44px;
  z-index: 3;
  display: flex;
  align-items: center;
  gap: 14px;
  background: #fff;
  border-radius: 16px;
  padding: 16px 20px;
  box-shadow: 0 24px 55px rgba(0,0,0,.18);
  animation: zf-float-badge 7s ease-in-out infinite .9s;
}
@keyframes zf-float-badge {
  0%, 100% { transform: translateY(0); }
  50%      { transform: translateY(-10px); }
}
.zf-badge-dot { width: 11px; height: 11px; border-radius: 50%; background: #1fae6a; box-shadow: 0 0 0 5px rgba(31,174,106,.16); }
.zf-feature-badge strong { display: block; font-family: var(--zf-display); font-size: 22px; letter-spacing: -.02em; color: var(--zf-accent); line-height: 1; }
.zf-feature-badge em { font-family: var(--zf-body); font-style: normal; font-size: 12.5px; color: var(--zf-muted); }

/* ---------- VALUES cards (#about) ---------- */
.zf-about-head { max-width: 860px; margin: 0 auto; }
.zf-about-head .zf-eyebrow { justify-content: center; }
.zf-about-title {
  font-family: var(--zf-display);
  font-size: clamp(28px, 3.4vw, 50px);
  line-height: 1.1;
  letter-spacing: -.02em;
  color: var(--zf-accent);
  margin: 0;
}
.zf-about-title span { color: var(--zf-muted); }
.zf-values {
  display: grid;
  grid-template-columns: repeat(3, 1fr);
  gap: 24px;
  max-width: 1120px;
  margin: 0 auto 96px;
}
.zf-value-card {
  background: #fff;
  border: 1px solid var(--zf-line);
  border-radius: 20px;
  padding: 40px 34px;
  transition: transform .45s cubic-bezier(.22,.61,.36,1), box-shadow .45s ease, border-color .45s ease;
}
.zf-value-card:hover {
  transform: translateY(-8px);
  box-shadow: 0 34px 70px rgba(0,0,0,.09);
  border-color: transparent;
}
.zf-value-ic {
  width: 56px; height: 56px;
  border-radius: 15px;
  background: var(--zf-bg-soft);
  display: grid; place-items: center;
  color: var(--zf-accent);
  margin-bottom: 26px;
  transition: background .45s ease, color .45s ease;
}
.zf-value-ic svg { width: 27px; height: 27px; }
.zf-value-card:hover .zf-value-ic { background: var(--zf-accent); color: #fff; }
.zf-value-card h3 { font-family: var(--zf-display); font-size: 22px; letter-spacing: -.01em; color: var(--zf-accent); margin: 0 0 12px; }
.zf-value-card p { font-family: var(--zf-body); font-size: 15.5px; line-height: 1.55; color: var(--zf-muted); margin: 0; }

/* ---------- SERVICES header ---------- */
.zf-services-head { text-align: center; max-width: 700px; margin: 0 auto 72px; }
.zf-services-head .zf-eyebrow { justify-content: center; }
.zf-services-head .zf-eyebrow::after {
  content: "";
  width: 26px; height: 1px;
  background: var(--zf-accent);
  opacity: .45;
}
.zf-services-title {
  font-family: var(--zf-display);
  font-size: clamp(54px, 8vw, 128px);
  line-height: .98;
  letter-spacing: -.035em;
  color: var(--zf-accent);
  margin: 4px 0 22px;
}
.zf-services-head p { font-family: var(--zf-body); font-size: 17px; line-height: 1.55; color: var(--zf-muted); margin: 0; }

/* ---------- WIZARD form ---------- */
.zf-wizard {
  display: grid;
  grid-template-columns: 1.55fr 1fr;
  gap: 36px;
  align-items: start;
}
.zf-wizard-main {
  background: #fff;
  border: 1px solid var(--zf-line);
  border-radius: 22px;
  padding: 42px;
}
.zf-steps-nav { margin-bottom: 36px; }
.zf-steps-row { display: flex; gap: 26px; margin-bottom: 18px; flex-wrap: wrap; }
.zf-step-dot {
  display: inline-flex;
  align-items: center;
  gap: 10px;
  border: none;
  background: transparent;
  padding: 0;
  cursor: pointer;
  font-family: var(--zf-body);
  font-size: 14.5px;
  color: var(--zf-muted);
  transition: color .3s ease;
}
.zf-step-dot span {
  width: 28px; height: 28px;
  border-radius: 50%;
  border: 1.5px solid var(--zf-line);
  display: grid; place-items: center;
  font-family: var(--zf-display); font-size: 13px;
  color: var(--zf-muted);
  transition: all .3s ease;
}
.zf-step-dot.is-active { color: var(--zf-accent); }
.zf-step-dot.is-active span,
.zf-step-dot.is-done span { background: var(--zf-accent); color: #fff; border-color: var(--zf-accent); }
.zf-steps-bar { height: 3px; background: var(--zf-line); border-radius: 3px; overflow: hidden; }
.zf-steps-bar i { display: block; height: 100%; width: 0; background: var(--zf-accent); border-radius: 3px; transition: width .55s cubic-bezier(.22,.61,.36,1); }

.zf-step { display: none; }
.zf-step.is-active { display: block; animation: zf-step-in .45s cubic-bezier(.22,.61,.36,1); }
@keyframes zf-step-in { from { opacity: 0; transform: translateX(16px); } to { opacity: 1; transform: none; } }
.zf-step-head h3 { font-family: var(--zf-display); font-size: clamp(24px, 3vw, 32px); letter-spacing: -.02em; color: var(--zf-accent); margin: 0 0 8px; }
.zf-step-head p { font-family: var(--zf-body); font-size: 15.5px; line-height: 1.55; color: var(--zf-muted); margin: 0 0 28px; max-width: 540px; }

.zf-step-foot { display: flex; align-items: center; justify-content: space-between; gap: 16px; margin-top: 30px; }
.zf-step-counter { font-family: var(--zf-body); font-size: 13px; color: var(--zf-muted); }

.zf-btn {
  display: inline-flex;
  align-items: center;
  gap: 9px;
  border: none;
  cursor: pointer;
  font-family: var(--zf-display-medium);
  font-size: 15.5px;
  padding: 14px 24px;
  border-radius: 12px;
  text-decoration: none;
  transition: transform .2s ease, background .25s ease, box-shadow .25s ease, color .25s ease, border-color .25s ease;
}
.zf-btn svg { width: 18px; height: 18px; }
.zf-btn-dark { background: var(--zf-accent); color: #fff; }
.zf-btn-dark:hover { transform: translateY(-2px); box-shadow: 0 14px 28px rgba(0,0,0,.22); color: #fff; }
.zf-btn-ghost { background: transparent; color: var(--zf-accent); border: 1px solid var(--zf-line); }
.zf-btn-ghost:hover { border-color: var(--zf-accent); background: var(--zf-bg-soft); color: var(--zf-accent); }

.zf-send-grid { display: grid; grid-template-columns: repeat(3, 1fr); gap: 12px; margin: 26px 0 4px; }
.zf-btn-send { justify-content: center; padding: 16px 14px; color: #fff; }
.zf-btn-send:hover { transform: translateY(-2px); box-shadow: 0 16px 32px rgba(0,0,0,.2); color: #fff; }
.zf-btn-max { background: #0b0b0c; }
.zf-btn-tg { background: #29a9eb; }
.zf-btn-call { background: #1fae6a; }

.zf-summary-trust { display: grid; gap: 10px; margin-top: 4px; }
.zf-summary-trust span { display: flex; align-items: center; gap: 9px; font-family: var(--zf-body); font-size: 13px; color: rgba(255,255,255,.72); }
.zf-summary-trust svg { width: 16px; height: 16px; color: #5fd49b; flex: 0 0 auto; }

.zf-shake { animation: zf-shake .42s ease; }
@keyframes zf-shake { 0%,100%{transform:translateX(0)} 20%{transform:translateX(-7px)} 40%{transform:translateX(7px)} 60%{transform:translateX(-5px)} 80%{transform:translateX(5px)} }

/* responsive */
@media (max-width: 991px) {
  .zf-feature-area { padding: 80px 0; }
  .zf-feature-inner { grid-template-columns: 1fr; gap: 48px; }
  .zf-feature-visual { padding: 8px; max-width: 560px; }
  .zf-float { animation: none; }
  .zf-feature-figure { transform: none; }
  .zf-values { grid-template-columns: 1fr; gap: 16px; margin-bottom: 60px; }
  .zf-wizard { grid-template-columns: 1fr; }
  .zf-wizard-main { padding: 26px; }
  .zf-send-grid { grid-template-columns: 1fr; }
  .zf-steps-row { gap: 16px; }
  .zf-step-dot { font-size: 13px; }
}

/* reduced motion */
@media (prefers-reduced-motion: reduce) {
  .zf-reveal { opacity: 1 !important; transform: none !important; }
  .zf-float, .zf-feature-badge { animation: none !important; }
  .zf-step.is-active { animation: none !important; }
}

/* ---------- PROCESS timeline (#contact) ---------- */
.design-award-title-box .zf-eyebrow { justify-content: center; }
.zf-process {
  position: relative;
  display: grid;
  grid-template-columns: repeat(4, 1fr);
  gap: 24px;
  max-width: 1180px;
  margin: 0 auto;
}
.zf-process-line {
  position: absolute;
  top: 54px;
  left: 11%;
  right: 11%;
  height: 1px;
  background: linear-gradient(90deg, transparent, var(--zf-line) 14%, var(--zf-line) 86%, transparent);
  z-index: 0;
}
.zf-process-step {
  position: relative;
  z-index: 1;
  background: #fff;
  border: 1px solid var(--zf-line);
  border-radius: 18px;
  padding: 30px 26px;
  transition: transform .4s cubic-bezier(.22,.61,.36,1), box-shadow .4s ease, border-color .4s ease;
}
.zf-process-step:hover {
  transform: translateY(-6px);
  box-shadow: 0 28px 56px rgba(0,0,0,.08);
  border-color: transparent;
}
.zf-process-num {
  display: inline-grid;
  place-items: center;
  width: 50px; height: 50px;
  border-radius: 50%;
  background: var(--zf-accent);
  color: #fff;
  font-family: var(--zf-display);
  font-size: 18px;
  margin-bottom: 22px;
}
.zf-process-dur {
  position: absolute;
  top: 38px; right: 26px;
  font-family: var(--zf-body);
  font-size: 13px;
  color: var(--zf-muted);
  padding: 5px 12px;
  border: 1px solid var(--zf-line);
  border-radius: 20px;
}
.zf-process-step h4 { font-family: var(--zf-display); font-size: 19px; letter-spacing: -.01em; color: var(--zf-accent); margin: 0 0 9px; }
.zf-process-step p { font-family: var(--zf-body); font-size: 14.5px; line-height: 1.5; color: var(--zf-muted); margin: 0; }

@media (max-width: 991px) {
  .zf-process { grid-template-columns: repeat(2, 1fr); gap: 16px; }
  .zf-process-line { display: none; }
}
@media (max-width: 575px) {
  .zf-process { grid-template-columns: 1fr; }
}

/* ---------- описание под кейсом ---------- */
.zf-project-desc {
  font-family: var(--zf-body);
  font-size: 16px;
  line-height: 1.55;
  color: var(--zf-muted);
  max-width: 440px;
  margin: 16px 0 0;
}

/* ---------- услуги: фикс растянутых/искажённых превью ---------- */
.design-service-img {
  object-fit: cover !important;
  height: 130px !important;
  width: 190px !important;
  border-radius: 12px !important;
  box-shadow: 0 18px 40px rgba(0,0,0,.14);
}
/* мягкий наклон вместо агрессивного scale(1.4) rotate(-20deg) */
.design-service-accordion .accordion-buttons:not(.collapsed) img {
  transform: scale(1.06) rotate(-5deg) translate(-12px, 10px) !important;
}
/* плавное авто-раскрытие при скролле */
.design-service-accordion .accordion-collapse {
  transition: height .5s cubic-bezier(.22,.61,.36,1);
}

/* ---------- услуги: плавное появление + лёгкий отступ неактивных ---------- */
/* плавная анимация высоты (Bootstrap по умолчанию .35s — делаем мягче) */
.design-service-accordion .accordion-collapse.collapsing {
  transition: height .55s cubic-bezier(.22, .61, .36, 1);
}
/* контент услуги мягко проявляется и чуть приподнимается */
.design-service-accordion .accordion-body {
  opacity: 0;
  transform: translateY(10px);
  transition: opacity .55s ease .08s, transform .55s cubic-bezier(.22,.61,.36,1) .08s;
}
.design-service-accordion .accordion-collapse.show .accordion-body {
  opacity: 1;
  transform: none;
}
/* активный пункт — в фокусе, неактивные совсем чуть «уходят назад» */
.design-service-accordion .accordion-items {
  transition: opacity .55s ease, transform .55s cubic-bezier(.22,.61,.36,1), filter .55s ease;
}
.design-service-accordion .accordion-items:not(.is-current) {
  opacity: .62;
  transform: scale(.985);
}
.design-service-accordion .accordion-items.is-current {
  opacity: 1;
  transform: none;
}
@media (max-width: 767px) {
  /* на мобиле без «затемнения» — всё читаемо */
  .design-service-accordion .accordion-items:not(.is-current) { opacity: 1; transform: none; }
}
@media (prefers-reduced-motion: reduce) {
  .design-service-accordion .accordion-body { opacity: 1 !important; transform: none !important; }
  .design-service-accordion .accordion-items:not(.is-current) { opacity: 1; transform: none; }
}

/* ==========================================================================
   v3 — мобильные фиксы, шрифт, прелоадер, команда-дорожка
   ========================================================================== */

/* --- прелоадер: убираем кислотно-зелёный --- */
#preloader { background-color: #ffffff !important; }
.preloader span { background: var(--zf-accent) !important; }
.green-bg { background-color: var(--zf-bg-soft) !important; }

/* --- курсор: прячем на тач/мобиле --- */
@media (hover: none), (max-width: 991px) {
  #magic-cursor, #ball { display: none !important; }
  body.tp-magic-cursor, body.tp-magic-cursor a, body.tp-magic-cursor button { cursor: auto !important; }
}

/* --- ШРИФТ: фирменный Clash почти везде (кроме полей формы) --- */
:root {
  --tp-ff-body: "ClashDisplay-Semibold", "Inter", sans-serif;
  --tp-ff-p: "ClashDisplay-Semibold", "Inter", sans-serif;
  --tp-ff-heading: "ClashDisplay-Semibold", "Inter", sans-serif;
  --tp-ff-inter: "ClashDisplay-Semibold", "Inter", sans-serif;
  --tp-ff-onest: "ClashDisplay-Semibold", "Inter", sans-serif;
  --zf-body: "ClashDisplay-Semibold", "Inter", sans-serif;
}
body, p, span, a, li, div { font-family: var(--tp-ff-body); }
h1, h2, h3, h4, h5, h6 { font-family: var(--tp-ff-heading); }
/* поля и текст калькулятора — оставляем читаемый Inter */
.zf-wizard input, .zf-opt-name, .zf-opt-desc, .zf-opt-price, .zf-hint,
.zf-step-head p, .zf-summary-line, .zf-summary-note, .zf-summary-empty,
.zf-summary-trust, .zf-contact-fields input {
  font-family: "Inter", sans-serif !important;
}

/* --- дорожка команды (роли + стрелки) --- */
.zf-team-sub { font-family: var(--zf-body); font-size: 17px; line-height: 1.55; color: var(--zf-muted); max-width: 600px; margin: 0 auto; }
.zf-team {
  display: flex;
  align-items: stretch;
  justify-content: center;
  gap: 14px;
  max-width: 1180px;
  margin: 0 auto;
}
.zf-team-step {
  flex: 1;
  background: #fff;
  border: 1px solid var(--zf-line);
  border-radius: 18px;
  padding: 32px 24px;
  text-align: center;
  transition: transform .45s cubic-bezier(.22,.61,.36,1), box-shadow .45s ease, border-color .45s ease;
}
.zf-team-step:hover { transform: translateY(-6px); box-shadow: 0 28px 56px rgba(0,0,0,.09); border-color: transparent; }
.zf-team-ic {
  width: 56px; height: 56px;
  border-radius: 15px;
  background: var(--zf-bg-soft);
  display: grid; place-items: center;
  color: var(--zf-accent);
  margin: 0 auto 20px;
  transition: background .4s ease, color .4s ease;
}
.zf-team-ic svg { width: 27px; height: 27px; }
.zf-team-step:hover .zf-team-ic { background: var(--zf-accent); color: #fff; }
.zf-team-step h4 { font-family: var(--zf-display); font-size: 20px; letter-spacing: -.01em; color: var(--zf-accent); margin: 0 0 10px; }
.zf-team-step p { font-family: var(--zf-body); font-size: 14px; line-height: 1.5; color: var(--zf-muted); margin: 0; }
.zf-team-arrow { flex: 0 0 auto; display: flex; align-items: center; color: #c4c4c8; }
.zf-team-arrow svg { width: 26px; height: 26px; }
@media (max-width: 991px) {
  .zf-team { flex-direction: column; align-items: stretch; gap: 8px; }
  .zf-team-arrow { justify-content: center; transform: rotate(90deg); margin: 4px 0; }
}

/* --- CTA после работ --- */
.zf-projects-cta { display: flex; flex-direction: column; align-items: center; gap: 22px; text-align: center; margin-top: 50px; }
.zf-projects-cta p { font-family: var(--zf-display); font-size: clamp(22px, 3vw, 32px); letter-spacing: -.015em; color: var(--zf-accent); margin: 0; }

/* ==========================================================================
   МОБАЙЛ — компактные блоки
   ========================================================================== */
@media (max-width: 767px) {
  /* цифры 15+/3+/100%/1ч — по 2 в ряд, компактно */
  .design-choose-area .design-choose-item-wrap .col-xl-6 { flex: 0 0 50%; max-width: 50%; }
  .design-choose-item { padding: 22px 10px !important; text-align: center; }
  .design-choose-item span { font-size: clamp(40px, 13vw, 60px) !important; line-height: 1 !important; }
  .design-choose-item span i { font-size: .5em; }
  .design-choose-item p { font-size: 12.5px !important; line-height: 1.35 !important; margin-top: 8px; }
  .design-choose-area { padding-top: 70px !important; padding-bottom: 60px !important; }

  /* почему мы — карточки компактнее */
  .zf-value-card { padding: 26px 22px; }
  .zf-value-ic { width: 46px; height: 46px; margin-bottom: 16px; }
  .zf-value-ic svg { width: 22px; height: 22px; }
  .zf-value-card h3 { font-size: 19px; margin-bottom: 8px; }
  .zf-value-card p { font-size: 14.5px; }
  .zf-values { gap: 12px; }

  /* отзывы — компактная карточка, гасим гигантскую 5.0 */
  .design-testimonial-area { padding-top: 70px !important; padding-bottom: 80px !important; }
  .design-testimonial-item { padding: 26px 22px !important; }
  .design-testimonial-review h4 { font-size: 40px !important; line-height: 1 !important; }
  .design-testimonial-text p { font-size: 15px !important; line-height: 1.5 !important; }
  .design-testimonial-author h4 { font-size: 18px !important; }

  /* услуги — аккуратное фото активного пункта на мобиле */
  .design-service-accordion .accordion-buttons { display: block; position: relative; }
  .design-service-accordion .design-service-img { display: none !important; }
  .design-service-accordion .accordion-items.is-current .accordion-buttons img.design-service-img {
    display: block !important;
    position: static !important;
    width: 100% !important;
    height: 200px !important;
    object-fit: cover !important;
    border-radius: 14px !important;
    transform: none !important;
    margin-top: 18px !important;
    box-shadow: 0 14px 30px rgba(0,0,0,.12);
  }
  .design-service-area .col-xl-11 { padding-left: 14px; padding-right: 14px; }

  /* отступы крупных секций потеснее */
  .zf-feature-area { padding: 64px 0 !important; }
  .design-award-area { padding-bottom: 70px !important; }
}

/* --- hero на весь экран на мобиле --- */
@media (max-width: 767px) {
  .design-hero-area {
    min-height: 100vh;
    min-height: 100svh;
    display: flex;
    align-items: center;
  }
  .design-hero-area .design-hero-ptb {
    width: 100%;
    padding-top: 96px;
    padding-bottom: 48px;
  }
  .design-hero-content-wrap { margin-bottom: 0 !important; }
}

/* --- hero слоган: акцент на «бесплатно» --- */
.design-hero-content p b {
  font-weight: inherit;
  color: var(--zf-accent);
  border-bottom: 2px solid var(--zf-accent);
  padding-bottom: 1px;
}
@media (max-width: 767px) {
  /* слоган крупный, но помещается целиком и читается */
  .design-hero-slide-text span,
  .zf-tw-text {
    font-size: clamp(22px, 7vw, 38px) !important;
    white-space: nowrap;
    line-height: 1.1 !important;
  }
  .design-hero-content p { font-size: 16px !important; line-height: 1.5 !important; }

  /* На мобиле Swiper иногда не инициализируется и слайды слогана
     складываются в столбик на много экранов — фиксируем статичный
     первый слайд, прячем остальные. */
  .design-hero-slide-active { height: auto !important; }
  .design-hero-slide-active .swiper-wrapper {
    display: block !important;
    transform: none !important;
    height: auto !important;
  }
  .design-hero-slide-active .swiper-slide { display: none !important; }
  .design-hero-slide-active .swiper-slide:first-child { display: block !important; }

  /* гарантируем видимость hero-контента независимо от GSAP-анимаций */
  .design-hero-wrap,
  .design-hero-content,
  .design-hero-content-wrap,
  .design-hero-area .tp_text_anim,
  .design-hero-area .tp_fade_anim {
    opacity: 1 !important;
    transform: none !important;
    visibility: visible !important;
  }
  .design-hero-wrap { margin-bottom: 20px; }
}

/* --- логотип (монограмма Z + wordmark) --- */
.zf-logo { display: inline-flex; align-items: center; gap: 11px; text-decoration: none; }
.zf-logo-mark { display: inline-flex; flex: 0 0 auto; }
.zf-logo-mark svg { width: 36px; height: 36px; display: block; }
/* инвертируем знак на тёмных секциях */
.footer-black-bg .zf-logo-mark svg,
.dark-bg .zf-logo-mark svg { filter: invert(1); }
.zf-logo .zf-logo-text,
.tp-header-logo .zf-logo-text,
.tp-offcanvas-2-logo .zf-logo-text {
  font-family: "Unbounded", sans-serif !important;
  font-weight: 800 !important;
  font-size: 16px !important;
  letter-spacing: -0.01em !important;
  color: var(--zf-accent);
  line-height: 1;
  text-transform: lowercase;
  white-space: nowrap;
}
.zf-logo-sub { color: var(--zf-muted); margin-left: 6px; }
/* в тёмных контекстах (если понадобится) */
.footer-black-bg .zf-logo-text, .dark-bg .zf-logo-text { color: #fff; }
@media (max-width: 575px) {
  .zf-logo-text { font-size: 17px; }
  .zf-logo-mark svg { width: 30px; height: 30px; }
}

/* ==========================================================================
   Вакансии
   ========================================================================== */
.zf-vacancy-area { padding: 120px 0; background: var(--zf-bg-soft); }
.zf-vacancy-inner { display: grid; grid-template-columns: 1fr 1fr; gap: 64px; align-items: center; }
.zf-vacancy-figure { position: relative; }
.zf-vacancy-figure img { width: 100%; border-radius: 20px; box-shadow: 0 40px 80px rgba(0,0,0,.14); display: block; }
.zf-vacancy-badge {
  position: absolute; right: -16px; bottom: 28px;
  background: var(--zf-accent); color: #fff;
  border-radius: 16px; padding: 16px 22px; text-align: center;
  box-shadow: 0 22px 50px rgba(0,0,0,.22);
}
.zf-vacancy-badge strong { display: block; font-family: var(--zf-display); font-size: 24px; letter-spacing: -.02em; line-height: 1; }
.zf-vacancy-badge em { font-style: normal; font-size: 13px; color: rgba(255,255,255,.7); }
.zf-vacancy-content h2 { font-family: var(--zf-display); font-size: clamp(30px, 4vw, 50px); line-height: 1.05; letter-spacing: -.025em; color: var(--zf-accent); margin: 0 0 16px; }
.zf-vacancy-content > p { font-family: var(--zf-body); font-size: 17px; line-height: 1.6; color: var(--zf-muted); margin: 0 0 30px; max-width: 480px; }
.zf-vacancy-list { list-style: none; padding: 0; margin: 0 0 30px; display: grid; gap: 16px; }
.zf-vacancy-list li { display: flex; gap: 14px; align-items: flex-start; font-family: var(--zf-body); font-size: 15px; line-height: 1.45; color: var(--zf-muted); }
.zf-vacancy-list svg { width: 22px; height: 22px; flex: 0 0 auto; color: var(--zf-accent); margin-top: 1px; }
.zf-vacancy-list b { font-weight: inherit; color: var(--zf-accent); }
.zf-vacancy-roles { display: flex; flex-wrap: wrap; gap: 10px; align-items: center; margin-bottom: 32px; }
.zf-vacancy-roles span { font-family: var(--zf-body); font-size: 14px; color: var(--zf-muted); margin-right: 2px; }
.zf-vacancy-roles a { font-family: var(--zf-body); font-size: 14px; padding: 9px 16px; border: 1px solid var(--zf-line); border-radius: 22px; color: var(--zf-accent); background: #fff; text-decoration: none; transition: border-color .25s ease, transform .2s ease; }
.zf-vacancy-roles a:hover { border-color: var(--zf-accent); transform: translateY(-1px); }
@media (max-width: 991px) {
  .zf-vacancy-area { padding: 72px 0; }
  .zf-vacancy-inner { grid-template-columns: 1fr; gap: 40px; }
  .zf-vacancy-badge { right: 14px; bottom: 14px; padding: 13px 18px; }
  .zf-vacancy-badge strong { font-size: 20px; }
}

/* ==========================================================================
   reg.ru-конкурент: новые секции (Почему мы, Тарифы, Зачем, Что получите,
   Панель, Стена проектов, Как работаем, CTA, модалка)
   ========================================================================== */

/* --- общие заголовки секций --- */
.zf-why-head, .zf-tariffs-head, .zf-wall-head, .zf-get-head {
  max-width: 760px; margin: 0 auto 56px; text-align: center;
}
.zf-why-title, .zf-tariffs-title, .zf-wall-title, .zf-get-title, .zf-whysite-lead h2 {
  font-family: var(--zf-display); font-weight: 700; letter-spacing: -.02em;
  color: var(--zf-accent); margin: 14px 0 16px;
  font-size: clamp(20px, 3vw, 36px); line-height: 1.1;
}
.zf-why-title span, .zf-tariffs-title span { color: var(--zf-gold); }
.zf-why-head p, .zf-tariffs-head p, .zf-wall-head p, .zf-whysite-lead p {
  font-family: var(--zf-body); font-size: 17px; line-height: 1.6; color: var(--zf-muted); margin: 0;
}
.zf-why-head p, .zf-tariffs-head p, .zf-wall-head p { margin: 0 auto; }

/* --- Почему мы (3 колонки) --- */
.zf-why-area { background: #fff; }
.zf-why-grid { display: grid; grid-template-columns: repeat(3, 1fr); gap: 24px; }
.zf-why-card {
  background: var(--zf-bg-soft); border: 1px solid var(--zf-line);
  border-radius: 20px; padding: 34px 30px; transition: transform .3s ease, box-shadow .3s ease;
}
.zf-why-card:hover { transform: translateY(-4px); box-shadow: 0 26px 50px rgba(0,0,0,.08); }
.zf-why-ic {
  display: inline-flex; width: 54px; height: 54px; align-items: center; justify-content: center;
  background: #fff; border: 1px solid var(--zf-line); border-radius: 14px; margin-bottom: 22px;
}
.zf-why-ic svg { width: 26px; height: 26px; color: var(--zf-gold); }
.zf-why-card h3 { font-family: var(--zf-display); font-size: 21px; letter-spacing: -.01em; color: var(--zf-accent); margin: 0 0 10px; }
.zf-why-card p { font-family: var(--zf-body); font-size: 15px; line-height: 1.55; color: var(--zf-muted); margin: 0; }

/* --- Тарифы --- */
.zf-tariffs-area { background: var(--zf-bg-soft); }
.zf-tariff-toggle {
  position: relative; display: flex; width: fit-content; gap: 4px; margin: 0 auto 48px;
  padding: 6px; background: #fff; border: 1px solid var(--zf-line); border-radius: 999px;
}
.zf-toggle-btn {
  position: relative; z-index: 2; display: inline-flex; align-items: center; gap: 9px;
  border: 0; background: transparent; cursor: pointer;
  font-family: var(--zf-display); font-size: 15.5px; color: var(--zf-muted);
  padding: 12px 26px; border-radius: 999px; transition: color .3s ease;
}
.zf-toggle-btn svg { width: 18px; height: 18px; }
.zf-toggle-btn.is-active { color: #fff; }
.zf-toggle-pill {
  position: absolute; z-index: 1; top: 6px; left: 0; height: calc(100% - 12px);
  background: var(--zf-accent); border-radius: 999px;
  transition: transform .35s cubic-bezier(.4,0,.2,1), width .35s cubic-bezier(.4,0,.2,1);
}

.zf-tariff-grid { display: none; grid-template-columns: repeat(3, 1fr); gap: 24px; align-items: stretch; }
.zf-tariff-grid.is-active { display: grid; animation: zf-fade-up .45s ease both; }
@keyframes zf-fade-up { from { opacity: 0; transform: translateY(14px); } to { opacity: 1; transform: none; } }

.zf-tariff-card {
  position: relative; display: flex; flex-direction: column;
  background: #fff; border: 1px solid var(--zf-line); border-radius: 22px;
  padding: 34px 30px; transition: transform .3s ease, box-shadow .3s ease, border-color .3s ease;
}
.zf-tariff-card:hover { transform: translateY(-5px); box-shadow: 0 30px 60px rgba(0,0,0,.1); }
.zf-tariff-card.is-featured { border-color: var(--zf-accent); box-shadow: 0 30px 70px rgba(0,0,0,.14); }
.zf-tariff-tag {
  position: absolute; top: -13px; left: 30px;
  background: var(--zf-gold); color: #fff; font-family: var(--zf-body); font-weight: 600;
  font-size: 12px; letter-spacing: .03em; padding: 6px 14px; border-radius: 999px;
}
.zf-tariff-top h3 { font-family: var(--zf-display); font-size: 24px; letter-spacing: -.015em; color: var(--zf-accent); margin: 0 0 6px; }
.zf-tariff-cap { font-family: var(--zf-body); font-size: 14px; color: var(--zf-muted); margin: 0 0 22px; min-height: 38px; }
.zf-tariff-price { padding: 0 0 18px; border-bottom: 1px solid var(--zf-line); margin-bottom: 20px; }
.zf-price-now { display: block; font-family: var(--zf-display); font-size: 34px; letter-spacing: -.025em; color: var(--zf-accent); line-height: 1; }
.zf-price-split { display: block; margin-top: 9px; font-family: var(--zf-body); font-size: 13.5px; color: var(--zf-muted); }
.zf-price-split i { font-style: normal; display: inline-block; margin-left: 4px; padding: 2px 8px; border-radius: 6px; background: var(--zf-gold-soft); color: #8a6d3f; font-weight: 600; font-size: 11.5px; letter-spacing: .02em; }
.zf-tariff-meta { margin-bottom: 18px; }
.zf-tariff-meta span { display: inline-flex; align-items: center; gap: 7px; font-family: var(--zf-body); font-size: 13.5px; color: var(--zf-accent); font-weight: 500; }
.zf-tariff-meta svg { width: 17px; height: 17px; color: var(--zf-gold); }
.zf-tariff-list { list-style: none; padding: 0; margin: 0 0 26px; display: grid; gap: 11px; flex: 1; }
.zf-tariff-list li { position: relative; padding-left: 26px; font-family: var(--zf-body); font-size: 14.5px; line-height: 1.45; color: #3a3a3e; }
.zf-tariff-list li::before {
  content: ""; position: absolute; left: 0; top: 4px; width: 16px; height: 16px;
  background: var(--zf-gold-soft) url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='none' stroke='%238a6d3f' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpath d='M20 6L9 17l-5-5'/%3E%3C/svg%3E") center/11px no-repeat;
  border-radius: 5px;
}
.zf-tariff-card .zf-btn { width: 100%; justify-content: center; margin-top: auto; }
.zf-btn-accent { background: var(--zf-gold); color: #fff; }
.zf-btn-accent:hover { background: #a07e54; color: #fff; transform: translateY(-2px); box-shadow: 0 14px 28px rgba(160,126,84,.32); }
.zf-tariff-foot { text-align: center; margin: 40px 0 0; font-family: var(--zf-body); font-size: 15px; color: var(--zf-muted); }
.zf-tariff-foot a { color: var(--zf-accent); text-decoration: underline; text-underline-offset: 3px; }

/* --- Зачем бизнесу сайт --- */
.zf-whysite-area { background: #fff; }
.zf-whysite-lead { max-width: 720px; margin: 0 0 50px; }
.zf-whysite-lead p { margin-top: 16px; }
.zf-whysite-cols { display: grid; grid-template-columns: repeat(3, 1fr); gap: 40px; }
.zf-whysite-col { border-top: 2px solid var(--zf-accent); padding-top: 22px; }
.zf-whysite-num { font-family: var(--zf-display); font-size: 15px; color: var(--zf-gold); letter-spacing: .05em; }
.zf-whysite-col h4 { font-family: var(--zf-display); font-size: 20px; letter-spacing: -.01em; color: var(--zf-accent); margin: 12px 0 8px; }
.zf-whysite-col p { font-family: var(--zf-body); font-size: 15px; line-height: 1.55; color: var(--zf-muted); margin: 0; }

/* --- Что вы получите (бенто) --- */
.zf-get-area { background: #fff; }
.zf-bento { display: grid; grid-template-columns: repeat(4, 1fr); gap: 20px; }
.zf-bento-card {
  background: var(--zf-bg-soft); border: 1px solid var(--zf-line); border-radius: 20px;
  padding: 30px 28px; transition: transform .3s ease, box-shadow .3s ease;
}
.zf-bento-card:hover { transform: translateY(-4px); box-shadow: 0 24px 48px rgba(0,0,0,.08); }
.zf-bento-lg { grid-column: span 2; grid-row: span 2; background: var(--zf-accent); border-color: var(--zf-accent); }
.zf-bento-lg h3, .zf-bento-lg p { color: #fff; }
.zf-bento-lg .zf-bento-ic { background: rgba(255,255,255,.1); border-color: rgba(255,255,255,.16); }
.zf-bento-lg .zf-bento-ic svg { color: #fff; }
.zf-bento-wide { grid-column: span 2; }
.zf-bento-ic { display: inline-flex; width: 50px; height: 50px; align-items: center; justify-content: center; background: #fff; border: 1px solid var(--zf-line); border-radius: 13px; margin-bottom: 20px; }
.zf-bento-ic svg { width: 24px; height: 24px; color: var(--zf-gold); }
.zf-bento-card h3 { font-family: var(--zf-display); font-size: 19px; letter-spacing: -.01em; color: var(--zf-accent); margin: 0 0 8px; }
.zf-bento-lg h3 { font-size: 28px; }
.zf-bento-card p { font-family: var(--zf-body); font-size: 14.5px; line-height: 1.5; color: var(--zf-muted); margin: 0; }

/* --- Панель: список галочек + 2-й скрин --- */
.zf-checklist { list-style: none; padding: 0; margin: 6px 0 22px; display: grid; gap: 13px; }
.zf-checklist li { display: flex; gap: 12px; align-items: flex-start; font-family: var(--zf-body); font-size: 15.5px; line-height: 1.45; color: #2c2c30; }
.zf-checklist svg { width: 20px; height: 20px; flex: 0 0 auto; color: #1fae6a; margin-top: 1px; }
.zf-feature-note { font-family: var(--zf-body); font-size: 14px; color: var(--zf-muted); margin: 0; font-style: italic; }
.zf-feature-figure-2 {
  position: absolute; right: -6px; bottom: -26px; width: 56%; z-index: 2;
  border-radius: 14px; box-shadow: 0 30px 60px rgba(0,0,0,.22); border: 4px solid #fff;
}
.zf-float-slow { animation: zf-float2 8.5s ease-in-out infinite; }
@keyframes zf-float2 {
  0%, 100% { transform: perspective(1500px) rotateY(-7deg) rotateX(2deg) translateY(8px); }
  50%      { transform: perspective(1500px) rotateY(-7deg) rotateX(2deg) translateY(-6px); }
}

/* --- Стена проектов (горизонтальный marquee) --- */
.zf-wall-area { background: var(--zf-bg-soft); overflow: hidden; }
.zf-wall { display: grid; gap: 22px; margin: 0 0 56px; }
.zf-wall-row { position: relative; display: flex; gap: 22px; width: max-content; }
.zf-wall-row::before, .zf-wall-row::after { content: none; }
.zf-wall-track { display: flex; gap: 22px; flex: 0 0 auto; }
.zf-wall-row-a { animation: zf-marquee 60s linear infinite; }
.zf-wall-row-b { animation: zf-marquee-rev 68s linear infinite; }
.zf-wall:hover .zf-wall-row { animation-play-state: paused; }
@keyframes zf-marquee     { from { transform: translateX(0); }      to { transform: translateX(-50%); } }
@keyframes zf-marquee-rev { from { transform: translateX(-50%); }   to { transform: translateX(0); } }
.zf-wall-card {
  position: relative; flex: 0 0 auto; width: 340px; margin: 0;
  border-radius: 16px; overflow: hidden; background: #fff;
  border: 1px solid var(--zf-line); box-shadow: 0 18px 40px rgba(0,0,0,.08);
}
.zf-wall-card img { display: block; width: 100%; height: 240px; object-fit: cover; object-position: top center; }
.zf-wall-card { display: block; text-decoration: none; transition: transform .35s ease, box-shadow .35s ease; }
.zf-wall-card:hover { transform: translateY(-6px); box-shadow: 0 26px 54px rgba(0,0,0,.16); }
.zf-wall-card:focus-visible { outline: 2px solid var(--zf-accent); outline-offset: 3px; }
.zf-wall-cap {
  position: absolute; left: 0; right: 0; bottom: 0; padding: 28px 18px 14px;
  background: linear-gradient(to top, rgba(11,11,12,.88), rgba(11,11,12,0));
  color: #fff; font-family: var(--zf-display); font-size: 17px; letter-spacing: -.01em;
  display: flex; align-items: baseline; justify-content: space-between; gap: 10px;
}
.zf-wall-cap span { font-family: var(--zf-body); font-size: 12px; font-weight: 500; color: rgba(255,255,255,.72); letter-spacing: .01em; }
.zf-wall-cta { text-align: center; }
.zf-wall-cta p { font-family: var(--zf-display); font-size: clamp(20px, 2.6vw, 28px); letter-spacing: -.02em; color: var(--zf-accent); margin: 0 0 20px; }

/* --- Как мы работаем (аккордеон шагов) --- */
.zf-how-area { background: #fff; }
.zf-how-inner { display: grid; grid-template-columns: 0.85fr 1.15fr; gap: 64px; align-items: start; }
.zf-how-aside { position: sticky; top: 110px; }
.zf-how-aside h2 { font-family: var(--zf-display); font-weight: 700; font-size: clamp(19px, 2.6vw, 32px); line-height: 1.12; letter-spacing: -.02em; color: var(--zf-accent); margin: 14px 0 16px; }
.zf-how-aside > p { font-family: var(--zf-body); font-size: 16px; line-height: 1.6; color: var(--zf-muted); margin: 0 0 26px; }
.zf-how-guarantee { display: flex; gap: 13px; align-items: center; padding: 18px 20px; background: var(--zf-gold-soft); border-radius: 14px; }
.zf-how-guarantee svg { width: 26px; height: 26px; flex: 0 0 auto; color: var(--zf-gold); }
.zf-how-guarantee span { font-family: var(--zf-body); font-size: 14.5px; line-height: 1.4; color: #6a5536; font-weight: 500; }
.zf-steps-accordion { display: grid; gap: 12px; }
.zf-step-item { border: 1px solid var(--zf-line); border-radius: 16px; overflow: hidden; background: #fff; transition: border-color .3s ease, box-shadow .3s ease; }
.zf-step-item:has(.accordion-collapse.show) { border-color: var(--zf-accent); box-shadow: 0 18px 40px rgba(0,0,0,.07); }
.zf-step-btn {
  width: 100%; display: flex; align-items: center; gap: 18px; cursor: pointer;
  border: 0; background: transparent; padding: 22px 24px; text-align: left;
}
.zf-step-no { font-family: var(--zf-display); font-size: 15px; color: var(--zf-gold); flex: 0 0 auto; width: 26px; }
.zf-step-name { font-family: var(--zf-display); font-size: 19px; letter-spacing: -.01em; color: var(--zf-accent); flex: 1; }
.zf-step-chev { flex: 0 0 auto; transition: transform .3s ease; color: var(--zf-muted); }
.zf-step-chev svg { width: 20px; height: 20px; display: block; }
.zf-step-btn:not(.collapsed) .zf-step-chev { transform: rotate(180deg); color: var(--zf-accent); }
.zf-step-body { padding: 0 24px 24px 68px; }
.zf-step-body p { font-family: var(--zf-body); font-size: 15.5px; line-height: 1.6; color: var(--zf-muted); margin: 0; }
.accordion-collapse.collapsing { transition: height .4s ease; }

/* --- CTA-блок --- */
.zf-cta-area { background: #fff; padding: 30px 0 130px; }
.zf-cta-card {
  background: var(--zf-accent); border-radius: 28px; padding: 60px 56px;
  display: grid; grid-template-columns: 1.3fr 0.7fr; gap: 50px; align-items: center;
  position: relative; overflow: hidden;
}
.zf-cta-card::after {
  content: ""; position: absolute; right: -10%; top: -40%; width: 50%; height: 180%;
  background: radial-gradient(closest-side, rgba(179,148,106,.34), rgba(179,148,106,0) 70%);
}
.zf-cta-text { position: relative; z-index: 1; }
.zf-cta-text .zf-eyebrow { color: var(--zf-gold); }
.zf-cta-text .zf-eyebrow::before { background: var(--zf-gold); }
.zf-cta-text h2 { font-family: var(--zf-display); font-weight: 700; font-size: clamp(18px, 2.4vw, 30px); line-height: 1.12; letter-spacing: -.02em; color: #fff; margin: 14px 0 14px; }
.zf-cta-text > p { font-family: var(--zf-body); font-size: 16px; line-height: 1.6; color: rgba(255,255,255,.72); margin: 0 0 28px; max-width: 540px; }
.zf-cta-actions { display: flex; flex-wrap: wrap; gap: 12px; }
.zf-cta-actions .zf-btn { padding: 15px 24px; color: #fff; }
.zf-btn-ghost-light { background: transparent; border: 1px solid rgba(255,255,255,.26); color: #fff; }
.zf-btn-ghost-light:hover { border-color: #fff; background: rgba(255,255,255,.08); color: #fff; transform: translateY(-2px); }
.zf-cta-trust { position: relative; z-index: 1; display: grid; gap: 16px; }
.zf-cta-trust-row { display: flex; gap: 12px; align-items: center; font-family: var(--zf-body); font-size: 15px; color: rgba(255,255,255,.86); }
.zf-cta-trust-row svg { width: 20px; height: 20px; flex: 0 0 auto; color: var(--zf-gold); }

/* --- модалка с сообщением --- */
body.zf-modal-open { overflow: hidden; }
.zf-modal { position: fixed; inset: 0; z-index: 9999; display: flex; align-items: center; justify-content: center; padding: 20px; }
.zf-modal[hidden] { display: none; }
.zf-modal-overlay { position: absolute; inset: 0; background: rgba(11,11,12,.62); opacity: 0; transition: opacity .26s ease; backdrop-filter: blur(3px); }
.zf-modal.is-open .zf-modal-overlay { opacity: 1; }
.zf-modal-card {
  position: relative; z-index: 1; width: 100%; max-width: 520px;
  background: #fff; border-radius: 22px; padding: 40px 38px;
  box-shadow: 0 40px 100px rgba(0,0,0,.4);
  transform: translateY(18px) scale(.98); opacity: 0; transition: transform .3s ease, opacity .3s ease;
  max-height: 90vh; overflow-y: auto;
}
.zf-modal.is-open .zf-modal-card { transform: none; opacity: 1; }
.zf-modal-x { position: absolute; top: 18px; right: 18px; width: 38px; height: 38px; border: 0; background: var(--zf-bg-soft); border-radius: 10px; cursor: pointer; display: inline-flex; align-items: center; justify-content: center; color: var(--zf-accent); }
.zf-modal-x svg { width: 18px; height: 18px; }
.zf-modal-x:hover { background: var(--zf-line); }
.zf-modal-card h3 { font-family: var(--zf-display); font-size: 25px; letter-spacing: -.015em; color: var(--zf-accent); margin: 12px 0 10px; }
.zf-modal-sub { font-family: var(--zf-body); font-size: 14.5px; line-height: 1.55; color: var(--zf-muted); margin: 0 0 18px; }
.zf-modal-msg {
  font-family: "SFMono-Regular", ui-monospace, Menlo, monospace; font-size: 13px; line-height: 1.55;
  white-space: pre-wrap; word-break: break-word; color: #2c2c30;
  background: var(--zf-bg-soft); border: 1px solid var(--zf-line); border-radius: 12px;
  padding: 16px 18px; margin: 0 0 20px;
}
.zf-modal-actions { display: grid; grid-template-columns: 1fr 1fr; gap: 12px; margin-bottom: 14px; }
.zf-modal-actions .zf-btn { justify-content: center; padding: 15px 16px; color: #fff; }
.zf-modal-copy { width: 100%; border: 0; background: transparent; cursor: pointer; font-family: var(--zf-body); font-size: 13.5px; color: var(--zf-muted); text-decoration: underline; text-underline-offset: 3px; padding: 6px; }
.zf-modal-copy:hover { color: var(--zf-accent); }

/* ==========================================================================
   Адаптация планшет / мобайл для новых секций
   ========================================================================== */
@media (max-width: 1199px) {
  .zf-feature-figure-2 { width: 60%; bottom: -16px; }
}
@media (max-width: 991px) {
  .zf-why-area, .zf-tariffs-area, .zf-whysite-area, .zf-get-area, .zf-how-area, .zf-wall-area { padding-top: 72px; padding-bottom: 72px; }
  .zf-why-grid { grid-template-columns: 1fr; gap: 16px; }
  .zf-tariff-grid.is-active { grid-template-columns: 1fr; }
  .zf-tariff-card.is-featured { order: -1; }
  .zf-whysite-cols { grid-template-columns: 1fr; gap: 28px; }
  .zf-bento { grid-template-columns: repeat(2, 1fr); }
  .zf-bento-lg { grid-column: span 2; grid-row: auto; }
  .zf-bento-wide { grid-column: span 2; }
  .zf-how-inner { grid-template-columns: 1fr; gap: 36px; }
  .zf-how-aside { position: static; }
  .zf-cta-card { grid-template-columns: 1fr; gap: 30px; padding: 44px 34px; }
  .zf-feature-figure-2 { position: static; width: 78%; margin: 18px auto 0; display: block; }
  .zf-float-slow { animation: none; }
}
@media (max-width: 767px) {
  /* защита от горизонтального выноса на мобиле */
  .zf-why-area, .zf-tariffs-area, .zf-wall-area, .zf-whysite-area,
  .zf-get-area, .zf-how-area, .zf-cta-area, .zf-feature-area { overflow-x: hidden; }
  /* гарантированные боковые поля на мобиле (кастомные контейнеры без padding) */
  .zf-why-area .container, .zf-tariffs-area .container, .zf-wall-area .container,
  .zf-whysite-area .container, .zf-get-area .container, .zf-how-area .container,
  .zf-cta-area .container, .zf-feature-area .container {
    width: 100%; max-width: 100%; padding-left: 20px; padding-right: 20px;
  }
  /* grid-дети не должны раздувать сетку своим контентом */
  .zf-why-grid > *, .zf-tariff-grid > *, .zf-bento > *,
  .zf-whysite-cols > *, .zf-feature-inner > * { min-width: 0; max-width: 100%; }
  .zf-feature-inner { grid-template-columns: 1fr; }
  /* заголовки секций не должны упираться в край */
  .zf-why-title, .zf-tariffs-title, .zf-wall-title, .zf-get-title,
  .zf-whysite-lead h2, .zf-how-aside h2, .zf-cta-text h2, .zf-feature-text h2 {
    font-size: clamp(24px, 7vw, 34px) !important; line-height: 1.1 !important;
  }
}
@media (max-width: 575px) {
  .zf-why-area, .zf-tariffs-area, .zf-whysite-area, .zf-get-area, .zf-how-area, .zf-wall-area, .zf-cta-area { padding-top: 56px; padding-bottom: 56px; }
  .zf-why-head, .zf-tariffs-head, .zf-wall-head, .zf-get-head { margin-bottom: 36px; }
  .zf-tariff-toggle { width: 100%; left: 0; transform: none; justify-content: center; }
  .zf-toggle-btn { flex: 1; justify-content: center; padding: 12px 10px; font-size: 14px; }
  .zf-tariff-card { padding: 28px 22px; }
  .zf-price-now { font-size: 30px; }
  .zf-bento { grid-template-columns: 1fr; }
  .zf-bento-lg, .zf-bento-wide { grid-column: auto; }
  .zf-wall-card { width: 250px; }
  .zf-wall-card img { height: 175px; }
  .zf-wall-row-a { animation-duration: 42s; }
  .zf-wall-row-b { animation-duration: 48s; }
  .zf-step-btn { padding: 18px 18px; gap: 12px; }
  .zf-step-name { font-size: 16.5px; }
  .zf-step-body { padding: 0 18px 20px 48px; }
  .zf-cta-card { padding: 34px 24px; border-radius: 22px; }
  .zf-cta-actions { flex-direction: column; }
  .zf-cta-actions .zf-btn { width: 100%; justify-content: center; }
  .zf-modal-card { padding: 30px 22px; }
  .zf-modal-actions { grid-template-columns: 1fr; }
}

/* уважение к prefers-reduced-motion: стопаем marquee и float */
@media (prefers-reduced-motion: reduce) {
  .zf-wall-row-a, .zf-wall-row-b, .zf-float, .zf-float-slow { animation: none !important; }
}

/* ==========================================================================
   Иммерсивный слой v8: металл, preloader, glassy-кнопки, фон, карусель,
   лента интеграций, mind-map, typewriter
   ========================================================================== */

/* preloader — спрятан (нативный шаблонный скрывается main.js) */
#preloader { display: none; }

/* --- лёгкий иммерсивный фон через псевдоэлементы body
   (без лишних DOM-узлов — body-дети ломают ScrollSmoother/IntersectionObserver) --- */
body::before {
  content: ""; position: fixed; inset: 0; z-index: 0; pointer-events: none;
  background-image:
    radial-gradient(38vw 38vw at 12% 6%, rgba(196,176,148,.24), transparent 70%),
    radial-gradient(36vw 36vw at 88% 42%, rgba(150,170,210,.15), transparent 70%),
    linear-gradient(rgba(11,11,12,.02) 1px, transparent 1px),
    linear-gradient(90deg, rgba(11,11,12,.02) 1px, transparent 1px);
  background-size: 100% 100%, 100% 100%, 64px 64px, 64px 64px;
  -webkit-mask-image: radial-gradient(circle at 50% 24%, #000 0%, #000 42%, transparent 84%);
  mask-image: radial-gradient(circle at 50% 24%, #000 0%, #000 42%, transparent 84%);
}
body::after {
  content: ""; position: fixed; width: 46vw; height: 46vw; left: 4vw; top: 28vh; z-index: 0;
  pointer-events: none; border-radius: 50%; filter: blur(70px); opacity: .55; will-change: transform;
  background: radial-gradient(closest-side, rgba(196,176,148,.22), transparent 70%);
  animation: zf-aura1 28s ease-in-out infinite alternate;
}
@keyframes zf-aura1 { from { transform: translate(0,0); } to { transform: translate(10vw,8vh); } }
#smooth-content, header, .zf-modal, #preloader { position: relative; z-index: 1; }
#preloader { z-index: 1000; }

/* --- glassy-кнопки (без тяжёлого backdrop на больших площадях) --- */
.zf-btn { position: relative; overflow: hidden; isolation: isolate; }
.zf-btn::before {
  content: ""; position: absolute; left: 0; right: 0; top: 0; height: 52%; z-index: 0;
  background: linear-gradient(to bottom, rgba(255,255,255,.22), rgba(255,255,255,0));
  pointer-events: none;
}
.zf-btn > * { position: relative; z-index: 1; }
.zf-btn-dark { box-shadow: 0 8px 20px rgba(0,0,0,.18), inset 0 1px 0 rgba(255,255,255,.16); }
.zf-btn-accent { box-shadow: 0 8px 20px rgba(160,126,84,.28), inset 0 1px 0 rgba(255,255,255,.3); }
.zf-btn-max { box-shadow: 0 8px 20px rgba(0,0,0,.2), inset 0 1px 0 rgba(255,255,255,.16); }
.zf-btn-tg { box-shadow: 0 8px 20px rgba(41,169,235,.32), inset 0 1px 0 rgba(255,255,255,.4); }
.zf-btn-ghost { background: rgba(255,255,255,.55); backdrop-filter: blur(8px); -webkit-backdrop-filter: blur(8px); }
.zf-btn-ghost-light { backdrop-filter: blur(8px); -webkit-backdrop-filter: blur(8px); }
/* шиммер по hover для glassy */
.zf-btn::after {
  content: ""; position: absolute; inset: 0; z-index: 0; pointer-events: none;
  background: linear-gradient(115deg, transparent 38%, rgba(255,255,255,.35) 50%, transparent 62%);
  background-size: 250% 100%; background-position: 180% 0; transition: background-position .7s ease;
}
.zf-btn:hover::after { background-position: -40% 0; }

/* герой-кнопки шаблона тоже делаем glassy */
.tp-btn-sky-border { position: relative; overflow: hidden; }
.tp-btn-sky-border.solid-bg { box-shadow: 0 8px 22px rgba(0,0,0,.18), inset 0 1px 0 rgba(255,255,255,.18); }

/* --- лента интеграций --- */
.zf-integ-area { overflow: hidden; }
.zf-integ-label { text-align: center; font-family: var(--zf-body); font-size: 14px; letter-spacing: .03em; color: var(--zf-muted); margin: 0 0 26px; text-transform: uppercase; }
.zf-integ { display: flex; gap: 16px; width: max-content; mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); -webkit-mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); }
.zf-integ-track { display: flex; gap: 16px; flex: 0 0 auto; animation: zf-marquee 38s linear infinite; }
.zf-integ:hover .zf-integ-track { animation-play-state: paused; }
.zf-chip {
  flex: 0 0 auto; display: inline-flex; align-items: center; gap: 8px;
  padding: 7px 14px 7px 7px; border-radius: 10px; background: #fff; border: 1px solid var(--zf-line);
  font-family: var(--zf-display); font-size: 13.5px; letter-spacing: -.01em; color: var(--zf-accent);
  box-shadow: 0 2px 8px rgba(0,0,0,.05);
}
.zf-chip img {
  width: 22px; height: 22px; border-radius: 5px; object-fit: contain; flex: 0 0 auto;
}

/* --- карусель «Почему мы» (drag + snap) --- */
.zf-carousel { position: relative; margin-top: 46px; }
.zf-carousel-track {
  display: flex; gap: 24px; overflow-x: auto; scroll-snap-type: x mandatory;
  padding: 8px 4px 22px; scrollbar-width: none; cursor: grab;
  scroll-behavior: smooth; -webkit-overflow-scrolling: touch;
}
.zf-carousel-track::-webkit-scrollbar { display: none; }
.zf-carousel-track.is-drag { cursor: grabbing; scroll-behavior: auto; }
.zf-carousel-track.is-drag .zf-cslide { pointer-events: none; }
.zf-cslide {
  flex: 0 0 clamp(300px, 40%, 460px); scroll-snap-align: center; margin: 0;
  border-radius: 22px; overflow: hidden; position: relative; background: #fff;
  border: 1px solid var(--zf-line); box-shadow: 0 24px 60px rgba(0,0,0,.10);
  transition: transform .4s ease, box-shadow .4s ease;
}
.zf-cslide:hover { transform: translateY(-4px); box-shadow: 0 32px 70px rgba(0,0,0,.16); }
.zf-cslide-media { height: 230px; background-size: cover; background-position: center; background-color: var(--zf-bg-soft); }
.zf-cslide-body { padding: 26px 28px 30px; position: relative; }
.zf-cslide-ic {
  position: absolute; top: -28px; left: 26px; width: 56px; height: 56px;
  display: inline-flex; align-items: center; justify-content: center; border-radius: 16px;
  background: rgba(255,255,255,.72); backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px);
  border: 1px solid rgba(255,255,255,.8); box-shadow: 0 10px 24px rgba(0,0,0,.16);
}
.zf-cslide-ic svg { width: 26px; height: 26px; color: var(--zf-accent); }
.zf-cslide-body h3 { font-family: var(--zf-display); font-size: 22px; letter-spacing: -.015em; color: var(--zf-accent); margin: 16px 0 8px; }
.zf-cslide-body p { font-family: var(--zf-body); font-size: 15px; line-height: 1.55; color: var(--zf-muted); margin: 0; }
.zf-carousel-ui { display: flex; align-items: center; justify-content: center; gap: 18px; margin-top: 10px; }
.zf-carousel-arrow { width: 46px; height: 46px; border-radius: 50%; border: 1px solid var(--zf-line); background: #fff; color: var(--zf-accent); cursor: pointer; display: inline-flex; align-items: center; justify-content: center; transition: transform .2s ease, border-color .2s ease; }
.zf-carousel-arrow svg { width: 20px; height: 20px; }
.zf-carousel-arrow:hover { border-color: var(--zf-accent); transform: translateY(-2px); }
.zf-carousel-dots { display: flex; gap: 9px; }
.zf-cdot { width: 8px; height: 8px; border-radius: 50%; background: var(--zf-line); border: 0; cursor: pointer; padding: 0; transition: width .3s ease, background .3s ease; }
.zf-cdot.is-active { width: 26px; border-radius: 5px; background: var(--zf-gold); }

/* --- mind-map «что вы получите» --- */
.zf-mind { position: relative; min-height: 560px; margin-top: 30px; }
.zf-mind-svg { position: absolute; inset: 0; width: 100%; height: 100%; z-index: 0; pointer-events: none; }
.zf-mind-svg path { fill: none; stroke: var(--zf-line); stroke-width: 2;
  stroke-dasharray: var(--len); stroke-dashoffset: var(--len); transition: stroke-dashoffset 1s ease; }
.zf-mind.is-in .zf-mind-svg path { stroke-dashoffset: 0; }
.zf-mind-hub {
  position: absolute; left: 50%; top: 50%; transform: translate(-50%,-50%); z-index: 2;
  width: 210px; min-height: 210px; border-radius: 50%; text-align: center;
  display: flex; flex-direction: column; align-items: center; justify-content: center; gap: 6px; padding: 24px;
  background: radial-gradient(circle at 50% 30%, #1a1a1d, #0b0b0c); color: #fff;
  box-shadow: 0 30px 70px rgba(0,0,0,.3), inset 0 1px 0 rgba(255,255,255,.12);
}
.zf-mind-hub-ic { width: 46px; height: 46px; display: inline-flex; align-items: center; justify-content: center; border-radius: 13px; background: rgba(255,255,255,.1); border: 1px solid rgba(255,255,255,.16); }
.zf-mind-hub-ic svg { width: 24px; height: 24px; color: var(--zf-gold); }
.zf-mind-hub strong { font-family: var(--zf-display); font-size: 16px; letter-spacing: -.01em; line-height: 1.2; }
.zf-mind-hub em { font-style: normal; font-size: 12px; color: rgba(255,255,255,.6); }
.zf-mind-node {
  position: absolute; z-index: 2; width: 270px; display: flex; gap: 13px; align-items: flex-start;
  padding: 16px 18px; border-radius: 16px; background: rgba(255,255,255,.7);
  backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px);
  border: 1px solid rgba(255,255,255,.85); box-shadow: 0 16px 38px rgba(0,0,0,.10);
  opacity: 0; transform: scale(.9); transition: opacity .5s ease, transform .5s cubic-bezier(.2,.8,.2,1);
}
.zf-mind.is-in .zf-mind-node { opacity: 1; transform: none; }
.zf-mind-node[data-mind="1"] { left: 0; top: 4%; }
.zf-mind-node[data-mind="2"] { left: 0; top: 40%; }
.zf-mind-node[data-mind="3"] { left: 0; top: 76%; }
.zf-mind-node[data-mind="4"] { right: 0; top: 4%; }
.zf-mind-node[data-mind="5"] { right: 0; top: 40%; }
.zf-mind-node[data-mind="6"] { right: 0; top: 76%; }
.zf-mind-ic { flex: 0 0 auto; width: 44px; height: 44px; display: inline-flex; align-items: center; justify-content: center; border-radius: 13px;
  background: color-mix(in srgb, var(--c) 16%, #fff); border: 1px solid color-mix(in srgb, var(--c) 26%, #fff);
  box-shadow: inset 0 1px 0 rgba(255,255,255,.7); }
.zf-mind-ic svg { width: 22px; height: 22px; color: var(--c); }
.zf-mind-node h4 { font-family: var(--zf-display); font-size: 16px; letter-spacing: -.01em; color: var(--zf-accent); margin: 2px 0 3px; }
.zf-mind-node p { font-family: var(--zf-body); font-size: 13px; line-height: 1.45; color: var(--zf-muted); margin: 0; }

/* --- typewriter / rolling helpers --- */
.zf-tw-caret { display: inline-block; width: .06em; background: currentColor; margin-left: .04em; animation: zf-caret 1s steps(1) infinite; vertical-align: -.05em; }
@keyframes zf-caret { 50% { opacity: 0; } }

/* ==========================================================================
   Адаптация v8
   ========================================================================== */
@media (max-width: 991px) {
  .zf-mind { min-height: 0; }
  .zf-mind-svg { display: none; }
  .zf-mind-hub { position: static; transform: none; width: 100%; min-height: 0; border-radius: 20px; margin: 0 auto 22px; flex-direction: row; justify-content: center; gap: 14px; padding: 20px; }
  .zf-mind-hub strong { font-size: 18px; }
  .zf-mind { display: grid; grid-template-columns: 1fr 1fr; gap: 14px; }
  .zf-mind-hub { grid-column: 1 / -1; }
  .zf-mind-node { position: static; width: auto; }
  .zf-mind-node[data-mind] { inset: auto; }
}
@media (max-width: 767px) {
  .zf-integ-area .container { padding-left: 20px; padding-right: 20px; }
  .zf-cslide { flex-basis: 84%; }
  .zf-cslide-media { height: 200px; }
  .zf-toggle-btn { padding: 11px 14px; font-size: 13.5px; gap: 6px; }
  .zf-toggle-btn svg { width: 16px; height: 16px; }
  body::before { background-size: 100% 100%, 100% 100%, 48px 48px, 48px 48px; }
}
@media (max-width: 575px) {
  .zf-mind { grid-template-columns: 1fr; }
  .zf-tariff-toggle { gap: 2px; padding: 5px; }
  .zf-toggle-btn { padding: 10px 8px; font-size: 12.5px; }
  .zf-toggle-btn svg { display: none; }
}
@media (prefers-reduced-motion: reduce) {
  .zf-integ-track, body::after { animation: none !important; }
}

/* =====================================================
   LIGHT HEADER
   ===================================================== */
.zf-header-dark {
  position: fixed;
  top: 0; left: 0; right: 0;
  z-index: 1000;
  padding: 18px 0;
  background: rgba(255,255,255,.88);
  backdrop-filter: blur(18px);
  -webkit-backdrop-filter: blur(18px);
  border-bottom: 1px solid rgba(0,0,0,.07);
}
.zf-header-dark .zf-logo { gap: 10px; }
.zf-header-dark .zf-logo-mark img { width: 48px; height: 48px; }

.zf-header-nav {
  display: flex;
  align-items: center;
  justify-content: center;
  gap: 36px;
}
.zf-header-nav a {
  font-size: 13px;
  font-weight: 500;
  color: rgba(11,11,12,.5);
  text-decoration: none;
  letter-spacing: .01em;
  transition: color .2s;
}
.zf-header-nav a:hover { color: #0b0b0c; }

.zf-header-cta {
  display: inline-flex;
  align-items: center;
  background: #0b0b0c;
  color: #fff;
  font-size: 13px;
  font-weight: 700;
  padding: 10px 20px;
  border-radius: 8px;
  text-decoration: none;
  letter-spacing: -.01em;
  white-space: nowrap;
  transition: background .2s;
}
.zf-header-cta:hover { background: #333; color: #fff; }

.zf-menu-btn { color: rgba(11,11,12,.7) !important; }
.zf-menu-btn span:first-child { font-size: 13px; font-weight: 500; }
.zf-menu-btn i { background: rgba(11,11,12,.7) !important; }

/* =====================================================
   LIGHT HERO
   ===================================================== */
.zf-hero-light {
  position: relative;
  background: #f8f8f6;
  min-height: 100vh;
  display: flex;
  align-items: center;
  overflow: hidden;
  padding: 160px 0 100px;
}

.zf-grid-bg {
  position: absolute;
  inset: 0;
  background-image:
    linear-gradient(rgba(0,0,0,.055) 1px, transparent 1px),
    linear-gradient(90deg, rgba(0,0,0,.055) 1px, transparent 1px);
  background-size: 64px 64px;
  -webkit-mask-image: radial-gradient(ellipse 85% 65% at 50% 45%, #000 25%, transparent 75%);
  mask-image: radial-gradient(ellipse 85% 65% at 50% 45%, #000 25%, transparent 75%);
  pointer-events: none;
}

.zf-hero-inner {
  text-align: center;
  max-width: 860px;
  margin: 0 auto;
  padding: 0 20px;
}

.zf-hero-badge {
  display: inline-flex;
  align-items: center;
  gap: 8px;
  background: rgba(0,0,0,.05);
  border: 1px solid rgba(0,0,0,.09);
  color: rgba(11,11,12,.55);
  font-size: 12px;
  font-weight: 500;
  padding: 7px 16px;
  border-radius: 99px;
  margin-bottom: 40px;
  letter-spacing: .015em;
  animation: zf-fade-up .5s ease .05s both;
}
.zf-badge-dot {
  width: 7px; height: 7px;
  background: #4ade80;
  border-radius: 50%;
  flex-shrink: 0;
  box-shadow: 0 0 6px rgba(74,222,128,.6);
}

.zf-hero-v2-title {
  font-size: clamp(32px, 5vw, 68px);
  font-weight: 800;
  color: #0b0b0c;
  line-height: 1.08;
  letter-spacing: -0.03em;
  margin-bottom: 28px;
  animation: zf-fade-up .55s ease .15s both;
}
.zf-hero-dim { color: rgba(11,11,12,.28); }

.zf-hero-v2-sub {
  font-size: clamp(14px, 1.35vw, 17px);
  font-weight: 400;
  color: rgba(11,11,12,.5);
  line-height: 1.7;
  max-width: 520px;
  margin: 0 auto 44px;
  animation: zf-fade-up .55s ease .25s both;
}

.zf-hero-btns {
  display: flex;
  gap: 12px;
  justify-content: center;
  flex-wrap: wrap;
  animation: zf-fade-up .55s ease .35s both;
}

.zf-btn-hero-primary {
  display: inline-flex; align-items: center;
  background: #0b0b0c; color: #fff;
  font-size: 14px; font-weight: 700;
  padding: 15px 30px; border-radius: 10px;
  text-decoration: none; letter-spacing: -.01em;
  transition: background .2s, transform .15s;
}
.zf-btn-hero-primary:hover { background: #333; color: #fff; transform: translateY(-1px); }

.zf-btn-hero-ghost {
  display: inline-flex; align-items: center;
  background: transparent; color: rgba(11,11,12,.7);
  font-size: 14px; font-weight: 600;
  padding: 15px 30px; border-radius: 10px;
  border: 1.5px solid rgba(11,11,12,.18);
  text-decoration: none; letter-spacing: -.01em;
  transition: border-color .2s, color .2s, transform .15s;
}
.zf-btn-hero-ghost:hover { border-color: rgba(11,11,12,.5); color: #0b0b0c; transform: translateY(-1px); }

@keyframes zf-fade-up {
  from { opacity: 0; transform: translateY(22px); }
  to   { opacity: 1; transform: translateY(0); }
}

@media (max-width: 991px) {
  .zf-hero-dark { padding: 140px 0 80px; }
  .zf-hero-v2-title { font-size: clamp(28px, 7vw, 48px); }
}
@media (max-width: 575px) {
  .zf-hero-dark { padding: 120px 0 70px; min-height: auto; }
  .zf-hero-badge { font-size: 11px; }
  .zf-btn-hero-primary, .zf-btn-hero-ghost { width: 100%; justify-content: center; padding: 14px 20px; }
}

/* ===== Features-dark (3 карточки: chart + notifs + chat) ===== */
.zf-fea-area { background: #000; }
.zf-fea-head { text-align: center; max-width: 640px; margin: 0 auto 64px; }
.zf-fea-title { font-size: clamp(32px, 4.5vw, 58px); font-weight: 700; color: #fff; letter-spacing: -0.025em; line-height: 1.1; }
.zf-fea-dim { color: rgba(255,255,255,.32); }
.zf-fea-sub { font-size: 15px; color: rgba(255,255,255,.42); line-height: 1.7; margin-top: 16px; }
.zf-fea-grid { display: grid; grid-template-columns: repeat(3,1fr); gap: 16px; }
.zf-fea-card {
  background: #131313;
  border: 1px solid rgba(255,255,255,.07);
  border-radius: 20px;
  padding: 32px 28px 28px;
  display: flex; flex-direction: column; gap: 28px;
  overflow: hidden;
  min-height: 420px;
}
.zf-fea-card-title { font-size: 17px; font-weight: 700; color: #fff; letter-spacing: -0.01em; margin-bottom: 8px; }
.zf-fea-card-desc { font-size: 13px; color: rgba(255,255,255,.38); line-height: 1.7; }

/* ---- Chart ---- */
.zf-chart-wrap { flex: 1; position: relative; display: flex; flex-direction: column; justify-content: flex-end; min-height: 170px; }
.zf-chart-stat { position: absolute; top: 0; left: 0; font-size: 34px; font-weight: 800; color: #fff; letter-spacing: -0.04em; line-height: 1; }
.zf-chart-inner { display: flex; align-items: flex-end; height: 130px; gap: 0; }
.zf-chart-bars { display: flex; align-items: flex-end; gap: 6px; flex: 1; height: 100%; }
.zf-cbar { flex: 1; border-radius: 5px 5px 0 0; background: #252525; }
.zf-cbar--hi { background: linear-gradient(to top, #1d4ed8, #60a5fa); }
.zf-chart-pie {
  width: 68px; height: 68px; border-radius: 50%; flex-shrink: 0;
  align-self: flex-end; margin-left: 14px;
  background: conic-gradient(#3b82f6 0% 50%, #84cc16 50% 80%, #f97316 80% 100%);
}

/* ---- Notifications ---- */
.zf-notifs { display: flex; flex-direction: column; gap: 10px; }
.zf-notif {
  display: flex; align-items: center; gap: 14px;
  background: #1c1c1c; border: 1px solid rgba(255,255,255,.06);
  border-radius: 14px; padding: 14px 16px;
}
.zf-notif-ic {
  width: 44px; height: 44px; background: #262626; border-radius: 10px; flex-shrink: 0;
  display: flex; align-items: center; justify-content: center;
}
.zf-notif-ic svg { width: 20px; height: 20px; color: rgba(255,255,255,.6); display: block; }
.zf-notif-body { display: flex; flex-direction: column; gap: 3px; }
.zf-notif-body b { font-size: 12px; font-weight: 600; color: #fff; }
.zf-notif-body span { font-size: 11px; color: rgba(255,255,255,.28); }

/* ---- Chat ---- */
.zf-chat { display: flex; flex-direction: column; gap: 12px; }
.zf-chat-row { display: flex; align-items: flex-end; gap: 10px; }
.zf-chat-row--r { flex-direction: row-reverse; }
.zf-chat-av {
  width: 30px; height: 30px; border-radius: 50%; flex-shrink: 0;
  background: #2c2c2c url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23555'%3E%3Cpath d='M12 12c2.7 0 5-2.3 5-5S14.7 2 12 2 7 4.3 7 7s2.3 5 5 5zm0 2c-3.3 0-10 1.7-10 5v1h20v-1c0-3.3-6.7-5-10-5z'/%3E%3C/svg%3E") center/55% no-repeat;
}
.zf-chat-av--out { background-color: #1d4ed8; background-image: url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 24 24' fill='%23fff'%3E%3Cpath d='M12 12c2.7 0 5-2.3 5-5S14.7 2 12 2 7 4.3 7 7s2.3 5 5 5zm0 2c-3.3 0-10 1.7-10 5v1h20v-1c0-3.3-6.7-5-10-5z'/%3E%3C/svg%3E"); }
.zf-chat-bubble {
  max-width: 82%; padding: 10px 14px; border-radius: 16px 16px 16px 4px;
  font-size: 12px; line-height: 1.55; color: rgba(255,255,255,.7);
  background: #1e1e1e; border: 1px solid rgba(255,255,255,.06);
}
.zf-chat-bubble--out { border-radius: 16px 16px 4px 16px; background: #1e3a6e; border-color: rgba(59,130,246,.18); color: #c8dcff; }

@media (max-width: 991px) { .zf-fea-grid { grid-template-columns: 1fr; } }
@media (max-width: 575px) { .zf-fea-card { padding: 24px 20px; min-height: auto; } }

/* ===== Value-props (designfast-style: иконки + горизонтальная линия) ===== */
.zf-vprops-area { background: #000; }
.zf-vprops-head {
  text-align: center;
  margin-bottom: 80px;
}
.zf-vprops-title {
  font-size: clamp(36px, 5vw, 68px);
  font-weight: 700;
  color: #fff;
  letter-spacing: -0.025em;
  line-height: 1.08;
}
.zf-vprops-sub {
  font-size: 16px;
  font-weight: 400;
  color: rgba(255,255,255,.45);
  line-height: 1.65;
  max-width: 500px;
  margin: 16px auto 0;
}
.zf-vprops-grid {
  display: grid;
  grid-template-columns: repeat(3, 1fr);
  gap: 0;
  position: relative;
}
/* горизонтальная линия между иконками */
.zf-vprops-grid::before {
  content: '';
  position: absolute;
  top: 56px;
  left: calc(100% / 6);
  right: calc(100% / 6);
  height: 1px;
  background: rgba(255,255,255,.12);
  z-index: 0;
}
.zf-vpcard {
  text-align: center;
  padding: 0 40px;
  position: relative;
  z-index: 1;
}
.zf-vpcard-icon {
  width: 112px;
  height: 112px;
  background: #1c1c1c;
  border-radius: 50%;
  display: flex;
  align-items: center;
  justify-content: center;
  margin: 0 auto 36px;
}
.zf-vpcard-icon svg {
  width: 38px;
  height: 38px;
  color: rgba(255,255,255,.75);
}
.zf-vpcard-title {
  font-size: 20px;
  font-weight: 700;
  color: #fff;
  letter-spacing: -0.01em;
  margin-bottom: 12px;
}
.zf-vpcard-desc {
  font-size: 14px;
  font-weight: 400;
  color: rgba(255,255,255,.45);
  line-height: 1.7;
}
@media (max-width: 768px) {
  .zf-vprops-grid { grid-template-columns: 1fr; gap: 48px; }
  .zf-vprops-grid::before { display: none; }
  .zf-vpcard { padding: 0 16px; }
}

/* ============ ОБО МНЕ ============ */
.zf-about-area { background: var(--zf-ink, #0b0b0c); color: #fff; }
.zf-about-grid { display: grid; gap: 40px; align-items: start; }
.zf-about-photo {
  border-radius: 20px; overflow: hidden; border: 1px solid rgba(255,255,255,.12);
  max-width: 420px; background: #111;
}
.zf-about-photo img { display: block; width: 100%; height: auto; }
.zf-about-title { font-family: var(--zf-display); font-size: clamp(30px, 4.5vw, 54px); letter-spacing: -.025em; margin: 10px 0 18px; color: #fff; }
.zf-about-lead { font-size: clamp(17px, 1.6vw, 21px); color: rgba(255,255,255,.94); margin: 0 0 20px; }
.zf-about-text p { color: rgba(255,255,255,.66); margin: 0 0 16px; line-height: 1.75; }
.zf-about-facts { display: grid; grid-template-columns: repeat(2, minmax(0,1fr)); gap: 22px 16px; margin-top: 34px; padding-top: 28px; border-top: 1px solid rgba(255,255,255,.12); }
.zf-fact b { display: block; font-family: var(--zf-display); font-size: clamp(28px, 3.4vw, 40px); line-height: 1; color: #fff; }
.zf-fact span { display: block; margin-top: 6px; font-size: 12px; letter-spacing: .06em; text-transform: uppercase; color: rgba(255,255,255,.62); }

/* ============ НАВЫКИ ============ */
.zf-skills-head { margin-bottom: 46px; max-width: 640px; }
.zf-skills-title { font-family: var(--zf-display); font-size: clamp(28px, 3.6vw, 46px); letter-spacing: -.025em; margin: 10px 0 0; }
.zf-skills-grid { display: grid; gap: 20px; }
.zf-skill { border-top: 2px solid var(--zf-accent, #c8a04a); padding-top: 18px; }
.zf-skill h3 { font-family: var(--zf-display); font-size: 20px; letter-spacing: -.015em; margin: 0 0 10px; }
.zf-skill p { margin: 0; color: var(--zf-muted, #5f6068); font-size: 15px; line-height: 1.7; }

@media (min-width: 768px) {
  .zf-about-facts { grid-template-columns: repeat(4, minmax(0,1fr)); }
  .zf-skills-grid { grid-template-columns: repeat(2, minmax(0,1fr)); gap: 28px; }
}
@media (min-width: 992px) {
  .zf-about-grid { grid-template-columns: 420px 1fr; gap: 60px; }
  .zf-skills-grid { grid-template-columns: repeat(4, minmax(0,1fr)); }
}

/* ============ АВТОМАТИЗАЦИЯ ============ */
.zf-auto-area { background: var(--zf-paper, #f4f3ef); }
.zf-auto-head { max-width: 720px; margin-bottom: 54px; }
.zf-auto-title { font-family: var(--zf-display); font-size: clamp(28px, 3.6vw, 46px); letter-spacing: -.025em; margin: 10px 0 16px; }
.zf-auto-head p { color: var(--zf-muted, #6b6b70); margin: 0; font-size: 16px; line-height: 1.7; }

.zf-auto-case { display: grid; gap: 26px; margin-bottom: 46px; padding-bottom: 46px; border-bottom: 1px solid var(--zf-line, #e2e2e6); }
.zf-auto-case:last-of-type { border-bottom: 0; }
.zf-auto-flow { border-radius: 14px; overflow: hidden; border: 1px solid var(--zf-line, #e2e2e6); background: #fff; box-shadow: 0 16px 40px rgba(0,0,0,.07); }
.zf-auto-flow img { display: block; width: 100%; }
.zf-auto-body h3 { font-family: var(--zf-display); font-size: clamp(20px, 2.2vw, 26px); letter-spacing: -.02em; margin: 0 0 12px; }
.zf-auto-body p { color: var(--zf-muted, #6b6b70); margin: 0 0 12px; font-size: 15px; line-height: 1.72; }
.zf-auto-note { color: #2b2b30 !important; border-left: 2px solid var(--zf-accent, #0b0b0c); padding-left: 14px; }
.zf-auto-tags { list-style: none; display: flex; flex-wrap: wrap; gap: 8px; padding: 0; margin: 16px 0 0; }
.zf-auto-tags li { font-size: 12px; border: 1px solid var(--zf-line, #e2e2e6); border-radius: 999px; padding: 5px 11px; color: var(--zf-muted, #6b6b70); background: #fff; }

.zf-auto-phone { max-width: 300px; }
.zf-auto-phone img { display: block; width: 100%; border-radius: 14px; border: 1px solid var(--zf-line, #e2e2e6); }
.zf-auto-phone span { display: block; margin-top: 10px; font-size: 12.5px; color: var(--zf-muted, #6b6b70); line-height: 1.5; }

.zf-auto-infra { background: #0b0b0c; color: #fff; border-radius: 16px; padding: 30px 32px; margin-top: 10px; }
.zf-auto-infra h3 { font-family: var(--zf-display); font-size: 20px; margin: 0 0 12px; color: #fff; }
.zf-auto-infra p { color: rgba(255,255,255,.68); margin: 0; font-size: 15px; line-height: 1.75; }
.zf-auto-infra code { background: rgba(255,255,255,.12); padding: 2px 7px; border-radius: 5px; font-size: 13.5px; }

@media (min-width: 992px) {
  .zf-auto-case { grid-template-columns: 1.25fr 1fr; align-items: start; column-gap: 40px; }
  .zf-auto-case .zf-auto-phone { grid-column: 1 / -1; justify-self: start; }
  .zf-auto-case--flip .zf-auto-flow { order: 2; }
  .zf-auto-case--flip .zf-auto-body { order: 1; }
}
@media (min-width: 1200px) {
  .zf-auto-case { grid-template-columns: 1.15fr 0.85fr 300px; }
  .zf-auto-case .zf-auto-phone { grid-column: auto; }
  .zf-auto-case--flip { grid-template-columns: 1.3fr 1fr; }
}

/* ============ ХАБ: НАПРАВЛЕНИЯ ============ */
.zf-dirs-area { background: #fff; }
.zf-dirs-grid { display: grid; gap: 18px; }
.zf-dir {
  display: block; text-decoration: none; color: inherit;
  border: 1px solid var(--zf-line, #e2e2e6); border-radius: 18px;
  padding: 30px 30px 26px; background: #fff;
  transition: transform .35s ease, box-shadow .35s ease, border-color .35s ease;
}
.zf-dir:hover { transform: translateY(-5px); box-shadow: 0 26px 54px rgba(0,0,0,.1); border-color: #0b0b0c; }
.zf-dir-num { font-family: var(--zf-mono, ui-monospace, monospace); font-size: 12px; letter-spacing: .12em; color: var(--zf-muted, #6b6b70); }
.zf-dir-title { font-family: var(--zf-display); font-size: clamp(22px, 2.4vw, 30px); letter-spacing: -.025em; margin: 10px 0 12px; }
.zf-dir-text { color: var(--zf-muted, #6b6b70); font-size: 15px; line-height: 1.7; margin: 0 0 16px; }
.zf-dir-tags { list-style: none; display: flex; flex-wrap: wrap; gap: 7px; padding: 0; margin: 0 0 18px; }
.zf-dir-tags li { font-size: 12px; border: 1px solid var(--zf-line, #e2e2e6); border-radius: 999px; padding: 4px 10px; color: var(--zf-muted, #6b6b70); }
.zf-dir-go { font-size: 14px; font-weight: 600; }
.zf-dir:hover .zf-dir-go { color: #0b0b0c; }

/* заголовок внутренней страницы */
.zf-hero-page { padding-bottom: 40px; }
.zf-page-title { font-family: var(--zf-display); font-size: clamp(30px, 4.6vw, 58px); letter-spacing: -.03em; line-height: 1.06; margin: 18px 0 20px; }
.zf-header-nav a.is-current { color: #0b0b0c; font-weight: 600; }

/* ============ ВИДЕО-РИЛ ============ */
.zf-reel-area { background: var(--zf-paper, #f4f3ef); }
.zf-reel { display: grid; gap: 16px; margin: 0 0 40px; }
.zf-reel-item { margin: 0; border-radius: 14px; overflow: hidden; background: #000; border: 1px solid var(--zf-line, #e2e2e6); }
.zf-reel-item video { display: block; width: 100%; aspect-ratio: 16/9; object-fit: cover; background: #000; }
.zf-reel-item figcaption { font-size: 12.5px; letter-spacing: .04em; text-transform: uppercase; color: #fff; background: #0b0b0c; padding: 10px 14px; }

@media (min-width: 700px) {
  .zf-dirs-grid { grid-template-columns: repeat(2, minmax(0,1fr)); gap: 22px; }
  .zf-reel { grid-template-columns: repeat(2, minmax(0,1fr)); }
}
@media (min-width: 1100px) {
  .zf-reel { grid-template-columns: repeat(3, minmax(0,1fr)); }
}


/* ============ ВИДЕО-КЕЙСЫ ============ */
.zf-vid { margin: 0 0 22px; border-radius: 16px; overflow: hidden; background: #000;
  border: 1px solid var(--zf-line, #e2e2e6); box-shadow: 0 18px 44px rgba(0,0,0,.1); }
.zf-vid video { display: block; width: 100%; aspect-ratio: 16/9; object-fit: cover; background: #000; }
.zf-vid--vert video { aspect-ratio: 9/16; }
.zf-vid figcaption { background: #0b0b0c; color: #fff; padding: 14px 16px; }
.zf-vid figcaption b { display: block; font-family: var(--zf-display); font-size: 15px; letter-spacing: -.01em; margin-bottom: 5px; }
.zf-vid figcaption span { display: block; font-size: 13px; line-height: 1.55; color: rgba(255,255,255,.62); }
.zf-vid-row { display: grid; gap: 22px; margin-bottom: 14px; }
.zf-vid-notes { display: grid; gap: 18px; margin-top: 26px; }
.zf-vid-note { border-top: 2px solid #0b0b0c; padding-top: 16px; }
.zf-vid-note h3 { font-family: var(--zf-display); font-size: 18px; letter-spacing: -.015em; margin: 0 0 10px; }
.zf-vid-note p { color: var(--zf-muted, #6b6b70); font-size: 15px; line-height: 1.72; margin: 0; }
@media (min-width: 860px) { .zf-vid-notes { grid-template-columns: repeat(2, minmax(0,1fr)); gap: 30px; } }
@media (min-width: 900px) {
  .zf-vid-row { grid-template-columns: 1.55fr 1fr; align-items: start; }
  .zf-vid--vert { max-width: 340px; }
}

/* ============ РАЗВЁРНУТЫЕ КЕЙСЫ САЙТОВ ============ */
.zf-cases-area { background: var(--zf-paper, #f4f3ef); }
.zf-case { display: grid; gap: 24px; padding-bottom: 46px; margin-bottom: 46px;
  border-bottom: 1px solid var(--zf-line, #e2e2e6); }
.zf-case:last-of-type { border-bottom: 0; margin-bottom: 0; padding-bottom: 0; }
.zf-case-shot { display: block; border-radius: 14px; overflow: hidden;
  border: 1px solid var(--zf-line, #e2e2e6); background: #fff;
  box-shadow: 0 16px 40px rgba(0,0,0,.08); transition: transform .35s ease, box-shadow .35s ease; }
a.zf-case-shot:hover { transform: translateY(-5px); box-shadow: 0 26px 56px rgba(0,0,0,.14); }
.zf-case-shot img { display: block; width: 100%; }
.zf-case-shot--plain { display: grid; place-items: center; min-height: 220px; background: #0b0b0c; }
.zf-case-plain { text-align: center; padding: 34px 26px; }
.zf-case-plain span { display: block; font-size: 12px; letter-spacing: .1em; text-transform: uppercase;
  color: rgba(255,255,255,.5); margin-bottom: 10px; }
.zf-case-plain p { color: rgba(255,255,255,.8); font-size: 14.5px; line-height: 1.6; margin: 0; max-width: 24rem; }
.zf-case-kick { font-size: 12px; letter-spacing: .09em; text-transform: uppercase; color: var(--zf-muted, #6b6b70); }
.zf-case-title { font-family: var(--zf-display); font-size: clamp(22px, 2.4vw, 30px);
  letter-spacing: -.025em; margin: 9px 0 12px; }
.zf-case-text { color: #2b2b30; font-size: 15.5px; line-height: 1.72; margin: 0 0 12px; }
.zf-case-note { color: var(--zf-muted, #6b6b70); font-size: 14.5px; line-height: 1.7;
  margin: 0 0 16px; border-left: 2px solid var(--zf-line, #e2e2e6); padding-left: 14px; }
.zf-case-tags { list-style: none; display: flex; flex-wrap: wrap; gap: 7px; padding: 0; margin: 0 0 18px; }
.zf-case-tags li { font-size: 12px; border: 1px solid var(--zf-line, #e2e2e6); border-radius: 999px;
  padding: 4px 10px; color: var(--zf-muted, #6b6b70); background: #fff; }
.zf-case-link { font-size: 14px; font-weight: 600; text-decoration: none; color: #0b0b0c;
  border-bottom: 1px solid #0b0b0c; padding-bottom: 2px; }
.zf-case-link:hover { opacity: .65; }

@media (min-width: 992px) {
  .zf-case { grid-template-columns: 1.1fr 1fr; column-gap: 44px; align-items: center; }
  .zf-case--flip .zf-case-shot { order: 2; }
  .zf-case--flip .zf-case-body { order: 1; }
}

/* ============ ФИКСЫ ВЁРСТКИ ============ */
/* меню: не рвать «AI-видео» на две строки */
.zf-header-nav a { white-space: nowrap; }

/* подвал: телефон налезал на почту — разводим колонки и запрещаем перенос */
.design-footer-widget-title { margin-bottom: 10px; }
.zf-foot-contact { min-width: 0; }
.zf-foot-contact a, .zf-foot-contact p { word-break: normal; overflow-wrap: anywhere; }
footer a[href^="tel:"] { white-space: nowrap; }

/* доказательство автопостинга */
.zf-post-proof { background: #fff; border: 1px solid var(--zf-line, #e2e2e6);
  border-radius: 12px; padding: 18px 20px; margin: 0 0 18px; }
.zf-post-proof-label { display: block; font-size: 11.5px; letter-spacing: .08em;
  text-transform: uppercase; color: var(--zf-muted, #6b6b70); margin-bottom: 12px; }
.zf-post-proof blockquote { margin: 0; font-size: 15px; line-height: 1.75; color: #2b2b30; }

/* подвал: телефон в 24px не влезал в колонку и с line-height:1 налезал на почту */
.design-footer-widget-info a { font-size: 19px !important; line-height: 1.35 !important; }
.design-footer-widget-info { min-width: 0; }
footer a[href^="tel:"] { white-space: nowrap; }
@media (min-width: 1200px) { .design-footer-widget-info a { font-size: 20px !important; } }

/* кейс без третьей колонки не должен оставлять пустоту справа */
@media (min-width: 1200px) {
  .zf-auto-case { grid-template-columns: 1.15fr 0.85fr; }
  .zf-auto-case:has(.zf-auto-phone) { grid-template-columns: 1.15fr 0.85fr 300px; }
}

/* кнопка «смотреть со звуком» */
.zf-vid { position: relative; }
.zf-vid-sound {
  position: absolute; top: 14px; right: 14px; z-index: 3;
  font-family: inherit; font-size: 12.5px; font-weight: 600; cursor: pointer;
  color: #0b0b0c; background: rgba(255,255,255,.92); border: 0;
  border-radius: 999px; padding: 9px 15px; min-height: 38px;
  backdrop-filter: blur(6px); transition: background-color .25s ease, transform .25s ease;
}
.zf-vid-sound:hover { background: #fff; transform: translateY(-1px); }
.zf-vid.is-loud .zf-vid-sound { background: #0b0b0c; color: #fff; }
.zf-vid video { cursor: pointer; }